![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.000b_01.jpg | 2011-07-13 21:26 | 3.7K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0001.html | 2013-12-16 13:12 | 6.6K | Ex parte JUDSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0001.pdf | 2011-11-01 10:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0002.html | 2013-12-16 13:12 | 14K | In re JUDSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0002.pdf | 2011-11-01 10:17 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0004.html | 2013-12-16 13:12 | 11K | In re JUDSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0004.pdf | 2011-11-01 10:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0005.html | 2013-12-16 13:12 | 1.2K | JUDSON v. BOSTON BELTING CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0005.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0006.html | 2013-12-16 13:12 | 27K | JUDSON v. BRADFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0006.pdf | 2011-11-01 10:17 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0010.html | 2013-12-16 13:12 | 28K | JUDSON v. COPE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0010.pdf | 2011-11-01 10:17 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0014.1.html | 2013-12-16 13:12 | 1.3K | JUDSON v. DAY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0014.1.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0014.2.html | 2013-12-16 13:12 | 9.8K | JUDSON v. KELTY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0014.2.pdf | 2011-11-01 10:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0016.html | 2013-12-16 13:12 | 6.0K | JUDSON v. MACON COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0016.pdf | 2011-11-01 10:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0017.html | 2013-12-16 13:12 | 36K | JUDSON v. MOORE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0017.pdf | 2011-11-01 10:17 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0022.html | 2013-12-16 13:12 | 8.6K | JUDSON v. PLATTSBURG. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0022.pdf | 2011-11-01 10:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0024.html | 2013-12-16 13:12 | 7.5K | JUDY v. GERARD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0024.pdf | 2011-11-01 10:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0025.1.html | 2013-12-16 13:12 | 4.0K | JUILLARD v. REMINGTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0025.1.pdf | 2011-11-01 10:17 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0025.2.html | 2013-12-16 13:12 | 1.2K | JUILLETTE, The (RICHARDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0025.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0025.3.html | 2013-12-16 13:12 | 5.7K | The JULIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0025.3.pdf | 2011-11-01 10:17 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0026.html | 2013-12-16 13:12 | 8.1K | The JULIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0026.pdf | 2011-11-01 10:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0027.html | 2013-12-16 13:12 | 40K | The JULIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0027.pdf | 2011-11-01 10:17 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0034.html | 2013-12-16 13:12 | 9.1K | The JULIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0034.pdf | 2011-11-01 10:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0035.html | 2013-12-16 13:12 | 18K | The JULIA ANN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0035.pdf | 2011-11-01 10:17 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0038.html | 2013-12-16 13:12 | 63K | The JULIA BLAKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0038.pdf | 2011-11-01 10:17 | 145K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0048.1.html | 2013-12-16 13:12 | 1.2K | JULIA LAWRENCE. The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0048.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0048.2.html | 2013-12-16 13:12 | 18K | The JULIA M. HALLO OK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0048.2.pdf | 2011-11-01 10:17 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0050.1.html | 2013-12-16 13:12 | 1.2K | JULIAN (THAMES LOAN & TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0050.1.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0050.2.html | 2013-12-16 13:12 | 1.2K | JULIA SMITH, The (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0050.2.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0050.3.html | 2013-12-16 13:12 | 5.3K | The JULIET C. CLARK v. WELSH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0050.3.pdf | 2011-11-01 10:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0051.1.html | 2013-12-16 13:12 | 1.2K | JUMEL (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0051.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0051.2.html | 2013-12-16 13:12 | 1.3K | Case of JUMP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0051.2.pdf | 2011-11-01 10:17 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0051.3.html | 2013-12-16 13:12 | 1.2K | JUNCTION R. CO. (LATHROP v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0051.3.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0051.4.html | 2013-12-16 13:12 | 1.2K | JUNCTION RAILROAD (WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0051.4.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0051.5.html | 2013-12-16 13:12 | 6.4K | JUNEAU BANK v. McSPEDAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0051.5.pdf | 2011-11-01 10:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0052.html | 2013-12-16 13:12 | 5.7K | JUNGBLUTH v. REDFIELD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0052.pdf | 2011-11-01 10:17 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0053.html | 2013-12-16 13:12 | 10K | The JUNIATA PATON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0053.pdf | 2011-11-01 10:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0054.1.html | 2013-12-16 13:12 | 1.2K | JUNO, The (SAVIN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0054.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0054.2.html | 2013-12-16 13:12 | 1.2K | JUNO, The (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0054.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0054.3.html | 2013-12-16 13:12 | 16K | The JUPITER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0054.3.pdf | 2011-11-01 10:17 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0057.html | 2013-12-16 13:12 | 19K | JURGENSEN v. MAGNIN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0057.pdf | 2011-11-01 10:17 | 82K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0057_01.jpg | 2011-07-13 21:26 | 20K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0059.html | 2013-12-16 13:12 | 1.3K | JURGENSON V. The CATHARINE MARIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0059.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0060.html | 2013-12-16 13:12 | 15K | JUSTICE v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0060.pdf | 2011-11-01 10:17 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0062.1.html | 2013-12-16 13:12 | 1.2K | JUSTICES OF THE COUNTY COURT OF LINCOLN COUNTY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0062.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0062.2.html | 2013-12-16 13:12 | 1.2K | JUSTICES OF THE PEACE (BRENT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0062.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0062.3.html | 2013-12-16 13:12 | 7.0K | JUSTI PON v. The ARBUSTCI., FAIRBANKS et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0062.3.pdf | 2011-11-01 10:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0063.html | 2013-12-16 13:12 | 12K | The J. W. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0063.pdf | 2011-11-01 10:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0064.html | 2013-12-16 13:12 | 31K | The J. W. EVERMAN. PAULL et al. v. The J. W. EVERMAN. ARNOLD et al. v. SAME. ORIENT MUT. INS. CO. v. SAME. MERCHANTS' & PEOPLE'S LINE v. PAULL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0064.pdf | 2011-11-01 10:17 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0069.html | 2013-12-16 13:12 | 8.1K | The J. W. WILDER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0069.pdf | 2011-11-01 10:17 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0071.1.html | 2013-12-16 13:12 | 1.2K | KABWRECK (SCHULENBERG v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0071.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0071.2.html | 2013-12-16 13:12 | 18K | In re KAHLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0071.2.pdf | 2011-11-01 10:17 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0073.html | 2013-12-16 13:12 | 14K | In re KAHLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0073.pdf | 2011-11-01 10:17 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0075.html | 2013-12-16 13:12 | 9.5K | KAIN v. GIBBONEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0075.pdf | 2011-11-01 10:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0077.1.html | 2013-12-16 13:12 | 1.2K | KAIN (SPRAGUE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0077.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0077.2.html | 2013-12-16 13:12 | 11K | KAIN v. TEXAS PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0077.2.pdf | 2011-11-01 10:17 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0078.html | 2013-12-16 13:12 | 24K | Ex parte KAINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0078.pdf | 2011-11-01 10:17 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0082.html | 2013-12-16 13:12 | 16K | In re KAINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0082.pdf | 2011-11-01 10:17 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0084.html | 2013-12-16 13:12 | 55K | In re KAINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0084.pdf | 2011-11-01 10:17 | 125K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0093.1.html | 2013-12-16 13:12 | 1.2K | KALDENBACH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0093.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0093.2.html | 2013-12-16 13:12 | 9.4K | In re KALLISH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0093.2.pdf | 2011-11-01 10:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0095.html | 2013-12-16 13:12 | 40K | The KALLISTO., PETTITT et al. v. The KALLISTO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0095.pdf | 2011-11-01 10:17 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0101.html | 2013-12-16 13:12 | 8.2K | The KELMAR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0101.pdf | 2011-11-01 10:17 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0102.html | 2013-12-16 13:12 | 12K | The KALOOLAH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0102.pdf | 2011-11-01 10:17 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0104.1.html | 2013-12-16 13:12 | 1.2K | KAMM (LAMB v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0104.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0104.2.html | 2013-12-16 13:12 | 1.2K | KAMM v. STARK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0104.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0104.3.html | 2013-12-16 13:12 | 16K | KAMM v. STARK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0104.3.pdf | 2011-11-01 10:17 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0106.html | 2013-12-16 13:12 | 13K | KAMPSHALL v. GOODMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0106.pdf | 2011-11-01 10:17 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0108.html | 2013-12-16 13:12 | 77K | KANAWHA COAL CO. v. KANAWHA & O. COAL CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0108.pdf | 2011-11-01 10:17 | 165K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0121.1.html | 2013-12-16 13:12 | 1.2K | KANE (BARTLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0121.1.pdf | 2011-11-01 10:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0121.2.html | 2013-12-16 13:12 | 25K | KANE v. JENKINSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0121.2.pdf | 2011-11-01 10:17 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0125.1.html | 2013-12-16 13:12 | 2.4K | KANE v. LOVE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0125.1.pdf | 2011-11-01 10:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0125.2.html | 2013-12-16 13:12 | 1.2K | KANE (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0125.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0125.3.html | 2013-12-16 13:12 | 1.2K | KANE (PAUL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0125.3.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0125.4.html | 2013-12-16 13:12 | 20K | KANE v. RICE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0125.4.pdf | 2011-11-01 10:17 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.1.html | 2013-12-16 13:12 | 1.2K | KANE (TUCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.2.html | 2013-12-16 13:12 | 1.2K | KANE (VAN REIMSDYK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.3.html | 2013-12-16 13:12 | 1.2K | KANKAKEE COUNTY (WARRENER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.3.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.4.html | 2013-12-16 13:12 | 1.2K | KANOUSE (MARTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.4.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.5.html | 2013-12-16 13:12 | 1.2K | KANOWRS (REUTGEN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.5.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.6.html | 2013-12-16 13:12 | 1.3K | KANSAS CITY PUB. CO. (FARMERS' & DROVERS' SAV. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.6.pdf | 2011-11-01 10:17 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0128.7.html | 2013-12-16 13:12 | 17K | In re KANSAS CITY STONE, ETC., CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0128.7.pdf | 2011-11-01 10:17 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.1.html | 2013-12-16 13:12 | 1.2K | KANSAS CITY TIMES CO. (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.2.html | 2013-12-16 13:12 | 1.2K | KANSAS PAC. RY. CO. (ARAPAHOE COUNTY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.3.html | 2013-12-16 13:12 | 1.2K | KANSAS PAC. RY. CO. (MEIER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.3.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.4.html | 2013-12-16 13:12 | 1.2K | KANSAS PAC. RY. CO. (STEVENS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.4.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.5.html | 2013-12-16 13:12 | 1.2K | KANSAS PAC. RY. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.5.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0130.6.html | 2013-12-16 13:12 | 1.2K | KANSAS PAC. RY. CO. (WASHINGTON IMP. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0130.6.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0131.html | 2013-12-16 13:12 | 10K | KANSAS VAL. NAT. BANK v. ROWELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0131.pdf | 2011-11-01 10:17 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0132.html | 2013-12-16 13:12 | 6.1K | KAPPNER v. ST. LOUIS & ST. J. R. ASS'N. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0132.pdf | 2011-11-01 10:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0133.1.html | 2013-12-16 13:12 | 1.2K | KARPER (HOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0133.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0133.2.html | 2013-12-16 13:12 | 7.9K | KARR v. WHITTAKER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0133.2.pdf | 2011-11-01 10:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0134.html | 2013-12-16 13:12 | 12K | KARRAHOO v. ADAMS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0134.pdf | 2011-11-01 10:17 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0136.1.html | 2013-12-16 13:12 | 1.2K | KARTHAUS (ARDREY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0136.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0136.2.html | 2013-12-16 13:12 | 13K | KARTHAUS v. FRICK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0136.2.pdf | 2011-11-01 10:17 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0138.1.html | 2013-12-16 13:12 | 1.2K | KARTHAUSE (HUTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0138.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0138.2.html | 2013-12-16 13:12 | 2.6K | In re KASSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0138.2.pdf | 2011-11-01 10:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0138.3.html | 2013-12-16 13:12 | 6.3K | In re KASSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0138.3.pdf | 2011-11-01 10:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0139.1.html | 2013-12-16 13:12 | 3.0K | The KATE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0139.1.pdf | 2011-11-01 10:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0139.2.html | 2013-12-16 13:12 | 16K | The KATE HERON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0139.2.pdf | 2011-11-01 10:17 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0142.html | 2013-12-16 13:12 | 7.9K | The KATE HINCHMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0142.pdf | 2011-11-01 10:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0143.html | 2013-12-16 13:12 | 8.9K | The KATE HINCHMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0143.pdf | 2011-11-01 10:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0144.1.html | 2013-12-16 13:12 | 1.2K | KATE L. BRUEE, The (CHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0144.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0144.2.html | 2013-12-16 13:12 | 27K | The KATE TREMAINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0144.2.pdf | 2011-11-01 10:17 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0148.html | 2013-12-16 13:12 | 13K | The KATE WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0148.pdf | 2011-11-01 10:17 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0150.html | 2013-12-16 13:12 | 8.1K | The KATHLEEN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0150.pdf | 2011-11-01 10:17 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0151.html | 2013-12-16 13:12 | 15K | The KATHLEEN MARY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0151.pdf | 2011-11-01 10:17 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0153.1.html | 2013-12-16 13:12 | 1.2K | KATIE, The (UNDERWRITERS' WRECKING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0153.1.pdf | 2011-11-01 10:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0153.2.html | 2013-12-16 13:12 | 1.2K | KATY WISE, The (ELLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0153.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0153.3.html | 2013-12-16 13:12 | 1.2K | KAUB (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0153.3.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0153.4.html | 2013-12-16 13:12 | 5.9K | In re KAUFMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0153.4.pdf | 2011-11-01 10:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0154.html | 2013-12-16 13:12 | 9.1K | In re KAUFMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0154.pdf | 2011-11-01 10:17 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0155.1.html | 2013-12-16 13:12 | 1.2K | KAUFMAN (HAMMER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0155.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0155.2.html | 2013-12-16 13:12 | 1.1K | KAUFMAN (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0155.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0155.3.html | 2013-12-16 13:12 | 1.2K | KAUFMAN (OLIVER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0155.3.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0155.4.html | 2013-12-16 13:12 | 1.4K | KAUPE v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0155.4.pdf | 2011-11-01 10:17 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0155.5.html | 2013-12-16 13:12 | 1.2K | KAZINSKI (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0155.5.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0156.1.html | 2013-12-16 13:12 | 6.9K | In re KEACH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0156.1.pdf | 2011-11-01 10:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0156.2.html | 2013-12-16 13:12 | 1.2K | KEALLY (HAYMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0156.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0157.html | 2013-12-16 13:12 | 31K | In re KEAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0157.pdf | 2011-11-01 10:17 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0161.1.html | 2013-12-16 13:12 | 1.2K | KEAN (HAGEN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0161.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0161.2.html | 2013-12-16 13:12 | 1.2K | KEAN (McMARREN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0161.2.