![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.000b_01.jpg | 2011-07-23 13:24 | 3.7K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0001.html | 2013-12-16 13:14 | 7.6K | In re PROBY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0001.pdf | 2011-11-01 10:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0002.html | 2013-12-16 13:14 | 10K | PROCEEDS OF PRIZES OF WAR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0002.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0003.html | 2013-12-16 13:14 | 4.3K | PROCTOR v. McBRIDE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0003.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0004.html | 2013-12-16 13:14 | 6.3K | The PROMETHEUS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0004.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.1.html | 2013-12-16 13:14 | 1.4K | PROMETHEUS, The (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.1.pdf | 2011-11-01 10:44 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.2.html | 2013-12-16 13:14 | 1.2K | PROPRIETORS OF ORE BED (LIVINGSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.3.html | 2013-12-16 13:14 | 5.1K | The PROSPECT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.3.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.4.html | 2013-12-16 13:14 | 1.2K | PROSPECT, The (PERKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.5.html | 2013-12-16 13:14 | 1.2K | PROSPERITY, The (KELLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.5.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.6.html | 2013-12-16 13:14 | 1.2K | PROTECTION INS. CO. (BULKLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.6.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.7.html | 2013-12-16 13:14 | 1.2K | PROTECTION INS. CO. (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.7.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.8.html | 2013-12-16 13:14 | 1.2K | PROTECTION INS. CO. (CLARKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.8.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0005.9.html | 2013-12-16 13:14 | 1.3K | PROTECTION INS. CO. (NEW YORK STATE MARINE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0005.9.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0006.html | 2013-12-16 13:14 | 26K | In re PROTECTION LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0006.pdf | 2011-11-01 10:44 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0009.1.html | 2013-12-16 13:14 | 1.2K | PROUD (CRISP v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0009.1.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0009.2.html | 2013-12-16 13:14 | 8.5K | PROUT et al. v. GIBSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0009.2.pdf | 2011-11-01 10:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0011.1.html | 2013-12-16 13:14 | 1.2K | PROUT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0011.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0011.2.html | 2013-12-16 13:14 | 14K | PROUTY et al. v. DRAPER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0011.2.pdf | 2011-11-01 10:44 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0013.html | 2013-12-16 13:14 | 10K | PROUTY et al. v. DRAPER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0013.pdf | 2011-11-01 10:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0014.1.html | 2013-12-16 13:14 | 1.3K | PROUTY v. RUGGLES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0014.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0014.2.html | 2013-12-16 13:14 | 7.0K | The PROVIDENCE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0014.2.pdf | 2011-11-01 10:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0015.html | 2013-12-16 13:14 | 3.8K | PROVIDENCE v. MANCHESTER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0015.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0016.1.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE (WIGHTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0016.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0016.2.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE, ETC., R. R. CO. (HIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0016.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0016.3.html | 2013-12-16 13:14 | 27K | In re PROVIDENCE & N. Y. STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0016.3.pdf | 2011-11-01 10:44 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0020.1.html | 2013-12-16 13:14 | 4.6K | In re PROVIDENCE & N. Y. STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0020.1.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0020.2.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE & W. R. CO. (PIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0020.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0020.3.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE AQUEDUCT CO. (DEXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0020.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0020.4.html | 2013-12-16 13:14 | 12K | PROVIDENCE COUNTY SAV. BANK et al. v. FROST. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0020.4.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0022.html | 2013-12-16 13:14 | 4.8K | PROVIDENCE COUNTY SAV. BANK et al. v. FROST et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0022.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.1.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE RUBBER CO. (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.2.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE TOOL CO. (HENRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.3.html | 2013-12-16 13:14 | 1.3K | PROVIDENCE TOOL CO. (METROPOLITAN WASHING MACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.4.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE WASHINGTON INS. CO. (BREED v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.4.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.5.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE WASHINGTON INS. CO. (HUCHBERGER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.5.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.6.html | 2013-12-16 13:14 | 1.2K | PROVIDENCE WASHINGTON INS. CO. (POTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.6.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0023.7.html | 2013-12-16 13:14 | 10K | PROVOST v. The SELKIRK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0023.7.pdf | 2011-11-01 10:44 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0024.html | 2013-12-16 13:14 | 25K | PRUSEUX et al. v. WELCH et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0024.pdf | 2011-11-01 10:44 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0028.1.html | 2013-12-16 13:14 | 1.2K | PRUSSING [UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0028.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0028.2.html | 2013-12-16 13:14 | 6.7K | In re PRYOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0028.2.pdf | 2011-11-01 10:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0029.html | 2013-12-16 13:14 | 14K | PRYOR v. DUNKLE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0029.pdf | 2011-11-01 10:44 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0031.1.html | 2013-12-16 13:14 | 1.2K | PRYOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0031.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0031.2.html | 2013-12-16 13:14 | 4.1K | In re PUFFER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0031.2.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0031.3.html | 2013-12-16 13:14 | 1.2K | PUFFER (BLAISDELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0031.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.1.html | 2013-12-16 13:14 | 5.3K | PUGH et al. v. DURFEE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.1.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.2.html | 2013-12-16 13:14 | 1.2K | PUGSLEY (STERRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.3.html | 2013-12-16 13:14 | 1.2K | PUIG (SLEEPER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.4.html | 2013-12-16 13:14 | 1.2K | PULASKI COUNTY (KINSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.5.html | 2013-12-16 13:14 | 1.2K | PULASKI COUNTY (SHIRK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.5.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.6.html | 2013-12-16 13:14 | 1.2K | PULASKI COUNTY (WHITWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.6.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0032.7.html | 2013-12-16 13:14 | 36K | PULLAN v. CINCINNATI & C. AIR-LINE R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0032.7.pdf | 2011-11-01 10:44 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0038.html | 2013-12-16 13:14 | 38K | PULLAN v. CINCINNATI & C. AIR-LINE R., CO. et al |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0038.pdf | 2011-11-01 10:44 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0044.html | 2013-12-16 13:14 | 43K | PULLAN v. KINSINGER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0044.pdf | 2011-11-01 10:44 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0050.1.html | 2013-12-16 13:14 | 1.5K | PULLIAM v. PULLIAM. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0050.1.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0050.2.html | 2013-12-16 13:14 | 1.3K | PULLING v. TUCKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0050.2.pdf | 2011-11-01 10:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0051.html | 2013-12-16 13:14 | 19K | PULTE v. DERBY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0051.pdf | 2011-11-01 10:44 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0053.html | 2013-12-16 13:14 | 1.2K | PULTZ & WALKLEY CO. (UNION PAPER BAG MACHINE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0053.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0054.html | 2013-12-16 13:14 | 24K | In re PULVER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0054.pdf | 2011-11-01 10:44 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0057.html | 2013-12-16 13:14 | 8.0K | In re PULVER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0057.pdf | 2011-11-01 10:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0058.1.html | 2013-12-16 13:14 | 1.2K | PUMPHREY (REBECCA v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0058.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0058.2.html | 2013-12-16 13:14 | 1.2K | PUMPHREYS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0058.2.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0059.1.html | 2013-12-16 13:14 | 3.1K | In re PUPKE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0059.1.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0059.2.html | 2013-12-16 13:14 | 13K | In re PURCELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0059.2.pdf | 2011-11-01 10:44 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0061.html | 2013-12-16 13:14 | 19K | In re PURCELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0061.pdf | 2011-11-01 10:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0064.1.html | 2013-12-16 13:14 | 6.6K | PURCELL v. LINCOLN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0064.1.pdf | 2011-11-01 10:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0064.2.html | 2013-12-16 13:14 | 1.2K | PURCELL (SCHNERTZEL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0064.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0065.1.html | 2013-12-16 13:14 | 1.2K | PURDY (ATKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0065.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0065.2.html | 2013-12-16 13:14 | 1.2K | PURDY (MEAD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0065.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0065.3.html | 2013-12-16 13:14 | 1.2K | PURDY (SWOPE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0065.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0065.4.html | 2013-12-16 13:14 | 13K | PURINTON v. HULL OF A NEW SHIP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0065.4.pdf | 2011-11-01 10:44 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0067.html | 2013-12-16 13:14 | 20K | PURINTON v. HULL OF A NEW SHIP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0067.pdf | 2011-11-01 10:45 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0070.html | 2013-12-16 13:14 | 20K | The PURITAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0070.pdf | 2011-11-01 10:45 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0073.1.html | 2013-12-16 13:14 | 1.2K | PURNELL (KENNEDY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0073.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0073.2.html | 2013-12-16 13:14 | 11K | PURVIANCE v. UNION NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0073.2.pdf | 2011-11-01 10:45 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0074.html | 2013-12-16 13:14 | 6.8K | In re PURVIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0074.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0075.html | 2013-12-16 13:14 | 7.7K | In re PUSEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0075.pdf | 2011-11-01 10:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0076.html | 2013-12-16 13:14 | 5.5K | In re PUSEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0076.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0077.1.html | 2013-12-16 13:14 | 1.2K | PUSEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0077.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0077.2.html | 2013-12-16 13:14 | 1.2K | PUTNAM (BARING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0077.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0077.3.html | 2013-12-16 13:14 | 1.4K | PUTNAM v. HAMMER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0077.3.pdf | 2011-11-01 10:45 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0077.4.html | 2013-12-16 13:14 | 14K | PUTNAM v. HICKEY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0077.4.pdf | 2011-11-01 10:45 | 73K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0077_01.jpg | 2011-07-23 13:25 | 19K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0079.html | 2013-12-16 13:14 | 49K | PUTNAM et al. v. NEW ALBANY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0079.pdf | 2011-11-01 10:45 | 117K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0087.html | 2013-12-16 13:14 | 7.5K | PUTNAM v. The POLLY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0087.pdf | 2011-11-01 10:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0088.html | 2013-12-16 13:14 | 9.7K | PUTNAM v. SUDHOFF et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0088.pdf | 2011-11-01 10:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0090.1.html | 2013-12-16 13:14 | 5.1K | PUTNAM et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0090.1.pdf | 2011-11-01 10:45 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0090.2.html | 2013-12-16 13:14 | 13K | PUTNAM v. WEATHERBEE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0090.2.pdf | 2011-11-01 10:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0092.html | 2013-12-16 13:14 | 18K | PUTNAM v. YERRINGTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0092.pdf | 2011-11-01 10:45 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.1.html | 2013-12-16 13:14 | 1.2K | PUTNAM (YERRINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.2.html | 2013-12-16 13:14 | 1.2K | PUTNAM COUNTY (BURLINGTON & S. W. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.3.html | 2013-12-16 13:14 | 1.2K | PUTNAM COUNTY (NUGENT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.4.html | 2013-12-16 13:14 | 1.2K | PUTNEY v. The CELESTINE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.5.html | 2013-12-16 13:14 | 1.2K | PUTTMAN (BLANCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.5.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0095.6.html | 2013-12-16 13:14 | 25K | PYE et al. v. JENKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0095.6.pdf | 2011-11-01 10:45 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0099.1.html | 2013-12-16 13:14 | 1.2K | PYE (REEVES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0099.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0099.2.html | 2013-12-16 13:14 | 8.6K | PYE v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0099.2.pdf | 2011-11-01 10:45 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0100.1.html | 2013-12-16 13:14 | 1.2K | PYFER (CALDER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0100.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0100.2.html | 2013-12-16 13:14 | 1.2K | PYLE (DUNLAP v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0100.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0101.html | 2013-12-16 13:14 | 19K | Ex parte QUACKENBOSS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0101.pdf | 2011-11-01 10:45 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0104.html | 2013-12-16 13:14 | 7.7K | In re QUACKENBOSS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0104.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0105.1.html | 2013-12-16 13:14 | 3.2K | QUACKENBUSH v. LANE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0105.1.pdf | 2011-11-01 10:45 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0105.2.html | 2013-12-16 13:14 | 3.2K | QUANDO v. CLAGETT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0105.2.pdf | 2011-11-01 10:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0105.3.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF COTTON (CLIFTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0105.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0105.4.html | 2013-12-16 13:14 | 10K | QUANTITY OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0105.4.pdf | 2011-11-01 10:45 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0107.html | 2013-12-16 13:14 | 55K | QUANTITY OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0107.pdf | 2011-11-01 10:45 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0116.html | 2013-12-16 13:14 | 27K | QUANTITY OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0116.pdf | 2011-11-01 10:45 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0120.1.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF DISTILLED SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0120.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0120.2.html | 2013-12-16 13:14 | 1.3K | QUANTITY OF DISTILLED SPIRITS AT NO. 133 MOTT ST. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0120.2.pdf | 2011-11-01 10:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0120.3.html | 2013-12-16 13:14 | 3.6K | QUANTITY OF IRON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0120.3.pdf | 2011-11-01 10:45 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0121.1.html | 2013-12-16 13:14 | 1.3K | QUANTITY OF MANUFACTURED TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0121.1.pdf | 2011-11-01 10:45 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0121.2.html | 2013-12-16 13:14 | 1.3K | QUANTITY OF MANUFACTURED TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0121.2.pdf | 2011-11-01 10:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0121.3.html | 2013-12-16 13:14 | 6.7K | QUANTITY OF MANUFACTURED TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0121.3.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0122.1.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF MANUFACTURED TOBACCO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0122.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0122.2.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF RAGS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0122.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0122.3.html | 2013-12-16 13:14 | 15K | QUANTITY OF TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0122.3.pdf | 2011-11-01 10:45 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.1.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF TOBACCO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.2.html | 2013-12-16 13:14 | 1.2K | QUANTITY OF WEARING APPAREL (CURTIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.3.html | 2013-12-16 13:14 | 1.2K | QUARLES, PETITION OF. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.4.html | 2013-12-16 13:14 | 1.2K | QUANTRILL (SANGSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.5.html | 2013-12-16 13:14 | 1.2K | QUARLES (MORANCY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.5.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0124.6.html | 2013-12-16 13:14 | 14K | The QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0124.6.pdf | 2011-11-01 10:45 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0126.html | 2013-12-16 13:14 | 23K | The QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0126.pdf | 2011-11-01 10:45 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.1.html | 2013-12-16 13:14 | 1.2K | QUEEN (BOONE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.2.html | 2013-12-16 13:14 | 1.2K | QUEEN (DENNY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.2.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.3.html | 2013-12-16 13:14 | 3.1K | QUEEN et al. v. HEPBURN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.3.pdf | 2011-11-01 10:45 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.4.html | 2013-12-16 13:14 | 1.2K | QUEEN (McSHERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.5.html | 2013-12-16 13:14 | 3.2K | QUEEN v. NEALE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.5.pdf | 2011-11-01 10:45 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0130.6.html | 2013-12-16 13:14 | 1.2K | QUEEN (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0130.6.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0131.html | 2013-12-16 13:14 | 12K | QUEEN et al. v. UNION INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0131.pdf | 2011-11-01 10:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0132.1.html | 2013-12-16 13:14 | 1.2K | QUEEN, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0132.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0132.2.html | 2013-12-16 13:14 | 1.2K | QUEEN (WEIGHTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0132.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0132.3.html | 2013-12-16 13:14 | 8.1K | The QUEEN OF THE EAST., The CALYPSO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0132.3.pdf | 2011-11-01 10:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.1.html | 2013-12-16 13:14 | 6.0K | The QUEENS COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.1.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.2.html | 2013-12-16 13:14 | 1.2K | QUEEN VICTORIA, The (PENNSYLVANIA COAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.3.html | 2013-12-16 13:14 | 1.2K | QUERRY (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.4.html | 2013-12-16 13:14 | 1.2K | QUICK v. CLINTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.4.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.5.html | 2013-12-16 13:14 | 1.2K | QUICK (OVERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.5.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0134.6.html | 2013-12-16 13:14 | 11K | QUICKSILVER MIN. CO. v. HICKS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0134.6.pdf | 2011-11-01 10:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0136.html | 2013-12-16 13:14 | 15K | The QUICKSTEP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0136.pdf | 2011-11-01 10:45 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0138.html | 2013-12-16 13:14 | 19K | QUIGLEY v. CENTRAL PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0138.pdf | 2011-11-01 10:45 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0141.html | 2013-12-16 13:14 | 5.6K | QUIGLEY v. MUTUAL LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0141.pdf | 2011-11-01 10:45 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0142.1.html | 2013-12-16 13:14 | 3.7K | QUIMBY et al. v. The EUPHEMIA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0142.1.pdf | 2011-11-01 10:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0142.2.html | 2013-12-16 13:14 | 1.2K | QUIMBY (ST. LOUIS STAMPING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0142.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0142.3.html | 2013-12-16 13:14 | 1.3K | QUINEBANG BANK v. JEROLOMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0142.3.pdf | 2011-11-01 10:45 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0142.4.html | 2013-12-16 13:14 | 3.9K | In re QUINIKE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0142.4.pdf | 2011-11-01 10:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0143.1.html | 2013-12-16 13:14 | 1.2K | QUINLAN (FRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0143.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0143.2.html | 2013-12-16 13:14 | 1.3K | In re QUINN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0143.2.pdf | 2011-11-01 10:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0143.3.html | 2013-12-16 13:14 | 7.2K | QUINN v. The TRANSPORT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0143.3.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0144.1.html | 2013-12-16 13:14 | 1.2K | QUINN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0144.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0144.2.html | 2013-12-16 13:14 | 1.2K | QUINTABD (HEATON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0144.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0144.3.html | 2013-12-16 13:14 | 1.2K | QUINTABD (WEBB v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0144.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0144.4.html | 2013-12-16 13:14 | 15K | The QUINTERO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0144.4.pdf | 2011-11-01 10:45 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0146.html | 2013-12-16 13:14 | 9.0K | QUIRK v. CLINTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0146.pdf | 2011-11-01 10:45 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0147.html | 2013-12-16 13:14 | 1.2K | QUITMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0147.pdf | 2011-11-01 10:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0148.html | 2013-12-16 13:14 | 29K | RABAUD et al. v. D'WOLF. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0148.pdf | 2011-11-01 10:45 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0152.1.html | 2013-12-16 13:14 | 1.4K | RACE v. NINE THOUSAND SIX HUNDRED AND EIGHTY-ONE DRY OX HIDES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0152.1.pdf | 2011-11-01 10:45 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0152.2.html | 2013-12-16 13:14 | 1.2K | RACINE (BECKWITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0152.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0152.3.html | 2013-12-16 13:14 | 1.2K | RACINE (LULING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0152.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0152.4.html | 2013-12-16 13:14 | 1.2K | RACINE (SEELING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0152.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0152.5.html | 2013-12-16 13:14 | 5.6K | The RADAMA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0152.5.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0153.1.html | 2013-12-16 13:14 | 1.2K | RADAMA, The (CROWEL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0153.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0153.2.html | 2013-12-16 13:14 | 1.2K | RADCLIFFE (LEATHERBERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0153.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0153.3.html | 2013-12-16 13:14 | 2.9K | In re RADO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0153.3.pdf | 2011-11-01 10:45 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0153.4.html | 2013-12-16 13:14 | 1.2K | RADOWITZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0153.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0154.html | 2013-12-16 13:14 | 68K | In re RADWAY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0154.pdf | 2011-11-01 10:45 | 153K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0165.1.html | 2013-12-16 13:14 | 1.2K | RAE (MATTHEW v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0165.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0165.2.html | 2013-12-16 13:14 | 3.0K | RAE et al. v. The NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0165.2.pdf | 2011-11-01 10:45 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0165.3.html | 2013-12-16 13:14 | 1.2K | RAFAEL ARROYO, The (WIENER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0165.3.