![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.000b_01.jpg | 2011-04-25 21:36 | 3.7K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0001.html | 2013-12-16 13:12 | 50K | Ex parte FIELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0001.pdf | 2011-11-01 09:58 | 119K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0009.1.html | 2013-12-16 13:12 | 1.2K | FIELD v. The ARGUS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0009.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0009.2.html | 2013-12-16 13:11 | 16K | FIELD v. BAKER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0009.2.pdf | 2011-11-01 09:58 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0011.html | 2013-12-16 13:12 | 1.4K | FIELD v. BALTIMORE C. P. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0011.pdf | 2011-11-01 09:58 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0012.html | 2013-12-16 13:11 | 17K | FIELD v. COLUMBET. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0012.pdf | 2011-11-01 09:58 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0014.html | 2013-12-16 13:12 | 5.8K | FIELD v. DE COMEAN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0014.pdf | 2011-11-01 09:58 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0015.html | 2013-12-16 13:12 | 11K | FIELD v. GIBBS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0015.pdf | 2011-11-01 09:58 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0016.html | 2013-12-16 13:11 | 21K | FIELD v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0016.pdf | 2011-11-01 09:58 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0019.1.html | 2013-12-16 13:12 | 1.2K | FIELD (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0019.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0019.2.html | 2013-12-16 13:11 | 1.2K | FIELD v. LAMB. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0019.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0020.1.html | 2013-12-16 13:11 | 4.3K | FIELD et al. v. The LOVETT PEACOCK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0020.1.pdf | 2011-11-01 09:58 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0020.2.html | 2013-12-16 13:12 | 16K | FIELD v. LOWNSDALE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0020.2.pdf | 2011-11-01 09:58 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0023.1.html | 2013-12-16 13:12 | 4.5K | FIELD v. MOULSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0023.1.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0023.2.html | 2013-12-16 13:11 | 7.1K | FIELD v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0023.2.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0024.html | 2013-12-16 13:12 | 10K | FIELD v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0024.pdf | 2011-11-01 09:58 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0025.1.html | 2013-12-16 13:12 | 1.1K | FIELD v. SCHNELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0025.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0025.2.html | 2013-12-16 13:11 | 1.2K | FIELD (SEABURY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0025.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0025.3.html | 2013-12-16 13:11 | 1.2K | FIELD (STEERE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0025.3.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0026.html | 2013-12-16 13:11 | 6.9K | FIELDEN et al. v. LAHENS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0026.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0027.1.html | 2013-12-16 13:12 | 6.7K | FIELDEN et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0027.1.pdf | 2011-11-01 09:58 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0027.2.html | 2013-12-16 13:11 | 1.2K | FIELDS (HUSSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0027.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0027.3.html | 2013-12-16 13:11 | 7.9K | FIELDS v. LAMB et ux. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0027.3.pdf | 2011-11-01 09:58 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0028.1.html | 2013-12-16 13:12 | 1.2K | FIELDS (OCEAN INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0028.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0028.2.html | 2013-12-16 13:11 | 1.2K | FIELDS, The, v. The SAILOR'S BRIDE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0028.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0029.html | 2013-12-16 13:12 | 79K | FIELDS v. SQUIRES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0029.pdf | 2011-11-01 09:58 | 168K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0041.html | 2013-12-16 13:11 | 2.9K | FIELDS v. TAYLOR et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0041.pdf | 2011-11-01 09:58 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0042.1.html | 2013-12-16 13:12 | 1.2K | FIELDS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0042.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0042.2.html | 2013-12-16 13:11 | 6.2K | FIFTEEN EMPTY BARRELS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0042.2.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0042.3.html | 2013-12-16 13:11 | 1.2K | FIFTEEN HOGSHEADS OF BRANDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0042.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0043.1.html | 2013-12-16 13:11 | 5.9K | FIFTEEN PIECES OF BLACK SILK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0043.1.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0043.2.html | 2013-12-16 13:12 | 1.2K | FIFTEEN THOUSAND DOLLARS SPECIE (MAGOWN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0043.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0043.3.html | 2013-12-16 13:12 | 5.4K | FIFTH NAT. BANK v. LONG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0043.3.pdf | 2011-11-01 09:58 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.1.html | 2013-12-16 13:12 | 1.2K | FIFTY BARRELS OF WHISKY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.2.html | 2013-12-16 13:11 | 1.3K | FIFTY-EIGHT THOUSAND EIGHT HUNDRED AND FIFTY CIGARS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.3.html | 2013-12-16 13:11 | 1.3K | FIFTY-FOUR BARRELS OF DISTILLED SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.4.html | 2013-12-16 13:12 | 3.2K | FIFTY-ONE BALES OF GOATS' HAIR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.4.pdf | 2011-11-01 09:58 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.5.html | 2013-12-16 13:12 | 1.2K | FIFTY-ONE CASES OF BRANDY (HOOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.6.html | 2013-12-16 13:11 | 1.3K | FIFTY-ONE DOZEN PIECES OF MERCHANDISE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.6.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.7.html | 2013-12-16 13:11 | 1.2K | FIFTY-SIX BARRELS OF WHISKY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.7.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.8.html | 2013-12-16 13:12 | 1.3K | FIFTY-SIX THOUSAND FOUR HUNDRED AND TWELVE FEET OF LUMBER (LYON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.8.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0044.9.html | 2013-12-16 13:12 | 18K | FIFTY THOUSAND CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0044.9.pdf | 2011-11-01 09:58 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0047.1.html | 2013-12-16 13:11 | 1.2K | FIFTY THOUSAND CIGARS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0047.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0047.2.html | 2013-12-16 13:12 | 7.9K | FIFTY THOUSAND FEET OF TIMBER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0047.2.pdf | 2011-11-01 09:58 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0048.html | 2013-12-16 13:11 | 1.2K | FIFTY-THREE BOXES OF HAVANA SUGAR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0048.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0049.1.html | 2013-12-16 13:12 | 4.6K | FIFTY-TWO BALES OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0049.1.pdf | 2011-11-01 09:58 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0049.2.html | 2013-12-16 13:11 | 4.5K | FIFTY-TWO BALES OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0049.2.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0050.1.html | 2013-12-16 13:12 | 2.6K | FIKES v. BENTLEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0050.1.pdf | 2011-11-01 09:58 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0050.2.html | 2013-12-16 13:11 | 19K | FILKINS et al. v. BLACKMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0050.2.pdf | 2011-11-01 09:58 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0053.1.html | 2013-12-16 13:11 | 6.2K | FILLEY v. CHILD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0053.1.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0053.2.html | 2013-12-16 13:12 | 1.2K | FILLEY (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0053.