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0161.3.html | 2013-12-16 13:12 | 9.2K | KEANE v. FORT SCOTT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0161.3.pdf | 2011-11-01 10:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0163.html | 2013-12-16 13:12 | 12K | KEANE et al. v. The GLOUCESTER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0163.pdf | 2011-11-01 10:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0164.1.html | 2013-12-16 13:12 | 1.2K | KEANE (MEADE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0164.1.pdf | 2011-11-01 10:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0164.2.html | 2013-12-16 13:12 | 1.2K | KEARNES (MILBURNE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0164.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0164.3.html | 2013-12-16 13:12 | 1.2K | KEARNEY (NAILOR v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0164.3.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0164.4.html | 2013-12-16 13:12 | 1.2K | The KEARSARGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0164.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0165.html | 2013-12-16 13:12 | 22K | The KEARSARGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0165.pdf | 2011-11-01 10:18 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0168.html | 2013-12-16 13:12 | 26K | KEATING v. KEEFER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0168.pdf | 2011-11-01 10:18 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0172.1.html | 2013-12-16 13:12 | 1.2K | KEATING (MAISSONNAIRE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0172.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0172.2.html | 2013-12-16 13:12 | 1.2K | KEDGELEY (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0172.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0172.3.html | 2013-12-16 13:12 | 1.2K | KEEFE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0172.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0172.4.html | 2013-12-16 13:12 | 6.2K | In re KEEFER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0172.4.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0173.1.html | 2013-12-16 13:12 | 1.2K | KEEFER (KEATING v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0173.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0173.2.html | 2013-12-16 13:12 | 17K | In re KEELER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0173.2.pdf | 2011-11-01 10:18 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0176.html | 2013-12-16 13:12 | 6.8K | In re KEELER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0176.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0177.1.html | 2013-12-16 13:12 | 5.9K | KEEN v. AUDENRIED et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0177.1.pdf | 2011-11-01 10:18 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0177.2.html | 2013-12-16 13:12 | 1.2K | KEEN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0177.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0177.3.html | 2013-12-16 13:12 | 11K | KEENAN V. SHANNON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0177.3.pdf | 2011-11-01 10:18 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0179.1.html | 2013-12-16 13:12 | 1.2K | KEENE (CENTRE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0179.1.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0179.2.html | 2013-12-16 13:12 | 1.2K | KEENE v. CLARK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0179.2.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0179.3.html | 2013-12-16 13:12 | 2.7K | KEENE v. COOPER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0179.3.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0179.4.html | 2013-12-16 13:12 | 1.2K | KEENE v. The DAVID REEVES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0179.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0179.5.html | 2013-12-16 13:12 | 6.6K | KEENE v. HARRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0179.5.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0180.1.html | 2013-12-16 13:12 | 2.7K | KEENE v. JACKSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0180.1.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0180.2.html | 2013-12-16 13:12 | 1.2K | KEENE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0180.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0180.3.html | 2013-12-16 13:12 | 169K | KEENE v. WHEATLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0180.3.pdf | 2011-11-01 10:18 | 324K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0208.html | 2013-12-16 13:12 | 8.6K | KEENE v. The WHISTLER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0208.pdf | 2011-11-01 10:18 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0209.1.html | 2013-12-16 13:12 | 1.2K | KEFFER (NEWMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0209.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0209.2.html | 2013-12-16 13:12 | 7.8K | KEGAN v. The AMARANTH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0209.2.pdf | 2011-11-01 10:18 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0210.1.html | 2013-12-16 13:12 | 1.2K | KEHR (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0210.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0210.2.html | 2013-12-16 13:12 | 32K | In re KEILER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0210.2.pdf | 2011-11-01 10:18 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0216.html | 2013-12-16 13:12 | 14K | In re KEILER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0216.pdf | 2011-11-01 10:18 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0218.1.html | 2013-12-16 13:12 | 2.8K | KEILER v. LESSFORD et ux. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0218.1.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0218.2.html | 2013-12-16 13:12 | 14K | KEIME v. GRAFF et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0218.2.pdf | 2011-11-01 10:18 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0220.html | 2013-12-16 13:12 | 9.6K | KEIRLL v. McINTIRE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0220.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0222.html | 2013-12-16 13:12 | 8.0K | KEITH et al. v. MURDOCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0222.pdf | 2011-11-01 10:18 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0223.1.html | 2013-12-16 13:12 | 1.2K | KEITH (UNITED NICKEL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0223.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0223.2.html | 2013-12-16 13:12 | 1.2K | KEITH (WOODBURY PATENT PLANINGMACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0223.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0223.3.html | 2013-12-16 13:12 | 1.2K | KELL (FANNY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0223.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0223.4.html | 2013-12-16 13:12 | 58K | KELLEHER et al. v. DARLING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0223.4.pdf | 2011-11-01 10:18 | 185K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0225_01.jpg | 2011-07-13 21:26 | 32K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0225_02.jpg | 2011-07-13 21:26 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0233.html | 2013-12-16 13:12 | 9.7K | In re KELLER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0233.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0234.1.html | 2013-12-16 13:12 | 1.2K | KELLERMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0234.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0234.2.html | 2013-12-16 13:12 | 14K | In re KELLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0234.2.pdf | 2011-11-01 10:18 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0236.html | 2013-12-16 13:12 | 11K | In re KELLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0236.pdf | 2011-11-01 10:18 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0238.html | 2013-12-16 13:12 | 31K | KELLEY v. GREENLEAF et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0238.pdf | 2011-11-01 10:18 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0243.html | 2013-12-16 13:12 | 7.2K | KELLEY v. HOME INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0243.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0244.html | 2013-12-16 13:12 | 17K | KELLEY ads. JACKSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0244.pdf | 2011-11-01 10:18 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0246.1.html | 2013-12-16 13:12 | 1.2K | KELLEY (PRICE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0246.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0246.2.html | 2013-12-16 13:12 | 1.3K | KELLEY v. The PROSPERITY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0246.2.pdf | 2011-11-01 10:18 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0246.3.html | 2013-12-16 13:12 | 1.2K | KELLEY v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0246.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0246.4.html | 2013-12-16 13:12 | 1.2K | KELLOGG (ATKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0246.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0246.5.html | 2013-12-16 13:12 | 21K | KELLOGG et al. v. BARNARD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0246.5.pdf | 2011-11-01 10:18 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0249.html | 2013-12-16 13:12 | 6.3K | KELLOGG v. HUGHES et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0249.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0250.html | 2013-12-16 13:12 | 10K | KELLOGG v. LA CROSSE, ETC., PACKET CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0250.pdf | 2011-11-01 10:18 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0251.1.html | 2013-12-16 13:12 | 1.2K | KELLOGG (McCAULEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0251.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0251.2.html | 2013-12-16 13:12 | 24K | KELLOGG v. MILWAUKEE & ST. P. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0251.2.pdf | 2011-11-01 10:18 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0255.1.html | 2013-12-16 13:12 | 1.3K | KELLOGG v. MORSE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0255.1.pdf | 2011-11-01 10:18 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0255.2.html | 2013-12-16 13:12 | 13K | KELLOGG v. RUSSELL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0255.2.pdf | 2011-11-01 10:18 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0257.1.html | 2013-12-16 13:12 | 1.2K | KELLOGG (SUTHERLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0257.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0257.2.html | 2013-12-16 13:12 | 1.2K | KELLOGG (UNION MUTUAL LIFE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0257.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0257.3.html | 2013-12-16 13:12 | 19K | KELLOGG v. WARMOUTH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0257.3.pdf | 2011-11-01 10:18 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0260.1.html | 2013-12-16 13:12 | 1.2K | KELLOGG (WEED v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0260.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0260.2.html | 2013-12-16 13:12 | 21K | KELLOM et al. v. EASLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0260.2.pdf | 2011-11-01 10:18 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0263.html | 2013-12-16 13:12 | 18K | KELLUM et al. v. EMERSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0263.pdf | 2011-11-01 10:18 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.1.html | 2013-12-16 13:12 | 1.2K | KELLY (ANTRIMS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.2.html | 2013-12-16 13:12 | 1.2K | KELLY v. ATLANTIC & G. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.3.html | 2013-12-16 13:12 | 1.2K | KELLY (CASE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.3.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.4.html | 2013-12-16 13:12 | 4.0K | KELLY v. HARDING et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.4.pdf | 2011-11-01 10:18 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.5.html | 2013-12-16 13:12 | 1.2K | KELLY v. HOME INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.5.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.6.html | 2013-12-16 13:12 | 1.2K | KELLY (HOWLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.6.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0266.7.html | 2013-12-16 13:12 | 3.0K | KELLY v. HUFFINGTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0266.7.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0267.html | 2013-12-16 13:12 | 7.1K | KELLY v. JOHNSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0267.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0268.1.html | 2013-12-16 13:12 | 1.2K | KELLY (LIPPINCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0268.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0268.2.html | 2013-12-16 13:12 | 1.2K | KELLY (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0268.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0268.3.html | 2013-12-16 13:12 | 17K | KELLY et al. v. PHELAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0268.3.pdf | 2011-11-01 10:18 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0270.html | 2013-12-16 13:12 | 3.4K | KELLY v. The PITTSBURGH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0270.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0271.html | 2013-12-16 13:12 | 17K | KELLY et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0271.pdf | 2011-11-01 10:18 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0273.1.html | 2013-12-16 13:12 | 7.6K | KELLY v. STRANGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0273.1.pdf | 2011-11-01 10:18 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0274.1.html | 2013-12-16 13:12 | 1.2K | KELLY (TONG DUCK CHUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0274.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0274.2.html | 2013-12-16 13:12 | 1.2K | KELLY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0274.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0274.3.html | 2013-12-16 13:12 | 1.2K | KELLY (VAN RENSSELLAER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0274.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0274.4.html | 2013-12-16 13:12 | 9.1K | KELLY v. VIRGINIA PROTECTION INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0274.4.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.1.html | 2013-12-16 13:12 | 1.1K | KELSEA (LILLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.2.html | 2013-12-16 13:12 | 3.9K | KELSEY v. DALLON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.2.pdf | 2011-11-01 10:18 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.3.html | 2013-12-16 13:12 | 1.2K | KELSEY v. The KATE TREMAINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.4.html | 2013-12-16 13:12 | 1.1K | KELSEY (McKIM v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.5.html | 2013-12-16 13:12 | 1.2K | KELSEY (MITCHELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.5.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.6.html | 2013-12-16 13:12 | 4.2K | KELSEY v. PENNSYLVANIA R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.6.pdf | 2011-11-01 10:18 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0276.7.html | 2013-12-16 13:12 | 5.5K | KELSEY v. The WILLIAM KALLAHAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0276.7.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0277.1.html | 2013-12-16 13:12 | 1.2K | KELTON (DEWEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0277.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0277.2.html | 2013-12-16 13:12 | 7.6K | Ex parte KELTY et al., In re STORMS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0277.2.pdf | 2011-11-01 10:18 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0278.1.html | 2013-12-16 13:12 | 1.1K | KELTY (JUDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0278.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0278.2.html | 2013-12-16 13:12 | 1.1K | KEMBALL (HOW v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0278.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0278.3.html | 2013-12-16 13:12 | 3.4K | KEMBALL v. STEWART. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0278.3.pdf | 2011-11-01 10:18 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0279.html | 2013-12-16 13:12 | 6.4K | KEMBLE et al. v. LULL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0279.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0280.1.html | 2013-12-16 13:12 | 6.3K | KEMBLE v. WILMINGTON & N. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0280.1.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0280.2.html | 2013-12-16 13:12 | 7.4K | KEMMIL v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0280.2.pdf | 2011-11-01 10:18 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0281.html | 2013-12-16 13:12 | 26K | KEMP v. KENNEDY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0281.pdf | 2011-11-01 10:18 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0285.html | 2013-12-16 13:12 | 1.2K | KEMP (STOCKWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0285.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0286.html | 2013-12-16 13:12 | 26K | In re KEMPER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0286.pdf | 2011-11-01 10:18 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0290.1.html | 2013-12-16 13:12 | 4.4K | KEMPER v. ADAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0290.1.pdf | 2011-11-01 10:18 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0290.2.html | 2013-12-16 13:12 | 1.2K | KEMPER (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0290.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0290.3.html | 2013-12-16 13:12 | 1.1K | KEMPF (HUS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0290.3.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0290.4.html | 2013-12-16 13:12 | 27K | In re KEMPNER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0290.4.pdf | 2011-11-01 10:18 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0294.html | 2013-12-16 13:12 | 1.2K | KEMPTON (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0294.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0295.html | 2013-12-16 13:12 | 46K | KENDALL v. ALMY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0295.pdf | 2011-11-01 10:18 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0302.1.html | 2013-12-16 13:12 | 1.2K | KENDALL (BOWEN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0302.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0302.2.html | 2013-12-16 13:12 | 5.2K | KENDALL et al. v. BADGER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0302.2.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.1.html | 2013-12-16 13:12 | 5.9K | KENDALL v. FREEMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.1.pdf | 2011-11-01 10:18 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.2.html | 2013-12-16 13:12 | 1.1K | KENDALL (JARVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.3.html | 2013-12-16 13:12 | 1.2K | KENDALL (STOKES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.4.html | 2013-12-16 13:12 | 1.2K | KENDALL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.5.html | 2013-12-16 13:12 | 1.1K | KENDALL (WINSOR v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.5.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0303.6.html | 2013-12-16 13:12 | 1.2K | KENDALLVILLE (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0303.6.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0304.1.html | 2013-12-16 13:12 | 2.6K | KENDEPT v. The THEODORE KORNER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0304.1.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0304.2.html | 2013-12-16 13:12 | 6.6K | KENDRICK v. EMMONS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0304.2.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0305.html | 2013-12-16 13:12 | 12K | KENDRICK v. EMMONS., SAME v. NICHOLS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0305.pdf | 2011-11-01 10:18 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0306.html | 2013-12-16 13:12 | 6.0K | KENDRICK v. EMMONS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0306.pdf | 2011-11-01 10:18 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.1.html | 2013-12-16 13:12 | 1.2K | KENDRICK v. NICHOLS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.2.html | 2013-12-16 13:12 | 1.2K | KENDRICK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.3.html | 2013-12-16 13:12 | 1.2K | KENEDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.4.html | 2013-12-16 13:12 | 1.2K | KENNAN v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.4.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.5.html | 2013-12-16 13:12 | 1.2K | KENNAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.5.