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0165.4.html | 2013-12-16 13:14 | 9.1K | In re RAFFAUF. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0165.4.pdf | 2011-11-01 10:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0166.html | 2013-12-16 13:14 | 20K | RAFFERTY v. MALLORY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0166.pdf | 2011-11-01 10:45 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0169.html | 2013-12-16 13:14 | 12K | RAFT OF CYPRESS LOGS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0169.pdf | 2011-11-01 10:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0171.html | 2013-12-16 13:14 | 14K | RAFT OF SPARS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0171.pdf | 2011-11-01 10:45 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0173.html | 2013-12-16 13:14 | 12K | RAFT OF SPARS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0173.pdf | 2011-11-01 10:45 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0175.html | 2013-12-16 13:14 | 6.1K | In re RAGSDALE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0175.pdf | 2011-11-01 10:45 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0176.1.html | 2013-12-16 13:14 | 1.2K | RAGSDALE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0176.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0176.2.html | 2013-12-16 13:14 | 20K | RAHILLY v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0176.2.pdf | 2011-11-01 10:45 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0179.html | 2013-12-16 13:14 | 24K | RAHILLY v. “WILSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0179.pdf | 2011-11-01 10:45 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.1.html | 2013-12-16 13:14 | 1.2K | RAHMER (MALLORY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.2.html | 2013-12-16 13:14 | 1.2K | RAILROAD BRIDGE CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.3.html | 2013-12-16 13:14 | 1.2K | RAILROAD COM'RS (BONDHOLDERS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.3.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.4.html | 2013-12-16 13:14 | 1.3K | Ex parte RAILROAD CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.4.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.5.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.5.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.6.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (COWDREY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.6.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.7.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.7.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.8.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (FALLON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.8.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.9.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (McDONNELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.9.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0182.10.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (MORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0182.10.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0183.html | 2013-12-16 13:14 | 14K | RAILROAD CO. v. NEAL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0183.pdf | 2011-11-01 10:45 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.1.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO. (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.2.html | 2013-12-16 13:14 | 1.2K | RAILROAD CO (WILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.3.html | 2013-12-16 13:14 | 1.2K | RAILROADS, The (STIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.3.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.4.html | 2013-12-16 13:14 | 1.2K | RAILROADS, The (WILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.5.html | 2013-12-16 13:14 | 1.2K | RAILWAY CO. (BEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.5.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.6.html | 2013-12-16 13:14 | 1.2K | RAILWAY PASS. ASSUR. CO. (RIPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.6.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.7.html | 2013-12-16 13:14 | 1.2K | RAILWAY PASS. ASSUR. CO. (SAWTELLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.7.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.8.html | 2013-12-16 13:14 | 1.2K | RAILWAY PASS. ASSUR. CO. (SOUTHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.8.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.9.html | 2013-12-16 13:14 | 1.2K | RAILWAY PASS. ASSUR. CO. (TOOLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.9.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0185.10.html | 2013-12-16 13:14 | 12K | RAILWAY REGISTER MANUF'G CO. v. HIGHLAND ST. RY. CO. et al. PASSENGER PARE ENUMERATOR. & CLASSIFIER CO. v. METROPOLITAN R. CO. RAILWAY REGISTER MANUF'G CO. v. HIGHLAND ST. RY. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0185.10.pdf | 2011-11-01 10:45 | 102K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0186_01.jpg | 2011-07-23 13:24 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0187.1.html | 2013-12-16 13:14 | 1.2K | RAINBOW, The (ACKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0187.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0187.2.html | 2013-12-16 13:14 | 1.2K | RAINBOW, The (BULGIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0187.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0187.3.html | 2013-12-16 13:14 | 1.2K | RAINBOW, The (TREAT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0187.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0187.4.html | 2013-12-16 13:14 | 10K | RAINER v. HAYNES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0187.4.pdf | 2011-11-01 10:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0188.html | 2013-12-16 13:14 | 27K | In re RAINSFORD |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0188.pdf | 2011-11-01 10:45 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0193.html | 2013-12-16 13:14 | 14K | The RAJAH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0193.pdf | 2011-11-01 10:45 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0195.html | 2013-12-16 13:14 | 36K | The RALEIGH et al., SUNDRY MATERIAL-MEN OF NORFOLK AND PORTSMOUTH v. PIONEER TRANSP CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0195.pdf | 2011-11-01 10:45 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0200.html | 2013-12-16 13:14 | 1.2K | RALPH POST, The (WARNER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0200.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0201.html | 2013-12-16 13:14 | 59K | RALSTON et al. v. The STATE RIGHTS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0201.pdf | 2011-11-01 10:45 | 138K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0210.html | 2013-12-16 13:14 | 3.1K | The RAMBLER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0210.pdf | 2011-11-01 10:45 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0211.1.html | 2013-12-16 13:14 | 3.0K | RAMBLER v. CHOAT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0211.1.pdf | 2011-11-01 10:45 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0211.2.html | 2013-12-16 13:14 | 1.2K | RAMBLER, The (TEASDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0211.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0211.3.html | 2013-12-16 13:14 | 10K | RAMDULOLLDAY v. DARIEUX. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0211.3.pdf | 2011-11-01 10:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0212.1.html | 2013-12-16 13:14 | 1.2K | RAMSAY (DIXON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0212.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0212.2.html | 2013-12-16 13:14 | 1.2K | RAMSAY (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0212.2.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0212.3.html | 2013-12-16 13:14 | 1.2K | RAMSAY (McKNIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0212.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0212.4.html | 2013-12-16 13:14 | 3.0K | RAMSAY v. RIDDLE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0212.4.pdf | 2011-11-01 10:45 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0213.1.html | 2013-12-16 13:14 | 1.2K | RAMSAY (TRAVERS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0213.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0213.2.html | 2013-12-16 13:14 | 1.2K | RAMSAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0213.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0213.3.html | 2013-12-16 13:14 | 2.3K | RAMSAY v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0213.3.pdf | 2011-11-01 10:45 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0213.4.html | 2013-12-16 13:14 | 1.2K | RAMSDELL (COX v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0213.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0213.5.html | 2013-12-16 13:14 | 9.8K | RAMSEY et al. v. HERNDON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0213.5.pdf | 2011-11-01 10:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0214.html | 2013-12-16 13:14 | 18K | RAMSEY v. JAILER OF WARREN COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0214.pdf | 2011-11-01 10:45 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0217.1.html | 2013-12-16 13:14 | 1.2K | RAND (ATLANTIC GIANT POWDER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0217.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0217.2.html | 2013-12-16 13:14 | 23K | RAND v. The HERCULES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0217.2.pdf | 2011-11-01 10:45 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0221.1.html | 2013-12-16 13:14 | 1.2K | RAND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0221.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0221.2.html | 2013-12-16 13:14 | 1.3K | RAND v. WINSLOW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0221.2.pdf | 2011-11-01 10:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0221.3.html | 2013-12-16 13:14 | 7.4K | Ex parte RANDALL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0221.3.pdf | 2011-11-01 10:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0222.html | 2013-12-16 13:14 | 23K | In re RANDALL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0222.pdf | 2011-11-01 10:45 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0226.html | 2013-12-16 13:14 | 17K | In re RANDALL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0226.pdf | 2011-11-01 10:45 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0228.1.html | 2013-12-16 13:14 | 1.2K | RANDALL (AUDENREID v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0228.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0228.2.html | 2013-12-16 13:14 | 36K | RANDALL v. JAQUES et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0228.2.pdf | 2011-11-01 10:45 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0234.html | 2013-12-16 13:14 | 10K | RANDALL v. KREIGEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0234.pdf | 2011-11-01 10:45 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0235.1.html | 2013-12-16 13:14 | 1.2K | RANDALL (LANZ v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0235.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0235.2.html | 2013-12-16 13:14 | 27K | RANDALL v. PHILLIPS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0235.2.pdf | 2011-11-01 10:45 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0240.html | 2013-12-16 13:14 | 7.7K | RANDALL et al. v. RHODBS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0240.pdf | 2011-11-01 10:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0241.1.html | 2013-12-16 13:14 | 1.2K | RANDALL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0241.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0241.2.html | 2013-12-16 13:14 | 1.2K | RANDALL (WEST v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0241.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0241.3.html | 2013-12-16 13:14 | 5.5K | RANDALL v. The ZEBRA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0241.3.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0242.html | 2013-12-16 13:14 | 95K | Ex parte RANDOLPH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0242.pdf | 2011-11-01 10:45 | 202K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0257.html | 2013-12-16 13:14 | 18K | RANDOLPH et al. v. CANBY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0257.pdf | 2011-11-01 10:45 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0260.1.html | 2013-12-16 13:14 | 1.2K | RANDOLPH (HOPKIRK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0260.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0260.2.html | 2013-12-16 13:14 | 15K | RANDOLPH v. KING. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0260.2.pdf | 2011-11-01 10:45 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0262.1.html | 2013-12-16 13:14 | 1.2K | RANDOLPH, The (PATTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0262.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0262.2.html | 2013-12-16 13:14 | 1.2K | RANDOLPH (RICHARDS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0262.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0262.3.html | 2013-12-16 13:14 | 5.0K | RANDOLPH v. ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0262.3.pdf | 2011-11-01 10:45 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0263.1.html | 2013-12-16 13:14 | 1.2K | RANDOLPH (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0263.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0263.2.html | 2013-12-16 13:14 | 9.2K | RANDOLPH v. The UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0263.2.pdf | 2011-11-01 10:45 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0264.1.html | 2013-12-16 13:14 | 1.2K | RANDOLPH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0264.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0264.2.html | 2013-12-16 13:14 | 29K | RANDOLPH v. WILMINGTON & R. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0264.2.pdf | 2011-11-01 10:45 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0268.1.html | 2013-12-16 13:14 | 1.2K | RANDON (TOBY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0268.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0268.2.html | 2013-12-16 13:14 | 1.2K | RANGELEY (BURNHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0268.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0268.3.html | 2013-12-16 13:14 | 1.2K | RANGELEY (SHAPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0268.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0268.4.html | 2013-12-16 13:14 | 1.2K | RANGELY (DURHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0268.4.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0269.1.html | 2013-12-16 13:14 | 1.2K | RANGELY (SHEPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0269.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0269.2.html | 2013-12-16 13:14 | 1.2K | RANGER. The (DRYSDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0269.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0269.3.html | 2013-12-16 13:14 | 18K | RANGER v. NEW ORLEANS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0269.3.pdf | 2011-11-01 10:45 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0271.1.html | 2013-12-16 13:14 | 1.2K | RANGER v. NEW ORLEANS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0271.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0271.2.html | 2013-12-16 13:14 | 11K | The RANIER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0271.2.pdf | 2011-11-01 10:45 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0273.html | 2013-12-16 13:14 | 8.5K | Ex parte RANK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0273.pdf | 2011-11-01 10:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0274.1.html | 2013-12-16 13:14 | 1.2K | RANKIN v. BEARD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0274.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0274.2.html | 2013-12-16 13:14 | 1.2K | RANKIN (DAWSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0274.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0274.3.html | 2013-12-16 13:14 | 1.2K | RANKIN, The (DRAIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0274.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0274.4.html | 2013-12-16 13:14 | 30K | RANKIN et al. v. FLORIDA, A. & G. C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0274.4.pdf | 2011-11-01 10:45 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0279.1.html | 2013-12-16 13:14 | 1.2K | RANKIN (JOLLY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0279.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0279.2.html | 2013-12-16 13:14 | 1.2K | RANKIN (SHOOK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0279.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0279.3.html | 2013-12-16 13:14 | 8.6K | RANKIN v. THIRD NAT. BANK et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0279.3.pdf | 2011-11-01 10:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0280.1.html | 2013-12-16 13:14 | 1.2K | RANKIN (TOMPKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0280.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0280.2.html | 2013-12-16 13:14 | 1.2K | RANKIN (TYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0280.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0280.3.html | 2013-12-16 13:14 | 1.4K | RANLETT v. LEAVENWORTH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0280.3.pdf | 2011-11-01 10:45 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0281.html | 2013-12-16 13:14 | 10K | RANSDALE v. GROVE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0281.pdf | 2011-11-01 10:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0282.1.html | 2013-12-16 13:14 | 3.8K | RANSOM et al. v. MAYO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0282.1.pdf | 2011-11-01 10:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0282.2.html | 2013-12-16 13:14 | 7.9K | RANSOM et al. v. MAYO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0282.2.pdf | 2011-11-01 10:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0284.html | 2013-12-16 13:14 | 16K | RANSOM et al. v. NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0284.pdf | 2011-11-01 10:45 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0286.html | 2013-12-16 13:14 | 63K | RANSOM et al. v. NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0286.pdf | 2011-11-01 10:45 | 140K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0296.html | 2013-12-16 13:14 | 4.5K | RANSOM v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0296.pdf | 2011-11-01 10:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0297.1.html | 2013-12-16 13:14 | 1.3K | The RAPID. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0297.1.pdf | 2011-11-01 10:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0297.2.html | 2013-12-16 13:14 | 40K | The RAPID. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0297.2.pdf | 2011-11-01 10:45 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0303.1.html | 2013-12-16 13:14 | 1.2K | RAPINE (PORTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0303.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0303.2.html | 2013-12-16 13:14 | 1.2K | RAPLEE (BALDWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0303.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0303.3.html | 2013-12-16 13:14 | 6.4K | RAPP v. BARD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0303.3.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0304.1.html | 2013-12-16 13:14 | 1.2K | RAPP (CONOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0304.1.pdf | 2011-11-01 10:45 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0304.2.html | 2013-12-16 13:14 | 1.2K | RAPPLEE (BALDWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0304.2.pdf | 2011-11-01 10:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0304.3.html | 2013-12-16 13:14 | 1.2K | RASCH (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0304.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0304.4.html | 2013-12-16 13:14 | 6.9K | In re RATCLIFFE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0304.4.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0305.html | 2013-12-16 13:14 | 12K | RATEAU v. BERNARD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0305.pdf | 2011-11-01 10:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0307.html | 2013-12-16 13:14 | 17K | In re RATHBONE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0307.pdf | 2011-11-01 10:45 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0309.html | 2013-12-16 13:14 | 29K | In re RATHBONE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0309.pdf | 2011-11-01 10:45 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0314.1.html | 2013-12-16 13:14 | 1.2K | In re RATHBONE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0314.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0314.2.html | 2013-12-16 13:14 | 9.7K | In re RATHBONE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0314.2.pdf | 2011-11-01 10:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0316.html | 2013-12-16 13:14 | 13K | RATHBONE et al. v. FOWLER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0316.pdf | 2011-11-01 10:45 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0317.1.html | 2013-12-16 13:14 | 1.2K | RATHBONE (HOOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0317.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0317.2.html | 2013-12-16 13:14 | 6.5K | RATHBONE et al. v. ORR et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0317.2.pdf | 2011-11-01 10:45 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0318.1.html | 2013-12-16 13:14 | 1.2K | RATHBONE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0318.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0318.2.html | 2013-12-16 13:14 | 1.2K | RATHBURN (OREGON & W. TRUST INVESTMENT CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0318.2.pdf | 2011-11-01 10:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0318.3.html | 2013-12-16 13:14 | 1.2K | RATLER, The (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0318.3.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0318.4.html | 2013-12-16 13:14 | 1.2K | RAVARA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0318.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0318.5.html | 2013-12-16 13:14 | 6.5K | RAVERTY et ux. v. FEIDGE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0318.5.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0319.html | 2013-12-16 13:14 | 7.2K | RAVERTY et ux. v. FRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0319.pdf | 2011-11-01 10:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0320.html | 2013-12-16 13:14 | 13K | RAWLE v. PHELPS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0320.pdf | 2011-11-01 10:45 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.1.html | 2013-12-16 13:14 | 1.2K | RAWLINGS (HEINECKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.2.html | 2013-12-16 13:14 | 1.2K | RAWLINGS (RHEA v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.2.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.3.html | 2013-12-16 13:14 | 1.2K | RAWLINSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.3.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.4.html | 2013-12-16 13:14 | 1.2K | RAWSON (BLAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.4.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.5.html | 2013-12-16 13:14 | 1.2K | RAWSON (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.5.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0322.6.html | 2013-12-16 13:14 | 20K | In re RAY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0322.6.pdf | 2011-11-01 10:45 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0325.html | 2013-12-16 13:14 | 25K | RAY v. DONNELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0325.pdf | 2011-11-01 10:45 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0329.html | 2013-12-16 13:14 | 2.2K | RAY v. LAW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0329.pdf | 2011-11-01 10:45 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0330.html | 2013-12-16 13:14 | 14K | RAY v. LAW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0330.pdf | 2011-11-01 10:45 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0332.1.html | 2013-12-16 13:14 | 1.2K | RAY v. The MILWAUKEE BELLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0332.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0332.2.html | 2013-12-16 13:14 | 1.2K | RAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0332.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0332.3.html | 2013-12-16 13:14 | 5.5K | Ex parte RAYMOND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0332.3.pdf | 2011-11-01 10:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0332.4.html | 2013-12-16 13:14 | 11K | RAYMOND v. DANBURY & N. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0332.4.pdf | 2011-11-01 10:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0334.1.html | 2013-12-16 13:14 | 1.2K | RAYMOND (EARL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0334.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0334.2.html | 2013-12-16 13:14 | 8.0K | RAYMOND v. The ELLEN STEWART. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0334.2.pdf | 2011-11-01 10:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0335.1.html | 2013-12-16 13:14 | 1.2K | RAYMOND v. The GEORGE PRESCOTT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0335.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0335.2.html | 2013-12-16 13:14 | 1.2K | RAYMOND v. HARRIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0335.2.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0335.3.html | 2013-12-16 13:14 | 11K | RAYMOND v. LONGWOBTH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0335.3.pdf | 2011-11-01 10:45 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0337.1.html | 2013-12-16 13:14 | 1.2K | RAYMOND (MAYBIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0337.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0337.2.html | 2013-12-16 13:14 | 7.1K | RAYMOND v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0337.2.pdf | 2011-11-01 10:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0338.1.html | 2013-12-16 13:14 | 1.2K | RAYNOLDS (DE FLOREZ v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0338.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0338.2.html | 2013-12-16 13:14 | 26K | In re RAYNOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0338.2.pdf | 2011-11-01 10:45 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0342.1.html | 2013-12-16 13:14 | 1.2K | RAYNOR (WILLIAMS MOWER, ETC., CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0342.1.pdf | 2011-11-01 10:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0342.2.html | 2013-12-16 13:14 | 12K | The R. B. FORBES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0342.2.pdf | 2011-11-01 10:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0344.1.html | 2013-12-16 13:14 | 1.3K | R. B. FORBES. The (POPE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0344.1.pdf | 2011-11-01 10:45 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0344.2.html | 2013-12-16 13:14 | 8.9K | REA v. CUTLER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0344.2.pdf | 2011-11-01 10:45 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0345.1.html | 2013-12-16 13:14 | 1.2K | In re READ. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0345.1.pdf | 2011-11-01 10:45 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0345.2.html | 2013-12-16 13:14 | 17K | READ v. BERTRAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0345.2.pdf | 2011-11-01 10:45 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0347.html | 2013-12-16 13:14 | 9.0K | READ v. BERTBAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0347.pdf | 2011-11-01 10:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0349.1.html | 2013-12-16 13:14 | 2.5K | READ v. BERTRAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0349.1.pdf | 2011-11-01 10:45 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0349.2.html | 2013-12-16 13:14 | 2.4K | READ et al. v. CARBERY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0349.2.pdf | 2011-11-01 10:45 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0349.3.html | 2013-12-16 13:14 | 5.5K | READ v. CHAPMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0349.3.pdf | 2011-11-01 10:45 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0350.html | 2013-12-16 13:14 | 22K | READ v. CONSEQUA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0350.pdf | 2011-11-01 10:46 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0353.html | 2013-12-16 13:14 | 4.2K | READ v. CONSEQUA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0353.