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0054.html | 2013-12-16 13:11 | 9.2K | FINCH v. RIKEMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0054.pdf | 2011-11-01 09:58 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0055.html | 2013-12-16 13:11 | 13K | In re FINDLAY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0055.pdf | 2011-11-01 09:58 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0057.1.html | 2013-12-16 13:11 | 1.2K | FINDLAY (POTTS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0057.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0057.2.html | 2013-12-16 13:12 | 1.2K | FINDLAY (STOKES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0057.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0057.3.html | 2013-12-16 13:12 | 34K | FINDLAY et al. v. The WILLIAM. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0057.3.pdf | 2011-11-01 09:58 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0062.html | 2013-12-16 13:12 | 30K | FINDLAY'S EX'RS v. BANK OF THE UNITED STATES et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0062.pdf | 2011-11-01 09:58 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0067.html | 2013-12-16 13:12 | 15K | FINDLEY et al. v. SATTERFIELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0067.pdf | 2011-11-01 09:58 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0069.1.html | 2013-12-16 13:11 | 1.2K | FINDLEY v. VINT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0069.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0069.2.html | 2013-12-16 13:12 | 1.2K | FINK (LA MOTHE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0069.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0069.3.html | 2013-12-16 13:12 | 1.2K | FINK VALENTINE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0069.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0069.4.html | 2013-12-16 13:11 | 1.2K | FINLAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0069.4.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0069.5.html | 2013-12-16 13:11 | 14K | FINLAYSON v. CHICAGO, B. & Q. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0069.5.pdf | 2011-11-01 09:58 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0071.html | 2013-12-16 13:11 | 2.3K | FINLEY v. McCARTHY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0071.pdf | 2011-11-01 09:58 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.1.html | 2013-12-16 13:11 | 5.1K | In re FINN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.1.pdf | 2011-11-01 09:58 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.2.html | 2013-12-16 13:12 | 1.2K | FINNAGAN (CARROLL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.3.html | 2013-12-16 13:12 | 1.2K | FINNIE (RUMFORD CHEMICAL WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.4.html | 2013-12-16 13:11 | 1.2K | FIRE ASS'N (HARRINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.5.html | 2013-12-16 13:11 | 1.2K | FIRE INS. CO. (LEWIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.5.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.6.html | 2013-12-16 13:12 | 1.2K | FIREMEN'S FUND INS. CO. (ROBBINS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.6.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0072.7.html | 2013-12-16 13:12 | 17K | In re FIREMEN'S INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0072.7.pdf | 2011-11-01 09:58 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0075.html | 2013-12-16 13:11 | 33K | FIREMEN'S INS. CO. v. HEMINGWAY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0075.pdf | 2011-11-01 09:58 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0080.1.html | 2013-12-16 13:12 | 1.2K | FIRST BAPTIST SOCIETY OF ESSEX (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0080.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0080.2.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (BLAIR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0080.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0080.3.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (BURPEE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0080.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0081.html | 2013-12-16 13:11 | 23K | FIRST NAT. BANK v. CALDWELL et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0081.pdf | 2011-11-01 09:58 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0083.html | 2013-12-16 13:12 | 1.2K | FIRST NAT. BANK (CROCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0083.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0084.html | 2013-12-16 13:11 | 9.8K | FIRST NAT BANK v. DOUGLAS COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0084.pdf | 2011-11-01 09:58 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.1.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (FRENCH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.2.html | 2013-12-16 13:12 | 1.2K | FIRST NAT. BANK (HOUGH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.3.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (HYDE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.4.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (MARKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.5.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK (SARGEANT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.6.html | 2013-12-16 13:12 | 1.2K | FIRST NAT. BANK (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.6.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0085.7.html | 2013-12-16 13:12 | 5.0K | FIRST NAT. BANK OF ASHLAND v. CLEAVER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0085.7.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.1.html | 2013-12-16 13:12 | 1.2K | FIRST NAT BANK OF ASHLAND (McELHENNY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.1.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.2.html | 2013-12-16 13:11 | 4.6K | FIRST NAT. BANK OF CHICAGO v. THIRD NAT. BANK., UNION NAT. BANK v. THIRD NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.2.pdf | 2011-11-01 09:58 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.3.html | 2013-12-16 13:11 | 1.3K | FIRST NAT. BANK OF DENVER (FIRST NAT. BANK OF TRINIDAD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.4.html | 2013-12-16 13:12 | 1.5K | FIRST NAT. BANK OF HANNIBAL v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.4.pdf | 2011-11-01 09:58 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.5.html | 2013-12-16 13:12 | 1.2K | FIRST NAT. BANK OF JAMESTOWN (LAKIN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0086.6.html | 2013-12-16 13:11 | 11K | FIRST NAT. BANK OF MANHATTAN v. CITIZENS BANK OF TOPEKA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0086.6.pdf | 2011-11-01 09:58 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0088.html | 2013-12-16 13:11 | 20K | FIRST NAT. BANK OF MANHATTAN v. KING WROUGHT IRON BRIDGE CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0088.pdf | 2011-11-01 09:58 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0091.html | 2013-12-16 13:11 | 14K | FIRST NAT. BANK OF MT. PLEASANT v. DUNCAN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0091.pdf | 2011-11-01 09:58 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0093.1.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK OF MT. PLEASANT (DUNCAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0093.1.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0093.2.html | 2013-12-16 13:12 | 1.2K | FIRST NAT. BANK OF MT. PLEASANT (MELLINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0093.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0093.3.html | 2013-12-16 13:12 | 12K | FIRST NAT. BANK OF MOUNT PLEASANT v. TINSTMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0093.3.pdf | 2011-11-01 09:58 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0095.html | 2013-12-16 13:11 | 13K | FIRST NAT. BANK OF NORTH BENNINGTON v. ARLINGTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0095.pdf | 2011-11-01 09:58 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0097.html | 2013-12-16 13:12 | 9.1K | FIRST NAT. BANK OF NORTH BENNINGTON v. BENNINGTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0097.pdf | 2011-11-01 09:58 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0098.html | 2013-12-16 13:11 | 8.5K | FIRST NAT. BANK OF NORTH BENNINGTON v. DORSET. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0098.pdf | 2011-11-01 09:58 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0100.1.html | 2013-12-16 13:11 | 6.0K | FIRST NAT. BANK OF OMAHA v. DOUGLAS COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0100.1.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0100.2.html | 2013-12-16 13:11 | 14K | FIRST NAT. BANK OF TRINIDAD v. FIRST NAT. BANK OF DENVER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0100.2.pdf | 2011-11-01 09:58 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0102.1.html | 2013-12-16 13:12 | 1.3K | FIRST NAT. BANK OF UNIONTOWN v. STAUFFER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0102.1.