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0307.6.html | 2013-12-16 13:12 | 7.5K | KENNARD v. CASS COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0307.6.pdf | 2011-11-01 10:18 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0308.1.html | 2013-12-16 13:12 | 1.2K | KENNEALLY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0308.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0308.2.html | 2013-12-16 13:12 | 2.8K | Ex parte KENNEDY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0308.2.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0308.3.html | 2013-12-16 13:12 | 5.8K | In re KENNEDY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0308.3.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0309.html | 2013-12-16 13:12 | 8.8K | In re KENNEDY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0309.pdf | 2011-11-01 10:18 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0310.1.html | 2013-12-16 13:12 | 1.2K | KENNEDY (BARCLAY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0310.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0310.2.html | 2013-12-16 13:12 | 1.2K | KENNEDY (BAZIL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0310.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0310.3.html | 2013-12-16 13:12 | 1.2K | KENNEDY (CALLAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0310.3.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0310.4.html | 2013-12-16 13:12 | 14K | KENNEDY et al. v. DODGE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0310.4.pdf | 2011-11-01 10:18 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0313.1.html | 2013-12-16 13:12 | 6.3K | KENNEDY et al. v. FIRST NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0313.1.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0313.2.html | 2013-12-16 13:12 | 5.7K | KENNEDY v. GORMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0313.2.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0314.html | 2013-12-16 13:12 | 22K | KENNEDY et al. v. INDIANAPOLIS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0314.pdf | 2011-11-01 10:18 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0318.1.html | 2013-12-16 13:12 | 1.2K | KENNEDY (KEMP v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0318.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0318.2.html | 2013-12-16 13:12 | 1.2K | KENNEDY (McIVER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0318.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0318.3.html | 2013-12-16 13:12 | 6.1K | KENNEDY v. PURNELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0318.3.pdf | 2011-11-01 10:18 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0318.4.html | 2013-12-16 13:12 | 19K | KENNEDY v. RICKER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0318.4.pdf | 2011-11-01 10:18 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0321.1.html | 2013-12-16 13:12 | 1.2K | KENNEDY (ROSE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0321.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0321.2.html | 2013-12-16 13:12 | 30K | KENNEDY et al. v. ST. PAUL & P. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0321.2.pdf | 2011-11-01 10:18 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0325.html | 2013-12-16 13:12 | 29K | KENNEDY et al. v. ST. PAUL & P. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0325.pdf | 2011-11-01 10:18 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0329.1.html | 2013-12-16 13:12 | 1.2K | KENNEDY (STOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0329.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0329.2.html | 2013-12-16 13:12 | 1.2K | KENNEDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0329.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0330.1.html | 2013-12-16 13:12 | 6.3K | KENNEDY v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0330.1.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0330.2.html | 2013-12-16 13:12 | 1.2K | KENNEDY MANUF'G CO. (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0330.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0330.3.html | 2013-12-16 13:12 | 16K | KENNEWAY et al. v. The WICKFORD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0330.3.pdf | 2011-11-01 10:18 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0333.1.html | 2013-12-16 13:12 | 1.2K | KENNEY (PHILADELPHIA & R. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0333.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0333.2.html | 2013-12-16 13:12 | 16K | KENNICOTT et al. v. WAYNE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0333.2.pdf | 2011-11-01 10:18 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0335.html | 2013-12-16 13:12 | 7.7K | KENNICOTT et al. v. WAYNE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0335.pdf | 2011-11-01 10:18 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0336.html | 2013-12-16 13:12 | 9.8K | KENOSHA & R. R. CO. v. SPERRY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0336.pdf | 2011-11-01 10:18 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0338.html | 2013-12-16 13:12 | 14K | KENRICK v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0338.pdf | 2011-11-01 10:18 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0340.1.html | 2013-12-16 13:12 | 1.2K | KENSEY (BRONSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0340.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0340.2.html | 2013-12-16 13:12 | 1.2K | KENSINGTON, The (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0340.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0340.3.html | 2013-12-16 13:12 | 1.2K | KENSINGTON. The (MARINERS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0340.3.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0340.4.html | 2013-12-16 13:12 | 15K | KENT v. DAWSON BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0340.4.pdf | 2011-11-01 10:18 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0342.html | 2013-12-16 13:12 | 29K | KENT v. ROBERTS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0342.pdf | 2011-11-01 10:18 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0346.html | 2013-12-16 13:12 | 1.2K | KENTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0346.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0347.1.html | 2013-12-16 13:12 | 5.4K | The KENTUCKY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0347.1.pdf | 2011-11-01 10:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0347.2.html | 2013-12-16 13:12 | 9.3K | The KENTUCKY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0347.2.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0349.html | 2013-12-16 13:12 | 16K | KENTUCKY IMP. CO. v. SLACK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0349.pdf | 2011-11-01 10:18 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0351.1.html | 2013-12-16 13:12 | 1.3K | KENTUCKY MARINE & FIRE INS. CO. v. NASHVILLE & C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0351.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0351.2.html | 2013-12-16 13:12 | 15K | KENTUCKY SILVER MIN. CO. v. DAY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0351.2.pdf | 2011-11-01 10:18 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0353.html | 2013-12-16 13:12 | 17K | Ex parte KENYON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0353.pdf | 2011-11-01 10:18 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0355.html | 2013-12-16 13:12 | 10K | The KEOKUK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0355.pdf | 2011-11-01 10:18 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0357.1.html | 2013-12-16 13:12 | 1.2K | KEOKUK (BARNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0357.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0357.2.html | 2013-12-16 13:12 | 1.2K | KEOKUK (BRONSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0357.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0357.3.html | 2013-12-16 13:12 | 1.2K | KEPP (HAWLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0357.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0357.4.html | 2013-12-16 13:12 | 117K | KEPPEL v. PETERSBURG R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0357.4.pdf | 2011-11-01 10:18 | 236K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0375.1.html | 2013-12-16 13:12 | 1.2K | KER (HURST v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0375.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0375.2.html | 2013-12-16 13:12 | 1.2K | KERCHEVAL (MARTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0375.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0375.3.html | 2013-12-16 13:12 | 1.2K | KERFOOT (REID v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0375.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0375.4.html | 2013-12-16 13:12 | 3.2K | KEROSENE LAMP CO. v. LITTELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0375.4.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0375.5.html | 2013-12-16 13:12 | 19K | KEROSENE LAMP HEATER CO. v. LITTELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0375.5.pdf | 2011-11-01 10:18 | 116K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0376_01.jpg | 2011-07-13 21:26 | 23K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0377_01.jpg | 2011-07-13 21:26 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0379.html | 2013-12-16 13:12 | 9.4K | In re KEROSENE OIL CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0379.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0380.html | 2013-12-16 13:12 | 10K | In re KEROSENE OIL CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0380.pdf | 2011-11-01 10:18 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0382.html | 2013-12-16 13:12 | 19K | KERP et al. v. MICHIGAN L. S. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0382.pdf | 2011-11-01 10:18 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0385.html | 2013-12-16 13:12 | 8.2K | In re KERR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0385.pdf | 2011-11-01 10:18 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0386.1.html | 2013-12-16 13:12 | 4.5K | In re KERR et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0386.1.pdf | 2011-11-01 10:18 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0386.2.html | 2013-12-16 13:12 | 114K | KERR v. FORCE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0386.2.pdf | 2011-11-01 10:18 | 226K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0404.1.html | 2013-12-16 13:12 | 1.2K | KERR (GORDON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0404.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0404.2.html | 2013-12-16 13:12 | 3.0K | KERR v. HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0404.2.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0405.html | 2013-12-16 13:12 | 7.1K | KERR et al. v. The NORMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0405.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0406.html | 2013-12-16 13:12 | 36K | KERR v. SOUTH PARK COMMISSIONERS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0406.pdf | 2011-11-01 10:18 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0411.html | 2013-12-16 13:12 | 8.9K | KERRISON v. STEWART et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0411.pdf | 2011-11-01 10:18 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.1.html | 2013-12-16 13:12 | 1.2K | KERRISON (STEWART v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.1.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.2.html | 2013-12-16 13:12 | 1.2K | KERSHAW (NORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.3.html | 2013-12-16 13:12 | 1.2K | KERSHNER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.4.html | 2013-12-16 13:12 | 1.2K | KESSLER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.4.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.5.html | 2013-12-16 13:12 | 2.7K | KETCHUM v. DRIGGS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.5.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0413.6.html | 2013-12-16 13:12 | 6.1K | KETCHUM et ux. v. FARMERS' LOAN & TRUST CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0413.6.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0414.1.html | 2013-12-16 13:12 | 1.2K | KETCHUM (FARMERS' TRUST & CANAL BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0414.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0414.2.html | 2013-12-16 13:12 | 27K | KETCHUM v. MOBILE & O. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0414.2.pdf | 2011-11-01 10:18 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0418.1.html | 2013-12-16 13:12 | 1.2K | KETCHUM v. MOBILE & OHIO R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0418.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0418.2.html | 2013-12-16 13:12 | 42K | KETCHUM et al. v. PACIFIC R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0418.2.pdf | 2011-11-01 10:18 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0425.html | 2013-12-16 13:12 | 22K | KETCHUM v. PACIFIC B. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0425.pdf | 2011-11-01 10:18 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0428.html | 2013-12-16 13:12 | 8.2K | KETCHUM et al. v. PACIFIC R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0428.pdf | 2011-11-01 10:18 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0429.1.html | 2013-12-16 13:12 | 1.2K | KETCHUM (SHAEFER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0429.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0429.2.html | 2013-12-16 13:12 | 10K | KETCHUM HARVESTING MACH. CO. v. JOHNSTON HARVESTER CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0429.2.pdf | 2011-11-01 10:18 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0431.1.html | 2013-12-16 13:12 | 3.0K | KETELTAS et al. v. RAFT OF TIMBER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0431.1.pdf | 2011-11-01 10:18 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0431.2.html | 2013-12-16 13:12 | 3.9K | KETLAND v. BISSETT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0431.2.pdf | 2011-11-01 10:18 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0431.3.html | 2013-12-16 13:12 | 13K | KETLAND v. The CASSIUS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0431.3.pdf | 2011-11-01 10:18 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0433.html | 2013-12-16 13:12 | 5.3K | KETLAND v. LEBERING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0433.pdf | 2011-11-01 10:18 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0434.1.html | 2013-12-16 13:12 | 1.1K | KETLAND (STONE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0434.1.pdf | 2011-11-01 10:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0434.2.html | 2013-12-16 13:12 | 1.1K | KETTELL (DONAHOE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0434.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0434.3.html | 2013-12-16 13:12 | 1.1K | KETTELL (SUTTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0434.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0434.4.html | 2013-12-16 13:12 | 3.1K | KEUTGEN v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0434.4.pdf | 2011-11-01 10:18 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0434.5.html | 2013-12-16 13:12 | 8.3K | KEY v. BANK OF UNITED STATES et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0434.5.pdf | 2011-11-01 10:18 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0435.1.html | 2013-12-16 13:12 | 1.2K | KEY (CHESAPEAKE & OHIO CANAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0435.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0435.2.html | 2013-12-16 13:12 | 1.1K | KEYES (BURT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0435.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0436.html | 2013-12-16 13:12 | 37K | KEYS et al. v. The AMBASSADOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0436.pdf | 2011-11-01 10:18 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.1.html | 2013-12-16 13:12 | 1.1K | KEYS, The DICK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.2.html | 2013-12-16 13:12 | 1.1K | KEYS (FORD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.3.html | 2013-12-16 13:12 | 1.1K | KEYS (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.4.html | 2013-12-16 13:12 | 2.6K | In re KEYSER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.4.pdf | 2011-11-01 10:18 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.5.html | 2013-12-16 13:12 | 3.6K | KEYSER v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.5.pdf | 2011-11-01 10:18 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0442.6.html | 2013-12-16 13:12 | 41K | KEYSER v. COE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0442.6.pdf | 2011-11-01 10:18 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0449.1.html | 2013-12-16 13:12 | 1.2K | KEYSTONE, The (TWIBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0449.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0449.2.html | 2013-12-16 13:12 | 11K | KEYSTONE BRIDGE CO. v. PHOENIX IRON CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0449.2.pdf | 2011-11-01 10:18 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0450.html | 2013-12-16 13:12 | 1.2K | KEYSTONE BRIDGE CO. (REEVES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0450.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0451.1.html | 2013-12-16 13:12 | 2.5K | KEZIAH v. SLYE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0451.1.pdf | 2011-11-01 10:18 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0451.2.html | 2013-12-16 13:12 | 11K | KIBBE v. DUNN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0451.2.pdf | 2011-11-01 10:18 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0452.1.html | 2013-12-16 13:12 | 1.2K | KIBBE (HUNTER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0452.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0452.2.html | 2013-12-16 13:12 | 16K | KIBBE v. THOMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0452.2.pdf | 2011-11-01 10:18 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0455.html | 2013-12-16 13:12 | 9.4K | KIDD v. SPENCE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0455.pdf | 2011-11-01 10:18 | 71K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0456_01.jpg | 2011-07-13 21:26 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0457.1.html | 2013-12-16 13:12 | 4.8K | KIDD et al. v. SWARTWOUT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0457.1.pdf | 2011-11-01 10:18 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0457.2.html | 2013-12-16 13:12 | 7.4K | KIDWELL v. HOUSTON & G. N. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0457.2.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0458.html | 2013-12-16 13:12 | 8.0K | KIDWELL v. MASTERSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0458.pdf | 2011-11-01 10:18 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0459.1.html | 2013-12-16 13:12 | 1.2K | KIDWELL (MASTERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0459.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0459.2.html | 2013-12-16 13:12 | 6.9K | KIEF et al. v. The LONDON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0459.2.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0460.1.html | 2013-12-16 13:12 | 1.2K | KIELEY v. BELCHER SILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0460.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0460.2.html | 2013-12-16 13:12 | 23K | KIELLEY v. BELCHER SILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0460.2.pdf | 2011-11-01 10:18 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0464.html | 2013-12-16 13:12 | 15K | KIELLEY v. BELCHER SILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0464.pdf | 2011-11-01 10:18 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0466.1.html | 2013-12-16 13:12 | 1.2K | KIERMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0466.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0466.2.html | 2013-12-16 13:12 | 11K | The KIERSAGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0466.2.pdf | 2011-11-01 10:18 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0468.1.html | 2013-12-16 13:12 | 6.1K | KIKINDAL v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0468.1.pdf | 2011-11-01 10:18 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0468.2.html | 2013-12-16 13:12 | 1.2K | KILBOURN MANUF'C CO. (WOODMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0468.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0468.3.html | 2013-12-16 13:12 | 1.2K | KILBRETH (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0468.3.pdf | 2011-11-01 10:18 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0468.4.html | 2013-12-16 13:12 | 17K | KILGOUR v. NEW ORLEANS GAS LIGHT CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0468.4.pdf | 2011-11-01 10:18 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0471.1.html | 2013-12-16 13:12 | 1.2K | KILGOUR v. NEW YORK GUARANTY, ETC., CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0471.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0471.2.html | 2013-12-16 13:12 | 18K | KILLAM v. The ERI. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0471.2.pdf | 2011-11-01 10:18 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0474.1.html | 2013-12-16 13:12 | 2.1K | KILLINGLY v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0474.1.pdf | 2011-11-01 10:18 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0474.2.html | 2013-12-16 13:12 | 1.2K | KILLINGWORTH (LANCASHIRE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0474.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0474.3.html | 2013-12-16 13:12 | 15K | In re KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0474.3.pdf | 2011-11-01 10:18 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0476.html | 2013-12-16 13:12 | 12K | In re KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0476.pdf | 2011-11-01 10:18 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0478.html | 2013-12-16 13:12 | 7.2K | In re KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0478.pdf | 2011-11-01 10:18 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0479.html | 2013-12-16 13:12 | 7.9K | In re KIMBALL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0479.pdf | 2011-11-01 10:18 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0480.html | 2013-12-16 13:12 | 6.9K | In re KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0480.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0481.html | 2013-12-16 13:12 | 37K | KIMBALL v. The ANNA KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0481.pdf | 2011-11-01 10:18 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0487.html | 2013-12-16 13:12 | 12K | KIMBALL et al. v. The DISPATCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0487.pdf | 2011-11-01 10:18 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0489.1.html | 2013-12-16 13:12 | 1.2K | KIMBALL (LIGHTNER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0489.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0489.2.html | 2013-12-16 13:12 | 30K | KIMBALL et al. v. MOBILE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0489.2.pdf | 2011-11-01 10:18 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0493.1.html | 2013-12-16 13:12 | 1.2K | KIMBALL v. The SAM SLICK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0493.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0493.2.html | 2013-12-16 13:12 | 1.2K | KIMBALL (SCAMMON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0493.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0493.3.html | 2013-12-16 13:12 | 15K | KIMBALL v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0493.3.pdf | 2011-11-01 10:18 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0495.html | 2013-12-16 13:12 | 1.2K | KIMBALL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0495.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0496.html | 2013-12-16 13:12 | 17K | KIMBALL v. WELD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0496.pdf | 2011-11-01 10:18 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0498.1.html | 2013-12-16 13:12 | 1.2K | KIMBARK (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0498.1.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0498.2.html | 2013-12-16 13:12 | 1.2K | KIMBER (LITTLE GUNNELL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0498.2.pdf | 2011-11-01 10:18 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0498.3.html | 2013-12-16 13:12 | 16K | KIMBERLY et al. v. BUTLER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0498.3.pdf | 2011-11-01 10:18 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0501.html | 2013-12-16 13:12 | 7.1K | KIMBRO v. COLGATE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0501.pdf | 2011-11-01 10:18 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0502.1.html | 2013-12-16 13:12 | 1.2K | KIMMELSTIEL v. The DEFIANCE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0502.1.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0502.2.html | 2013-12-16 13:12 | 1.2K | KINCAID (ADAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0502.2.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0502.3.html | 2013-12-16 13:12 | 1.2K | KINCAID (KINGSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0502.3.pdf | 2011-11-01 10:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0502.4.html | 2013-12-16 13:12 | 1.2K | KINCHELOE (DANIEL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0502.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0502.5.html | 2013-12-16 13:12 | 9.5K | In re KING et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0502.5.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0503.html | 2013-12-16 13:12 | 9.1K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0503.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0504.html | 2013-12-16 13:12 | 9.2K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0504.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0505.html | 2013-12-16 13:12 | 5.8K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0505.pdf | 2011-11-01 10:19 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0506.html | 2013-12-16 13:12 | 5.3K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0506.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0507.html | 2013-12-16 13:12 | 14K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0507.pdf | 2011-11-01 10:19 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0509.html | 2013-12-16 13:12 | 5.5K | In re KING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0509.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0510.html | 2013-12-16 13:12 | 12K | KING V. ACKERMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0510.pdf | 2011-11-01 10:19 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0511.1.html | 2013-12-16 13:12 | 1.2K | KING (ALLEN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0511.1.pdf | 2011-11-01 10:19 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0511.2.html | 2013-12-16 13:12 | 30K | KING et al. v. AMERICAN TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0511.2.pdf | 2011-11-01 10:19 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0516.1.html | 2013-12-16 13:12 | 1.2K | KING (BANK OF COLUMBIA v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0516.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0516.2.html | 2013-12-16 13:12 | 1.2K | KING (BANKS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0516.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0516.3.html | 2013-12-16 13:12 | 24K | KING v. DELAWARE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0516.3.pdf | 2011-11-01 10:19 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0520.1.html | 2013-12-16 13:12 | 4.4K | KING v. FEARSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0520.1.pdf | 2011-11-01 10:19 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0520.2.html | 2013-12-16 13:12 | 8.5K | KING v. FEARSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0520.2.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0521.html | 2013-12-16 13:12 | 4.8K | KING v. FORCE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0521.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0522.html | 2013-12-16 13:12 | 4.9K | KING v. FOYLES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0522.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0523.html | 2013-12-16 13:12 | 14K | KING v. FRENCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0523.pdf | 2011-11-01 10:19 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0525.html | 2013-12-16 13:12 | 10K | KING v. FROSTEL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0525.pdf | 2011-11-01 10:19 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0526.html | 2013-12-16 13:12 | 30K | KING v. GEDNEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0526.pdf | 2011-11-01 10:19 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0531.1.html | 2013-12-16 13:12 | 1.2K | KING (GILMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0531.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0531.2.html | 2013-12-16 13:12 | 4.0K | KING v. GORSLINE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0531.2.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0531.3.html | 2013-12-16 13:12 | 12K | KING v. HAMMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0531.3.pdf | 2011-11-01 10:19 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0533.html | 2013-12-16 13:12 | 17K | KING v. LOUISVILLE CEMENT CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0533.pdf | 2011-11-01 10:19 | 70K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0534_01.jpg | 2011-07-13 21:26 | 13K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0536.html | 2013-12-16 13:12 | 17K | KING v. MAUDELBAUM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0536.pdf | 2011-11-01 10:19 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0539.html | 2013-12-16 13:12 | 26K | KING et al. v. OHIO & M. RY. CO., ALSO THREE OTHER CASES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0539.pdf | 2011-11-01 10:19 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0543.html | 2013-12-16 13:12 | 13K | KING et al. v. OHIO & M. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0543.pdf | 2011-11-01 10:19 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.1.html | 2013-12-16 13:12 | 3.1K | KING et al. v. PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.1.pdf | 2011-11-01 10:19 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.2.html | 2013-12-16 13:12 | 1.2K | KING v. RAILROAD COS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.3.html | 2013-12-16 13:12 | 1.2K | KING v. The R. E. LEE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.4.html | 2013-12-16 13:12 | 1.2K | KING (RANDOLPH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.5.html | 2013-12-16 13:12 | 2.3K | KING et al. v. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.5.pdf | 2011-11-01 10:19 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0545.6.html | 2013-12-16 13:12 | 36K | KING et al. v. SHEPHERD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0545.6.pdf | 2011-11-01 10:19 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0551.1.html | 2013-12-16 13:12 | 1.2K | KING, (SHERBURNE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0551.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0551.2.html | 2013-12-16 13:12 | 3.5K | KING v. SIMM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0551.2.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0551.3.html | 2013-12-16 13:12 | 1.2K | KING (SMALL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0551.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0551.4.html | 2013-12-16 13:12 | 13K | KING et al. v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0551.4.pdf | 2011-11-01 10:19 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0553.1.html | 2013-12-16 13:12 | 1.1K | KING (STEVENSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0553.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0553.2.html | 2013-12-16 13:12 | 1.2K | KING (STRIDER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0553.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0553.3.html | 2013-12-16 13:12 | 4.4K | KING v. THOMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0553.3.pdf | 2011-11-01 10:19 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0554.1.html | 2013-12-16 13:12 | 1.2K | KING (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0554.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0554.2.html | 2013-12-16 13:12 | 1.2K | KING v. TROSTEL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0554.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0554.3.html | 2013-12-16 13:12 | 25K | KING et al. v. TUSCUMBIA, C. & D. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0554.3.pdf | 2011-11-01 10:19 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0558.1.html | 2013-12-16 13:12 | 1.2K | KING (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0558.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0558.2.html | 2013-12-16 13:12 | 1.2K | KING (VINT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0558.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0558.3.html | 2013-12-16 13:12 | 27K | KING v. WERNER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0558.3.pdf | 2011-11-01 10:19 | 181K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0559_01.jpg | 2011-07-13 21:26 | 30K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0559_02.jpg | 2011-07-13 21:26 | 32K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0561_01.jpg | 2011-07-13 21:26 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0562.html | 2013-12-16 13:12 | 1.2K | KING (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0562.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0563.html | 2013-12-16 13:12 | 30K | KING et al. v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0563.pdf | 2011-11-01 10:19 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0567.html | 2013-12-16 13:12 | 25K | KING et al. v. YOUNG MEN's ASSN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0567.pdf | 2011-11-01 10:19 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0571.html | 2013-12-16 13:12 | 7.3K | KING OF SPAIN v. OLIVER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0571.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0572.html | 2013-12-16 13:12 | 32K | KING OF SPAIN v. OLIVER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0572.pdf | 2011-11-01 10:19 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0577.html | 2013-12-16 13:12 | 9.6K | KING OF SPAIN v. OLIVER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0577.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0579.html | 2013-12-16 13:12 | 22K | In re KINGON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0579.pdf | 2011-11-01 10:19 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0582.html | 2013-12-16 13:12 | 17K | In re KINGSBURY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0582.pdf | 2011-11-01 10:19 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0585.1.html | 2013-12-16 13:12 | 1.2K | KINGSBURY (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0585.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0585.2.html | 2013-12-16 13:12 | 14K | KINGSBURY v. KINGSBURY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0585.2.pdf | 2011-11-01 10:19 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0587.1.html | 2013-12-16 13:12 | 1.2K | KINGSLAND (PATTERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0587.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0587.2.html | 2013-12-16 13:12 | 4.9K | In re KINGSLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0587.2.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0587.3.html | 2013-12-16 13:12 | 17K | In re KINGSLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0587.3.pdf | 2011-11-01 10:19 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0590.1.html | 2013-12-16 13:12 | 4.2K | In re KINGSLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0590.1.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0590.2.html | 2013-12-16 13:12 | 1.3K | KINGSLEY's ASSIGNEE v. HERRIET. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0590.2.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0590.3.html | 2013-12-16 13:12 | 13K | KINGSTON v. KINCAID et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0590.3.pdf | 2011-11-01 10:19 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0592.html | 2013-12-16 13:12 | 16K | KINGSTON v. KINCAID et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0592.pdf | 2011-11-01 10:19 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0595.1.html | 2013-12-16 13:12 | 1.2K | KINGSTON (ROSS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0595.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0595.2.html | 2013-12-16 13:12 | 25K | KINGSTON v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0595.2.pdf | 2011-11-01 10:19 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0599.1.html | 2013-12-16 13:12 | 1.3K | KING WROUGHT IRON BRIDGE CO. (FIRST NAT. BANK OF MANHATTAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0599.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0599.2.html | 2013-12-16 13:12 | 24K | In re KINKEAD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0599.2.pdf | 2011-11-01 10:19 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0602.html | 2013-12-16 13:12 | 35K | Ex parte KINNEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0602.pdf | 2011-11-01 10:19 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0608.1.html | 2013-12-16 13:12 | 1.2K | KINNEY v. The ALHAMBRA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0608.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0608.2.html | 2013-12-16 13:12 | 21K | KINNEY v. ALLEN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0608.2.pdf | 2011-11-01 10:19 | 71K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0608_01.jpg | 2011-07-13 21:26 | 5.5K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0611.html | 2013-12-16 13:12 | 162K | KINNEY v. CONSOLIDATED VA. MIN. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0611.pdf | 2011-11-01 10:19 | 379K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0618_01.jpg | 2011-07-13 21:26 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0639.1.html | 2013-12-16 13:12 | 1.1K | KINNEY (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0639.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0639.2.html | 2013-12-16 13:12 | 1.1K | KINNEY (LEWIS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0639.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0639.3.html | 2013-12-16 13:12 | 1.2K | KINNIE, The (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0639.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0639.4.html | 2013-12-16 13:12 | 3.3K | KINSEY v. KINSEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0639.4.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0639.5.html | 2013-12-16 13:12 | 9.8K | KINSEY v. LITTLE RIVER COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0639.5.pdf | 2011-11-01 10:19 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0641.html | 2013-12-16 13:12 | 7.4K | KINSEY v. PULASKI COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0641.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0642.html | 2013-12-16 13:12 | 6.8K | KINSING's ASSIGNEE v. BARTHOLEW et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0642.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0643.1.html | 2013-12-16 13:12 | 1.1K | KINSINGER (PULLAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0643.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0643.2.html | 2013-12-16 13:12 | 1.2K | KINSLEY (PENDLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0643.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0643.3.html | 2013-12-16 13:12 | 8.7K | In re KINSMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0643.3.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0644.1.html | 2013-12-16 13:12 | 1.2K | KINSMAN (PARKHURST v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0644.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0644.2.html | 2013-12-16 13:12 | 4.0K | In re KINTZING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0644.2.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0644.3.html | 2013-12-16 13:12 | 1.1K | KINTZING v. BARTHOLEW. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0644.3.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0644.4.html | 2013-12-16 13:12 | 31K | KINTZING v. HUTCHINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0644.4.pdf | 2011-11-01 10:19 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0649.html | 2013-12-16 13:12 | 21K | KINZIE v. WINSTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0649.pdf | 2011-11-01 10:19 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0653.1.html | 2013-12-16 13:12 | 1.1K | KIP (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0653.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0653.2.html | 2013-12-16 13:12 | 1.1K | KIP v. KIP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0653.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0653.3.html | 2013-12-16 13:12 | 9.2K | In re KIPP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0653.3.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0654.html | 2013-12-16 13:12 | 40K | KIRBY et al. v. BEARDSLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0654.pdf | 2011-11-01 10:19 | 124K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0658_01.jpg | 2011-07-13 21:26 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0660.html | 2013-12-16 13:12 | 1.1K | KIRBY (CARRICO v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0660.