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0354.1.html | 2013-12-16 13:14 | 3.6K | READ et al. v. HAYNIE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0354.1.pdf | 2011-11-01 10:46 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0354.2.html | 2013-12-16 13:14 | 16K | READ v. HULL OF A NEW BRIG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0354.2.pdf | 2011-11-01 10:46 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0357.html | 2013-12-16 13:14 | 14K | READ et al. v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0357.pdf | 2011-11-01 10:46 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0359.1.html | 2013-12-16 13:14 | 1.2K | READ (SIMMS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0359.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0359.2.html | 2013-12-16 13:14 | 1.2K | READ (STEVELIE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0359.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0359.3.html | 2013-12-16 13:14 | 1.2K | READ (STODDARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0359.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0359.4.html | 2013-12-16 13:14 | 1.2K | READ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0359.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0359.5.html | 2013-12-16 13:14 | 11K | READ v. WILKINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0359.5.pdf | 2011-11-01 10:46 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0360.1.html | 2013-12-16 13:14 | 1.2K | READE (GREIGG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0360.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0360.2.html | 2013-12-16 13:14 | 31K | READING v. BLACKWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0360.2.pdf | 2011-11-01 10:46 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0365.1.html | 2013-12-16 13:14 | 1.2K | READING (SHANKWIKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0365.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0365.2.html | 2013-12-16 13:14 | 1.2K | READING (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0365.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0365.3.html | 2013-12-16 13:14 | 20K | READY ROOFING CO. et al. v. TAYLOR et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0365.3.pdf | 2011-11-01 10:46 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0368.1.html | 2013-12-16 13:14 | 1.2K | REAGAN (M'IVER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0368.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0368.2.html | 2013-12-16 13:14 | 1.2K | REAGAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0368.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0368.3.html | 2013-12-16 13:14 | 5.6K | In re REAKIRT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0368.3.pdf | 2011-11-01 10:46 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0369.1.html | 2013-12-16 13:14 | 3.3K | Ex parte REAEDON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0369.1.pdf | 2011-11-01 10:46 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0369.2.html | 2013-12-16 13:14 | 1.2K | REAEDON (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0369.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0369.3.html | 2013-12-16 13:14 | 4.8K | REARDON v. MILLER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0369.3.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0370.1.html | 2013-12-16 13:14 | 1.2K | REARDON (NEWTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0370.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0370.2.html | 2013-12-16 13:14 | 3.3K | REASON v. BRIDGES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0370.2.pdf | 2011-11-01 10:46 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0370.3.html | 2013-12-16 13:14 | 18K | The REBECCA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0370.3.pdf | 2011-11-01 10:46 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0373.html | 2013-12-16 13:14 | 61K | The REBECCA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0373.pdf | 2011-11-01 10:46 | 142K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0383.html | 2013-12-16 13:14 | 6.2K | The REBECCA v. The AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0383.pdf | 2011-11-01 10:46 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0384.1.html | 2013-12-16 13:14 | 1.3K | The REBECCA v. The AMEBICA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0384.1.pdf | 2011-11-01 10:46 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0384.2.html | 2013-12-16 13:14 | 1.2K | REBECCA, The (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0384.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0384.3.html | 2013-12-16 13:14 | 4.7K | REBECCA et al. v. PUMPHREY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0384.3.pdf | 2011-11-01 10:46 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0384.4.html | 2013-12-16 13:14 | 14K | The REBECCA CLYDE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0384.4.pdf | 2011-11-01 10:46 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0386.html | 2013-12-16 13:14 | 4.0K | The REBECCA CLYDE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0386.pdf | 2011-11-01 10:46 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0387.1.html | 2013-12-16 13:14 | 1.2K | REBECCA FOGG, The (BROOKMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0387.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0387.2.html | 2013-12-16 13:14 | 12K | In re REBMEISTER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0387.2.pdf | 2011-11-01 10:46 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.1.html | 2013-12-16 13:14 | 1.4K | RECEIVER OF OCEAN NAT. BANK v. WILD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.1.pdf | 2011-11-01 10:46 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.2.html | 2013-12-16 13:14 | 1.2K | RECEIVERS (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.3.html | 2013-12-16 13:14 | 1.2K | RECEIVERS (DALTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.4.html | 2013-12-16 13:14 | 1.2K | RECEIVERS (MILES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.4.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.5.html | 2013-12-16 13:14 | 1.2K | RECEIVERS (MUSSELWHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.5.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0389.6.html | 2013-12-16 13:14 | 28K | RECKENDORFER v. FABER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0389.6.pdf | 2011-11-01 10:46 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.1.html | 2013-12-16 13:14 | 1.2K | RECORDER, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.2.html | 2013-12-16 13:14 | 1.2K | RECOVEEY. The (PRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.3.html | 2013-12-16 13:14 | 1.2K | RECTIFYING ESTABLISHMENT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.4.html | 2013-12-16 13:14 | 1.2K | RECTOR (GREENWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.5.html | 2013-12-16 13:14 | 1.2K | RECTOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.5.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0393.6.html | 2013-12-16 13:14 | 7.3K | RED BANK CO. v. The JOHN W. GANDY., TOWNSEND v. The EAGLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0393.6.pdf | 2011-11-01 10:46 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0394.1.html | 2013-12-16 13:14 | 1.2K | RED CHIEF (WHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0394.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0394.2.html | 2013-12-16 13:14 | 1.2K | REDDY (BINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0394.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0394.3.html | 2013-12-16 13:14 | 1.2K | REDDY v. LUDLOW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0394.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0394.4.html | 2013-12-16 13:14 | 8.3K | REDFERN et al. v. RUMNEY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0394.4.pdf | 2011-11-01 10:46 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.1.html | 2013-12-16 13:14 | 2.4K | In re REDFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.1.pdf | 2011-11-01 10:46 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.2.html | 2013-12-16 13:14 | 4.1K | In re REDFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.2.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.3.html | 2013-12-16 13:14 | 1.2K | REDFIELD (ANDRAE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.3.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.4.html | 2013-12-16 13:14 | 1.2K | REDFIELD (ANDREAE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.5.html | 2013-12-16 13:14 | 1.2K | REDFIELD (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.5.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.6.html | 2013-12-16 13:14 | 1.2K | REDFIELD (BANNENDAHL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.6.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.7.html | 2013-12-16 13:14 | 1.2K | REDFIELD (BLISS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.7.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.8.html | 2013-12-16 13:14 | 1.2K | REDFIELD (CASE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.8.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.9.html | 2013-12-16 13:14 | 1.2K | REDFIELD (CHOUTEAU v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.9.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.10.html | 2013-12-16 13:14 | 1.2K | REDFIELD (CROCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.10.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.11.html | 2013-12-16 13:14 | 1.2K | REDFIELD (DE FOREST v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.11.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.12.html | 2013-12-16 13:14 | 1.2K | REDFIELD (DRAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.12.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.13.html | 2013-12-16 13:14 | 1.2K | REDFIELD (FOWLER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.13.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.14.html | 2013-12-16 13:14 | 1.2K | REDFIELD (JUNGBLUTH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.14.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.15.html | 2013-12-16 13:14 | 1.2K | REDFIELD (LILLIE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.15.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.16.html | 2013-12-16 13:14 | 1.2K | REDFIELD (LOTTIMER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.16.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.17.html | 2013-12-16 13:14 | 1.2K | REDFIELD (MARSHALL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.17.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.18.html | 2013-12-16 13:14 | 1.2K | REDFIELD (POWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.18.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.19.html | 2013-12-16 13:14 | 1.2K | REDFIELD (RIESS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.19.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.20.html | 2013-12-16 13:14 | 1.2K | REDFIELD (STRANGE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.20.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.21.html | 2013-12-16 13:14 | 1.2K | REDFIELD (SULLIVAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.21.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.22.html | 2013-12-16 13:14 | 1.2K | REDFIELD (TOMES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.22.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.23.html | 2013-12-16 13:14 | 1.2K | REDFIELD (YZNAGA v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.23.pdf | 2011-11-01 10:46 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0396.24.html | 2013-12-16 13:14 | 1.4K | REDICK v. FROST. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0396.24.pdf | 2011-11-01 10:46 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0397.1.html | 2013-12-16 13:14 | 4.0K | REDING v. TEXAS & P. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0397.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0397.2.html | 2013-12-16 13:14 | 1.2K | REDINGTON (WINTERMUTE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0397.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0397.3.html | 2013-12-16 13:14 | 1.2K | RED JACKET, The (KLOTS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0397.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0397.4.html | 2013-12-16 13:14 | 1.2K | REDMAN (HARDY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0397.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0397.5.html | 2013-12-16 13:14 | 18K | REDMAN et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0397.5.pdf | 2011-11-01 10:46 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0400.html | 2013-12-16 13:14 | 11K | In re REDMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0400.pdf | 2011-11-01 10:46 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0401.html | 2013-12-16 13:14 | 1.2K | REDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0401.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0402.html | 2013-12-16 13:14 | 9.5K | In re REECE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0402.pdf | 2011-11-01 10:46 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0403.html | 2013-12-16 13:14 | 4.5K | REECE v. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0403.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0404.html | 2013-12-16 13:14 | 31K | Ex parte REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0404.pdf | 2011-11-01 10:46 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0408.html | 2013-12-16 13:14 | 6.1K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0408.pdf | 2011-11-01 10:46 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0409.html | 2013-12-16 13:14 | 41K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0409.pdf | 2011-11-01 10:46 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0416.html | 2013-12-16 13:14 | 5.9K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0416.pdf | 2011-11-01 10:46 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0417.1.html | 2013-12-16 13:14 | 3.8K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0417.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0417.2.html | 2013-12-16 13:14 | 4.1K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0417.2.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0417.3.html | 2013-12-16 13:14 | 26K | In re REED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0417.3.pdf | 2011-11-01 10:46 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0422.1.html | 2013-12-16 13:14 | 1.2K | REED (BRADLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0422.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0422.2.html | 2013-12-16 13:14 | 29K | REED et al. v. CAMPBELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0422.2.pdf | 2011-11-01 10:46 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0426.html | 2013-12-16 13:14 | 27K | REED et al. v. CANFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0426.pdf | 2011-11-01 10:46 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0431.1.html | 2013-12-16 13:14 | 1.2K | REED (CANFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0431.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0431.2.html | 2013-12-16 13:14 | 13K | REED v. CARUSI. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0431.2.pdf | 2011-11-01 10:46 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0433.1.html | 2013-12-16 13:14 | 4.1K | REED et al. v. CLARK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0433.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0433.2.html | 2013-12-16 13:14 | 1.2K | REED (CLEVELAND INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0433.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0433.3.html | 2013-12-16 13:14 | 12K | REED et al. v. COWLEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0433.3.pdf | 2011-11-01 10:46 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0435.html | 2013-12-16 13:14 | 28K | REED v. CUTTER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0435.pdf | 2011-11-01 10:46 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0439.html | 2013-12-16 13:14 | 9.5K | REED et al. v. The FANNY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0439.pdf | 2011-11-01 10:46 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0440.1.html | 2013-12-16 13:14 | 1.2K | REED (GILLESPIE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0440.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0440.2.html | 2013-12-16 13:14 | 39K | REED v. HUSSEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0440.2.pdf | 2011-11-01 10:46 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0446.1.html | 2013-12-16 13:14 | 1.2K | REED v. INDEPENDENT INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0446.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0446.2.html | 2013-12-16 13:14 | 1.2K | REED (MEXICO SOUTHERN BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0446.2.pdf | 2011-11-01 10:46 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0446.3.html | 2013-12-16 13:14 | 4.8K | REED et al. v. MINOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0446.3.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0447.1.html | 2013-12-16 13:14 | 1.2K | REED (MORSE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0447.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0447.2.html | 2013-12-16 13:14 | 1.3K | REED v. NELSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0447.2.pdf | 2011-11-01 10:46 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0447.3.html | 2013-12-16 13:14 | 22K | REED v. The NEW HAVEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0447.3.pdf | 2011-11-01 10:46 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0451.html | 2013-12-16 13:14 | 12K | REED v. REED et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0451.pdf | 2011-11-01 10:46 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0452.1.html | 2013-12-16 13:14 | 1.3K | REED v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0452.1.pdf | 2011-11-01 10:46 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0452.2.html | 2013-12-16 13:14 | 6.3K | REED v. ROSS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0452.2.pdf | 2011-11-01 10:46 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.1.html | 2013-12-16 13:14 | 1.2K | REED (SELLON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.1.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.2.html | 2013-12-16 13:14 | 1.3K | REED v. The TELOS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.2.pdf | 2011-11-01 10:46 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.3.html | 2013-12-16 13:14 | 1.2K | REED (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.4.html | 2013-12-16 13:14 | 1.2K | REED (VOSE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.4.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.5.html | 2013-12-16 13:14 | 1.2K | REED (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.5.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.6.html | 2013-12-16 13:14 | 1.2K | REEDER (CRANE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.6.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0453.7.html | 2013-12-16 13:14 | 13K | REEDER v. The GEORGE'S CREEK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0453.7.pdf | 2011-11-01 10:46 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0455.1.html | 2013-12-16 13:14 | 1.2K | REEDER (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0455.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0455.2.html | 2013-12-16 13:14 | 1.2K | REED TORPEDO CO. (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0455.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0455.3.html | 2013-12-16 13:14 | 3.2K | REELER v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0455.3.pdf | 2011-11-01 10:46 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0455.4.html | 2013-12-16 13:14 | 1.2K | REES v. The PLANET. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0455.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0456.1.html | 2013-12-16 13:14 | 1.2K | REES (HOOE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0456.1.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0456.2.html | 2013-12-16 13:14 | 1.2K | REESE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0456.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0456.3.html | 2013-12-16 13:14 | 14K | Ex parte REESIDE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0456.3.pdf | 2011-11-01 10:46 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0458.html | 2013-12-16 13:14 | 22K | The REESIDE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0458.pdf | 2011-11-01 10:46 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0461.1.html | 2013-12-16 13:14 | 1.3K | REESIDE v. WALKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0461.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0461.2.html | 2013-12-16 13:14 | 1.2K | REEVES (BLANCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0461.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0461.3.html | 2013-12-16 13:14 | 30K | REEVES et al. v. The CONSTITUTION. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0461.3.pdf | 2011-11-01 10:46 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0466.1.html | 2013-12-16 13:14 | 1.2K | REEVES (DETMOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0466.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0466.2.html | 2013-12-16 13:14 | 31K | REEVES v. KEYSTONE BRIDGE CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0466.2.pdf | 2011-11-01 10:46 | 166K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0467_01.jpg | 2011-07-23 13:25 | 10K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0468_01.jpg | 2011-07-23 13:25 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0472.html | 2013-12-16 13:14 | 13K | REEVES v. KEYSTONE BRIDGE CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0472.pdf | 2011-11-01 10:46 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0473.1.html | 2013-12-16 13:14 | 1.2K | REEVES (LE ROY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0473.1.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0473.2.html | 2013-12-16 13:14 | 7.0K | REEVES v. PYE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0473.2.pdf | 2011-11-01 10:46 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0474.1.html | 2013-12-16 13:14 | 1.2K | REEVES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0474.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0474.2.html | 2013-12-16 13:14 | 9.9K | REEVES v. VINACKE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0474.2.pdf | 2011-11-01 10:46 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0476.html | 2013-12-16 13:14 | 7.7K | REGAN v. The AMARANTH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0476.pdf | 2011-11-01 10:46 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0477.1.html | 2013-12-16 13:14 | 1.4K | REGISTER, The (LITCHFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0477.1.pdf | 2011-11-01 10:46 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0477.2.html | 2013-12-16 13:14 | 16K | The REGULATOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0477.2.pdf | 2011-11-01 10:46 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0479.1.html | 2013-12-16 13:14 | 1.2K | REGULUS, The (JAMESON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0479.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0479.2.html | 2013-12-16 13:14 | 10K | REICHE et al. v. SMYTHE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0479.2.pdf | 2011-11-01 10:46 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0481.html | 2013-12-16 13:14 | 5.4K | REID et al. v. HODGSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0481.pdf | 2011-11-01 10:46 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0482.html | 2013-12-16 13:14 | 29K | REID et ux. v. KERFOOT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0482.pdf | 2011-11-01 10:46 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0486.html | 2013-12-16 13:14 | 12K | REID v. ROCHEREAU et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0486.pdf | 2011-11-01 10:46 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0488.1.html | 2013-12-16 13:14 | 1.2K | REID (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0488.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0488.2.html | 2013-12-16 13:14 | 4.6K | REID v. The VERE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0488.2.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.1.html | 2013-12-16 13:14 | 1.2K | REID (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.2.html | 2013-12-16 13:14 | 1.2K | REILEY (CHANNING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.3.html | 2013-12-16 13:14 | 3.6K | REILING v. BOLIER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.3.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.4.html | 2013-12-16 13:14 | 1.2K | REILLY (CAZE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.5.html | 2013-12-16 13:14 | 1.2K | REILLY (HOOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.5.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.6.html | 2013-12-16 13:14 | 3.9K | REILLY v. MARYMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.6.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.7.html | 2013-12-16 13:14 | 1.2K | REILLY (SCHWABACKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.7.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.8.html | 2013-12-16 13:14 | 1.2K | REILY (HARPER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.8.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.9.html | 2013-12-16 13:14 | 1.2K | REILY (PATTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.9.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0489.10.html | 2013-12-16 13:14 | 1.2K | REILY (WRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0489.10.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0490.html | 2013-12-16 13:14 | 62K | In re REIMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0490.pdf | 2011-11-01 10:46 | 139K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0500.1.html | 2013-12-16 13:14 | 4.7K | In re REIMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0500.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0500.2.html | 2013-12-16 13:14 | 23K | In re REIMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0500.2.pdf | 2011-11-01 10:46 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0504.html | 2013-12-16 13:14 | 10K | REIMER et al. v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0504.pdf | 2011-11-01 10:46 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0505.1.html | 2013-12-16 13:14 | 2.9K | In re REIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0505.1.pdf | 2011-11-01 10:46 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0505.2.html | 2013-12-16 13:14 | 20K | In re REIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0505.2.pdf | 2011-11-01 10:46 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0508.1.html | 2013-12-16 13:14 | 1.3K | REINACH v. ATLANTIC & GREAT WEST. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0508.1.pdf | 2011-11-01 10:46 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0508.2.html | 2013-12-16 13:14 | 1.2K | The REINDEER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0508.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0508.3.html | 2013-12-16 13:14 | 2.7K | The REINDEER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0508.3.pdf | 2011-11-01 10:46 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0509.1.html | 2013-12-16 13:14 | 3.9K | The REINDEER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0509.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0509.2.html | 2013-12-16 13:14 | 1.2K | REINDEER, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0509.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0509.3.html | 2013-12-16 13:14 | 2.0K | REINHART v. ORME et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0509.3.pdf | 2011-11-01 10:46 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0509.4.html | 2013-12-16 13:14 | 1.2K | REINTZEL (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0509.