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0102.2.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK OF WARREN v. PALMER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0102.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0102.3.html | 2013-12-16 13:11 | 1.2K | FIRST NAT. BANK OF WILMINGTON. (LOUDON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0102.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0103.1.html | 2013-12-16 13:11 | 4.5K | FIRST NAT. BANK OF YOUNGTOWN v. HUGHES et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0103.1.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0103.2.html | 2013-12-16 13:12 | 1.2K | FIRTH (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0103.2.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0103.3.html | 2013-12-16 13:12 | 20K | FISCHER v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0103.3.pdf | 2011-11-01 09:58 | 141K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0104_01.jpg | 2011-06-25 15:29 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0107.html | 2013-12-16 13:11 | 7.7K | FISH et al. v. The BLACK WARRIOR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0107.pdf | 2011-11-01 09:58 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0108.html | 2013-12-16 13:11 | 7.3K | FISH v. FOND DU LAC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0108.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0109.1.html | 2013-12-16 13:12 | 3.1K | FISH et al. v. The GEORGE THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0109.1.pdf | 2011-11-01 09:58 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0109.2.html | 2013-12-16 13:11 | 1.2K | FISH (HICKS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0109.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0109.3.html | 2013-12-16 13:11 | 1.2K | FISH (McDANIEL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0109.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0109.4.html | 2013-12-16 13:12 | 1.2K | FISHER (BLIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0109.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0109.5.html | 2013-12-16 13:12 | 34K | FISHER v. BOODY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0109.5.pdf | 2011-11-01 09:58 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0115.html | 2013-12-16 13:11 | 28K | FISHER v. CARTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0115.pdf | 2011-11-01 09:58 | 82K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0117_01.jpg | 2011-04-25 22:03 | 3.6K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0119.html | 2013-12-16 13:11 | 1.2K | FISHER (COMLY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0119.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0120.html | 2013-12-16 13:11 | 15K | FISHER v. CONSEQUA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0120.pdf | 2011-11-01 09:58 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0122.html | 2013-12-16 13:12 | 26K | FISHER v. CRAIG et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0122.pdf | 2011-11-01 09:58 | 136K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0123_01.jpg | 2011-04-25 21:36 | 24K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0123_02.jpg | 2011-04-25 21:36 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0127.1.html | 2013-12-16 13:12 | 1.2K | FISHER (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0127.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0127.2.html | 2013-12-16 13:11 | 16K | FISHER et al. v. CURRIER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0127.2.pdf | 2011-11-01 09:58 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0129.1.html | 2013-12-16 13:11 | 1.2K | FISHER (DRAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0129.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0129.2.html | 2013-12-16 13:12 | 1.2K | FISHER v. The GALLOWAY C. MORRIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0129.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0129.3.html | 2013-12-16 13:12 | 19K | FISHER v. HARNDEN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0129.3.pdf | 2011-11-01 09:58 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0132.html | 2013-12-16 13:12 | 11K | FISHER v. HENDERSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0132.pdf | 2011-11-01 09:58 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0134.1.html | 2013-12-16 13:11 | 1.2K | FISHER (HOGE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0134.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0134.2.html | 2013-12-16 13:12 | 14K | FISHER et al. v. LORD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0134.2.pdf | 2011-11-01 09:58 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0136.1.html | 2013-12-16 13:11 | 1.2K | FISHER (PEDRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0136.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0136.2.html | 2013-12-16 13:12 | 8.3K | FISHER v. The PLYMOUTH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0136.2.pdf | 2011-11-01 09:58 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0137.html | 2013-12-16 13:12 | 3.8K | FISHER v. REIDER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0137.pdf | 2011-11-01 09:58 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0138.html | 2013-12-16 13:11 | 21K | FISHER v. RUTHERFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0138.pdf | 2011-11-01 09:58 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0141.html | 2013-12-16 13:12 | 40K | FISHER et al. v. The SYBIL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0141.pdf | 2011-11-01 09:58 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0147.html | 2013-12-16 13:11 | 1.2K | FISHER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0147.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0148.1.html | 2013-12-16 13:11 | 1.2K | FISHER (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0148.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0148.2.html | 2013-12-16 13:12 | 1.2K | FISHING INS. CO. (HANCOX v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0148.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0148.3.html | 2013-12-16 13:12 | 1.3K | FISHLEY v. FISHLEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0148.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0148.4.html | 2013-12-16 13:11 | 7.8K | FISK et al. v. CHURCH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0148.4.pdf | 2011-11-01 09:58 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0149.1.html | 2013-12-16 13:12 | 1.2K | FISK (McKENNA v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0149.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0149.2.html | 2013-12-16 13:11 | 90K | FISK v. UNION PAC. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0149.2.pdf | 2011-11-01 09:58 | 191K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0164.html | 2013-12-16 13:12 | 16K | FISK v. UNION PAC. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0164.pdf | 2011-11-01 09:58 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0166.html | 2013-12-16 13:11 | 7.7K | FISK v. UNION PAC. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0166.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0167.html | 2013-12-16 13:11 | 8.4K | FISK v. UNION PAC. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0167.pdf | 2011-11-01 09:58 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0168.1.html | 2013-12-16 13:12 | 1.2K | FISK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0168.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0168.2.html | 2013-12-16 13:11 | 4.7K | FISK et al. v. WEST BRADLEY & CARY MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0168.2.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0169.1.html | 2013-12-16 13:11 | 1.2K | FISKE (BOSTON MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0169.1.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0169.2.html | 2013-12-16 13:12 | 20K | FISKE v. HUNT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0169.2.pdf | 2011-11-01 09:58 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.1.html | 2013-12-16 13:11 | 1.3K | FISKE v. MASSACHUSETTS NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.1.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.2.html | 2013-12-16 13:12 | 1.2K | FISKE (MOODY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.3.html | 2013-12-16 13:12 | 1.2K | FISKE (PALMER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.4.html | 2013-12-16 13:11 | 1.2K | FISKE (RISCH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.5.html | 2013-12-16 13:11 | 4.4K | FISKE et al. v. SMYTHE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.5.pdf | 2011-11-01 09:58 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.6.html | 2013-12-16 13:12 | 1.2K | FISLER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.6.