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0661.html | 2013-12-16 13:12 | 69K | KIRBY et al. v. DODGE & STEVENSON MANUF'G CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0661.pdf | 2011-11-01 10:19 | 199K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0665_01.jpg | 2011-05-17 22:25 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0672.1.html | 2013-12-16 13:12 | 1.1K | KIRBY (WIGLE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0672.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0672.2.html | 2013-12-16 13:12 | 1.2K | KIRBY CARPENTER CO. (GEEKIE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0672.2.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0672.3.html | 2013-12-16 13:12 | 3.1K | KIRK v. ARMSTRONG. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0672.3.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0673.1.html | 2013-12-16 13:12 | 1.2K | KIRK v. The OSSEO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0673.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0673.2.html | 2013-12-16 13:12 | 7.1K | In re KIRKBRIDE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0673.2.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0674.html | 2013-12-16 13:12 | 15K | KIRKBRIDE v. LAFAYETTE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0674.pdf | 2011-11-01 10:19 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0676.html | 2013-12-16 13:12 | 6.7K | KIRKENDALL v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0676.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0677.html | 2013-12-16 13:12 | 11K | In re KIRKLAND et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0677.pdf | 2011-11-01 10:19 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0678.html | 2013-12-16 13:12 | 5.3K | In re KIRKLAND et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0678.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0679.html | 2013-12-16 13:12 | 6.2K | In re KIRKLAND et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0679.pdf | 2011-11-01 10:19 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0680.html | 2013-12-16 13:12 | 10K | KIRKLAND v. The FAME. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0680.pdf | 2011-11-01 10:19 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0681.html | 2013-12-16 13:12 | 6.4K | KIRKPATRICK et al. v. AMERICAN STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0681.pdf | 2011-11-01 10:19 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0682.html | 2013-12-16 13:12 | 7.4K | KIRKPATRICK v. BALTIMORE & O. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0682.pdf | 2011-11-01 10:19 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0683.1.html | 2013-12-16 13:12 | 1.2K | KIRKPATRICK (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0683.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0683.2.html | 2013-12-16 13:12 | 10K | KIRKPATRICK et al. v. GIBSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0683.2.pdf | 2011-11-01 10:19 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0685.1.html | 2013-12-16 13:12 | 2.6K | KIRKPATRICK v. LANGPHIER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0685.1.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0685.2.html | 2013-12-16 13:12 | 1.2K | KIRKPATRICK (MONTEITH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0685.2.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0685.3.html | 2013-12-16 13:12 | 17K | KIRKPATRICK v. WHITE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0685.3.pdf | 2011-11-01 10:19 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0688.html | 2013-12-16 13:12 | 9.6K | In re KIRTLAND. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0688.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0689.1.html | 2013-12-16 13:12 | 2.0K | KISSAM v. The ALBERT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0689.1.pdf | 2011-11-01 10:19 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0689.2.html | 2013-12-16 13:12 | 19K | KISSINGER v. BEAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0689.2.pdf | 2011-11-01 10:19 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0692.1.html | 2013-12-16 13:12 | 1.2K | KISSLING (MURPHY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0692.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0692.2.html | 2013-12-16 13:12 | 1.2K | KITCHEN (POPLESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0692.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0692.3.html | 2013-12-16 13:12 | 7.8K | KITCHEN v. STRAWBRIDGE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0692.3.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0693.html | 2013-12-16 13:12 | 7.8K | KITCHEN et al. v. WOODFIN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0693.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0694.1.html | 2013-12-16 13:12 | 1.1K | KITTEL (ATWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0694.1.pdf | 2011-11-01 10:19 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0694.2.html | 2013-12-16 13:12 | 29K | KITTLE et al. v. FROST et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0694.2.pdf | 2011-11-01 10:19 | 121K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0695_01.jpg | 2011-05-17 22:24 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0699.html | 2013-12-16 13:12 | 12K | KITTLE v. MERRIAM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0699.pdf | 2011-11-01 10:19 | 100K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0699_01.jpg | 2011-05-17 22:34 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0701.1.html | 2013-12-16 13:12 | 1.3K | KITTLE v. SCHNEIDER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0701.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0701.2.html | 2013-12-16 13:12 | 43K | KITTREDGE v. CLAREMONT BANK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0701.2.pdf | 2011-11-01 10:19 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0708.html | 2013-12-16 13:12 | 8.1K | KITTREDGE v. CLAREMONT BANK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0708.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.1.html | 2013-12-16 13:12 | 1.2K | KITTREDGE (SPARKS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.2.html | 2013-12-16 13:12 | 1.2K | KITTRIDGE (WALLAMET FALLS C. & L. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.2.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.3.html | 2013-12-16 13:12 | 1.2K | KITTY, The (CAREY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.4.html | 2013-12-16 13:12 | 3.9K | KITTY v. McPHERSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.4.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.5.html | 2013-12-16 13:12 | 1.2K | KITTY, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.6.html | 2013-12-16 13:12 | 1.2K | KITTY SIMPSON, The (BRAGDON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.6.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0709.7.html | 2013-12-16 13:12 | 22K | In re KITZINGER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0709.7.pdf | 2011-11-01 10:19 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0713.html | 2013-12-16 13:12 | 7.3K | In re KITZINGER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0713.pdf | 2011-11-01 10:19 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0714.html | 2013-12-16 13:12 | 7.0K | In re KITZINGER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0714.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0715.1.html | 2013-12-16 13:12 | 4.5K | KLAIBER v. ILLINOIS BENEVOLENT MASONIC SOC. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0715.1.pdf | 2011-11-01 10:19 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0715.2.html | 2013-12-16 13:12 | 5.7K | In re KLANCKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0715.2.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0716.html | 2013-12-16 13:12 | 17K | In re KLEIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0716.pdf | 2011-11-01 10:19 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0719.html | 2013-12-16 13:12 | 70K | In re KLEIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0719.pdf | 2011-11-01 10:19 | 155K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.1.html | 2013-12-16 13:12 | 1.2K | KLEIN (BRADSHAW v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.2.html | 2013-12-16 13:12 | 1.2K | KLEIN (HAMMER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.3.html | 2013-12-16 13:12 | 1.2K | KLEIN v. KLOMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.4.html | 2013-12-16 13:12 | 1.2K | KLEIN (KONOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.5.html | 2013-12-16 13:12 | 1.2K | KLEIN (McLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0730.6.html | 2013-12-16 13:12 | 7.8K | KLEIN v. PARK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0730.6.pdf | 2011-11-01 10:19 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0732.html | 2013-12-16 13:12 | 40K | KLEINE v. CATARA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0732.pdf | 2011-11-01 10:19 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0738.html | 2013-12-16 13:12 | 15K | KLEINE et al. v. SHANKS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0738.pdf | 2011-11-01 10:19 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.1.html | 2013-12-16 13:12 | 1.2K | KLEINKNECHT (WICKE V.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.2.html | 2013-12-16 13:12 | 1.1K | KLIER (SIDENER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.3.html | 2013-12-16 13:12 | 1.1K | KLINE (PENN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.4.html | 2013-12-16 13:12 | 1.1K | KLINGLER (GREENE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.5.html | 2013-12-16 13:12 | 1.1K | KLIPPELL (BURFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.6.html | 2013-12-16 13:12 | 1.2K | KLORKGETER (BUCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.6.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.7.html | 2013-12-16 13:12 | 4.6K | KLOTS et al. v. The RED JACKET. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.7.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.8.html | 2013-12-16 13:12 | 1.1K | KLYNE (PENN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.8.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0740.9.html | 2013-12-16 13:12 | 26K | KNAGG v. GOLDSMITH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0740.9.pdf | 2011-11-01 10:19 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.1.html | 2013-12-16 13:12 | 3.2K | KNAP et al. v. The ELIZA AND SARAH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.1.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.2.html | 2013-12-16 13:12 | 1.1K | KNAPP (BEERS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.3.html | 2013-12-16 13:12 | 1.1K | KNAPP (FARRELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.4.html | 2013-12-16 13:12 | 1.1K | KNAPP (IRISH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.5.html | 2013-12-16 13:12 | 1.2K | KNAPP (RISON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.5.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0745.6.html | 2013-12-16 13:12 | 7.9K | KNARESBOROUGH v. BELCHER SILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0745.6.pdf | 2011-11-01 10:19 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0746.html | 2013-12-16 13:12 | 22K | KNEASS v. SCHUYLKILL BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0746.pdf | 2011-11-01 10:19 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0749.html | 2013-12-16 13:12 | 7.3K | KNEASS v. SCHUYLKILL BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0749.pdf | 2011-11-01 10:19 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0750.html | 2013-12-16 13:12 | 3.8K | KNEE v. AMERICAN STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0750.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0751.1.html | 2013-12-16 13:12 | 1.2K | KNEVALS v. HYDE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0751.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0751.2.html | 2013-12-16 13:12 | 7.4K | KNICKERBOCKER INS. CO. v. COMSTOCK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0751.2.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0752.1.html | 2013-12-16 13:12 | 1.2K | KNICKERBOCKER LIFE INS. CO. (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0752.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0752.2.html | 2013-12-16 13:12 | 1.2K | KNICKERBOCKER LIFE INS. CO. (TREFZ v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0752.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0752.3.html | 2013-12-16 13:12 | 20K | In re KNIGHT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0752.3.pdf | 2011-11-01 10:19 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0755.html | 2013-12-16 13:12 | 19K | KNIGHT v. The ATTILA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0755.pdf | 2011-11-01 10:19 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0758.html | 2013-12-16 13:12 | 11K | KNIGHT v. BALTIMORE & O. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0758.pdf | 2011-11-01 10:19 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0760.1.html | 2013-12-16 13:12 | 1.2K | KNIGHT v. CARGO OF THE SALEM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0760.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0760.2.html | 2013-12-16 13:12 | 31K | KNIGHT v. CHENEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0760.2.pdf | 2011-11-01 10:19 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0765.1.html | 2013-12-16 13:12 | 1.1K | KNIGHT (CROWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0765.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0765.2.html | 2013-12-16 13:12 | 44K | KNIGHT v. GAVIT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0765.2.pdf | 2011-11-01 10:19 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0772.html | 2013-12-16 13:12 | 27K | KNIGHT et al. v. OLD NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0772.pdf | 2011-11-01 10:19 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0776.html | 2013-12-16 13:12 | 9.8K | KNIGHT v. PARSONS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0776.pdf | 2011-11-01 10:19 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0777.html | 2013-12-16 13:12 | 8.4K | KNIGHT et al. v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0777.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0778.html | 2013-12-16 13:12 | 11K | KNIGHT v. STONE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0778.pdf | 2011-11-01 10:19 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0780.1.html | 2013-12-16 13:12 | 1.2K | KNIGHT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0780.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0780.2.html | 2013-12-16 13:12 | 13K | KNOEDLER v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0780.2.pdf | 2011-11-01 10:19 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0782.1.html | 2013-12-16 13:12 | 3.2K | KNOEDLER V. SCHELL (two cases). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0782.1.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0782.2.html | 2013-12-16 13:12 | 6.4K | In re KNOEPFEL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0782.2.pdf | 2011-11-01 10:19 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0783.html | 2013-12-16 13:12 | 11K | In re KNOEPFEL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0783.pdf | 2011-11-01 10:19 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0785.1.html | 2013-12-16 13:12 | 2.5K | In re KNOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0785.1.pdf | 2011-11-01 10:19 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0785.2.html | 2013-12-16 13:12 | 12K | KNOTT v. SOUTHERN LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0785.2.pdf | 2011-11-01 10:19 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0787.1.html | 2013-12-16 13:12 | 5.8K | Ex parte KNOWLES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0787.1.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0787.2.html | 2013-12-16 13:12 | 10K | KNOWLES et al. v. BEATY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0787.2.pdf | 2011-11-01 10:19 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0789.1.html | 2013-12-16 13:12 | 1.2K | KNOWLES (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0789.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0789.2.html | 2013-12-16 13:12 | 1.2K | KNOWLES (LOGANSPORT GASLIGHT & COKE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0789.2.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0789.3.html | 2013-12-16 13:12 | 18K | KNOWLES v. NICHOLS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0789.3.pdf | 2011-11-01 10:19 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0791.html | 2013-12-16 13:12 | 5.3K | KNOWLES v. PARROTT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0791.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0792.html | 2013-12-16 13:12 | 8.0K | KNOWLES v. PITTSBURGH, FT. W. & C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0792.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0793.1.html | 2013-12-16 13:12 | 1.2K | KNOWLES (SHARPLESS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0793.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0793.2.html | 2013-12-16 13:12 | 4.9K | KNOWLES v. STEWART. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0793.2.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0794.1.html | 2013-12-16 13:12 | 1.2K | KNOWLES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0794.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0794.2.html | 2013-12-16 13:12 | 13K | KNOWLTON v. BOSS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0794.2.pdf | 2011-11-01 10:19 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0796.html | 2013-12-16 13:12 | 8.6K | KNOWLTON v. CONGRESS & EMPIRE SPRING CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0796.pdf | 2011-11-01 10:19 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0797.html | 2013-12-16 13:12 | 18K | KNOWLTON v. CONGRESS & EMPIRE SPRING CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0797.pdf | 2011-11-01 10:19 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0799.html | 2013-12-16 13:12 | 5.9K | KNOWLTON v. HOLLAND. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0799.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0800.1.html | 2013-12-16 13:12 | 1.2K | KNOX (ALEXANDER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0800.1.pdf | 2011-11-01 10:19 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0800.2.html | 2013-12-16 13:12 | 1.2K | KNOX (BRADLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0800.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0800.3.html | 2013-12-16 13:12 | 4.2K | KNOX v. The DALLAS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0800.3.pdf | 2011-11-01 10:19 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0801.html | 2013-12-16 13:12 | 50K | KNOX v. DEVENS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0801.pdf | 2011-11-01 10:19 | 116K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0809.1.html | 2013-12-16 13:12 | 6.7K | KNOX et al. v. GREAT WESTERN QUICKSILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0809.1.pdf | 2011-11-01 10:19 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0809.2.html | 2013-12-16 13:12 | 30K | KNOX et al. v. GREAT WESTERN QUICKSILVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0809.2.pdf | 2011-11-01 10:19 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0814.html | 2013-12-16 13:12 | 8.7K | KNOX et al. v. GREENLEAF. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0814.pdf | 2011-11-01 10:19 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0815.html | 2013-12-16 13:12 | 25K | KNOX et al. v. GREENLEAF. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0815.pdf | 2011-11-01 10:19 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0819.html | 2013-12-16 13:12 | 14K | KNOX et al. v. LOWEREE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0819.pdf | 2011-11-01 10:19 | 108K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0821_01.jpg | 2011-05-19 16:15 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0822.html | 2013-12-16 13:12 | 30K | KNOX v. MURTHA et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0822.pdf | 2011-11-01 10:19 | 117K | |