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0509.5.html | 2013-12-16 13:14 | 2.9K | REINTZEL v. MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0509.5.pdf | 2011-11-01 10:46 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0510.1.html | 2013-12-16 13:14 | 1.2K | REINTZEL (PEIRCE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0510.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0510.2.html | 2013-12-16 13:14 | 1.2K | REINTZELL (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0510.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0510.3.html | 2013-12-16 13:14 | 4.0K | In re REIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0510.3.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0510.4.html | 2013-12-16 13:14 | 12K | REISER v. PARKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0510.4.pdf | 2011-11-01 10:46 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0512.html | 2013-12-16 13:14 | 7.1K | REISSNER et al. v. ANNESS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0512.pdf | 2011-11-01 10:46 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0513.1.html | 2013-12-16 13:14 | 3.9K | REISSNER et al. v. ANNESS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0513.1.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0513.2.html | 2013-12-16 13:14 | 8.1K | REISSNER et al. v. ANNESS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0513.2.pdf | 2011-11-01 10:46 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0514.html | 2013-12-16 13:14 | 32K | REISSNER et al. v. SHARP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0514.pdf | 2011-11-01 10:46 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0519.1.html | 2013-12-16 13:14 | 1.2K | REITER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0519.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0519.2.html | 2013-12-16 13:14 | 1.2K | RELAMPAGO, The (STONE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0519.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0519.3.html | 2013-12-16 13:14 | 8.8K | The R. E. LEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0519.3.pdf | 2011-11-01 10:46 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0521.html | 2013-12-16 13:14 | 6.3K | The R. E. LEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0521.pdf | 2011-11-01 10:46 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0522.html | 2013-12-16 13:14 | 23K | RELF et al. v. The MARIA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0522.pdf | 2011-11-01 10:46 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0525.1.html | 2013-12-16 13:14 | 1.2K | RELIANCE, The (DOWLING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0525.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0525.2.html | 2013-12-16 13:14 | 1.2K | RELIANCE, The (ROGERS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0525.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0525.3.html | 2013-12-16 13:14 | 12K | The RELIEF. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0525.3.pdf | 2011-11-01 10:46 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0527.1.html | 2013-12-16 13:14 | 5.3K | The RELIGIONE E LIBERTA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0527.1.pdf | 2011-11-01 10:46 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0527.2.html | 2013-12-16 13:14 | 1.2K | REMER (FITCH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0527.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0527.3.html | 2013-12-16 13:14 | 1.2K | REMHOFF (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0527.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0527.4.html | 2013-12-16 13:14 | 4.3K | REMINGTON et al. v. ATLANTIC ROYAL MAIL STEAM NAV. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0527.4.pdf | 2011-11-01 10:46 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0528.1.html | 2013-12-16 13:14 | 1.2K | REMINGTON (BERDAN FIRE ARMS MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0528.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0528.2.html | 2013-12-16 13:14 | 1.2K | REMINGTON (GOODRICH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0528.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0528.3.html | 2013-12-16 13:14 | 1.2K | REMINGTON (JUILLARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0528.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0528.4.html | 2013-12-16 13:14 | 1.2K | REMINGTON (LAWRENCE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0528.4.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0528.5.html | 2013-12-16 13:14 | 6.0K | REMINGTON v. LINTHICUM et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0528.5.pdf | 2011-11-01 10:46 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0529.1.html | 2013-12-16 13:14 | 1.4K | REMINGTON (LINTHICUM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0529.1.pdf | 2011-11-01 10:46 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0529.2.html | 2013-12-16 13:14 | 13K | REMNANTS IN COURT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0529.2.pdf | 2011-11-01 10:46 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0531.html | 2013-12-16 13:14 | 11K | In re REMSEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0531.pdf | 2011-11-01 10:46 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.1.html | 2013-12-16 13:14 | 1.2K | RENAULD (ENDICOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.2.html | 2013-12-16 13:14 | 1.2K | RENCH (BURRITT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.3.html | 2013-12-16 13:14 | 1.2K | RENCH (PENDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.4.html | 2013-12-16 13:14 | 1.2K | RENDELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.5.html | 2013-12-16 13:14 | 1.2K | RENKIN (COE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.5.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.6.html | 2013-12-16 13:14 | 1.2K | RENNEL (McDONALD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.6.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.7.html | 2013-12-16 13:14 | 1.2K | RENNELL (SHOREY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.7.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0532.8.html | 2013-12-16 13:14 | 4.7K | RENNER v. BANK OF COLUMBIA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0532.8.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0533.1.html | 2013-12-16 13:14 | 2.7K | RENNER v. HOWLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0533.1.pdf | 2011-11-01 10:46 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0533.2.html | 2013-12-16 13:14 | 1.2K | RENNER (RINGGOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0533.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0533.3.html | 2013-12-16 13:14 | 1.2K | RENNIE (PATON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0533.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0533.4.html | 2013-12-16 13:14 | 10K | RENO v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0533.4.pdf | 2011-11-01 10:46 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0534.1.html | 2013-12-16 13:14 | 1.2K | RENTON (WHIPPLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0534.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0534.2.html | 2013-12-16 13:14 | 8.6K | RENWICK et al. v. COOPER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0534.2.pdf | 2011-11-01 10:46 | 77K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0535_01.jpg | 2011-07-23 13:25 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0536.html | 2013-12-16 13:14 | 31K | RENWICK et al. v. POND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0536.pdf | 2011-11-01 10:46 | 120K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0537_01.jpg | 2011-07-23 13:25 | 21K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0537_02.jpg | 2011-07-23 13:25 | 14K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0541.html | 2013-12-16 13:14 | 19K | REPPERT v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0541.pdf | 2011-11-01 10:46 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0544.1.html | 2013-12-16 13:14 | 1.2K | REPUBLICAN BANNER OFFICERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0544.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0544.2.html | 2013-12-16 13:14 | 1.2K | REPUBLIC FIRE INS. CO. (CARDWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0544.2.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0544.3.html | 2013-12-16 13:14 | 1.2K | REPUBLIC FIRE INS. CO. (LEITER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0544.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0544.4.html | 2013-12-16 13:14 | 23K | In re REPUBLIC INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0544.4.pdf | 2011-11-01 10:46 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0548.html | 2013-12-16 13:14 | 26K | In re REPUBLIC INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0548.pdf | 2011-11-01 10:46 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0552.html | 2013-12-16 13:14 | 7.4K | In re REPUBLIC INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0552.pdf | 2011-11-01 10:46 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0553.html | 2013-12-16 13:14 | 9.6K | REPUBLIC INS. CO. v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0553.pdf | 2011-11-01 10:46 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0554.1.html | 2013-12-16 13:14 | 1.2K | REPUBLIC LIFE INS. CO. (CHAPMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0554.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0554.2.html | 2013-12-16 13:14 | 3.6K | The RESCUE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0554.2.pdf | 2011-11-01 10:46 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0554.3.html | 2013-12-16 13:14 | 1.2K | RESLER (SHEEHEE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0554.3.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0554.4.html | 2013-12-16 13:14 | 1.2K | RESLER (WISE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0554.4.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0554.5.html | 2013-12-16 13:14 | 4.4K | The RESOLUTION. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0554.5.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0555.1.html | 2013-12-16 13:14 | 1.2K | RESOLUTION, The (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0555.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0555.2.html | 2013-12-16 13:14 | 1.2K | RESSLER (WISE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0555.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0555.3.html | 2013-12-16 13:14 | 1.2K | RETTEW (BARNES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0555.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0555.4.html | 2013-12-16 13:14 | 14K | REUTGEN v. KANOWRS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0555.4.pdf | 2011-11-01 10:46 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0557.1.html | 2013-12-16 13:14 | 1.2K | REVENGE, The (DIAS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0557.1.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0557.2.html | 2013-12-16 13:14 | 17K | REVENS v. LEWIS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0557.2.pdf | 2011-11-01 10:46 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0559.html | 2013-12-16 13:14 | 7.3K | The Revenue Cutter. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0559.pdf | 2011-11-01 10:46 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0560.html | 2013-12-16 13:14 | 45K | The REVENUE CUTTER NO. 1. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0560.pdf | 2011-11-01 10:46 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0568.html | 2013-12-16 13:14 | 34K | The REVENUE CUTTER, NO. 2. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0568.pdf | 2011-11-01 10:46 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0573.html | 2013-12-16 13:14 | 6.5K | The REVERE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0573.pdf | 2011-11-01 10:46 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0574.html | 2013-12-16 13:14 | 34K | The REVERE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0574.pdf | 2011-11-01 10:46 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0580.1.html | 2013-12-16 13:14 | 2.2K | REVEREZ v. CAMELLOS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0580.1.pdf | 2011-11-01 10:46 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0580.2.html | 2013-12-16 13:14 | 1.2K | REVEREZ (CAMELLOS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0580.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0580.3.html | 2013-12-16 13:14 | 11K | REYLEY et al. v. The CARRIE BROOKS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0580.3.pdf | 2011-11-01 10:46 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0581.html | 2013-12-16 13:14 | 1.2K | REYMERT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0581.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0582.html | 2013-12-16 13:14 | 26K | Ex parte REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0582.pdf | 2011-11-01 10:46 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0586.html | 2013-12-16 13:14 | 41K | Ex parte REYNOLDS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0586.pdf | 2011-11-01 10:46 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0592.html | 2013-12-16 13:14 | 122K | In re REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0592.pdf | 2011-11-01 10:46 | 253K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0612.1.html | 2013-12-16 13:14 | 1.2K | In re REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0612.1.pdf | 2011-11-01 10:46 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0612.2.html | 2013-12-16 13:14 | 17K | In re REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0612.2.pdf | 2011-11-01 10:46 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0615.html | 2013-12-16 13:14 | 23K | In re REYNOLDS., CARTER et al. v. McGEHEE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0615.pdf | 2011-11-01 10:46 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0618.html | 2013-12-16 13:14 | 5.2K | In re REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0618.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0619.1.html | 2013-12-16 13:14 | 2.7K | REYNOLDS v. BADGER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0619.1.pdf | 2011-11-01 10:46 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0619.2.html | 2013-12-16 13:14 | 3.8K | REYNOLDS v. BAKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0619.2.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0620.1.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (BANK OF WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0620.1.pdf | 2011-11-01 10:46 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0620.2.html | 2013-12-16 13:14 | 3.7K | REYNOLDS v. CALVERT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0620.2.pdf | 2011-11-01 10:46 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0620.3.html | 2013-12-16 13:14 | 4.4K | REYNOLDS v. CORDERY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0620.3.pdf | 2011-11-01 10:46 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0621.html | 2013-12-16 13:14 | 16K | REYNOLDS et al. v. The JOSEPH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0621.pdf | 2011-11-01 10:46 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0623.html | 2013-12-16 13:14 | 7.6K | REYNOLDS et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0623.pdf | 2011-11-01 10:46 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0624.1.html | 2013-12-16 13:14 | 1.4K | REYNOLDS v. NATIONAL EXP. & TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0624.1.pdf | 2011-11-01 10:46 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0624.2.html | 2013-12-16 13:14 | 5.4K | REYNOLDS et al. v. The SIMOON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0624.2.pdf | 2011-11-01 10:46 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.1.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.1.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.2.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (STAPLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.2.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.3.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (THIELMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.3.pdf | 2011-11-01 10:46 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.4.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (VALENTINE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.4.pdf | 2011-11-01 10:46 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.5.html | 2013-12-16 13:14 | 1.2K | REYNOLDS (VANDERBILT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.5.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0625.6.html | 2013-12-16 13:14 | 14K | REYNOLDS v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0625.6.pdf | 2011-11-01 10:47 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0627.html | 2013-12-16 13:14 | 6.7K | The R. F. CAHILL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0627.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0628.html | 2013-12-16 13:14 | 11K | The R. G. WINSLOW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0628.pdf | 2011-11-01 10:47 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0629.1.html | 2013-12-16 13:14 | 1.2K | RHAWN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0629.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0630.1.html | 2013-12-16 13:14 | 2.5K | RHEA v. RAWLINGS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0630.1.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0630.2.html | 2013-12-16 13:14 | 5.0K | RHEIMER v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0630.2.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0630.3.html | 2013-12-16 13:14 | 1.2K | RHINELANDER (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0630.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0630.4.html | 2013-12-16 13:14 | 2.8K | RHINELANDER et al. v. SANFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0630.4.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0631.html | 2013-12-16 13:14 | 36K | RHOADES et al. v. SELIN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0631.pdf | 2011-11-01 10:47 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0636.html | 2013-12-16 13:14 | 16K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0636.pdf | 2011-11-01 10:47 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0639.html | 2013-12-16 13:14 | 12K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0639.pdf | 2011-11-01 10:47 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0641.1.html | 2013-12-16 13:14 | 5.4K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0641.1.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0641.2.html | 2013-12-16 13:14 | 23K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0641.2.pdf | 2011-11-01 10:47 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0645.html | 2013-12-16 13:14 | 8.5K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0645.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0646.html | 2013-12-16 13:14 | 38K | The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0646.pdf | 2011-11-01 10:47 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0652.1.html | 2013-12-16 13:14 | 1.2K | RHODE ISLAND, The (NAUGATUCK TRANSPORTATION CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0652.1.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0652.2.html | 2013-12-16 13:14 | 4.1K | In re RHODES., In re SMITH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0652.2.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0653.1.html | 2013-12-16 13:14 | 1.2K | RHODES (BELL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0653.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0653.2.html | 2013-12-16 13:14 | 2.3K | RHODES v. BROOKE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0653.2.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0653.3.html | 2013-12-16 13:14 | 1.2K | RHODES (FOSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0653.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0653.4.html | 2013-12-16 13:14 | 5.4K | RHODES v. HADFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0653.4.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.1.html | 2013-12-16 13:14 | 1.2K | RHODES (HOLY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.2.html | 2013-12-16 13:14 | 1.2K | RHODES (PERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.3.html | 2013-12-16 13:14 | 1.2K | RHODES (RANDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.4.html | 2013-12-16 13:14 | 2.8K | RHODES v. RIGG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.4.pdf | 2011-11-01 10:47 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.5.html | 2013-12-16 13:14 | 1.2K | RHODES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.5.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.6.html | 2013-12-16 13:14 | 1.2K | RIBBANS (SPERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.6.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0654.7.html | 2013-12-16 13:14 | 9.2K | In re RICE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0654.7.pdf | 2011-11-01 10:47 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0655.html | 2013-12-16 13:14 | 11K | RICE v. BALDWIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0655.pdf | 2011-11-01 10:47 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0657.html | 2013-12-16 13:14 | 8.1K | RICE v. BARRY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0657.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0658.1.html | 2013-12-16 13:14 | 1.1K | RICE (CARR v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0658.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0658.2.html | 2013-12-16 13:14 | 1.2K | RICE (CHOTEAU v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0658.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0658.3.html | 2013-12-16 13:14 | 42K | RICE v. HEALD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0658.3.pdf | 2011-11-01 10:47 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0665.1.html | 2013-12-16 13:14 | 1.2K | RICE (KANE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0665.1.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0665.2.html | 2013-12-16 13:14 | 1.2K | RICE (LEGER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0665.2.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0665.3.html | 2013-12-16 13:14 | 8.7K | RICE v. MONTGOMERY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0665.3.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0666.html | 2013-12-16 13:14 | 8.8K | RICE et al. v. The POLLY & KITTY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0666.pdf | 2011-11-01 10:47 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0667.html | 2013-12-16 13:14 | 1.2K | RICE (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0667.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0668.1.html | 2013-12-16 13:14 | 4.7K | RICE v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0668.1.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0668.2.html | 2013-12-16 13:14 | 1.2K | RICE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0668.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0668.3.html | 2013-12-16 13:14 | 1.2K | RICE (WETMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0668.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0668.4.html | 2013-12-16 13:14 | 1.2K | RICH v. CAMPBELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0668.4.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0668.5.html | 2013-12-16 13:14 | 11K | RICH et al. v. The CHERUB. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0668.5.pdf | 2011-11-01 10:47 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0670.html | 2013-12-16 13:14 | 13K | RICH v. CLOSE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0670.pdf | 2011-11-01 10:47 | 92K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0671_01.jpg | 2011-07-23 13:25 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0672.html | 2013-12-16 13:14 | 30K | RICH et al. v. LIPPINCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0672.pdf | 2011-11-01 10:47 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0677.1.html | 2013-12-16 13:14 | 5.4K | RICH v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0677.1.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0677.2.html | 2013-12-16 13:14 | 1.2K | RICH (NORTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0677.2.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0677.3.html | 2013-12-16 13:14 | 19K | RICH v. PARROTT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0677.3.pdf | 2011-11-01 10:47 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0680.html | 2013-12-16 13:14 | 9.4K | RICH v. PARROTT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0680.pdf | 2011-11-01 10:47 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0681.html | 2013-12-16 13:14 | 5.9K | RICH v. RICKETTS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0681.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0682.1.html | 2013-12-16 13:14 | 1.2K | RICHARD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0682.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0682.2.html | 2013-12-16 13:14 | 6.0K | RICHARD v. VAN METER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0682.2.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0683.html | 2013-12-16 13:14 | 30K | The RICHARD BUSTEED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0683.pdf | 2011-11-01 10:47 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0688.html | 2013-12-16 13:14 | 6.2K | The RICHARD DOANE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0688.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0689.1.html | 2013-12-16 13:14 | 6.2K | The RICHARD MATT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0689.1.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0689.2.html | 2013-12-16 13:14 | 4.9K | The RICHARD O'BRYAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0689.2.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0690.html | 2013-12-16 13:14 | 7.4K | The RICHARD E. HIGGINS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0690.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0691.html | 2013-12-16 13:14 | 4.4K | In re RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0691.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0692.1.html | 2013-12-16 13:14 | 4.0K | In re RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0692.1.pdf | 2011-11-01 10:47 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0692.2.html | 2013-12-16 13:14 | 20K | RICHARDS et al. v. CHESAPEAKE & O. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0692.2.pdf | 2011-11-01 10:47 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0695.1.html | 2013-12-16 13:14 | 1.2K | RICHARDS (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0695.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0695.2.html | 2013-12-16 13:14 | 1.2K | RICHARDS (DOYLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0695.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0695.3.html | 2013-12-16 13:14 | 1.2K | RICHARDS (GIBSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0695.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0695.4.html | 2013-12-16 13:14 | 1.2K | RICHARDS (HARVEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0695.4.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0695.5.html | 2013-12-16 13:14 | 6.0K | RICHARDS et al. v. RANDOLPH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0695.5.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.1.html | 2013-12-16 13:14 | 1.2K | RICHARDS (SPARHAWK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.2.html | 2013-12-16 13:14 | 1.2K | RICHARDS (STEELE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.3.html | 2013-12-16 13:14 | 1.2K | RICHARDS v. The STRANGER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.4.html | 2013-12-16 13:14 | 1.3K | RICHARDS v. SWIMLEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.4.pdf | 2011-11-01 10:47 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.5.html | 2013-12-16 13:14 | 1.2K | RICHARDS (VENABLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.5.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0696.6.html | 2013-12-16 13:14 | 6.5K | In re RICHARDSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0696.6.