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0172.7.html | 2013-12-16 13:12 | 47K | FITCH v. CORNELL et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0172.7.pdf | 2011-11-01 09:58 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0180.1.html | 2013-12-16 13:11 | 1.2K | FITCH (GEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0180.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0180.2.html | 2013-12-16 13:11 | 8.6K | FITCH et al. v. McGIE., Ex parte SANGER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0180.2.pdf | 2011-11-01 09:58 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0181.1.html | 2013-12-16 13:11 | 1.2K | FITCH (MIDDLETOWN TOOL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0181.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0181.2.html | 2013-12-16 13:12 | 23K | FITCH v. REMER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0181.2.pdf | 2011-11-01 09:58 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0185.1.html | 2013-12-16 13:11 | 1.2K | FITTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0185.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0185.2.html | 2013-12-16 13:12 | 8.3K | Ex parte FITZ., In re RAWSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0185.2.pdf | 2011-11-01 09:58 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0186.html | 2013-12-16 13:11 | 26K | FITZ v. The AMELIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0186.pdf | 2011-11-01 09:58 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0190.1.html | 2013-12-16 13:12 | 1.2K | FITZGERALD (ECKLE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0190.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0190.2.html | 2013-12-16 13:11 | 10K | FITZGERALD v. The H. A. RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0190.2.pdf | 2011-11-01 09:58 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0191.1.html | 2013-12-16 13:11 | 1.2K | FITZGERALD (LAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0191.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0191.2.html | 2013-12-16 13:12 | 1.2K | FITZGERALD (LEADVILLE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0191.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0192.1.html | 2013-12-16 13:12 | 1.2K | FITZGERALD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0192.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0192.2.html | 2013-12-16 13:11 | 1.2K | FITZHUGH (ASHTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0192.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0192.3.html | 2013-12-16 13:11 | 4.1K | FITZHUGH v. BLAKE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0192.3.pdf | 2011-11-01 09:58 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0192.4.html | 2013-12-16 13:12 | 7.3K | FITZHUGH v. The COMMERCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0192.4.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0193.1.html | 2013-12-16 13:11 | 1.2K | FITZHUGH (SCHOLFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0193.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0193.2.html | 2013-12-16 13:12 | 18K | FITZPATRICK v. DUBOIS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0193.2.pdf | 2011-11-01 09:58 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0196.html | 2013-12-16 13:11 | 18K | FITZPATRICK et al. v. EIGHT HUNDRED BALES OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0196.pdf | 2011-11-01 09:58 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0199.1.html | 2013-12-16 13:12 | 1.2K | FITZPATRICK (LOUISIANA STATE LOTTERY CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0199.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0199.2.html | 2013-12-16 13:11 | 6.2K | FITZPATRICK et al. v. TROY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0199.2.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0199.3.html | 2013-12-16 13:11 | 1.2K | FITZSIMMONS (AZCARATI v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0199.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0199.4.html | 2013-12-16 13:12 | 1.2K | FITZSIMMONS (HICKS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0199.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0199.5.html | 2013-12-16 13:12 | 1.2K | FIVE BARRELS OF WHISKEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0199.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.1.html | 2013-12-16 13:11 | 1.2K | FIVE CASES OF CIGARS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.2.html | 2013-12-16 13:12 | 1.2K | FIVE CASES OF CLOTH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.3.html | 2013-12-16 13:12 | 1.2K | FIVE CASES OF LINEN TABLE CLOTHS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.4.html | 2013-12-16 13:11 | 1.2K | FIVE CASKS OF FILES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.5.html | 2013-12-16 13:11 | 1.3K | FIVE HUNDRED AND EIGHT BARRELS DISTILLED SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.6.html | 2013-12-16 13:12 | 1.3K | FIVE HUNDRED AND EIGHT BARRELS OF SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.6.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0200.7.html | 2013-12-16 13:12 | 10K | FIVE HUNDRED AND TWENTY-EIGHT PIECES OF MAHOGANY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0200.7.pdf | 2011-11-01 09:58 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0201.1.html | 2013-12-16 13:12 | 1.2K | FIVE HUNDRED BARRELS OF WHISKEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0201.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0201.2.html | 2013-12-16 13:11 | 1.2K | FIVE HUNDRED BOXES OF PIPES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0201.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0201.3.html | 2013-12-16 13:11 | 1.2K | FIVE JUGS OF BRANDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0201.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0201.4.html | 2013-12-16 13:12 | 1.2K | FIVE NEGROES (BASS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0201.4.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0201.5.html | 2013-12-16 13:12 | 5.3K | FIVE SEAMEN v. The FAIR AMERICAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0201.5.pdf | 2011-11-01 09:58 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0202.1.html | 2013-12-16 13:11 | 1.3K | FIVE THOUSAND ONE HUNDRED DOLLARS IN SPECIE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0202.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0202.2.html | 2013-12-16 13:12 | 1.2K | FLAGG (GOODYEAR DENTAL VULCANITE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0202.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0202.3.html | 2013-12-16 13:12 | 179K | FLAGG v. MANN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0202.3.pdf | 2011-11-01 09:58 | 348K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0231.html | 2013-12-16 13:12 | 32K | FLAGG v. MANN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0231.pdf | 2011-11-01 09:58 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0237.html | 2013-12-16 13:11 | 14K | FLAHERTY et al. v. DOANE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0237.pdf | 2011-11-01 09:58 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0239.html | 2013-12-16 13:12 | 19K | In re FLANAGAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0239.pdf | 2011-11-01 09:58 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0242.html | 2013-12-16 13:11 | 14K | FLANDERS v. ABBEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0242.pdf | 2011-11-01 09:58 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0244.1.html | 2013-12-16 13:11 | 6.0K | FLANDERS v. AETNA INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0244.1.pdf | 2011-11-01 09:58 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0244.2.html | 2013-12-16 13:12 | 11K | FLANDERS v. THOMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0244.2.pdf | 2011-11-01 09:58 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0246.html | 2013-12-16 13:12 | 9.5K | FLANDERS v. TRIPP et al |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0246.pdf | 2011-11-01 09:58 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0247.html | 2013-12-16 13:12 | 23K | Ex parte FLANNAGANS., In re CHAMBERLAINES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0247.pdf | 2011-11-01 09:58 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0251.1.html | 2013-12-16 13:12 | 1.2K | FLANNERY (DEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0251.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0251.2.html | 2013-12-16 13:11 | 9.1K | FLANNERY v. The ONTARIO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0251.2.pdf | 2011-11-01 09:58 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0252.html | 2013-12-16 13:12 | 14K | The FLASH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0252.pdf | 2011-11-01 09:58 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0255.html | 2013-12-16 13:11 | 10K | The FLASH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0255.pdf | 2011-11-01 09:58 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0256.html | 2013-12-16 13:12 | 6.6K | The FLASH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0256.