![[IMG]](/html/icons/compressed.gif) | 0014.f.cas.0822_01.jpg | 2011-05-19 16:16 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0827.html | 2013-12-16 13:12 | 25K | KNOX v. The NINETTA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0827.pdf | 2011-11-01 10:19 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0831.1.html | 2013-12-16 13:12 | 5.3K | KNOX et al. v. SUMMERS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0831.1.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0831.2.html | 2013-12-16 13:12 | 3.3K | KNOX et al. v. SUMMERS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0831.2.pdf | 2011-11-01 10:19 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0832.1.html | 2013-12-16 13:12 | 2.3K | KNOX v. WALTON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0832.1.pdf | 2011-11-01 10:19 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0832.2.html | 2013-12-16 13:12 | 5.4K | In re KOCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0832.2.pdf | 2011-11-01 10:19 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.1.html | 2013-12-16 13:12 | 1.2K | KOCH (DUNCAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.2.html | 2013-12-16 13:12 | 1.5K | KOCH v. OREGON STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.2.pdf | 2011-11-01 10:19 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.3.html | 2013-12-16 13:12 | 1.2K | KOCH (THURSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.4.html | 2013-12-16 13:12 | 1.2K | KOCHERSPERGER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.4.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.5.html | 2013-12-16 13:12 | 1.2K | KOELLA (BARRETT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0833.6.html | 2013-12-16 13:12 | 12K | In re KOHLSAAT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0833.6.pdf | 2011-11-01 10:19 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0835.1.html | 2013-12-16 13:12 | 4.9K | KOHLSAAT v. HOGUET et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0835.1.pdf | 2011-11-01 10:19 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0835.2.html | 2013-12-16 13:12 | 18K | KOHNE v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0835.2.pdf | 2011-11-01 10:19 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0838.html | 2013-12-16 13:12 | 6.4K | KOHNE v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0838.pdf | 2011-11-01 10:19 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0839.html | 2013-12-16 13:12 | 22K | KOHNE v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0839.pdf | 2011-11-01 10:19 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0842.1.html | 2013-12-16 13:12 | 1.2K | KOHNSTAMM (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0842.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0842.2.html | 2013-12-16 13:12 | 1.2K | KOLLOOK (GIFFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0842.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0842.3.html | 2013-12-16 13:12 | 8.2K | The KOLON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0842.3.pdf | 2011-11-01 10:19 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0843.1.html | 2013-12-16 13:12 | 1.2K | KOMP (WILCOX v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0843.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0843.2.html | 2013-12-16 13:12 | 43K | KONING v. BAYARD, Jr., et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0843.2.pdf | 2011-11-01 10:19 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0849.1.html | 2013-12-16 13:12 | 1.2K | KONKAPOT (GRAHAM) v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0849.1.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0849.2.html | 2013-12-16 13:12 | 6.2K | KONOLD v. KLEIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0849.2.pdf | 2011-11-01 10:19 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.1.html | 2013-12-16 13:12 | 1.2K | KONYNG v. BAYARD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.2.html | 2013-12-16 13:12 | 3.5K | KOONES v. THOMEE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.2.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.3.html | 2013-12-16 13:12 | 1.1K | KOOX (SEELEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.4.html | 2013-12-16 13:12 | 1.2K | KORN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.5.html | 2013-12-16 13:12 | 1.1K | KORTRIGHT v. BOSTWICK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.6.html | 2013-12-16 13:12 | 1.2K | KOSCIUSKO, The (THOMAS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.6.pdf | 2011-11-01 10:19 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0850.7.html | 2013-12-16 13:12 | 2.3K | KOUNSALAER v. CLARKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0850.7.pdf | 2011-11-01 10:19 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0851.1.html | 2013-12-16 13:12 | 4.7K | KOUNTZE v. OMAHA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0851.1.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0851.2.html | 2013-12-16 13:12 | 4.5K | KRAFT v. STOTT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0851.2.pdf | 2011-11-01 10:19 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0852.html | 2013-12-16 13:12 | 19K | KRAMME et al. v. The NEW ENGLAND. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0852.pdf | 2011-11-01 10:19 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0855.html | 2013-12-16 13:12 | 11K | KRAUSKOPP v. AMES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0855.pdf | 2011-11-01 10:19 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0856.html | 2013-12-16 13:12 | 40K | KREBS v. CARLISLE BANK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0856.pdf | 2011-11-01 10:19 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0862.1.html | 2013-12-16 13:12 | 1.2K | KREMER (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0862.1.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0862.2.html | 2013-12-16 13:12 | 1.2K | KREMER (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0862.2.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0862.3.html | 2013-12-16 13:12 | 1.2K | KREPLIN, The ELWIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0862.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0862.4.html | 2013-12-16 13:12 | 1.2K | KREPLIN, The ELWINE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0862.4.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0862.5.html | 2013-12-16 13:12 | 1.2K | KRIEGER (RANDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0862.5.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0863.html | 2013-12-16 13:12 | 14K | KRIESLER v. MORTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0863.pdf | 2011-11-01 10:19 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0865.1.html | 2013-12-16 13:12 | 5.6K | KRIESLER v. MORTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0865.1.pdf | 2011-11-01 10:19 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0865.2.html | 2013-12-16 13:12 | 6.9K | The KRISTREL. BETHEL v. The KRISTREL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0865.2.pdf | 2011-11-01 10:19 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0866.1.html | 2013-12-16 13:12 | 1.2K | KROFFT (DEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0866.1.pdf | 2011-11-01 10:19 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0866.2.html | 2013-12-16 13:12 | 6.6K | In re KROGMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0866.2.pdf | 2011-11-01 10:19 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0867.1.html | 2013-12-16 13:12 | 3.0K | KROUSE et al. v. DEBLOIS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0867.1.pdf | 2011-11-01 10:19 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0867.2.html | 2013-12-16 13:12 | 3.5K | KROUSE et al. v. DEBLOIS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0867.2.pdf | 2011-11-01 10:19 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0868.1.html | 2013-12-16 13:12 | 4.0K | KROUSE v. ROSS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0868.1.pdf | 2011-11-01 10:19 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0868.2.html | 2013-12-16 13:12 | 1.8K | KROUSE v. SPROGELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0868.2.pdf | 2011-11-01 10:19 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0868.3.html | 2013-12-16 13:12 | 1.2K | KROUSE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0868.3.pdf | 2011-11-01 10:19 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0868.4.html | 2013-12-16 13:12 | 9.9K | In re KRUEGER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0868.4.pdf | 2011-11-01 10:19 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0870.html | 2013-12-16 13:12 | 15K | In re KRUEGER et al., Ex parte BUGBEE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0870.pdf | 2011-11-01 10:20 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0872.1.html | 2013-12-16 13:12 | 3.7K | In re KRUM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0872.1.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0872.2.html | 2013-12-16 13:12 | 11K | KRUMBAAR v. BURT et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0872.2.pdf | 2011-11-01 10:20 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0874.1.html | 2013-12-16 13:12 | 1.2K | KRUTZ (SPALDING v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0874.1.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0874.2.html | 2013-12-16 13:12 | 9.0K | KUHN et al. v. McMILLAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0874.2.pdf | 2011-11-01 10:20 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.1.html | 2013-12-16 13:12 | 1.2K | KUHN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.2.html | 2013-12-16 13:12 | 1.2K | KUHNS (DIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.3.html | 2013-12-16 13:12 | 1.3K | KU KLUX TRIALS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.3.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.4.html | 2013-12-16 13:12 | 1.2K | KUKUK (BRONSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.4.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.5.html | 2013-12-16 13:12 | 1.2K | KUNKALL v. DEANES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.5.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0875.6.html | 2013-12-16 13:12 | 22K | KURSHEEDT v. WERNER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0875.6.pdf | 2011-11-01 10:20 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0879.html | 2013-12-16 13:12 | 9.5K | In re KURTH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0879.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0880.html | 2013-12-16 13:12 | 7.7K | KURTZ v. BANK OF COLUMBIA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0880.pdf | 2011-11-01 10:20 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0881.1.html | 2013-12-16 13:12 | 1.2K | KURTZ (BANK OF UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0881.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0881.2.html | 2013-12-16 13:12 | 1.2K | KURTZ (BANK OF WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0881.2.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0881.3.html | 2013-12-16 13:12 | 6.0K | KURTZ et al. v. BEATTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0881.3.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0882.1.html | 2013-12-16 13:12 | 2.7K | KURTZ v. BECKER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0882.1.pdf | 2011-11-01 10:20 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0882.2.html | 2013-12-16 13:12 | 3.7K | KURTZ v. HOLLINGSHEAD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0882.2.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0882.3.html | 2013-12-16 13:12 | 9.7K | KURTZ v. HOLLINGSHEAD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0882.3.pdf | 2011-11-01 10:20 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0884.1.html | 2013-12-16 13:12 | 4.7K | KURTZ v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0884.1.pdf | 2011-11-01 10:20 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0884.2.html | 2013-12-16 13:12 | 1.2K | KURTZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0884.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0884.3.html | 2013-12-16 13:12 | 18K | KUTER v. MICHIGAN CENT. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0884.3.pdf | 2011-11-01 10:20 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0887.html | 2013-12-16 13:12 | 5.7K | In re KYLER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0887.pdf | 2011-11-01 10:20 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0888.1.html | 2013-12-16 13:12 | 4.9K | In re KYLER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0888.1.pdf | 2011-11-01 10:20 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0888.2.html | 2013-12-16 13:12 | 25K | KYNOCH v. The S. C. IVES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0888.2.pdf | 2011-11-01 10:20 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0892.html | 2013-12-16 13:12 | 18K | LABAREE et al. v. PEORIA, P. & J. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0892.pdf | 2011-11-01 10:20 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0895.html | 2013-12-16 13:12 | 27K | LA BAW et al. v. HAWKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0895.pdf | 2011-11-01 10:20 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0899.html | 2013-12-16 13:12 | 16K | LA BAW et al. v. HAWKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0899.pdf | 2011-11-01 10:20 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0902.1.html | 2013-12-16 13:12 | 1.2K | LA BELLE CREOLE (WARDER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0902.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0902.2.html | 2013-12-16 13:12 | 1.2K | LABER (COOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0902.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0902.3.html | 2013-12-16 13:12 | 1.2K | LABITUT (BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0902.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0902.4.html | 2013-12-16 13:12 | 21K | LABITUT v. PREWETT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0902.4.pdf | 2011-11-01 10:20 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0905.html | 2013-12-16 13:12 | 3.6K | The LA BRUCE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0905.pdf | 2011-11-01 10:20 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0906.1.html | 2013-12-16 13:12 | 2.2K | The LABUAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0906.1.pdf | 2011-11-01 10:20 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0906.2.html | 2013-12-16 13:12 | 48K | In re LACEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0906.2.pdf | 2011-11-01 10:20 | 113K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0914.1.html | 2013-12-16 13:12 | 1.2K | LACEY (CONNINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0914.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0914.2.html | 2013-12-16 13:12 | 1.2K | LACEY (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0914.2.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0914.3.html | 2013-12-16 13:12 | 1.2K | LACEY (WOLVERTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0914.3.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0914.4.html | 2013-12-16 13:12 | 16K | In re LACHEMEYER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0914.4.pdf | 2011-11-01 10:20 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0916.html | 2013-12-16 13:12 | 6.3K | LACHENMEYER v. The ANGELINA. DAY et al. v. SAME. WATSON et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0916.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0917.1.html | 2013-12-16 13:12 | 1.2K | LACHENMEYER (MERCIER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0917.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0917.2.html | 2013-12-16 13:12 | 1.2K | LACKLAND (MELVIN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0917.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0917.3.html | 2013-12-16 13:12 | 1.2K | LACKLAND (SANFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0917.3.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0917.4.html | 2013-12-16 13:12 | 1.2K | LACKMEYER v. LACKMEYER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0917.4.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0917.5.html | 2013-12-16 13:12 | 9.2K | The LAC LA BELLE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0917.5.pdf | 2011-11-01 10:20 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0918.1.html | 2013-12-16 13:12 | 1.2K | LA CLEDE COUNTY (DARLINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0918.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0918.2.html | 2013-12-16 13:12 | 1.2K | LA COSTE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0918.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0918.3.html | 2013-12-16 13:12 | 1.2K | LA CROSSE RAILROAD (SOUTER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0918.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0918.4.html | 2013-12-16 13:12 | 9.9K | LA CROSSE RAILROAD BRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0918.4.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.1.html | 2013-12-16 13:12 | 1.2K | LA CROSSE & M. R. CO. (BRONSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.2.html | 2013-12-16 13:12 | 1.2K | LA CROSSE & M. R. CO. (CLEVELAND v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.3.html | 2013-12-16 13:12 | 1.2K | LA CROSSE & M. R. CO. (HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.4.html | 2013-12-16 13:12 | 1.2K | LA CROSSE, ETC., PACKET CO. (GERMANIA INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.4.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.5.html | 2013-12-16 13:12 | 1.2K | LA CROSSE, ETC., PACKET CO. (KELLOGG v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.5.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.6.html | 2013-12-16 13:12 | 3.9K | In re LACY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.6.pdf | 2011-11-01 10:20 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.7.html | 2013-12-16 13:12 | 1.2K | LACY (ORR v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.7.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.8.html | 2013-12-16 13:12 | 1.2K | LACY (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.8.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.9.html | 2013-12-16 13:12 | 1.2K | LADD (BARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.9.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.10.html | 2013-12-16 13:12 | 1.2K | LADD (BARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.10.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.11.html | 2013-12-16 13:12 | 1.2K | LADD (CHANDLER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.11.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0920.12.html | 2013-12-16 13:12 | 4.6K | LADD v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0920.12.pdf | 2011-11-01 10:20 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0921.1.html | 2013-12-16 13:12 | 1.2K | LADD (HOOF v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0921.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0921.2.html | 2013-12-16 13:12 | 6.8K | LADD v. LADD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0921.2.pdf | 2011-11-01 10:20 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.1.html | 2013-12-16 13:12 | 2.3K | LADD v. PATTEN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.1.pdf | 2011-11-01 10:20 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.2.html | 2013-12-16 13:12 | 1.2K | LADD v. REED. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.2.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.3.html | 2013-12-16 13:12 | 1.2K | LADD (RICKARDS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.4.html | 2013-12-16 13:12 | 1.2K | LADD (SANDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.4.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.5.html | 2013-12-16 13:12 | 1.2K | LADD (SWAIN TURBINE & MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.5.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0922.6.html | 2013-12-16 13:12 | 6.2K | LADD v. TUCKER MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0922.6.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0923.html | 2013-12-16 13:12 | 18K | LADD v. TUDOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0923.pdf | 2011-11-01 10:20 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0926.1.html | 2013-12-16 13:12 | 1.2K | LADD (WEEKS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0926.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0926.2.html | 2013-12-16 13:12 | 3.7K | LADD v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0926.2.pdf | 2011-11-01 10:20 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0926.3.html | 2013-12-16 13:12 | 2.9K | LADD v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0926.3.pdf | 2011-11-01 10:20 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0926.4.html | 2013-12-16 13:12 | 10K | In re LADY BRYAN MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0926.4.