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0697.1.html | 2013-12-16 13:14 | 3.1K | In re RICHARDSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0697.1.pdf | 2011-11-01 10:47 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0697.2.html | 2013-12-16 13:14 | 8.5K | In re RICHARDSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0697.2.pdf | 2011-11-01 10:47 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0699.html | 2013-12-16 13:14 | 27K | In re RICHARDSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0699.pdf | 2011-11-01 10:47 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0703.html | 2013-12-16 13:14 | 17K | RICHARDSON'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0703.pdf | 2011-11-01 10:47 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0705.1.html | 2013-12-16 13:14 | 1.3K | RICHARDSON v. ASHCROFT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0705.1.pdf | 2011-11-01 10:47 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0705.2.html | 2013-12-16 13:14 | 6.8K | RICHARDSON v. BOSTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0705.2.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0706.1.html | 2013-12-16 13:14 | 1.2K | RICHARDSON (BRADLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0706.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0706.2.html | 2013-12-16 13:14 | 3.4K | RICHARDSON et al. v. CAMERON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0706.2.pdf | 2011-11-01 10:47 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0707.html | 2013-12-16 13:14 | 12K | RICHARDSON et al. v. CURTIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0707.pdf | 2011-11-01 10:47 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0708.html | 2013-12-16 13:14 | 6.6K | RICHARDSON v. ELDRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0708.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0709.html | 2013-12-16 13:14 | 3.3K | RICHARDSON v. GOLDEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0709.pdf | 2011-11-01 10:47 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0710.html | 2013-12-16 13:14 | 39K | RICHARDSON v. HICKS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0710.pdf | 2011-11-01 10:47 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0716.html | 2013-12-16 13:14 | 9.3K | RICHARDSON v. The JUILLETTE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0716.pdf | 2011-11-01 10:47 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0717.1.html | 2013-12-16 13:14 | 1.2K | RICHARDSON (HOUGH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0717.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0717.2.html | 2013-12-16 13:14 | 6.7K | RICHARDSON et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0717.2.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0718.html | 2013-12-16 13:14 | 13K | RICHARDSON v. LOCKWOOD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0718.pdf | 2011-11-01 10:47 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0720.html | 2013-12-16 13:14 | 6.4K | RICHARDSON v. LOCKWOOD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0720.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0721.1.html | 2013-12-16 13:14 | 1.3K | RICHARDSON v. McFARLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0721.1.pdf | 2011-11-01 10:47 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0721.2.html | 2013-12-16 13:14 | 6.1K | RICHARDSON v. M'INTYRE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0721.2.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0722.1.html | 2013-12-16 13:14 | 5.5K | RICHARDSON v. MATTISON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0722.1.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0722.2.html | 2013-12-16 13:14 | 8.7K | RICHARDSON v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0722.2.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0723.html | 2013-12-16 13:14 | 8.4K | RICHARDSON et al. v. NOYES et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0723.pdf | 2011-11-01 10:47 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0725.1.html | 2013-12-16 13:14 | 1.2K | RICHARDSON (OAKES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0725.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0725.2.html | 2013-12-16 13:14 | 6.4K | RICHARDSON v. PACIFIC MAID STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0725.2.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0725.3.html | 2013-12-16 13:14 | 4.1K | RICHARDSON v. PEYTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0725.3.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0726.1.html | 2013-12-16 13:14 | 1.2K | RICHABDSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0726.1.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0726.2.html | 2013-12-16 13:14 | 1.2K | RICHABDSON (WILLIAMSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0726.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0726.3.html | 2013-12-16 13:14 | 1.2K | RICHARDSON (WING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0726.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0726.4.html | 2013-12-16 13:14 | 34K | RICHARDSON et al. v. WINSOR et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0726.4.pdf | 2011-11-01 10:47 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0731.1.html | 2013-12-16 13:14 | 1.2K | RICHEY (EPPINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0731.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0731.2.html | 2013-12-16 13:14 | 8.2K | The RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0731.2.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0732.html | 2013-12-16 13:14 | 22K | The RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0732.pdf | 2011-11-01 10:47 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0736.1.html | 2013-12-16 13:14 | 4.5K | The RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0736.1.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0736.2.html | 2013-12-16 13:14 | 7.7K | In re RICHMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0736.2.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0737.1.html | 2013-12-16 13:14 | 1.2K | RICHMOND (BINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0737.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0737.2.html | 2013-12-16 13:14 | 1.2K | RICHMOND, The (DEXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0737.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0737.3.html | 2013-12-16 13:14 | 4.8K | RICHMOND v. DREYFOUS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0737.3.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0738.1.html | 2013-12-16 13:14 | 1.2K | RICHMOND (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0738.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0738.2.html | 2013-12-16 13:14 | 1.2K | RICHMOND (HULL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0738.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0738.3.html | 2013-12-16 13:14 | 1.2K | RICHMOND. The (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0738.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0738.4.html | 2013-12-16 13:14 | 1.2K | RICHMOND (LE FRANC v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0738.4.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0738.5.html | 2013-12-16 13:14 | 14K | RICHMOND et al. v. NEW BEDFORD COPPER CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0738.5.pdf | 2011-11-01 10:47 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0740.html | 2013-12-16 13:14 | 43K | RICHMOND v. RICHMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0740.pdf | 2011-11-01 10:47 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0747.1.html | 2013-12-16 13:14 | 1.2K | RICHMOND. The (SHIRLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0747.1.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0747.2.html | 2013-12-16 13:14 | 1.2K | RICHMOND, The (WRITER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0747.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0747.3.html | 2013-12-16 13:14 | 1.2K | RICHMOND CONSOLIDATED MIN. CO. (EUREKA CONSOLIDATED MIN. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0747.3.pdf | 2011-11-01 10:47 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0747.4.html | 2013-12-16 13:14 | 1.3K | RICHMOND, FREDERICKSBURG & POTOMAC R. R. CO. (SAYLES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0747.4.pdf | 2011-11-01 10:47 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0747.5.html | 2013-12-16 13:14 | 5.4K | RICHMOND MANUF'G CO. v. STARKS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0747.5.pdf | 2011-11-01 10:47 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0748.html | 2013-12-16 13:14 | 28K | In re RICHTER'S ESTATE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0748.pdf | 2011-11-01 10:47 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0752.html | 2013-12-16 13:14 | 19K | RICKARDS et ux. v. LADD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0752.pdf | 2011-11-01 10:47 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0755.1.html | 2013-12-16 13:14 | 1.2K | RICKER (KENNEDY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0755.1.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0755.2.html | 2013-12-16 13:14 | 1.2K | RICKERS (The ELIZABETH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0755.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0755.3.html | 2013-12-16 13:14 | 7.3K | RICKETSON et al. v. WRIGHT et al |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0755.3.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.1.html | 2013-12-16 13:14 | 2.5K | RICKETTS et al. v. HENDERSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.1.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.2.html | 2013-12-16 13:14 | 1.2K | RICKETTS (HENRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.3.html | 2013-12-16 13:14 | 1.2K | RICKETTS (RICH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.4.html | 2013-12-16 13:14 | 1.2K | RICKETTS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.4.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.5.html | 2013-12-16 13:14 | 1.2K | RICKEY (ARMSTRONG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.5.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.6.html | 2013-12-16 13:14 | 1.2K | RICO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.6.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.7.html | 2013-12-16 13:14 | 1.2K | RIDDICK (WHITELY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.7.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.8.html | 2013-12-16 13:14 | 1.2K | RIDDLE (COPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.8.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.9.html | 2013-12-16 13:14 | 1.2K | RIDDLE (GORDON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.9.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0756.10.html | 2013-12-16 13:14 | 4.9K | RIDDLE et al. v. MANDEVILLE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0756.10.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0757.1.html | 2013-12-16 13:14 | 3.6K | RIDDLE v. MARSHAL OF THE DISTRICT OF COLUMBIA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0757.1.pdf | 2011-11-01 10:47 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0757.2.html | 2013-12-16 13:14 | 1.2K | RIDDLE (RAMSAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0757.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0757.3.html | 2013-12-16 13:14 | 1.2K | RIDDLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0757.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0757.4.html | 2013-12-16 13:14 | 1.4K | RIDDLE v. MOSS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0757.4.pdf | 2011-11-01 10:47 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0757.5.html | 2013-12-16 13:14 | 2.3K | RIDDLE v. MOTT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0757.5.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0758.1.html | 2013-12-16 13:14 | 2.9K | RIDDLE v. POTTER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0758.1.pdf | 2011-11-01 10:47 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0758.2.html | 2013-12-16 13:14 | 1.2K | RIDENBAUGH (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0758.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0758.3.html | 2013-12-16 13:14 | 1.2K | RIDEOUT v. HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0758.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0758.4.html | 2013-12-16 13:14 | 1.2K | RIDER (DENNIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0758.4.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0758.5.html | 2013-12-16 13:14 | 8.4K | RIDER v. The PACIFIC. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0758.5.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0759.1.html | 2013-12-16 13:14 | 2.6K | RIDGEWAY v. GHEQUIER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0759.1.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0759.2.html | 2013-12-16 13:14 | 7.9K | RIDGEWAY v. OGDEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0759.2.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0760.html | 2013-12-16 13:14 | 32K | RIDGEWAY v. UNDERWOOD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0760.pdf | 2011-11-01 10:47 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0765.html | 2013-12-16 13:14 | 1.2K | RIDGWAY (BETTINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0765.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0766.1.html | 2013-12-16 13:14 | 2.4K | RIDGWAY v. GHEQUIER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0766.1.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0766.2.html | 2013-12-16 13:14 | 36K | RIDGWAY v. HAYS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0766.2.pdf | 2011-11-01 10:47 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0771.1.html | 2013-12-16 13:14 | 1.2K | RIDGWAY (LORILLARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0771.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0771.2.html | 2013-12-16 13:14 | 2.8K | RIDGWAY v. PACOST. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0771.2.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0771.3.html | 2013-12-16 13:14 | 1.2K | RIDGWAY (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0771.3.pdf | 2011-11-01 10:47 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0772.html | 2013-12-16 13:14 | 10K | RIDGWAY TP. v. GRISWOLD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0772.pdf | 2011-11-01 10:47 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0773.html | 2013-12-16 13:14 | 4.9K | RIDYARD et al. v. PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0773.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0774.1.html | 2013-12-16 13:14 | 6.0K | RIESS et al. v. REDFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0774.1.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0774.2.html | 2013-12-16 13:14 | 1.2K | RIGG [RHODES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0774.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0774.3.html | 2013-12-16 13:14 | 1.2K | RIGGS v. BARRON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0774.3.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0774.4.html | 2013-12-16 13:14 | 7.5K | RIGGS v. BOYLAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0774.4.pdf | 2011-11-01 10:47 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0776.1.html | 2013-12-16 13:14 | 2.9K | RIGGS v. CHESTER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0776.1.pdf | 2011-11-01 10:47 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0776.2.html | 2013-12-16 13:14 | 32K | RIGGS v. COLLINS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0776.2.pdf | 2011-11-01 10:47 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0781.html | 2013-12-16 13:14 | 15K | RIGGS et al v. FRICK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0781.pdf | 2011-11-01 10:47 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0783.html | 2013-12-16 13:14 | 6.1K | BIGGS v. GRAEFF. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0783.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0784.html | 2013-12-16 13:14 | 22K | RIGGS v. The JOHN RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0784.pdf | 2011-11-01 10:47 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.1.html | 2013-12-16 13:14 | 1.2K | RIGGS v. JOHNSON COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.2.html | 2013-12-16 13:14 | 1.2K | RIGGS (LINDSAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.2.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.3.html | 2013-12-16 13:14 | 1.2K | RIGGS (McDANIEL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.4.html | 2013-12-16 13:14 | 1.2K | RIGGS (MCLAUGHLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.4.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.5.html | 2013-12-16 13:14 | 4.0K | RIGGS v. MAGRUDER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.5.pdf | 2011-11-01 10:47 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.6.html | 2013-12-16 13:14 | 1.2K | RIGGS (O'CALLAGHON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.6.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0787.7.html | 2013-12-16 13:14 | 4.4K | RIGGS v. ST. CLAIR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0787.7.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0788.1.html | 2013-12-16 13:14 | 4.5K | RIGGS v. STEWART. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0788.1.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0788.2.html | 2013-12-16 13:14 | 28K | RIGGS v. SWANN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0788.2.pdf | 2011-11-01 10:47 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0793.html | 2013-12-16 13:14 | 17K | RIGGS v. TAYLOE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0793.pdf | 2011-11-01 10:47 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0795.1.html | 2013-12-16 13:14 | 1.2K | RIGGS (UNION BANK OF GEORGETOWN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0795.1.pdf | 2011-11-01 10:47 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0795.2.html | 2013-12-16 13:14 | 1.2K | RIGSBY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0795.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0795.3.html | 2013-12-16 13:14 | 1.2K | RIKEMAN (FINCH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0795.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0795.4.html | 2013-12-16 13:14 | 8.6K | In re RIKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0795.4.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0797.html | 2013-12-16 13:14 | 27K | In re RILEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0797.pdf | 2011-11-01 10:47 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0801.html | 2013-12-16 13:14 | 13K | RILEY et al. v. ANDERSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0801.pdf | 2011-11-01 10:47 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0803.1.html | 2013-12-16 13:14 | 2.2K | RILEY v. COOPER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0803.1.pdf | 2011-11-01 10:47 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0803.2.html | 2013-12-16 13:14 | 6.9K | RILEY et al. v. DANIELS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0803.2.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0804.1.html | 2013-12-16 13:14 | 1.2K | RILEY (DUNHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0804.1.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0804.2.html | 2013-12-16 13:14 | 3.1K | RILEY v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0804.2.pdf | 2011-11-01 10:47 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0804.3.html | 2013-12-16 13:14 | 7.5K | RILEY v. The OBELL MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0804.3.pdf | 2011-11-01 10:47 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.1.html | 2013-12-16 13:14 | 1.2K | RILEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.2.html | 2013-12-16 13:14 | 1.2K | RILEY (WELLS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.3.html | 2013-12-16 13:14 | 1.2K | RILEY (WRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.4.html | 2013-12-16 13:14 | 1.2K | RILEY v. The YORKTOWN NO. 2. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.4.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.5.html | 2013-12-16 13:14 | 1.2K | RIND (DUANE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.5.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0805.6.html | 2013-12-16 13:14 | 1.2K | RINDSKOPF (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0805.6.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0806.html | 2013-12-16 13:14 | 30K | RINEHABT et us. v. HARRISON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0806.pdf | 2011-11-01 10:47 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0810.1.html | 2013-12-16 13:14 | 1.2K | RINES (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0810.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0810.2.html | 2013-12-16 13:14 | 1.2K | RING (CAHOON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0810.2.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0810.3.html | 2013-12-16 13:14 | 1.2K | RING v. The R. E. LEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0810.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0810.4.html | 2013-12-16 13:14 | 16K | Ex parte RINGGOLD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0810.4.pdf | 2011-11-01 10:47 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0813.1.html | 2013-12-16 13:14 | 4.3K | RINGGOLD v. BACON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0813.1.pdf | 2011-11-01 10:47 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0813.2.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (BLAGROVE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0813.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0813.3.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (BURFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0813.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0813.4.html | 2013-12-16 13:14 | 9.5K | RINGGOLD v. CROCKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0813.4.pdf | 2011-11-01 10:47 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0815.1.html | 2013-12-16 13:14 | 3.3K | RINGGOLD v. ELLIOT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0815.1.pdf | 2011-11-01 10:47 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0815.2.html | 2013-12-16 13:14 | 2.9K | RINGGOLD v. GLOVER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0815.2.pdf | 2011-11-01 10:47 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0815.3.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (GUSTINE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0815.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0815.4.html | 2013-12-16 13:14 | 7.0K | RINGGOLD v. HOFFMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0815.4.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0816.1.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (LETOURNO v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0816.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0816.2.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (LEVY COURT OF WASHINGTON COUNTY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0816.2.pdf | 2011-11-01 10:47 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0816.3.html | 2013-12-16 13:14 | 6.0K | RINGGOLD v. LEWIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0816.3.pdf | 2011-11-01 10:47 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0817.1.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (MANDEVILLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0817.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0817.2.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0817.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0817.3.html | 2013-12-16 13:14 | 1.3K | RINGGOLD v. NICHOLLS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0817.3.pdf | 2011-11-01 10:47 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0817.4.html | 2013-12-16 13:14 | 3.7K | RINGGOLD v. RENNER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0817.4.pdf | 2011-11-01 10:47 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.1.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (RYAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.2.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.3.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (SWANN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.3.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.4.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.4.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.5.html | 2013-12-16 13:14 | 1.2K | RINGGOLD (WILLIAMSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.5.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.6.html | 2013-12-16 13:14 | 6.0K | The RINGLEADER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.6.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.7.html | 2013-12-16 13:14 | 1.2K | RINGOLD v. CROCKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.7.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0818.8.html | 2013-12-16 13:14 | 11K | RINKER v. MANHATTAN LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0818.8.pdf | 2011-11-01 10:47 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0820.1.html | 2013-12-16 13:14 | 1.2K | RINKER (MERRILL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0820.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0820.2.html | 2013-12-16 13:14 | 1.2K | RIO GRANDE, The (OTIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0820.2.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0820.3.html | 2013-12-16 13:14 | 9.9K | In re RIORDEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0820.3.pdf | 2011-11-01 10:47 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0822.html | 2013-12-16 13:14 | 12K | RIPLEY v. HARRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0822.pdf | 2011-11-01 10:47 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0823.html | 2013-12-16 13:14 | 14K | RIPLEY v. RAILWAY PASSENGERS' ASSUR. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0823.pdf | 2011-11-01 10:47 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0826.1.html | 2013-12-16 13:14 | 1.2K | RIPLEY (STEARNS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0826.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0826.2.html | 2013-12-16 13:14 | 1.3K | RISCH v. FISKE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0826.2.pdf | 2011-11-01 10:47 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0826.3.html | 2013-12-16 13:14 | 9.7K | RISHER v. The FROLIC. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0826.3.pdf | 2011-11-01 10:47 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0827.html | 2013-12-16 13:14 | 7.6K | The RISING DAWN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0827.pdf | 2011-11-01 10:47 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0828.1.html | 2013-12-16 13:14 | 1.2K | RISING FAWN IRON CO. (WARNER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0828.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0828.2.html | 2013-12-16 13:14 | 17K | The RISING SUN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0828.2.pdf | 2011-11-01 10:47 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0831.html | 2013-12-16 13:14 | 14K | RISLEY v. INDIANAPOLIS, B. & W. RY. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0831.pdf | 2011-11-01 10:47 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0833.html | 2013-12-16 13:14 | 12K | RISON v. CRIBBS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0833.pdf | 2011-11-01 10:47 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0835.html | 2013-12-16 13:14 | 36K | RISON v. KNAPP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0835.pdf | 2011-11-01 10:47 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0840.1.html | 2013-12-16 13:14 | 1.2K | RIST (CLABKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0840.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0840.2.html | 2013-12-16 13:14 | 4.2K | RISTON v. CONTENT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0840.2.pdf | 2011-11-01 10:47 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0841.1.html | 2013-12-16 13:14 | 1.2K | RITCHEY (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0841.1.