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0257.1.html | 2013-12-16 13:12 | 1.2K | FLECK (WOODSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0257.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0257.2.html | 2013-12-16 13:11 | 1.2K | FLECKE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0257.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0257.3.html | 2013-12-16 13:11 | 1.2K | FLECKENSTEIN (SHUMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0257.3.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0257.4.html | 2013-12-16 13:12 | 19K | FLEEGER et al. v. POOL et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0257.4.pdf | 2011-11-01 09:58 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0260.1.html | 2013-12-16 13:12 | 1.2K | FLEET (WOODSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0260.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0260.2.html | 2013-12-16 13:11 | 16K | FLEISHMAN v. The JOHN P. BEST. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0260.2.pdf | 2011-11-01 09:58 | 65K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0261_01.jpg | 2011-04-25 22:03 | 8.0K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0262.html | 2013-12-16 13:12 | 11K | FLEMING v. FOY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0262.pdf | 2011-11-01 09:58 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0264.html | 2013-12-16 13:11 | 6.6K | FLEMING v. NORTHAMPTON NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0264.pdf | 2011-11-01 09:58 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.1.html | 2013-12-16 13:11 | 1.2K | FLESHER (COPEN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.2.html | 2013-12-16 13:12 | 1.2K | FLETA, The (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.3.html | 2013-12-16 13:12 | 1.2K | FLETCHER (BERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.4.html | 2013-12-16 13:11 | 5.5K | FLETCHER et al. v. The CUBANA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.4.pdf | 2011-11-01 09:58 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.5.html | 2013-12-16 13:11 | 1.2K | FLETCHER (CURREY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.5.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0265.6.html | 2013-12-16 13:12 | 1.2K | FLETCHER (EASBY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0265.6.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0266.1.html | 2013-12-16 13:12 | 5.7K | FLETCHER v. ELLIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0266.1.pdf | 2011-11-01 09:58 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0266.2.html | 2013-12-16 13:11 | 35K | FLETCHER et al. v. MOREY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0266.2.pdf | 2011-11-01 09:58 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0272.1.html | 2013-12-16 13:12 | 1.3K | FLETCHER v. PECK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0272.1.pdf | 2011-11-01 09:58 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0272.2.html | 2013-12-16 13:11 | 1.2K | FLETCHER (ROUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0272.2.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0272.3.html | 2013-12-16 13:11 | 12K | FLETCHER v. SELDEN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0272.3.pdf | 2011-11-01 09:58 | 70K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0272_01.jpg | 2011-04-25 21:36 | 20K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0274.1.html | 2013-12-16 13:12 | 2.9K | FLETCHER v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0274.1.pdf | 2011-11-01 09:58 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0274.2.html | 2013-12-16 13:11 | 6.2K | FLETCHER v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0274.2.pdf | 2011-11-01 09:58 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0275.1.html | 2013-12-16 13:11 | 3.6K | FLETCHER v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0275.1.pdf | 2011-11-01 09:58 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0275.2.html | 2013-12-16 13:12 | 1.2K | FLICKENGER (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0275.2.pdf | 2011-11-01 09:58 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0275.3.html | 2013-12-16 13:12 | 5.8K | FLINN et al. v. The LEANDER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0275.3.pdf | 2011-11-01 09:58 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0276.1.html | 2013-12-16 13:12 | 1.2K | FLINT (BULEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0276.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0276.2.html | 2013-12-16 13:11 | 3.8K | FLINT v. CRAWFORD COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0276.2.pdf | 2011-11-01 09:58 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0276.3.html | 2013-12-16 13:11 | 5.7K | FLINT et al. v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0276.3.pdf | 2011-11-01 09:58 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0277.1.html | 2013-12-16 13:11 | 1.2K | FLINT (LEIDERSDORF v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0277.1.pdf | 2011-11-01 09:58 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0277.2.html | 2013-12-16 13:12 | 17K | FLINT v. NORWICH & N. Y. TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0277.2.pdf | 2011-11-01 09:58 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0280.html | 2013-12-16 13:11 | 27K | FLINT v. NORWICH & N. Y. TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0280.pdf | 2011-11-01 09:58 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0284.html | 2013-12-16 13:11 | 9.8K | FLINT v. ROBERTS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0284.pdf | 2011-11-01 09:58 | 98K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0285_01.jpg | 2011-04-25 21:36 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0286.html | 2013-12-16 13:12 | 19K | FLINT v. RUSSELL et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0286.pdf | 2011-11-01 09:58 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0289.1.html | 2013-12-16 13:11 | 1.2K | FLINT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0289.1.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0289.2.html | 2013-12-16 13:12 | 1.4K | FLOATING DOCK (JEROME v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0289.2.pdf | 2011-11-01 09:58 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0289.3.html | 2013-12-16 13:12 | 1.2K | FLOATING STEAM PUMP (WINSLOW v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0289.3.pdf | 2011-11-01 09:58 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0289.4.html | 2013-12-16 13:11 | 1.2K | FLOATING ZEPHYR, The (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0289.4.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0289.5.html | 2013-12-16 13:11 | 13K | FLOOD v. HICKS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0289.5.pdf | 2011-11-01 09:59 | 77K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0289_01.jpg | 2011-04-25 21:36 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0291.1.html | 2013-12-16 13:12 | 1.2K | FLOOD (ODELL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0291.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0291.2.html | 2013-12-16 13:11 | 19K | The FLORA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0291.2.pdf | 2011-11-01 09:59 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0294.1.html | 2013-12-16 13:11 | 1.3K | FLORA v. The GLOBE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0294.1.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0294.2.html | 2013-12-16 13:12 | 11K | The FLORENCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0294.2.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0295.html | 2013-12-16 13:11 | 10K | The FLORENCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0295.pdf | 2011-11-01 09:59 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0297.html | 2013-12-16 13:12 | 8.2K | FLORENCE MANUF'G CO. v. BOSTON DIATITE CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0297.pdf | 2011-11-01 09:59 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0298.html | 2013-12-16 13:11 | 28K | FLORENCE SEWING MACH. CO. v. GROVER & BAKER SEWING MACH. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0298.pdf | 2011-11-01 09:59 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0302.html | 2013-12-16 13:12 | 46K | FLORENCE SEWING MACH. CO. v. SINGER MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0302.pdf | 2011-11-01 09:59 | 109K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0310.html | 2013-12-16 13:11 | 40K | FLORENCE SEWING MACH. CO. v. SINGER MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0310.pdf | 2011-11-01 09:59 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0316.1.html | 2013-12-16 13:11 | 1.2K | FLORENS v. The SAM KIRKMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0316.