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0928.1.html | 2013-12-16 13:12 | 1.5K | In re LADY BRYAN MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0928.1.pdf | 2011-11-01 10:20 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0928.2.html | 2013-12-16 13:12 | 9.0K | In re LADY BRYAN MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0928.2.pdf | 2011-11-01 10:20 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0929.html | 2013-12-16 13:12 | 10K | The LADY ELLEN., The NORWALK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0929.pdf | 2011-11-01 10:20 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0931.html | 2013-12-16 13:12 | 14K | The LADY FRANKLIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0931.pdf | 2011-11-01 10:20 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0933.html | 2013-12-16 13:12 | 8.7K | The LADY FRANKLIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0933.pdf | 2011-11-01 10:20 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0934.html | 2013-12-16 13:12 | 17K | The LADY FRANKLIN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0934.pdf | 2011-11-01 10:20 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0937.1.html | 2013-12-16 13:12 | 1.2K | The LADY HORATIA (PRITCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0937.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0937.2.html | 2013-12-16 13:12 | 1.2K | The LADY MAUNSEL (SUTHERLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0937.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0937.3.html | 2013-12-16 13:12 | 15K | The LADY PIKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0937.3.pdf | 2011-11-01 10:20 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0939.1.html | 2013-12-16 13:12 | 4.6K | The LADY STIRLING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0939.1.pdf | 2011-11-01 10:20 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0939.2.html | 2013-12-16 13:12 | 7.3K | LAFAYETTE BANK v. BANK OF ILLINOIS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0939.2.pdf | 2011-11-01 10:20 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.1.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE BANK (McLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.2.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE COUNTY (KIRKBRIDE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.3.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE COUNTY COURT (SHERRARD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.4.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE INS. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.4.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.5.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE INS, CO (FRENCH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.5.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.6.html | 2013-12-16 13:12 | 1.2K | LAFAYETTE, MUNCIE & B. RY. CO. (BAYLISS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.6.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.7.html | 2013-12-16 13:12 | 1.1K | LAFLIN (BEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.7.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.8.html | 2013-12-16 13:12 | 1.1K | LAFLIN (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.8.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.9.html | 2013-12-16 13:12 | 1.2K | LAFONTAINE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.9.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.10.html | 2013-12-16 13:12 | 1.2K | LAFRICAINE (SOULT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.10.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.11.html | 2013-12-16 13:12 | 1.1K | LAGOWITZ (ROEMER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.11.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.12.html | 2013-12-16 13:12 | 1.1K | LAHENS (FIELDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.12.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0940.13.html | 2013-12-16 13:12 | 6.0K | LAING v. The G. L. BUCKMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0940.13.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0941.html | 2013-12-16 13:12 | 5.8K | In re LAINS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0941.pdf | 2011-11-01 10:20 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.1.html | 2013-12-16 13:12 | 1.2K | LAIRD (CUSHING v.) |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.1.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.2.html | 2013-12-16 13:12 | 3.1K | LAIRD v. DICK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.2.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.3.html | 2013-12-16 13:12 | 1.1K | LAIRD (DICK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.4.html | 2013-12-16 13:12 | 1.1K | LAIRD (WETMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.4.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.5.html | 2013-12-16 13:12 | 1.2K | LA JEUNE EUGENIE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.5.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0942.6.html | 2013-12-16 13:12 | 9.6K | Ex parte LAKE et al., In re WHITING et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0942.6.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0944.html | 2013-12-16 13:12 | 8.4K | In re LAKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0944.pdf | 2011-11-01 10:20 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0945.1.html | 2013-12-16 13:12 | 1.1K | LAKE (BICKHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0945.1.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0945.2.html | 2013-12-16 13:12 | 1.2K | LAKE (CORREY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0945.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0945.3.html | 2013-12-16 13:12 | 9.3K | LAKE v. FITZGERALD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0945.3.pdf | 2011-11-01 10:20 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0946.html | 2013-12-16 13:12 | 12K | LAKE v. HEQUEMBOURG. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0946.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0948.1.html | 2013-12-16 13:12 | 1.2K | LAKE, The (VANTINE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0948.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0948.2.html | 2013-12-16 13:12 | 1.2K | LAKEMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0948.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0948.3.html | 2013-12-16 13:12 | 9.5K | LAKE ERIE & B. STEAMBOAT CO. v. The SON & HEIR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0948.3.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0949.html | 2013-12-16 13:12 | 8.2K | LAKE SHORE & M. S. R. CO. v. The NEIL COCHRAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0949.pdf | 2011-11-01 10:20 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0950.html | 2013-12-16 13:12 | 1.2K | LAKE SUPERIOR, The (ST. PAUL FIRE & MARINE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0950.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0951.html | 2013-12-16 13:12 | 38K | In re LAKE SUPERIOR SHIP CANAL, RAILROAD & IRON CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0951.pdf | 2011-11-01 10:20 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0957.html | 2013-12-16 13:12 | 14K | In re LAKE SUPERIOR SHIP-CANAL, ETC., CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0957.pdf | 2011-11-01 10:20 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0959.1.html | 2013-12-16 13:12 | 1.3K | LAKE SUPERIOR SHIP CANAL RAILROAD & IRON CO. (SUTHERLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0959.1.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0959.2.html | 2013-12-16 13:12 | 12K | LAKIN v. FIRST NAT. BANK OF JAMESTOWN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0959.2.pdf | 2011-11-01 10:20 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0961.html | 2013-12-16 13:12 | 8.9K | LALLANDE et al. v. The C. D. JR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0961.pdf | 2011-11-01 10:20 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0962.html | 2013-12-16 13:12 | 14K | In re LALOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0962.pdf | 2011-11-01 10:20 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0964.1.html | 2013-12-16 13:12 | 1.2K | LALOR (LYMAN VENTILATING & REFRIGERATOR CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0964.1.pdf | 2011-11-01 10:20 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0964.2.html | 2013-12-16 13:12 | 3.3K | LAMALERE v. CAZE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0964.2.pdf | 2011-11-01 10:20 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0964.3.html | 2013-12-16 13:12 | 6.8K | LAMALERE v. CAZE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0964.3.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0965.html | 2013-12-16 13:12 | 44K | The LA MANCHE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0965.pdf | 2011-11-01 10:20 | 116K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0972.html | 2013-12-16 13:12 | 1.2K | LAMAR, (BALDWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0972.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0973.1.html | 2013-12-16 13:12 | 1.2K | LAMAR, The (BULLOCH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0973.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0973.2.html | 2013-12-16 13:12 | 14K | LAMAR v. DANA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0973.2.pdf | 2011-11-01 10:20 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0975.html | 2013-12-16 13:12 | 15K | LAMAR v. DANA. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0975.pdf | 2011-11-01 10:20 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0977.html | 2013-12-16 13:12 | 19K | LAMAR v. The PENELOPE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0977.pdf | 2011-11-01 10:20 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0980.html | 2013-12-16 13:12 | 14K | LAMB v. BOWSER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0980.pdf | 2011-11-01 10:20 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0982.html | 2013-12-16 13:12 | 23K | LAMB v. BOWSER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0982.pdf | 2011-11-01 10:20 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0986.1.html | 2013-12-16 13:12 | 1.2K | LAMB v. BRIAND. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0986.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0986.2.html | 2013-12-16 13:12 | 15K | LAMB v. BRIARD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0986.2.pdf | 2011-11-01 10:20 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0988.html | 2013-12-16 13:12 | 6.2K | LAMB v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0988.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0989.html | 2013-12-16 13:12 | 15K | LAMB et al. v. BURBANK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0989.pdf | 2011-11-01 10:20 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0991.html | 2013-12-16 13:12 | 20K | LAMB et al. v. CARTER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0991.pdf | 2011-11-01 10:20 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0994.html | 2013-12-16 13:12 | 9.7K | LAMB v. DAMRON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0994.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.0996.html | 2013-12-16 13:12 | 77K | LAMB et al. v. DAVENPORT et al., DAVENPORT et al. v. LAMB et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.0996.pdf | 2011-11-01 10:20 | 163K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1008.1.html | 2013-12-16 13:12 | 1.1K | LAMB (FIELDS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1008.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1008.2.html | 2013-12-16 13:12 | 38K | LAMB v. GILLETT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1008.2.pdf | 2011-11-01 10:20 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1014.html | 2013-12-16 13:12 | 14K | LAMB et al. v. KAMM et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1014.pdf | 2011-11-01 10:20 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1016.html | 2013-12-16 13:12 | 13K | LAMB v. LAMB. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1016.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1018.html | 2013-12-16 13:12 | 6.7K | LAMB et al. v. PARKMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1018.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1019.html | 2013-12-16 13:12 | 33K | LAMB et al. v. PARKMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1019.pdf | 2011-11-01 10:20 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1024.html | 2013-12-16 13:12 | 39K | LAMB et al. v. STARR et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1024.pdf | 2011-11-01 10:20 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1030.html | 2013-12-16 13:12 | 26K | LAMB et al. v. STARR et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1030.pdf | 2011-11-01 10:20 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1034.html | 2013-12-16 13:12 | 35K | LAMB et al. v. VAUGHN et al., VAUGHN v. LAMB et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1034.pdf | 2011-11-01 10:20 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1040.html | 2013-12-16 13:12 | 22K | LAMB et al. v. WAKEFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1040.pdf | 2011-11-01 10:20 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1043.1.html | 2013-12-16 13:12 | 1.2K | LAMBELL (NALLY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1043.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1043.2.html | 2013-12-16 13:12 | 1.2K | LAMBELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1043.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1043.3.html | 2013-12-16 13:12 | 11K | LAMBELL v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1043.3.pdf | 2011-11-01 10:20 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1045.html | 2013-12-16 13:12 | 4.7K | In re LAMBERT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1045.pdf | 2011-11-01 10:20 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1046.1.html | 2013-12-16 13:12 | 3.5K | LAMBERT et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1046.1.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1046.2.html | 2013-12-16 13:12 | 8.7K | LAMBERT et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1046.2.pdf | 2011-11-01 10:20 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1047.1.html | 2013-12-16 13:12 | 1.2K | LAMBERT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1047.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1047.2.html | 2013-12-16 13:12 | 6.8K | In re LAMBSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1047.2.pdf | 2011-11-01 10:20 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1048.1.html | 2013-12-16 13:12 | 1.3K | LAMBSON v. BOILEAU. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1048.1.pdf | 2011-11-01 10:20 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1048.2.html | 2013-12-16 13:12 | 13K | In re LAMMER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1048.2.pdf | 2011-11-01 10:20 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1050.1.html | 2013-12-16 13:12 | 1.2K | LAMOILLE VAL. R. CO. (MERCANTILE TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1050.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1050.2.html | 2013-12-16 13:12 | 20K | LA MOTHE v. FINK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1050.2.pdf | 2011-11-01 10:20 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1053.html | 2013-12-16 13:12 | 12K | LA MOTHE MANUF'G CO. v. NATIONAL TUBE WORKS CO. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1053.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1055.1.html | 2013-12-16 13:12 | 1.2K | LAMPMAN (PENDERGRAST v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1055.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1055.2.html | 2013-12-16 13:12 | 16K | LAMSON v. MIX et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1055.2.pdf | 2011-11-01 10:20 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1058.html | 2013-12-16 13:12 | 20K | LAMSON v. WESTCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1058.pdf | 2011-11-01 10:20 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1061.html | 2013-12-16 13:12 | 6.3K | LANAHAN v. PATTISON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1061.pdf | 2011-11-01 10:20 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1062.1.html | 2013-12-16 13:12 | 1.4K | LANCASHIRE v. KILLINGWORTH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1062.1.pdf | 2011-11-01 10:20 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1062.2.html | 2013-12-16 13:12 | 3.3K | LANCASTER v. COUNTY AUDITOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1062.2.pdf | 2011-11-01 10:20 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1062.3.html | 2013-12-16 13:12 | 1.2K | LANCASTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1062.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1062.4.html | 2013-12-16 13:12 | 21K | LANDER et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1062.4.pdf | 2011-11-01 10:20 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1065.1.html | 2013-12-16 13:12 | 1.3K | LANDERS v. The SEA FOWL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1065.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1065.2.html | 2013-12-16 13:12 | 1.2K | LANDRUM (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1065.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1065.3.html | 2013-12-16 13:12 | 21K | In re LANDSBERG. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1065.3.pdf | 2011-11-01 10:20 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1069.1.html | 2013-12-16 13:12 | 4.6K | In re LANE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1069.1.pdf | 2011-11-01 10:20 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1069.2.html | 2013-12-16 13:12 | 7.9K | In re LANE et al., Ex parte DREYFUS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1069.2.pdf | 2011-11-01 10:20 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1070.html | 2013-12-16 13:12 | 15K | In re LANE et al., In re BOYNTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1070.pdf | 2011-11-01 10:20 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1073.html | 2013-12-16 13:12 | 16K | LANE v. The A. DENIKE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1073.pdf | 2011-11-01 10:20 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1075.1.html | 2013-12-16 13:12 | 1.2K | LANE (AMERICAN MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1075.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1075.2.html | 2013-12-16 13:12 | 1.2K | LANE (BASCOM v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1075.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1075.3.html | 2013-12-16 13:12 | 4.0K | LANE v. The BEDFORD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1075.3.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1076.1.html | 2013-12-16 13:12 | 6.8K | LANE et al. v. BELTZHOOVER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1076.1.pdf | 2011-11-01 10:20 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1076.2.html | 2013-12-16 13:12 | 6.0K | LANE v. The BUCK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1076.2.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1077.1.html | 2013-12-16 13:12 | 1.2K | LANE (CARTER v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1077.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1077.2.html | 2013-12-16 13:12 | 1.2K | LANE (CROSBY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1077.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1077.3.html | 2013-12-16 13:12 | 20K | LANE v. DOLICK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1077.3.pdf | 2011-11-01 10:20 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1080.html | 2013-12-16 13:12 | 3.9K | LANE v. DYER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1080.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1081.1.html | 2013-12-16 13:12 | 2.9K | LANE et al. v. GOBBOLD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1081.1.pdf | 2011-11-01 10:20 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1081.2.html | 2013-12-16 13:12 | 1.2K | LANE v. The HENRY BUCK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1081.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1081.3.html | 2013-12-16 13:12 | 1.2K | LANE (HUDGINS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1081.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1081.4.html | 2013-12-16 13:12 | 26K | LANE v. LUDLOW. DORR v. SAME. WILSON v. SAME. HAMILTON v. SAME. REDDY v. SAME. McSORLY v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1081.4.pdf | 2011-11-01 10:20 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1084.html | 2013-12-16 13:12 | 1.2K | LANE (QUACKENBUSH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1084.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1085.html | 2013-12-16 13:12 | 16K | LANE v. RUSSELL. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1085.pdf | 2011-11-01 10:20 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1087.1.html | 2013-12-16 13:12 | 1.2K | LANE (THOMAS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1087.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1087.2.html | 2013-12-16 13:12 | 55K | LANE v. TOWNSEND et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1087.2.pdf | 2011-11-01 10:20 | 127K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1096.1.html | 2013-12-16 13:12 | 1.2K | LANE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1096.