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0841.2.html | 2013-12-16 13:14 | 7.1K | RITCHIE et al. v. BANK OF THE UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0841.2.pdf | 2011-11-01 10:47 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.1.html | 2013-12-16 13:14 | 1.2K | RITCHIE v. LITLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.2.html | 2013-12-16 13:14 | 1.2K | RITCHIE (DURANT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.3.html | 2013-12-16 13:14 | 1.2K | RITCHIE (MAURO v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.3.pdf | 2011-11-01 10:47 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.4.html | 2013-12-16 13:14 | 2.9K | RITCHIE v. STONE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.4.pdf | 2011-11-01 10:47 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.5.html | 2013-12-16 13:14 | 1.2K | RITCHIE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.5.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0842.6.html | 2013-12-16 13:14 | 4.2K | RITCHIE v. WOODS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0842.6.pdf | 2011-11-01 10:47 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0843.1.html | 2013-12-16 13:14 | 1.2K | RITTEN (SPOFFOBD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0843.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0843.2.html | 2013-12-16 13:14 | 5.9K | RITTEN v. UNION PAC. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0843.2.pdf | 2011-11-01 10:47 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0843.3.html | 2013-12-16 13:14 | 1.2K | RITTER (COURCIER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0843.3.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0843.4.html | 2013-12-16 13:14 | 11K | RITTER et al. v. SERRELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0843.4.pdf | 2011-11-01 10:47 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0845.1.html | 2013-12-16 13:14 | 1.2K | RITTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0845.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0845.2.html | 2013-12-16 13:14 | 7.0K | The RIVAL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0845.2.pdf | 2011-11-01 10:47 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0846.1.html | 2013-12-16 13:14 | 1.3K | The RIVER QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0846.1.pdf | 2011-11-01 10:47 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0846.2.html | 2013-12-16 13:14 | 1.2K | RIVERS (VIRGINIA v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0846.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0846.3.html | 2013-12-16 13:14 | 1.2K | RIVES (PAGE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0846.3.pdf | 2011-11-01 10:47 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0846.4.html | 2013-12-16 13:14 | 10K | RIX v. CAPITOL BANK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0846.4.pdf | 2011-11-01 10:47 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0848.html | 2013-12-16 13:14 | 7.8K | The R. L. MAYBEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0848.pdf | 2011-11-01 10:47 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0849.1.html | 2013-12-16 13:14 | 5.0K | The R. L. MAYBEX. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0849.1.pdf | 2011-11-01 10:47 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0849.2.html | 2013-12-16 13:14 | 1.3K | The R. L. STEVENS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0849.2.pdf | 2011-11-01 10:47 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0849.3.html | 2013-12-16 13:14 | 3.8K | ROACH v. BURGESS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0849.3.pdf | 2011-11-01 10:47 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0850.1.html | 2013-12-16 13:14 | 1.2K | ROACH (CONOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0850.1.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0850.2.html | 2013-12-16 13:14 | 1.2K | ROACH (HATHAWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0850.2.pdf | 2011-11-01 10:47 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0850.3.html | 2013-12-16 13:14 | 8.1K | ROACH v. HULINGS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0850.3.pdf | 2011-11-01 10:48 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0851.1.html | 2013-12-16 13:14 | 4.8K | The ROANOKE |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0851.1.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0851.2.html | 2013-12-16 13:14 | 1.2K | ROANOKE. The (LAWRENCE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0851.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0851.3.html | 2013-12-16 13:14 | 5.7K | The ROARER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0851.3.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0852.html | 2013-12-16 13:14 | 14K | ROBACK v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0852.pdf | 2011-11-01 10:48 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0854.1.html | 2013-12-16 13:14 | 1.2K | ROBB (COMEGYSS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0854.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0854.2.html | 2013-12-16 13:14 | 1.2K | ROBB (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0854.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0854.3.html | 2013-12-16 13:14 | 1.2K | ROBB (DIDLAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0854.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0854.4.html | 2013-12-16 13:14 | 1.3K | Case of ROBBINS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0854.4.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0854.5.html | 2013-12-16 13:14 | 12K | Ex parte ROBBINS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0854.5.pdf | 2011-11-01 10:48 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0856.1.html | 2013-12-16 13:14 | 1.2K | ROBBINS (ATKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0856.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0856.2.html | 2013-12-16 13:14 | 1.2K | ROBBINS (BRUSH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0856.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0856.3.html | 2013-12-16 13:14 | 1.2K | ROBBINS (CLAFFLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0856.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0856.4.html | 2013-12-16 13:14 | 13K | ROBBINS v. DAVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0856.4.pdf | 2011-11-01 10:48 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0858.1.html | 2013-12-16 13:14 | 1.2K | ROBBINS (FARMERS' BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0858.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0858.2.html | 2013-12-16 13:14 | 26K | ROBBINS et al. v. FIREMEN'S FUND INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0858.2.pdf | 2011-11-01 10:48 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0862.html | 2013-12-16 13:14 | 3.7K | ROBBINS et al. v. FIREMEN'S FUND INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0862.pdf | 2011-11-01 10:48 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0863.html | 2013-12-16 13:14 | 6.6K | ROBBINS v. FREELAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0863.pdf | 2011-11-01 10:48 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0864.html | 2013-12-16 13:14 | 7.6K | LOBBINS v. McDONALD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0864.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0865.1.html | 2013-12-16 13:14 | 5.6K | ROBBINS v. PEOPLE'S INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0865.1.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0865.2.html | 2013-12-16 13:14 | 1.2K | ROBBINS (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0865.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0865.3.html | 2013-12-16 13:14 | 1.2K | ROBBINS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0865.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0865.4.html | 2013-12-16 13:14 | 2.9K | ROBBINS et al. v. UPTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0865.4.pdf | 2011-11-01 10:48 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0866.html | 2013-12-16 13:14 | 7.3K | ROBBINS v. WELSH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0866.pdf | 2011-11-01 10:48 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0867.html | 2013-12-16 13:14 | 12K | ROBERDEAU v. ROBERDEAU. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0867.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0868.1.html | 2013-12-16 13:14 | 1.2K | ROBERT v. The GALATEA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0868.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0868.2.html | 2013-12-16 13:14 | 1.2K | ROBERT v. The YUBA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0868.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0869.1.html | 2013-12-16 13:14 | 5.2K | The ROBERT BRUCE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0869.1.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0869.2.html | 2013-12-16 13:14 | 1.2K | ROBERT CENTER, The (ATLANTIC & P. GUANO CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0869.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0869.3.html | 2013-12-16 13:14 | 1.2K | ROBERT F. STOCKTON, The (EDWARDS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0869.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0869.4.html | 2013-12-16 13:14 | 21K | The ROBERT FULTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0869.4.pdf | 2011-11-01 10:48 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0872.1.html | 2013-12-16 13:14 | 1.2K | ROBERT G. SHAW, The (FOLGER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0872.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0872.2.html | 2013-12-16 13:14 | 5.5K | The ROBERT J. MERCER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0872.2.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0873.html | 2013-12-16 13:14 | 17K | The ROBERT L. LANE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0873.pdf | 2011-11-01 10:48 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0876.1.html | 2013-12-16 13:14 | 1.2K | ROBERT L. STEVENS, The (ABBEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0876.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0876.2.html | 2013-12-16 13:14 | 4.5K | The ROBERT MORRIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0876.2.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0876.3.html | 2013-12-16 13:14 | 1.2K | ROBERT MORRIS. The, (McLELLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0876.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0876.4.html | 2013-12-16 13:14 | 9.7K | The ROBERT NOBLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0876.4.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0878.1.html | 2013-12-16 13:14 | 1.3K | The ROBERT RITSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0878.1.pdf | 2011-11-01 10:48 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0878.2.html | 2013-12-16 13:14 | 7.4K | In re ROBERTS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0878.2.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0879.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS (BANK of UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0879.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0879.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS v. BLAKE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0879.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0879.3.html | 2013-12-16 13:14 | 1.2K | ROBERTS (BOYER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0879.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0879.4.html | 2013-12-16 13:14 | 7.0K | ROBERTS v. BUCK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0879.4.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0880.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS (COOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0880.1.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0880.2.html | 2013-12-16 13:14 | 5.7K | ROBERTS v. DALLAS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0880.2.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0880.3.html | 2013-12-16 13:14 | 48K | ROBERTS v. DICKEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0880.3.pdf | 2011-11-01 10:48 | 166K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0883_01.jpg | 2011-07-23 13:25 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0889.1.html | 2013-12-16 13:14 | 1.3K | ROBERTS v. DODGE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0889.1.pdf | 2011-11-01 10:48 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0889.2.html | 2013-12-16 13:14 | 8.9K | ROBERTS v. ELDRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0889.2.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0890.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS (FLINT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0890.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0890.2.html | 2013-12-16 13:14 | 5.7K | ROBERTS v. GALLAGHER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0890.2.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0891.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS (GALLAGHER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0891.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0891.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS (GREENWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0891.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0891.3.html | 2013-12-16 13:14 | 20K | ROBERTS v. HARNDEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0891.3.pdf | 2011-11-01 10:48 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0894.html | 2013-12-16 13:14 | 7.2K | ROBERTS et al. v. The HUNTSVILLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0894.pdf | 2011-11-01 10:48 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0895.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS v. JAILER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0895.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0895.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS (KENT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0895.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0895.3.html | 2013-12-16 13:14 | 1.2K | ROBERTS (MEADE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0895.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0895.4.html | 2013-12-16 13:14 | 20K | ROBERTS et ux. v. MOORE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0895.4.pdf | 2011-11-01 10:48 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0898.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS v. MEYERS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0898.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0898.2.html | 2013-12-16 13:14 | 14K | ROBERTS v. MYERS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0898.2.pdf | 2011-11-01 10:48 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0900.html | 2013-12-16 13:14 | 12K | ROBERTS v. NELSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0900.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0902.html | 2013-12-16 13:14 | 23K | ROBERTS et al. v. The OCEAN STAR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0902.pdf | 2011-11-01 10:48 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0905.html | 2013-12-16 13:14 | 29K | ROBERTS v. PILLOW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0905.pdf | 2011-11-01 10:48 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0910.html | 2013-12-16 13:14 | 7.3K | ROBERTS v. REED TORPEDO CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0910.pdf | 2011-11-01 10:48 | 58K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0910_01.jpg | 2011-07-23 13:25 | 16K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0911.1.html | 2013-12-16 13:14 | 2.5K | ROBERTS v. REINTZELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0911.1.pdf | 2011-11-01 10:48 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0911.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS v. The ROCKLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0911.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0911.3.html | 2013-12-16 13:14 | 6.4K | ROBERTS v. ROTER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0911.3.pdf | 2011-11-01 10:48 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0912.html | 2013-12-16 13:14 | 54K | ROBERTS v. RYER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0912.pdf | 2011-11-01 10:48 | 160K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0913_01.jpg | 2011-07-23 13:25 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0921.html | 2013-12-16 13:14 | 40K | ROBERTS et al. v. The ST. JAMES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0921.pdf | 2011-11-01 10:48 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0928.html | 2013-12-16 13:14 | 13K | ROBERTS v. SCHUYLER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0928.pdf | 2011-11-01 10:48 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0930.html | 2013-12-16 13:14 | 13K | ROBERTS v. SHELDON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0930.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0932.html | 2013-12-16 13:14 | 27K | ROBERTS v. SKOLFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0932.pdf | 2011-11-01 10:48 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0936.1.html | 2013-12-16 13:14 | 1.2K | ROBERTS (STUMP v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0936.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0936.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0936.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0936.3.html | 2013-12-16 13:14 | 6.7K | ROBERTS et al. v. WARD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0936.3.pdf | 2011-11-01 10:48 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0937.html | 2013-12-16 13:14 | 7.4K | ROBERTS v. YATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0937.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0938.1.html | 2013-12-16 13:14 | 4.0K | ROBERTS v. The YUBA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0938.1.pdf | 2011-11-01 10:48 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0938.2.html | 2013-12-16 13:14 | 1.2K | ROBERTS v. The YUBA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0938.2.pdf | 2011-11-01 10:48 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0938.3.html | 2013-12-16 13:14 | 12K | Ex parte ROBERTSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0938.3.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0940.1.html | 2013-12-16 13:14 | 1.3K | In re ROBERTSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0940.1.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0940.2.html | 2013-12-16 13:14 | 17K | The ROBERTSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0940.2.pdf | 2011-11-01 10:48 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.1.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (BLAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.2.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.3.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (CARSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.4.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (CHESAPEAKE & O. CANAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.4.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.5.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (DIBBLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.5.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.6.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (ELLITHORP v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.6.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0943.7.html | 2013-12-16 13:14 | 8.7K | ROBERTSON v. GARRETT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0943.7.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0944.html | 2013-12-16 13:14 | 11K | ROBERTSON v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0944.pdf | 2011-11-01 10:48 | 65K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.0945_01.jpg | 2011-07-23 13:25 | 18K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0946.html | 2013-12-16 13:14 | 27K | ROBERTSON v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0946.pdf | 2011-11-01 10:48 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0950.1.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (MUNRO v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0950.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0950.2.html | 2013-12-16 13:14 | 1.2K | ROBERSTON (POLK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0950.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0950.3.html | 2013-12-16 13:14 | 3.5K | ROBERTSON v. ROE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0950.3.pdf | 2011-11-01 10:48 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0950.4.html | 2013-12-16 13:14 | 25K | ROBERTSON v. SECOMBE MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0950.4.pdf | 2011-11-01 10:48 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0954.1.html | 2013-12-16 13:14 | 2.4K | ROBERTSON v. SELBY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0954.1.pdf | 2011-11-01 10:48 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0954.2.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0954.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0954.3.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (WARNER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0954.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0954.4.html | 2013-12-16 13:14 | 25K | ROBERTSON v. WELLSVILLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0954.4.pdf | 2011-11-01 10:48 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0958.1.html | 2013-12-16 13:14 | 1.2K | ROBERTSON (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0958.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0958.2.html | 2013-12-16 13:14 | 1.2K | ROBERTSON, The (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0958.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0958.3.html | 2013-12-16 13:14 | 9.5K | ROBIN et al. v. The CACIQUE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0958.3.pdf | 2011-11-01 10:48 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0960.1.html | 2013-12-16 13:14 | 5.6K | ROBINS et al. v. POPE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0960.1.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0960.2.html | 2013-12-16 13:14 | 1.2K | ROBINS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0960.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0961.html | 2013-12-16 13:14 | 18K | Ex parte ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0961.pdf | 2011-11-01 10:48 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0963.html | 2013-12-16 13:14 | 9.5K | Ex parte ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0963.pdf | 2011-11-01 10:48 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0965.html | 2013-12-16 13:14 | 27K | Ex parte ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0965.pdf | 2011-11-01 10:48 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0969.html | 2013-12-16 13:14 | 23K | Ex parte ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0969.pdf | 2011-11-01 10:48 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0973.html | 2013-12-16 13:14 | 9.5K | In le ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0973.pdf | 2011-11-01 10:48 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0974.html | 2013-12-16 13:14 | 28K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0974.pdf | 2011-11-01 10:48 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0978.1.html | 2013-12-16 13:14 | 6.0K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0978.1.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0978.2.html | 2013-12-16 13:14 | 8.9K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0978.2.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0980.html | 2013-12-16 13:14 | 7.4K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0980.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0981.html | 2013-12-16 13:14 | 6.9K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0981.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0982.1.html | 2013-12-16 13:14 | 4.6K | In re ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0982.1.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0982.2.html | 2013-12-16 13:14 | 6.4K | In re ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0982.2.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0983.html | 2013-12-16 13:14 | 15K | In re ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0983.pdf | 2011-11-01 10:48 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0985.1.html | 2013-12-16 13:14 | 1.2K | The ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0985.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0985.2.html | 2013-12-16 13:14 | 1.2K | ROBINSON (ALLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0985.2.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0985.3.html | 2013-12-16 13:14 | 1.2K | ROBINSON (CARPENTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0985.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0985.4.html | 2013-12-16 13:14 | 64K | ROBINSON v. CATHCART. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0985.4.pdf | 2011-11-01 10:48 | 146K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.0996.html | 2013-12-16 13:14 | 38K | ROBINSON v. CATHCART. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.0996.pdf | 2011-11-01 10:48 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1001.html | 2013-12-16 13:14 | 6.1K | ROBINSON v. CLIFFORD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1001.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1002.html | 2013-12-16 13:14 | 20K | ROBINSON v. COMMONWEALTH INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1002.pdf | 2011-11-01 10:48 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1005.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (CORPS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1005.1.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1005.2.html | 2013-12-16 13:14 | 1.2K | ROBINSON (CROWNINSHIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1005.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1005.3.html | 2013-12-16 13:14 | 7.7K | ROBINSON v. DOW. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1005.3.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1006.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1006.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1006.2.html | 2013-12-16 13:14 | 26K | ROBINSON v. GALLIER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1006.2.pdf | 2011-11-01 10:48 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1010.html | 2013-12-16 13:14 | 6.1K | ROBINSON v. GIFFOED. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1010.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1011.html | 2013-12-16 13:14 | 7.1K | ROBINSON v. HALL et al., HALL et al. v. SCHNEIDER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1011.pdf | 2011-11-01 10:48 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1012.html | 2013-12-16 13:14 | 5.4K | ROBINSON et. al. v. HANWAY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1012.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1013.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON, The (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1013.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1013.2.html | 2013-12-16 13:14 | 1.2K | ROBINSON (HAZARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1013.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1013.3.html | 2013-12-16 13:14 | 24K | ROBINSON v. HINCKLEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1013.3.pdf | 2011-11-01 10:48 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1016.html | 2013-12-16 13:14 | 6.1K | ROBINSON et al. v. HOLT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1016.pdf | 2011-11-01 10:48 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1017.html | 2013-12-16 13:14 | 43K | ROBINSON v. HOOK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1017.pdf | 2011-11-01 10:48 | 107K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1023.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON v. The HUNTRESS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1023.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1023.2.html | 2013-12-16 13:14 | 1.2K | ROBINSON (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1023.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1024.html | 2013-12-16 13:14 | 20K | ROBINSON v. KILBRETH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1024.pdf | 2011-11-01 10:48 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1027.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (LIDDERDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1027.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1027.2.html | 2013-12-16 13:14 | 5.4K | ROBINSON et al. v. The LILLIE MILLS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1027.2.