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0316.2.html | 2013-12-16 13:12 | 26K | The FLORENZO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0316.2.pdf | 2011-11-01 09:59 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0321.1.html | 2013-12-16 13:11 | 5.9K | The FLORIDA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0321.1.pdf | 2011-11-01 09:59 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0321.2.html | 2013-12-16 13:12 | 4.5K | The FLORIDA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0321.2.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0322.1.html | 2013-12-16 13:12 | 4.6K | The FLORIDA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0322.1.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0322.2.html | 2013-12-16 13:11 | 1.2K | FLORIDA, The (MERCER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0322.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0322.3.html | 2013-12-16 13:11 | 1.2K | FLORIDA, A. & G. C. R. CO. (RANKIN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0322.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0322.4.html | 2013-12-16 13:12 | 1.2K | FLORIDA R. CO. (CARRINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0322.4.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0322.5.html | 2013-12-16 13:12 | 1.2K | FLORIDA R. CO. (VOSE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0322.5.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0323.1.html | 2013-12-16 13:11 | 4.5K | FLORIO v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0323.1.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0323.2.html | 2013-12-16 13:12 | 1.2K | FLOURNOY (PENARO v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0323.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0323.3.html | 2013-12-16 13:12 | 17K | FLOWER v. PARKER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0323.3.pdf | 2011-11-01 09:59 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0326.1.html | 2013-12-16 13:11 | 1.2K | FLOWERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0326.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0326.2.html | 2013-12-16 13:11 | 1.2K | FLOYD (HOTCHKISS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0326.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0326.3.html | 2013-12-16 13:11 | 1.2K | FLUES (DALLAS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0326.3.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0326.4.html | 2013-12-16 13:12 | 1.2K | FLUSHING & N. R. CO. (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0326.4.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0326.5.html | 2013-12-16 13:12 | 8.4K | The FLYING FISH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0326.5.pdf | 2011-11-01 09:59 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0327.1.html | 2013-12-16 13:11 | 1.2K | FLYNN v. The FALCON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0327.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0327.2.html | 2013-12-16 13:12 | 1.2K | FLYNN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0327.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0327.3.html | 2013-12-16 13:12 | 12K | The F. MERWIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0327.3.pdf | 2011-11-01 09:59 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0329.html | 2013-12-16 13:11 | 11K | FOCKE et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0329.pdf | 2011-11-01 09:59 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0330.html | 2013-12-16 13:11 | 13K | FOGARTY v. GERRITY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0330.pdf | 2011-11-01 09:59 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0332.1.html | 2013-12-16 13:12 | 1.2K | FOGARTY (GREAT WESTERN INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0332.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0332.2.html | 2013-12-16 13:11 | 9.3K | FOGERTY v. PRATT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0332.2.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0334.1.html | 2013-12-16 13:12 | 1.2K | FOGG v. LAWRY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0334.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0334.2.html | 2013-12-16 13:11 | 7.2K | FOGG v. STICKNEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0334.2.pdf | 2011-11-01 09:59 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0335.1.html | 2013-12-16 13:11 | 1.2K | FOLGER (CROSBY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0335.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0335.2.html | 2013-12-16 13:12 | 1.2K | FOLGER (HYDE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0335.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0335.3.html | 2013-12-16 13:12 | 38K | FOLGER v. The ROBERT G. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0335.3.pdf | 2011-11-01 09:59 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0341.1.html | 2013-12-16 13:12 | 1.2K | FOLLEN (DAWSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0341.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0341.2.html | 2013-12-16 13:11 | 9.6K | FOLLETT v. ROSE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0341.2.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0342.1.html | 2013-12-16 13:11 | 1.2K | FOLLETT (WILCOX & GIBBS SEWING MACH. Co. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0342.1.pdf | 2011-11-01 09:59 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0342.2.html | 2013-12-16 13:12 | 44K | FOLSOM et al. v. MARSH et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0342.2.pdf | 2011-11-01 09:59 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0349.html | 2013-12-16 13:12 | 17K | FOLSOM v. MERCANTILE MUT. INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0349.pdf | 2011-11-01 09:59 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0352.html | 2013-12-16 13:11 | 11K | FOLSOM v. MERCANTILE MUT. INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0352.pdf | 2011-11-01 09:59 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0353.1.html | 2013-12-16 13:12 | 1.2K | FOLSOM (TARR. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0353.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0353.2.html | 2013-12-16 13:11 | 1.2K | FOLSOM (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0353.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0353.3.html | 2013-12-16 13:11 | 9.2K | FONDA v. BRITISH-AMERICAN ASSUR. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0353.3.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0355.1.html | 2013-12-16 13:12 | 1.2K | FOND DU LAC COUNTY (OLCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0355.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0355.2.html | 2013-12-16 13:11 | 1.2K | FONGERES (SARDO v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0355.2.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0355.3.html | 2013-12-16 13:11 | 1.2K | FONTAIN (GUILLOU v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0355.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0355.4.html | 2013-12-16 13:12 | 3.8K | FONTAINE v. ARESTA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0355.4.pdf | 2011-11-01 09:59 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0355.5.html | 2013-12-16 13:12 | 12K | In re FOOT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0355.5.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0357.html | 2013-12-16 13:11 | 9.2K | In re FOOT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0357.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0358.html | 2013-12-16 13:12 | 14K | FOOT et al. v. EDWARDS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0358.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0360.html | 2013-12-16 13:12 | 11K | FOOTE et al. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0360.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0362.html | 2013-12-16 13:11 | 8.3K | FOOTE v. FROST et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0362.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0363.html | 2013-12-16 13:11 | 11K | FOOTE v. HANCOCK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0363.pdf | 2011-11-01 09:59 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0364.html | 2013-12-16 13:12 | 12K | FOOTE v. JOHNSON COUNTX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0364.pdf | 2011-11-01 09:59 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0366.1.html | 2013-12-16 13:11 | 1.2K | FOOTE v. JOHNSON COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0366.