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1096.2.html | 2013-12-16 13:12 | 6.6K | In re LANER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1096.2.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1097.1.html | 2013-12-16 13:12 | 3.4K | In re LANG. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1097.1.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1097.2.html | 2013-12-16 13:12 | 13K | LANG v. HOLBROOK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1097.2.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1099.1.html | 2013-12-16 13:12 | 1.2K | LANG (PIERCE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1099.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1099.2.html | 2013-12-16 13:12 | 5.2K | In re LANGDON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1099.2.pdf | 2011-11-01 10:20 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1099.3.html | 2013-12-16 13:12 | 12K | LANGDON v. DE GROOT et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1099.3.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1101.html | 2013-12-16 13:12 | 23K | LANGDON et al. v. GODDARD et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1101.pdf | 2011-11-01 10:20 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1105.html | 2013-12-16 13:12 | 26K | LANGDON et al. v. GODDARD. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1105.pdf | 2011-11-01 10:20 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1109.html | 2013-12-16 13:12 | 13K | LANGDON v. JOY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1109.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1111.html | 2013-12-16 13:12 | 5.8K | The LANGDON CHEVES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1111.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1112.html | 2013-12-16 13:12 | 9.6K | The LANGDON CHEEVES and The CALEDONIAN., Ex parte CAHOONE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1112.pdf | 2011-11-01 10:20 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1113.1.html | 2013-12-16 13:12 | 1.3K | Case of LANGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1113.1.pdf | 2011-11-01 10:20 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1113.2.html | 2013-12-16 13:12 | 1.2K | LANGHAM (VICTOR SEWING MACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1113.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1113.3.html | 2013-12-16 13:12 | 1.2K | LANGHAY v. PERRY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1113.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1113.4.html | 2013-12-16 13:12 | 2.3K | LANGLEY v. BRENT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1113.4.pdf | 2011-11-01 10:20 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1113.5.html | 2013-12-16 13:12 | 8.2K | LANGLEY v. PERRY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1113.5.pdf | 2011-11-01 10:20 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1114.html | 2013-12-16 13:12 | 1.2K | LANGLEY (PERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1114.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1115.html | 2013-12-16 13:12 | 8.2K | LANGLEY v. The SYRACUSE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1115.pdf | 2011-11-01 10:20 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1116.1.html | 2013-12-16 13:12 | 1.2K | LANGPHIER (KIRKPATRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1116.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1116.2.html | 2013-12-16 13:12 | 1.2K | LANGTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1116.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1116.3.html | 2013-12-16 13:12 | 1.2K | LANGTREE (GREENOUGH v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1116.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1116.4.html | 2013-12-16 13:12 | 5.5K | LANHAM v. PATTERSON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1116.4.pdf | 2011-11-01 10:20 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1116.5.html | 2013-12-16 13:12 | 15K | In re LANIER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1116.5.pdf | 2011-11-01 10:20 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1119.1.html | 2013-12-16 13:12 | 4.8K | LANMON et al. v. CLARK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1119.1.pdf | 2011-11-01 10:20 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1119.2.html | 2013-12-16 13:12 | 3.5K | LANNING v. CASE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1119.2.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1120.html | 2013-12-16 13:12 | 21K | LANNING v. DOLPH et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1120.pdf | 2011-11-01 10:20 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1123.html | 2013-12-16 13:12 | 31K | LANNING v. LONDON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1123.pdf | 2011-11-01 10:20 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1128.html | 2013-12-16 13:12 | 7.0K | LANNING v. LONDON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1128.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1129.1.html | 2013-12-16 13:12 | 2.9K | LANNING v. LONDON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1129.1.pdf | 2011-11-01 10:20 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1129.2.html | 2013-12-16 13:12 | 1.2K | LANSDALE (LAUB v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1129.2.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1129.3.html | 2013-12-16 13:12 | 1.2K | LANSING (BAILEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1129.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1129.4.html | 2013-12-16 13:12 | 1.2K | LANSING (COOK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1129.4.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1129.5.html | 2013-12-16 13:12 | 8.2K | LANSING v. MANTON. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1129.5.pdf | 2011-11-01 10:20 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1130.1.html | 2013-12-16 13:12 | 1.2K | LANSING v. MUSCATINE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1130.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1130.2.html | 2013-12-16 13:12 | 1.2K | LANSING (STEWART v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1130.2.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1130.3.html | 2013-12-16 13:12 | 2.3K | LANSTRAAZ v. POWERS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1130.3.pdf | 2011-11-01 10:20 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1130.4.html | 2013-12-16 13:12 | 6.5K | In re LANZ. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1130.4.pdf | 2011-11-01 10:20 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1131.html | 2013-12-16 13:12 | 14K | LANZ v. RANDALL et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1131.pdf | 2011-11-01 10:20 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1133.1.html | 2013-12-16 13:12 | 1.2K | LAPEER COUNTY (LYELL v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1133.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1133.2.html | 2013-12-16 13:12 | 3.5K | LAPEYRE et al. v. GALES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1133.2.pdf | 2011-11-01 10:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1134.1.html | 2013-12-16 13:12 | 5.8K | LAPHAM v. IVES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1134.1.pdf | 2011-11-01 10:20 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1134.2.html | 2013-12-16 13:12 | 1.2K | LAPOURAILLE (CROSBY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1134.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1135.html | 2013-12-16 13:12 | 12K | Ex parte LAPSLEY. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1135.pdf | 2011-11-01 10:20 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1136.1.html | 2013-12-16 13:12 | 1.2K | LAPSLEY (LA VEGA v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1136.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1136.2.html | 2013-12-16 13:12 | 21K | LARABEE v. CORTLAN et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1136.2.pdf | 2011-11-01 10:20 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1139.html | 2013-12-16 13:12 | 20K | The LARCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1139.pdf | 2011-11-01 10:20 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1142.html | 2013-12-16 13:12 | 24K | The LARCH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1142.pdf | 2011-11-01 10:20 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1146.html | 2013-12-16 13:12 | 15K | LARCO v. The MARTHA AND ELIZABETH. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1146.pdf | 2011-11-01 10:20 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1148.1.html | 2013-12-16 13:12 | 1.2K | LAREDO (WATERBURY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1148.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1148.2.html | 2013-12-16 13:12 | 3.8K | L'ARINA v. The EXCHANGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1148.2.pdf | 2011-11-01 10:20 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1149.1.html | 2013-12-16 13:12 | 6.0K | L'ARINA v. MANWARING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1149.1.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1149.2.html | 2013-12-16 13:12 | 6.1K | The LARK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1149.2.pdf | 2011-11-01 10:20 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1150.html | 2013-12-16 13:12 | 30K | LARKIN v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1150.pdf | 2011-11-01 10:20 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1155.1.html | 2013-12-16 13:12 | 1.2K | LARKIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1155.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1155.2.html | 2013-12-16 13:12 | 22K | LARNED et al. v. ADAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1155.2.pdf | 2011-11-01 10:20 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1158.1.html | 2013-12-16 13:12 | 1.2K | LARNED (DENNISON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1158.1.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1158.2.html | 2013-12-16 13:12 | 1.2K | LARNED (LOWELL MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1158.2.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1158.3.html | 2013-12-16 13:12 | 1.2K | LARNED (SARGENT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1158.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1158.4.html | 2013-12-16 13:12 | 1.2K | LARNED (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1158.4.pdf | 2011-11-01 10:20 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1158.5.html | 2013-12-16 13:12 | 8.8K | Ex parte LAROWE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1158.5.pdf | 2011-11-01 10:20 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1160.1.html | 2013-12-16 13:12 | 1.4K | LARRA v. The HENRY BUCK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1160.1.pdf | 2011-11-01 10:20 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1160.2.html | 2013-12-16 13:12 | 4.4K | LARRABEE et al. v. The PIEDMONT. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1160.2.pdf | 2011-11-01 10:20 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1160.3.html | 2013-12-16 13:12 | 1.2K | LARRIMORE (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1160.3.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1160.4.html | 2013-12-16 13:12 | 8.0K | LARRIVIERE v. MADEGAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1160.4.pdf | 2011-11-01 10:20 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1161.1.html | 2013-12-16 13:12 | 1.2K | LARSEN (SINGER MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1161.1.pdf | 2011-11-01 10:20 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1161.2.html | 2013-12-16 13:12 | 1.2K | LARUE (MINTURN v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1161.2.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1161.3.html | 2013-12-16 13:12 | 1.2K | LASELLE (PARKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1161.3.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1161.4.html | 2013-12-16 13:12 | 11K | LASH v. HARDICK et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1161.4.pdf | 2011-11-01 10:21 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1163.html | 2013-12-16 13:12 | 6.1K | In re LASKI. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1163.pdf | 2011-11-01 10:21 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1164.1.html | 2013-12-16 13:12 | 1.2K | LASKY (WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1164.1.pdf | 2011-11-01 10:21 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1164.2.html | 2013-12-16 13:12 | 3.8K | LA SOCIETE ANONYME DES MINES v. BAXTER et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1164.2.pdf | 2011-11-01 10:21 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1164.3.html | 2013-12-16 13:12 | 1.2K | LA SOCIETE DE CREDIT MOBILIER (CASEY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1164.3.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1164.4.html | 2013-12-16 13:12 | 1.2K | LASSALLE (SIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1164.4.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1164.5.html | 2013-12-16 13:12 | 18K | LASTRAPES et al. v. BLANC et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1164.5.pdf | 2011-11-01 10:21 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1167.html | 2013-12-16 13:12 | 14K | LATAPEE v. PECHOLIER. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1167.pdf | 2011-11-01 10:21 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1169.html | 2013-12-16 13:12 | 8.2K | LATHAM et al. v. BARNEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1169.pdf | 2011-11-01 10:21 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1170.html | 2013-12-16 13:12 | 18K | In re LATHROP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1170.pdf | 2011-11-01 10:21 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1173.html | 2013-12-16 13:12 | 9.8K | In re LATHROP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1173.pdf | 2011-11-01 10:21 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1175.1.html | 2013-12-16 13:12 | 2.4K | In re LATHROP et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1175.1.pdf | 2011-11-01 10:21 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1175.2.html | 2013-12-16 13:12 | 19K | In re LATHROP et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1175.2.pdf | 2011-11-01 10:21 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1178.1.html | 2013-12-16 13:12 | 1.2K | In re LATHROP. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1178.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1178.2.html | 2013-12-16 13:12 | 5.5K | LATHROP v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1178.2.pdf | 2011-11-01 10:21 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1178.3.html | 2013-12-16 13:12 | 1.2K | LATHROP (CRAFT v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1178.3.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1178.4.html | 2013-12-16 13:12 | 5.1K | LATHROP v. DRAKE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1178.4.pdf | 2011-11-01 10:21 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1179.html | 2013-12-16 13:12 | 24K | LATHROP et al. v. JUNCTION R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1179.pdf | 2011-11-01 10:21 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1183.html | 2013-12-16 13:12 | 16K | LATHROP v. NELSON et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1183.pdf | 2011-11-01 10:21 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1185.1.html | 2013-12-16 13:12 | 1.2K | LATHROP v. STEADMAN. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1185.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1185.2.html | 2013-12-16 13:12 | 4.7K | LATHROP v. STEWART. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1185.2.pdf | 2011-11-01 10:21 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1185.3.html | 2013-12-16 13:12 | 7.7K | LATHROP v. STUART. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1185.3.pdf | 2011-11-01 10:21 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1186.1.html | 2013-12-16 13:12 | 1.2K | LATHROP (VOGLE v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1186.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1186.2.html | 2013-12-16 13:12 | 1.2K | LATHY (BAYARD v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1186.2.pdf | 2011-11-01 10:21 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1186.3.html | 2013-12-16 13:12 | 4.9K | LATIMER v. MOORE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1186.3.pdf | 2011-11-01 10:21 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1187.1.html | 2013-12-16 13:12 | 1.2K | LATORRE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1187.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1187.2.html | 2013-12-16 13:12 | 6.1K | LATSON v. STURM. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1187.2.pdf | 2011-11-01 10:21 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1188.1.html | 2013-12-16 13:12 | 1.2K | LATTA v. The HERMITAGE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1188.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1188.2.html | 2013-12-16 13:12 | 19K | LATTA v. SHAWK. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1188.2.pdf | 2011-11-01 10:21 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1191.1.html | 2013-12-16 13:12 | 1.3K | LATTIMER v. SMYTHE. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1191.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1191.2.html | 2013-12-16 13:12 | 5.5K | LAUB v. LANSDALE et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1191.2.pdf | 2011-11-01 10:21 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1191.3.html | 2013-12-16 13:12 | 1.2K | LAUB (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1191.3.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.1.html | 2013-12-16 13:12 | 1.4K | LAUDERBACH v. The J. M. B. KEHLOR. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.1.pdf | 2011-11-01 10:21 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.2.html | 2013-12-16 13:12 | 1.2K | LAUDERBRUN (COWQUA v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.2.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.3.html | 2013-12-16 13:12 | 1.2K | LAUER (RUMFORD CHEMICAL WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.3.pdf | 2011-11-01 10:21 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.4.html | 2013-12-16 13:12 | 1.2K | LAUGHLIN (PECK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.4.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.5.html | 2013-12-16 13:12 | 1.2K | LAUMAN (TROY CITY BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.5.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.6.html | 2013-12-16 13:12 | 1.2K | LAURA, The (NEILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.6.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.7.html | 2013-12-16 13:12 | 1.3K | The LAURA RUSS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.7.pdf | 2011-11-01 10:21 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.8.html | 2013-12-16 13:12 | 1.2K | LAUREL. The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.8.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1192.9.html | 2013-12-16 13:12 | 7.9K | The LAURENS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1192.9.pdf | 2011-11-01 10:21 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1193.html | 2013-12-16 13:12 | 24K | The LAURENS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1193.pdf | 2011-11-01 10:21 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1197.1.html | 2013-12-16 13:12 | 1.2K | LAUTH (SAVARY v.). |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1197.1.pdf | 2011-11-01 10:21 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1197.2.html | 2013-12-16 13:12 | 1.2K | LAVEAGA v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1197.2.pdf | 2011-11-01 10:21 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1197.3.html | 2013-12-16 13:12 | 11K | LA VEGA v. LAPSLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1197.3.pdf | 2011-11-01 10:21 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.1198.html | 2013-12-16 13:12 | 3.4K | LAVERTY et al. v. SNELLING. |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.1198.pdf | 2011-11-01 10:21 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.back.html | 2013-12-16 13:12 | 295K | Federal Cases, Volume 14 |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.back.pdf | 2011-10-31 12:49 | 397K | |
![[Text]](/html/icons/compressed.gif) | 0014.f.cas.front.html | 2013-12-16 13:12 | 2.9K | Federal Cases, Volume 14 |
![[ ]](/html/icons/compressed.gif) | 0014.f.cas.front.pdf | 2011-10-31 12:49 | 43K | |
|