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1027.3.html | 2013-12-16 13:14 | 39K | ROBINSON v. MANDELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1027.3.pdf | 2011-11-01 10:48 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1034.html | 2013-12-16 13:14 | 7.4K | ROBINSON v. The MEDORA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1034.pdf | 2011-11-01 10:48 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1035.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (METCALF v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1035.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1035.2.html | 2013-12-16 13:14 | 8.0K | ROBINSON et ux. v. MOORE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1035.2.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1036.html | 2013-12-16 13:14 | 49K | ROBINSON v. MUTUAL BEN. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1036.pdf | 2011-11-01 10:48 | 119K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1044.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1044.1.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1044.2.html | 2013-12-16 13:14 | 5.7K | ROBINSON et al. v. RANDOLPH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1044.2.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.1.html | 2013-12-16 13:14 | 5.1K | ROBINSON et al. v. RANDOLPH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.1.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.2.html | 2013-12-16 13:14 | 1.2K | ROBINSON (RANDOLPH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.3.html | 2013-12-16 13:14 | 1.2K | ROBINSON (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.3.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.4.html | 2013-12-16 13:14 | 1.2K | ROBINSON (REELER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.4.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.5.html | 2013-12-16 13:14 | 1.2K | ROBINSON (REPPERT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.5.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1045.6.html | 2013-12-16 13:14 | 4.8K | ROBINSON v. ST. LOUIS MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1045.6.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1046.1.html | 2013-12-16 13:14 | 1.3K | ROBINSON v. SATTERLEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1046.1.pdf | 2011-11-01 10:48 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1046.2.html | 2013-12-16 13:14 | 1.3K | ROBINSON v. SATTERLEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1046.2.pdf | 2011-11-01 10:48 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1046.3.html | 2013-12-16 13:14 | 20K | ROBINSON v. SATTERLEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1046.3.pdf | 2011-11-01 10:48 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1049.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (SHARPLESS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1049.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1049.2.html | 2013-12-16 13:14 | 23K | ROBINSON v. TUTTLE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1049.2.pdf | 2011-11-01 10:48 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1053.1.html | 2013-12-16 13:14 | 1.2K | ROBINSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1053.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1053.2.html | 2013-12-16 13:14 | 3.7K | ROBINSON v. WILEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1053.2.pdf | 2011-11-01 10:48 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1053.3.html | 2013-12-16 13:14 | 20K | ROBINSON v. WISCONSIN M. & F. INS. CO. BANK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1053.3.pdf | 2011-11-01 10:48 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1056.html | 2013-12-16 13:14 | 20K | ROBISON et al. v. CODMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1056.pdf | 2011-11-01 10:48 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1060.1.html | 2013-12-16 13:14 | 1.2K | ROB ROY, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1060.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1060.2.html | 2013-12-16 13:14 | 23K | ROBSON v. The HUNTRESS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1060.2.pdf | 2011-11-01 10:48 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1063.html | 2013-12-16 13:14 | 5.8K | ROBY v. LYNDALL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1063.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1064.html | 2013-12-16 13:14 | 6.4K | The ROCHAMBEAU. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1064.pdf | 2011-11-01 10:48 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1065.1.html | 2013-12-16 13:14 | 1.2K | ROCHAMBEAU. The (TRAECARTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1065.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1065.2.html | 2013-12-16 13:14 | 9.0K | ROCHE et al. v. FOX. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1065.2.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1066.1.html | 2013-12-16 13:14 | 1.2K | ROCHE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1066.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1066.2.html | 2013-12-16 13:14 | 4.9K | ROCHELL et al. v. PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1066.2.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1067.1.html | 2013-12-16 13:14 | 1.2K | ROCHEREAU (REID) v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1067.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1067.2.html | 2013-12-16 13:14 | 1.2K | ROCKAWAY, The (BYRNES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1067.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1067.3.html | 2013-12-16 13:14 | 1.2K | ROCKEFELLER (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1067.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1067.4.html | 2013-12-16 13:14 | 18K | The ROCKET. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1067.4.pdf | 2011-11-01 10:48 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1070.1.html | 2013-12-16 13:14 | 1.3K | ROCKET v. The SOUTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1070.1.pdf | 2011-11-01 10:48 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1070.2.html | 2013-12-16 13:14 | 5.5K | Ex parte ROCKETT., In re TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1070.2.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1070.3.html | 2013-12-16 13:14 | 1.2K | ROCKEY (McLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1070.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1071.html | 2013-12-16 13:14 | 13K | In re ROCKFORD, R. I. & ST. L. R. CO., In re McKAY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1071.pdf | 2011-11-01 10:48 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1072.1.html | 2013-12-16 13:14 | 1.2K | ROCKFORD, R. I. & ST. L. R. CO. v. McKAY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1072.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1072.2.html | 2013-12-16 13:14 | 1.3K | ROCKFORD, R. I. & ST. L. R. CO. (UNION TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1072.2.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1073.1.html | 2013-12-16 13:14 | 2.5K | ROCKHILL v. HANNA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1073.1.pdf | 2011-11-01 10:48 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1073.2.html | 2013-12-16 13:14 | 18K | ROCKHILL et al. v. HANNA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1073.2.pdf | 2011-11-01 10:48 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1076.1.html | 2013-12-16 13:14 | 5.3K | The ROCKIE E. YATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1076.1.pdf | 2011-11-01 10:48 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1076.2.html | 2013-12-16 13:14 | 1.2K | ROCK ISLAND (RUCH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1076.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1076.3.html | 2013-12-16 13:14 | 1.2K | ROCK ISLAND COUNTY (DOWNS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1076.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1076.4.html | 2013-12-16 13:14 | 4.3K | The ROCKLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1076.4.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1077.html | 2013-12-16 13:14 | 12K | ROCKMULH v. PITTSBURGH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1077.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1079.1.html | 2013-12-16 13:14 | 5.0K | ROCKSELL et al. v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1079.1.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1079.2.html | 2013-12-16 13:14 | 2.5K | ROCKVILLE & W. TURNPIKE ROAD v. ANDREWS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1079.2.pdf | 2011-11-01 10:48 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1079.3.html | 2013-12-16 13:14 | 2.6K | ROCKVILLE & W. TURNPIKE ROAD v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1079.3.pdf | 2011-11-01 10:48 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1080.html | 2013-12-16 13:14 | 7.8K | ROCKVILLE & W. TURNPIKE ROAD v. VAN NESS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1080.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1081.html | 2013-12-16 13:14 | 14K | In re ROCKWELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1081.pdf | 2011-11-01 10:48 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1083.1.html | 2013-12-16 13:14 | 1.2K | ROCKWOOD (OSGOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1083.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1083.2.html | 2013-12-16 13:14 | 6.0K | RODBIRD v. RODBIRD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1083.2.pdf | 2011-11-01 10:48 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1084.1.html | 2013-12-16 13:14 | 4.1K | In re RODDIN et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1084.1.pdf | 2011-11-01 10:48 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1084.2.html | 2013-12-16 13:14 | 7.7K | RODDY v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1084.2.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1085.html | 2013-12-16 13:14 | 20K | In re RODGER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1085.pdf | 2011-11-01 10:48 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1088.html | 2013-12-16 13:14 | 8.8K | In re RODGER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1088.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1089.1.html | 2013-12-16 13:14 | 1.2K | RODGERS (NICOLLS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1089.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1089.2.html | 2013-12-16 13:14 | 1.2K | RODGERS (NUTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1089.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1089.3.html | 2013-12-16 13:14 | 1.2K | RODMAN (SICKELS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1089.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1090.html | 2013-12-16 13:14 | 16K | The RODNEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1090.pdf | 2011-11-01 10:48 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.1.html | 2013-12-16 13:14 | 1.2K | RODNEY (HURST v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.2.html | 2013-12-16 13:14 | 1.2K | RODOCANACHI v. The OREGON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.3.html | 2013-12-16 13:14 | 1.2K | RODOCANACHI (SOULE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.4.html | 2013-12-16 13:14 | 1.2K | RODRIGUEZ (ALEXANDER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.4.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.5.html | 2013-12-16 13:14 | 1.3K | RODRIGUEZ v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.5.pdf | 2011-11-01 10:48 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.6.html | 2013-12-16 13:14 | 1.2K | RODRIGUEZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.6.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.7.html | 2013-12-16 13:14 | 1.2K | ROE (DUSSERT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.7.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.8.html | 2013-12-16 13:14 | 1.2K | ROE (ROBERTSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.8.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1092.9.html | 2013-12-16 13:14 | 4.1K | Ex parte ROELKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1092.9.pdf | 2011-11-01 10:48 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1093.1.html | 2013-12-16 13:14 | 1.2K | ROELLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1093.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1093.2.html | 2013-12-16 13:14 | 1.2K | ROEMER (CROUCH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1093.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1093.3.html | 2013-12-16 13:14 | 22K | ROEMER v. LOGOWITZ et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1093.3.pdf | 2011-11-01 10:48 | 87K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.1094_01.jpg | 2011-07-23 13:24 | 16K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1097.html | 2013-12-16 13:14 | 19K | ROEMER v. SIMON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1097.pdf | 2011-11-01 10:48 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1100.1.html | 2013-12-16 13:14 | 4.5K | ROEMER v. SIMON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1100.1.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1100.2.html | 2013-12-16 13:14 | 18K | ROFF et al. v. WASS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1100.2.pdf | 2011-11-01 10:48 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1103.html | 2013-12-16 13:14 | 7.3K | ROFF v. WASS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1103.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1104.html | 2013-12-16 13:14 | 7.4K | In re ROGERS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1104.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1105.1.html | 2013-12-16 13:14 | 4.6K | In re ROGERS et. al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1105.1.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1105.2.html | 2013-12-16 13:14 | 9.0K | In re ROGERS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1105.2.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1107.1.html | 2013-12-16 13:14 | 3.1K | ROGERS v. ABBOT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1107.1.pdf | 2011-11-01 10:48 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1107.2.html | 2013-12-16 13:14 | 24K | ROGERS v. The AMADO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1107.2.pdf | 2011-11-01 10:48 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1111.1.html | 2013-12-16 13:14 | 2.0K | ROGERS v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1111.1.pdf | 2011-11-01 10:48 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1111.2.html | 2013-12-16 13:14 | 1.3K | ROGERS v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1111.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1111.3.html | 2013-12-16 13:14 | 1.2K | ROGERS (BARTLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1111.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1111.4.html | 2013-12-16 13:14 | 10K | ROGERS et al. v. CINCINNATI. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1111.4.pdf | 2011-11-01 10:48 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1112.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (COMMONWEALTH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1112.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1112.2.html | 2013-12-16 13:14 | 2.4K | ROGERS et al. v. CROMMELIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1112.2.pdf | 2011-11-01 10:48 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1113.1.html | 2013-12-16 13:14 | 6.5K | ROGERS v. ENNIS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1113.1.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1113.2.html | 2013-12-16 13:14 | 4.6K | ROGERS v. FENWICK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1113.2.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1114.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (FRENCH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1114.1.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1114.2.html | 2013-12-16 13:14 | 1.2K | ROGERS (HEARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1114.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1114.3.html | 2013-12-16 13:14 | 1.2K | ROGERS v. HURNEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1114.3.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1114.4.html | 2013-12-16 13:14 | 9.4K | ROGERS v. JEWETT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1114.4.pdf | 2011-11-01 10:48 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1115.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1115.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1115.2.html | 2013-12-16 13:14 | 1.2K | ROGERS (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1115.2.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1115.3.html | 2013-12-16 13:14 | 5.7K | ROGERS v. LEE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1115.3.pdf | 2011-11-01 10:48 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1116.html | 2013-12-16 13:14 | 7.3K | ROGERS et al. v. LEWIS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1116.pdf | 2011-11-01 10:48 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1117.1.html | 2013-12-16 13:14 | 3.8K | ROGERS v. LINN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1117.1.pdf | 2011-11-01 10:48 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1117.2.html | 2013-12-16 13:14 | 1.2K | ROGERS (LONG v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1117.2.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1117.3.html | 2013-12-16 13:14 | 1.3K | ROGERS MARSHALL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1117.3.pdf | 2011-11-01 10:48 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1117.4.html | 2013-12-16 13:14 | 1.2K | ROGERS (MATTOCKS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1117.4.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1118.1.html | 2013-12-16 13:14 | 4.5K | ROGERS v. MAY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1118.1.pdf | 2011-11-01 10:48 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1118.2.html | 2013-12-16 13:14 | 17K | ROGERS v. MECHANICS' INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1118.2.pdf | 2011-11-01 10:48 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1121.html | 2013-12-16 13:14 | 7.6K | ROGERS v. MECHANICS' INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1121.pdf | 2011-11-01 10:48 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1122.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (MOFFITT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1122.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1122.2.html | 2013-12-16 13:14 | 24K | ROGERS et al. v. PARKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1122.2.pdf | 2011-11-01 10:48 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1125.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (PETERS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1125.1.pdf | 2011-11-01 10:48 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1125.2.html | 2013-12-16 13:14 | 5.1K | ROGERS v. The RELIANCE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1125.2.pdf | 2011-11-01 10:48 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1126.1.html | 2013-12-16 13:14 | 1.2K | ROGERS v. The RIVAL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1126.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1126.2.html | 2013-12-16 13:14 | 16K | ROGERS et al. v. SARGENT et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1126.2.pdf | 2011-11-01 10:48 | 71K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.1127_01.jpg | 2011-07-23 13:24 | 13K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1129.html | 2013-12-16 13:14 | 9.9K | ROGERS et al. v. The S. B. WHEELER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1129.pdf | 2011-11-01 10:48 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1130.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (STIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1130.1.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1130.2.html | 2013-12-16 13:14 | 1.2K | ROGERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1130.2.pdf | 2011-11-01 10:48 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1130.3.html | 2013-12-16 13:14 | 12K | ROGERS v. WELLER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1130.3.pdf | 2011-11-01 10:48 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1132.html | 2013-12-16 13:14 | 14K | ROGERS v. WINSOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1132.pdf | 2011-11-01 10:48 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1134.1.html | 2013-12-16 13:14 | 1.2K | ROGERS (WOODWORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1134.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1134.2.html | 2013-12-16 13:14 | 1.2K | ROGERS (WEIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1134.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1134.3.html | 2013-12-16 13:14 | 11K | ROGERS LOCOMOTIVE WORKS v. LEWIS et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1134.3.pdf | 2011-11-01 10:49 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1136.1.html | 2013-12-16 13:14 | 1.2K | ROGER WILLIAMS INS. CO. (BULLARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1136.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1136.2.html | 2013-12-16 13:14 | 1.2K | ROLAND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1136.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1136.3.html | 2013-12-16 13:14 | 3.7K | ROLLER v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1136.3.pdf | 2011-11-01 10:49 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1136.4.html | 2013-12-16 13:14 | 5.9K | ROLLHAUS v. McPHERSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1136.4.pdf | 2011-11-01 10:49 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1137.1.html | 2013-12-16 13:14 | 1.2K | ROLLING WAVE, The (COHAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1137.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1137.2.html | 2013-12-16 13:14 | 1.2K | ROLLINS (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1137.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1137.3.html | 2013-12-16 13:14 | 1.2K | ROLLINS (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1137.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1137.4.html | 2013-12-16 13:14 | 19K | ROLLINS v. TWITCHELL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1137.4.pdf | 2011-11-01 10:49 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1140.1.html | 2013-12-16 13:14 | 1.2K | ROLLINSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1140.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1140.2.html | 2013-12-16 13:14 | 1.2K | ROLLO (DRAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1140.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1140.3.html | 2013-12-16 13:14 | 1.2K | ROLLO (HITCHCOCK v.) |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1140.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1140.4.html | 2013-12-16 13:14 | 1.2K | ROLLSTONE MACH. WORKS (WHITNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1140.4.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1140.5.html | 2013-12-16 13:14 | 5.0K | ROMAYNE v. DUANE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1140.5.pdf | 2011-11-01 10:49 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1141.html | 2013-12-16 13:14 | 21K | ROMERO et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1141.pdf | 2011-11-01 10:49 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1144.1.html | 2013-12-16 13:14 | 1.2K | ROME. W. & O. R. CO. (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1144.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1144.2.html | 2013-12-16 13:14 | 1.2K | ROMEYN (WESTBROOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1144.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1144.3.html | 2013-12-16 13:14 | 1.2K | ROMEYNE (COPE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1144.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1144.4.html | 2013-12-16 13:14 | 24K | The ROMP. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1144.4.pdf | 2011-11-01 10:49 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1148.html | 2013-12-16 13:14 | 28K | RONALD v. BARKLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1148.pdf | 2011-11-01 10:49 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1152.html | 2013-12-16 13:14 | 8.7K | RONEDE v. JERSEY CITY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1152.pdf | 2011-11-01 10:49 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1153.1.html | 2013-12-16 13:14 | 1.2K | RONZONE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1153.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1153.2.html | 2013-12-16 13:14 | 1.2K | ROOD (ABBE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1153.2.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1153.3.html | 2013-12-16 13:14 | 1.2K | ROOD (COLT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1153.3.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1153.4.html | 2013-12-16 13:14 | 7.3K | In re ROONEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1153.4.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1154.html | 2013-12-16 13:14 | 6.8K | ROOSEVELT v. The C. H. FROST. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1154.pdf | 2011-11-01 10:49 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1155.html | 2013-12-16 13:14 | 15K | ROOSEVELT et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1155.pdf | 2011-11-01 10:49 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1157.1.html | 2013-12-16 13:14 | 1.2K | ROOT (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1157.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1157.2.html | 2013-12-16 13:14 | 10K | ROOT v. BALL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1157.2.pdf | 2011-11-01 10:49 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1159.1.html | 2013-12-16 13:14 | 6.2K | ROOT v. BROTHERSON et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1159.1.pdf | 2011-11-01 10:49 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1159.2.html | 2013-12-16 13:14 | 4.6K | ROOT v. GODARD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1159.2.pdf | 2011-11-01 10:49 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1160.1.html | 2013-12-16 13:14 | 1.2K | ROOT (GOODYEAR DENTAL VULCANITE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1160.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1160.2.html | 2013-12-16 13:14 | 1.2K | ROOT v. HILLIARD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1160.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1160.3.html | 2013-12-16 13:14 | 1.1K | ROOT (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1160.3.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1160.4.html | 2013-12-16 13:14 | 1.2K | ROOT (MORTON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1160.4.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1160.5.html | 2013-12-16 13:14 | 44K | ROOT v. SHIELDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1160.5.pdf | 2011-11-01 10:49 | 117K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1167.html | 2013-12-16 13:14 | 6.8K | ROOT v. WALLACE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1167.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1168.html | 2013-12-16 13:14 | 19K | ROOTS et al. v. HYNDMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1168.pdf | 2011-11-01 10:49 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1171.1.html | 2013-12-16 13:14 | 1.2K | ROPES (BEARSE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1171.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1171.2.html | 2013-12-16 13:14 | 24K | ROPES et al. v. CLINCH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1171.2.pdf | 2011-11-01 10:49 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1175.html | 2013-12-16 13:14 | 6.8K | The ROSCIUS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1175.pdf | 2011-11-01 10:49 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1176.1.html | 2013-12-16 13:14 | 5.4K | In re ROSE et al., WALKER v. BARTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1176.1.