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0366.2.html | 2013-12-16 13:11 | 14K | FOOTE v. LINCK et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0366.2.pdf | 2011-11-01 09:59 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0368.html | 2013-12-16 13:12 | 26K | FOOTE v. MT. PLEASANT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0368.pdf | 2011-11-01 09:59 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0373.1.html | 2013-12-16 13:11 | 2.8K | FOOTE v. NOLAND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0373.1.pdf | 2011-11-01 09:59 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0373.2.html | 2013-12-16 13:12 | 68K | FOOTE v. SILSBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0373.2.pdf | 2011-11-01 09:59 | 150K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0383.html | 2013-12-16 13:11 | 9.1K | FOOTE v. SILSBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0383.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0384.html | 2013-12-16 13:12 | 9.5K | FOOTE v. SILSBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0384.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0385.html | 2013-12-16 13:12 | 36K | FOOTE v. SILSBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0385.pdf | 2011-11-01 09:59 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0391.html | 2013-12-16 13:12 | 9.9K | FOOTE v. SILSBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0391.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0392.1.html | 2013-12-16 13:11 | 1.2K | FOOTE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0392.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0392.2.html | 2013-12-16 13:12 | 9.6K | Ex parte FORBES et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0392.2.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0394.html | 2013-12-16 13:12 | 10K | In re FORBES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0394.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0395.html | 2013-12-16 13:12 | 37K | FORBES et al. v. BARSTOW STOVE CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0395.pdf | 2011-11-01 09:59 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0401.html | 2013-12-16 13:12 | 31K | FORBES v. GRACEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0401.pdf | 2011-11-01 09:59 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0406.html | 2013-12-16 13:11 | 12K | FORBES v. The HANNAH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0406.pdf | 2011-11-01 09:59 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0408.html | 2013-12-16 13:12 | 34K | FORBES et al. v. MEMPHIS, E. P. & P. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0408.pdf | 2011-11-01 09:59 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0413.html | 2013-12-16 13:11 | 9.9K | FORBES et al. v. The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0413.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0415.1.html | 2013-12-16 13:12 | 4.5K | FORBES et al. v. MURRAY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0415.1.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0415.2.html | 2013-12-16 13:11 | 12K | FORBES v. OVERBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0415.2.pdf | 2011-11-01 09:59 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0417.html | 2013-12-16 13:11 | 28K | FORBES v. PARSONS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0417.pdf | 2011-11-01 09:59 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0421.1.html | 2013-12-16 13:11 | 1.2K | FORBES (PENTLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0421.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0421.2.html | 2013-12-16 13:12 | 1.2K | FORBES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0421.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0422.html | 2013-12-16 13:11 | 9.5K | FORBUSH et al. v. BRADFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0422.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0423.html | 2013-12-16 13:11 | 14K | FORBUSH et al. v. COOK et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0423.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.1.html | 2013-12-16 13:11 | 1.2K | FORBUSH v. SOUTHWICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.1.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.2.html | 2013-12-16 13:12 | 1.2K | FORBUSH v. WALLING. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.3.html | 2013-12-16 13:12 | 1.2K | FORBUSH v. WHEELOCK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.4.html | 2013-12-16 13:11 | 1.2K | FORCE (KERR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.4.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.5.html | 2013-12-16 13:11 | 1.2K | FORCE (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.5.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0425.6.html | 2013-12-16 13:12 | 9.1K | In re FORD et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0425.6.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0426.1.html | 2013-12-16 13:12 | 1.2K | FORD (CARRINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0426.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0426.2.html | 2013-12-16 13:11 | 1.2K | FORD (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0426.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0426.3.html | 2013-12-16 13:11 | 1.2K | FORD (COOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0426.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0426.4.html | 2013-12-16 13:12 | 1.2K | FORD (EVARTS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0426.4.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0426.5.html | 2013-12-16 13:12 | 3.1K | FORD v. KEYS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0426.5.pdf | 2011-11-01 09:59 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0427.1.html | 2013-12-16 13:11 | 1.2K | FORDYCE (STANWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0427.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0427.2.html | 2013-12-16 13:12 | 1.2K | FORDYCE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0427.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0427.3.html | 2013-12-16 13:12 | 1.3K | FOREIGN MISSIONS OF PRESBYTERIAN CHURCH. BOARD OF, v. McMASTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0427.3.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0427.4.html | 2013-12-16 13:11 | 104K | FOREMAN v. BIGELOW et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0427.4.pdf | 2011-11-01 09:59 | 212K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0443.1.html | 2013-12-16 13:12 | 2.4K | FOREMAN v. HOLMEAD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0443.1.pdf | 2011-11-01 09:59 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0443.2.html | 2013-12-16 13:11 | 17K | The FOREST. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0443.2.pdf | 2011-11-01 09:59 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0446.html | 2013-12-16 13:12 | 11K | The FOREST KING. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0446.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0448.html | 2013-12-16 13:11 | 16K | The FOREST QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0448.pdf | 2011-11-01 09:59 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0450.html | 2013-12-16 13:11 | 2.9K | FORMAN v. CAMPBELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0450.pdf | 2011-11-01 09:59 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0451.html | 2013-12-16 13:11 | 10K | FORMAN et al. v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0451.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0452.html | 2013-12-16 13:12 | 18K | FORMAN v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0452.pdf | 2011-11-01 09:59 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0455.1.html | 2013-12-16 13:12 | 1.2K | FORREST (CUSHWA v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0455.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0455.2.html | 2013-12-16 13:11 | 1.2K | FORREST (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0455.2.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0455.3.html | 2013-12-16 13:11 | 5.9K | FORREST v. HANSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0455.3.pdf | 2011-11-01 09:59 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0456.html | 2013-12-16 13:12 | 20K | FORREST v. HANSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0456.pdf | 2011-11-01 09:59 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.1.html | 2013-12-16 13:11 | 1.2K | FORREST (JEFFERS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.2.html | 2013-12-16 13:12 | 1.2K | FORREST (UNION BANK OF GEORGETOWN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.2.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.3.html | 2013-12-16 13:12 | 1.2K | FORREST (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.4.html | 2013-12-16 13:11 | 1.2K | FORREST (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.4.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.5.html | 2013-12-16 13:11 | 1.2K | The FORRESTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.5.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.6.html | 2013-12-16 13:12 | 1.2K | FORRESTER, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.6.