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1176.2.html | 2013-12-16 13:14 | 9.9K | The ROSE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1176.2.pdf | 2011-11-01 10:49 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1178.1.html | 2013-12-16 13:14 | 1.2K | ROSE (BIAS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1178.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1178.2.html | 2013-12-16 13:14 | 1.2K | ROSE (FOLLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1178.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1178.3.html | 2013-12-16 13:14 | 7.3K | ROSE v. HIMELY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1178.3.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1179.html | 2013-12-16 13:14 | 32K | ROSE v. HIMELY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1179.pdf | 2011-11-01 10:49 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1184.html | 2013-12-16 13:14 | 18K | ROSE v. HIMILI et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1184.pdf | 2011-11-01 10:49 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1187.html | 2013-12-16 13:14 | 10K | ROSE v. HIMILI. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1187.pdf | 2011-11-01 10:49 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1188.1.html | 2013-12-16 13:14 | 3.5K | ROSE v. KENNEDY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1188.1.pdf | 2011-11-01 10:49 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1188.2.html | 2013-12-16 13:14 | 16K | ROSE v. NILES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1188.2.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1191.1.html | 2013-12-16 13:14 | 1.2K | ROSE (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1191.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1191.2.html | 2013-12-16 13:14 | 8.6K | ROSE v. SIBLEY MACH. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1191.2.pdf | 2011-11-01 10:49 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1192.1.html | 2013-12-16 13:14 | 1.2K | ROSE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1192.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1192.2.html | 2013-12-16 13:14 | 1.2K | ROSE, The (WATSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1192.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1192.3.html | 2013-12-16 13:14 | 1.2K | ROSE (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1192.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1192.4.html | 2013-12-16 13:14 | 8.4K | In re ROSEBERRY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1192.4.pdf | 2011-11-01 10:49 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1193.1.html | 2013-12-16 13:14 | 1.2K | ROSEDALE, The (GARDNER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1193.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1193.2.html | 2013-12-16 13:14 | 6.8K | ROSENBAUM v. GARNETT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1193.2.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1194.html | 2013-12-16 13:14 | 16K | In re ROSENBERG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1194.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1196.html | 2013-12-16 13:14 | 7.4K | In re ROSENBERG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1196.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1197.html | 2013-12-16 13:14 | 5.2K | In re ROSENBERG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1197.pdf | 2011-11-01 10:49 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1198.1.html | 2013-12-16 13:14 | 1.2K | ROSENBERGER (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1198.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1198.2.html | 2013-12-16 13:14 | 28K | In re ROSENFELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1198.2.pdf | 2011-11-01 10:49 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1202.html | 2013-12-16 13:14 | 16K | In re ROSENFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1202.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1205.html | 2013-12-16 13:14 | 10K | In re ROSENFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1205.pdf | 2011-11-01 10:49 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1206.html | 2013-12-16 13:14 | 16K | ROSENFIELD v. EXPRESS CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1206.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1209.html | 2013-12-16 13:14 | 13K | In re ROSENFIELDS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1209.pdf | 2011-11-01 10:49 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1211.1.html | 2013-12-16 13:14 | 5.6K | In re ROSENTHAL et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1211.1.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1211.2.html | 2013-12-16 13:14 | 17K | ROSENTHAL v. MASTIN BANK et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1211.2.pdf | 2011-11-01 10:49 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1214.1.html | 2013-12-16 13:14 | 1.3K | Case of ROSETTA |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1214.1.pdf | 2011-11-01 10:49 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1214.2.html | 2013-12-16 13:14 | 3.4K | In re ROSEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1214.2.pdf | 2011-11-01 10:49 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1214.3.html | 2013-12-16 13:14 | 15K | In re ROSEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1214.3.pdf | 2011-11-01 10:49 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1217.1.html | 2013-12-16 13:14 | 5.7K | ROSHELL, et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1217.1.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1217.2.html | 2013-12-16 13:14 | 12K | The ROSLYN., The MIDLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1217.2.pdf | 2011-11-01 10:49 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1219.html | 2013-12-16 13:14 | 55K | The ROSLYN., The MIDLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1219.pdf | 2011-11-01 10:49 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1228.1.html | 2013-12-16 13:14 | 1.2K | ROSLYN, The (COBANKS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1228.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1228.2.html | 2013-12-16 13:14 | 21K | Ex parte ROSS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1228.2.pdf | 2011-11-01 10:49 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1231.1.html | 2013-12-16 13:14 | 1.3K | Ross v. The ACTIVE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1231.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1231.2.html | 2013-12-16 13:14 | 36K | ROSS v. The ACTIVE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1231.2.pdf | 2011-11-01 10:49 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1237.1.html | 2013-12-16 13:14 | 1.2K | ROSS (ANDEBSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1237.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1237.2.html | 2013-12-16 13:14 | 1.2K | ROSS (BOND v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1237.2.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1237.3.html | 2013-12-16 13:14 | 8.5K | ROSS et al. v. CARPENTER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1237.3.pdf | 2011-11-01 10:49 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1238.1.html | 2013-12-16 13:14 | 1.2K | ROSS (CHAMPION v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1238.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1238.2.html | 2013-12-16 13:14 | 1.3K | ROSS v. DAVY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1238.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1238.3.html | 2013-12-16 13:14 | 6.6K | ROSS v. GIBSON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1238.3.pdf | 2011-11-01 10:49 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1239.1.html | 2013-12-16 13:14 | 1.2K | ROSS (HOLBROOK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1239.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1239.2.html | 2013-12-16 13:14 | 9.8K | ROSS v. HOLTZMAN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1239.2.pdf | 2011-11-01 10:49 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1241.1.html | 2013-12-16 13:14 | 3.1K | ROSS v. KINGSTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1241.1.pdf | 2011-11-01 10:49 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1241.2.html | 2013-12-16 13:14 | 1.2K | ROSS (KROUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1241.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1241.3.html | 2013-12-16 13:14 | 1.2K | ROSS (LOCKHART v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1241.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1241.4.html | 2013-12-16 13:14 | 1.2K | ROSS v. The NEVERSINK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1241.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1241.5.html | 2013-12-16 13:14 | 7.6K | ROSS et al. v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1241.5.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1242.html | 2013-12-16 13:14 | 8.5K | ROSS v. PRENTISS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1242.pdf | 2011-11-01 10:49 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1243.html | 2013-12-16 13:14 | 15K | ROSS v. The NEVERSINK. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1243.pdf | 2011-11-01 10:49 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1245.1.html | 2013-12-16 13:14 | 1.2K | ROSS (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1245.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1245.2.html | 2013-12-16 13:14 | 40K | ROSS v. UNION PAC. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1245.2.pdf | 2011-11-01 10:49 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1252.1.html | 2013-12-16 13:14 | 1.2K | ROSS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1252.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1252.2.html | 2013-12-16 13:14 | 1.2K | ROSS (WAKEFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1252.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1252.3.html | 2013-12-16 13:14 | 1.2K | ROSS (WALTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1252.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1252.4.html | 2013-12-16 13:14 | 9.5K | ROSS v. WOLFINGER et al., ROSS v. SUNDRY OTHER PARTIES (five cases). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1252.4.pdf | 2011-11-01 10:49 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1253.1.html | 2013-12-16 13:14 | 1.2K | ROSSEAU (BALDWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1253.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1253.2.html | 2013-12-16 13:14 | 10K | ROSSITER et al. v. HALL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1253.2.pdf | 2011-11-01 10:49 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1254.1.html | 2013-12-16 13:14 | 1.2K | ROSSTEUSCHER (MORTIMER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1254.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1254.2.html | 2013-12-16 13:14 | 1.2K | ROSSVALLY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1254.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1254.3.html | 2013-12-16 13:14 | 2.5K | ROTCHFORD v. MEADE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1254.3.pdf | 2011-11-01 10:49 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1255.1.html | 2013-12-16 13:14 | 1.2K | ROTER (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1255.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1255.2.html | 2013-12-16 13:14 | 35K | ROTH v. CITY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1255.2.pdf | 2011-11-01 10:49 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1260.1.html | 2013-12-16 13:14 | 1.2K | ROTH (DARST v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1260.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1260.2.html | 2013-12-16 13:14 | 1.2K | ROTHWFLL (HAYMAN'S ADM'RS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1260.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1260.3.html | 2013-12-16 13:14 | 1.2K | ROUDENBUSH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1260.3.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1260.4.html | 2013-12-16 13:14 | 1.2K | ROULSTONE (CURRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1260.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1260.5.html | 2013-12-16 13:14 | 11K | ROUNDTREE v. McLAIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1260.5.pdf | 2011-11-01 10:49 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1262.1.html | 2013-12-16 13:14 | 3.5K | ROUNSAVEL v. SCHOLFIELD. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1262.1.pdf | 2011-11-01 10:49 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1262.2.html | 2013-12-16 13:14 | 1.2K | ROUNSAVEL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1262.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1262.3.html | 2013-12-16 13:14 | 1.2K | ROUNTREE (TYRELL'S HEIRS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1262.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1262.4.html | 2013-12-16 13:14 | 1.2K | ROURKE (DENIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1262.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1262.5.html | 2013-12-16 13:14 | 13K | In re ROUSE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1262.5.pdf | 2011-11-01 10:49 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1264.html | 2013-12-16 13:14 | 4.3K | ROUSE v. FLETCHER et at. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1264.pdf | 2011-11-01 10:49 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1265.html | 2013-12-16 13:14 | 29K | ROUSE v. HAMPTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1265.pdf | 2011-11-01 10:49 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1269.html | 2013-12-16 13:14 | 17K | ROUSE v. INSURANCE CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1269.pdf | 2011-11-01 10:49 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.1.html | 2013-12-16 13:14 | 1.2K | ROUSE (POST v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.2.html | 2013-12-16 13:14 | 1.2K | ROUSMANIER (HUNT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.3.html | 2013-12-16 13:14 | 1.2K | ROUSMANIERE (HUNT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.3.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.4.html | 2013-12-16 13:14 | 1.2K | ROUSMANIERE'S ADM'RS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.5.html | 2013-12-16 13:14 | 1.2K | ROUSSEAU (FRY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.5.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.6.html | 2013-12-16 13:14 | 1.2K | ROUSSEAU (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.6.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1272.7.html | 2013-12-16 13:14 | 30K | The ROVENA. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1272.7.pdf | 2011-11-01 10:49 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1277.html | 2013-12-16 13:14 | 18K | The ROVER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1277.pdf | 2011-11-01 10:49 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1280.1.html | 2013-12-16 13:14 | 1.2K | ROWAN (BEARD v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1280.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1280.2.html | 2013-12-16 13:14 | 1.2K | ROWAN (HARRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1280.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1280.3.html | 2013-12-16 13:14 | 1.2K | ROWAN (MORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1280.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1280.4.html | 2013-12-16 13:14 | 10K | In re ROWE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1280.4.pdf | 2011-11-01 10:49 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1281.html | 2013-12-16 13:14 | 22K | ROWE et al. v. The BRIG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1281.pdf | 2011-11-01 10:49 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1285.html | 2013-12-16 13:14 | 24K | ROWE v. The CITY OF DUBLIN. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1285.pdf | 2011-11-01 10:49 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1288.html | 2013-12-16 13:14 | 18K | In re ROWELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1288.pdf | 2011-11-01 10:49 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1291.1.html | 2013-12-16 13:14 | 1.2K | ROWELL (HANSON v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1291.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1291.2.html | 2013-12-16 13:14 | 1.2K | ROWELL (KANSAS VAL. NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1291.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1291.3.html | 2013-12-16 13:14 | 12K | In re ROWLAND., Ex parte BOOZE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1291.3.pdf | 2011-11-01 10:49 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1293.html | 2013-12-16 13:14 | 7.0K | ROWLAND v. EMPIRE STATE LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1293.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.1.html | 2013-12-16 13:14 | 1.2K | ROYAL CANADIAN INS. CO. (HUNTER v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.2.html | 2013-12-16 13:14 | 1.2K | ROYAL GEORGE, The (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.3.html | 2013-12-16 13:14 | 1.3K | The ROYAL SAXON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.3.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.4.html | 2013-12-16 13:14 | 1.2K | ROYAL SAXON. The (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.4.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.5.html | 2013-12-16 13:14 | 1.2K | ROYAL SAXON, The (WALL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.5.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.6.html | 2013-12-16 13:14 | 1.2K | ROYALL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.6.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.7.html | 2013-12-16 13:14 | 1.2K | ROYER (MORRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.7.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.8.html | 2013-12-16 13:14 | 5.1K | The R. P. CHASE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.8.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1294.9.html | 2013-12-16 13:14 | 1.2K | R. R. KIRKLAND, The (DUNSTAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1294.9.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1295.html | 2013-12-16 13:14 | 16K | RUAN v. GARDNER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1295.pdf | 2011-11-01 10:49 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1297.1.html | 2013-12-16 13:14 | 1.2K | RUBBEECOATED HARNESS TRIMMING CO. (WELLING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1297.1.pdf | 2011-11-01 10:49 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1297.2.html | 2013-12-16 13:14 | 1.2K | RUBBER STEP MANUF'G CO. (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1297.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1297.3.html | 2013-12-16 13:14 | 4.9K | RUBBER STEP MANUF'G CO. v. METRO-POLITAN R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1297.3.pdf | 2011-11-01 10:49 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1297.4.html | 2013-12-16 13:14 | 1.2K | RUBBER TIP PENCIL CO. v. HOVEY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1297.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1298.html | 2013-12-16 13:14 | 11K | RUBBER TIP PENCIL CO. v. HOWARD et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1298.pdf | 2011-11-01 10:49 | 55K | |
![[IMG]](/html/icons/compressed.gif) | 0020.f.cas.1298_01.jpg | 2011-07-23 13:24 | 6.7K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1299.html | 2013-12-16 13:14 | 5.2K | The RUBY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1299.pdf | 2011-11-01 10:49 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1300.html | 2013-12-16 13:14 | 7.8K | The RUBY. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1300.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1301.html | 2013-12-16 13:14 | 11K | RUCH v. ROCK ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1301.pdf | 2011-11-01 10:49 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1302.html | 2013-12-16 13:14 | 13K | RUCHER et al. v. CONYNGHAM. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1302.pdf | 2011-11-01 10:49 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1304.1.html | 2013-12-16 13:14 | 1.2K | RUCKER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1304.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1304.2.html | 2013-12-16 13:14 | 4.9K | RUCKMAN v. The FIVE BOYS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1304.2.pdf | 2011-11-01 10:49 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1305.1.html | 2013-12-16 13:14 | 1.2K | RUCKMAN (MOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1305.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1305.2.html | 2013-12-16 13:14 | 3.4K | RUDD et al. v. PAINE et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1305.2.pdf | 2011-11-01 10:49 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1305.3.html | 2013-12-16 13:14 | 7.9K | In re RUDDELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1305.3.pdf | 2011-11-01 10:49 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1306.html | 2013-12-16 13:14 | 18K | RUDDICK v. BILLINGS. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1306.pdf | 2011-11-01 10:49 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1309.html | 2013-12-16 13:14 | 8.5K | RUDDY et al. v. The GOLDEN STATE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1309.pdf | 2011-11-01 10:49 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1310.html | 2013-12-16 13:14 | 4.0K | RUE et al. v. DECKER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1310.pdf | 2011-11-01 10:49 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1311.html | 2013-12-16 13:14 | 6.8K | In re RUEHLE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1311.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1312.1.html | 2013-12-16 13:14 | 1.2K | RUFFNER (DAUSMAN & DRUMMOND TOBACCO CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1312.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1312.2.html | 2013-12-16 13:14 | 7.6K | RUGG v. HAINES. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1312.2.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1313.html | 2013-12-16 13:14 | 21K | RUGGLES v. BUCKNOR. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1313.pdf | 2011-11-01 10:49 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1316.html | 2013-12-16 13:14 | 7.3K | RUGGLES v. EDDY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1316.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1317.html | 2013-12-16 13:14 | 13K | RUGGLES v. EDDY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1317.pdf | 2011-11-01 10:49 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1319.html | 2013-12-16 13:14 | 16K | RUGGLES v. EDDY et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1319.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1321.html | 2013-12-16 13:14 | 23K | RUGGLES v. GENERAL INTEREST INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1321.pdf | 2011-11-01 10:49 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1325.1.html | 2013-12-16 13:14 | 1.2K | RUGGLES, The (HARDY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1325.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1325.2.html | 2013-12-16 13:14 | 1.2K | RUGGLES (PROUTY v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1325.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1325.3.html | 2013-12-16 13:14 | 16K | RUGGLES v. SIMONTON. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1325.3.pdf | 2011-11-01 10:49 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1327.html | 2013-12-16 13:14 | 23K | RUGGLES et al. v. SOUTHERN MINN. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1327.pdf | 2011-11-01 10:49 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1331.1.html | 2013-12-16 13:14 | 1.2K | RUGGLES (STEVENS v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1331.1.pdf | 2011-11-01 10:49 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1331.2.html | 2013-12-16 13:14 | 1.2K | RUGGLES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1331.2.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1331.3.html | 2013-12-16 13:14 | 20K | RUGGLES v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1331.3.pdf | 2011-11-01 10:49 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1334.html | 2013-12-16 13:14 | 5.7K | In re RUGSDALE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1334.pdf | 2011-11-01 10:49 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1335.html | 2013-12-16 13:14 | 5.5K | In re RUHL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1335.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1336.1.html | 2013-12-16 13:14 | 5.0K | RULE v. PARKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1336.1.pdf | 2011-11-01 10:49 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1336.2.html | 2013-12-16 13:14 | 7.0K | In re RULE OF COURT. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1336.2.pdf | 2011-11-01 10:49 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1337.1.html | 2013-12-16 13:14 | 1.3K | RUMACH v. The QUEEN OF THE SOUTH. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1337.1.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1337.2.html | 2013-12-16 13:14 | 1.3K | RUMBALL v. The PACIFIC. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1337.2.pdf | 2011-11-01 10:49 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1337.3.html | 2013-12-16 13:14 | 1.3K | RUMER v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1337.3.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1337.4.html | 2013-12-16 13:14 | 7.4K | RUMFORD CHEMICAL WORKS v. FINNIE. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1337.4.pdf | 2011-11-01 10:49 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1338.html | 2013-12-16 13:14 | 8.1K | RUMFORD CHEMICAL WORKS v. HECKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1338.pdf | 2011-11-01 10:49 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1339.html | 2013-12-16 13:14 | 16K | RUMFORD CHEMICAL WORKS v. HECKER et al. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1339.pdf | 2011-11-01 10:49 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1342.html | 2013-12-16 13:14 | 31K | RUMFORD CHEMICAL WORKS v. HECKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1342.pdf | 2011-11-01 10:49 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1347.html | 2013-12-16 13:14 | 11K | RUMFORD CHEMICAL WORKS v. HECKER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1347.pdf | 2011-11-01 10:49 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1348.html | 2013-12-16 13:14 | 44K | RUMFORD CHEMICAL WORKS v. LAUER. |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1348.pdf | 2011-11-01 10:49 | 107K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1355.html | 2013-12-16 13:14 | 8.4K | RUMFORD CHEMICAL WORKS v. VICE., SAME v. VARIOUS DEFENDANTS (56 Suits). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1355.pdf | 2011-11-01 10:49 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.1.html | 2013-12-16 13:14 | 1.2K | RUMNEY (MANDEVILLE v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.1.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.2.html | 2013-12-16 13:14 | 1.2K | RUMNEY (REDFERN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.2.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.3.html | 2013-12-16 13:14 | 1.2K | RUM RIVER & M. BOOM CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.3.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.4.html | 2013-12-16 13:14 | 1.2K | RUMSEY (BURRALL v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.4.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.5.html | 2013-12-16 13:14 | 1.2K | RUMSEY (CHRISTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.5.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.6.html | 2013-12-16 13:14 | 1.2K | RUMSEY (COWING v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.6.pdf | 2011-11-01 10:49 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.1356.7.html | 2013-12-16 13:14 | 1.2K | RUMSEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.1356.7.pdf | 2011-11-01 10:49 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.back.html | 2013-12-16 13:14 | 324K | Federal Cases, Volume 20 |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.back.pdf | 2011-10-31 13:22 | 452K | |
![[Text]](/html/icons/compressed.gif) | 0020.f.cas.front.html | 2013-12-16 13:14 | 2.9K | Federal Cases, Volume 20 |
![[ ]](/html/icons/compressed.gif) | 0020.f.cas.front.pdf | 2011-10-31 13:22 | 42K | |
|