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0459.7.html | 2013-12-16 13:12 | 28K | FORRESTIER v. BORDMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0459.7.pdf | 2011-11-01 09:59 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0464.1.html | 2013-12-16 13:12 | 6.4K | FORSAITH v. MERRITT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0464.1.pdf | 2011-11-01 09:59 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0464.2.html | 2013-12-16 13:11 | 4.2K | FORSHAY v. DU FAIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0464.2.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0465.1.html | 2013-12-16 13:11 | 1.2K | FORSOKET, The (WILLENDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0465.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0465.2.html | 2013-12-16 13:12 | 18K | In re FORSYTH et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0465.2.pdf | 2011-11-01 09:59 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0468.html | 2013-12-16 13:11 | 18K | FORSYTH v. CLAPP et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0468.pdf | 2011-11-01 09:59 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0471.html | 2013-12-16 13:11 | 16K | FORSYTH et al. v. SMALE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0471.pdf | 2011-11-01 09:59 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0473.1.html | 2013-12-16 13:11 | 1.2K | FORSYTH (WOODS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0473.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0473.2.html | 2013-12-16 13:12 | 13K | FORSYTHE v. BALLANCE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0473.2.pdf | 2011-11-01 09:59 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0475.1.html | 2013-12-16 13:11 | 1.2K | FORSYTHE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0475.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0475.2.html | 2013-12-16 13:12 | 1.2K | FORSYTHE (VORHIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0475.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0475.3.html | 2013-12-16 13:12 | 26K | FORT v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0475.3.pdf | 2011-11-01 09:59 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0479.1.html | 2013-12-16 13:12 | 1.2K | FORT (WHITNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0479.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0479.2.html | 2013-12-16 13:11 | 91K | The FORTITUDE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0479.2.pdf | 2011-11-01 09:59 | 193K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0494.1.html | 2013-12-16 13:11 | 1.2K | FORT SCOTT (KEANE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0494.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0494.2.html | 2013-12-16 13:11 | 39K | The FORTUNA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0494.2.pdf | 2011-11-01 09:59 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0500.html | 2013-12-16 13:11 | 9.8K | In re FORTUNE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0500.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.1.html | 2013-12-16 13:11 | 1.2K | FORT WAYNE. The (COLLING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.2.html | 2013-12-16 13:11 | 1.2K | FORT WAYNE, ETC., R. CO (GAYLORD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.3.html | 2013-12-16 13:11 | 1.2K | FORTY BALES OF COTTON, PROCEEDS OF (RUSSELL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.4.html | 2013-12-16 13:12 | 1.3K | FORTY—EIGHT HUNDRED GALLOMS DISTILLED SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.4.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.5.html | 2013-12-16 13:12 | 1.3K | FORTY—SIX CASKS OF CALIFORNIA GRAPE BRANDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.5.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.6.html | 2013-12-16 13:11 | 1.3K | FORTY—THREE GALLONS OF WHISKEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.6.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.7.html | 2013-12-16 13:11 | 1.2K | FOSBENDER (McCLELLAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.7.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.8.html | 2013-12-16 13:12 | 1.2K | FOSDICK (DESHON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.8.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0501.9.html | 2013-12-16 13:12 | 13K | FOSDICK v. STURGES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0501.9.pdf | 2011-11-01 09:59 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0503.1.html | 2013-12-16 13:12 | 1.2K | FOSS (CLARKE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0503.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0503.2.html | 2013-12-16 13:11 | 17K | FOSS et al. v. HERBERT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0503.2.pdf | 2011-11-01 09:59 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0506.1.html | 2013-12-16 13:11 | 1.2K | FOSSAT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0506.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0506.2.html | 2013-12-16 13:12 | 1.2K | FOSSATT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0506.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0506.3.html | 2013-12-16 13:12 | 8.3K | FOSSITT et al. v. BELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0506.3.pdf | 2011-11-01 09:59 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0507.html | 2013-12-16 13:12 | 9.6K | Ex parte FOSTER., In re REMICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0507.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0508.html | 2013-12-16 13:11 | 70K | Ex parte FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0508.pdf | 2011-11-01 09:59 | 154K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0520.html | 2013-12-16 13:11 | 8.8K | In re FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0520.pdf | 2011-11-01 09:59 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0521.html | 2013-12-16 13:11 | 11K | In re FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0521.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0523.html | 2013-12-16 13:12 | 6.6K | In re FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0523.pdf | 2011-11-01 09:59 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0524.html | 2013-12-16 13:11 | 23K | In re FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0524.pdf | 2011-11-01 09:59 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0527.html | 2013-12-16 13:12 | 19K | FOSTER et al. v. AMES et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0527.pdf | 2011-11-01 09:59 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0530.1.html | 2013-12-16 13:12 | 1.2K | FOSTER (BOSTWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0530.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0530.2.html | 2013-12-16 13:11 | 2.9K | FOSTER v. The BRITISH OAK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0530.2.pdf | 2011-11-01 09:59 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0530.3.html | 2013-12-16 13:11 | 22K | FOSTER v. CALLAWAY COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0530.3.pdf | 2011-11-01 09:59 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.1.html | 2013-12-16 13:12 | 1.2K | FOSTER (CATLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.2.html | 2013-12-16 13:11 | 1.2K | FOSTER (DRURY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.3.html | 2013-12-16 13:11 | 2.6K | FOSTER v. ELLIS et al |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.3.pdf | 2011-11-01 09:59 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.4.html | 2013-12-16 13:12 | 1.2K | FOSTER v. GARDNER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.4.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.5.html | 2013-12-16 13:12 | 1.4K | FOSTER v. GODDARD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.5.pdf | 2011-11-01 09:59 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0534.6.html | 2013-12-16 13:11 | 65K | FOSTER v. GODDARD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0534.6.pdf | 2011-11-01 09:59 | 143K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0545.html | 2013-12-16 13:11 | 28K | FOSTER v. HACKLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0545.pdf | 2011-11-01 09:59 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0549.html | 2013-12-16 13:12 | 31K | FOSTER v. HILLIARD et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0549.pdf | 2011-11-01 09:59 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0554.html | 2013-12-16 13:12 | 3.8K | FOSTER et al. v. INGLEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0554.pdf | 2011-11-01 09:59 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0555.html | 2013-12-16 13:12 | 12K | FOSTER v. JOICE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0555.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0556.html | 2013-12-16 13:11 | 9.0K | FOSTER v. LINDSAY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0556.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0558.html | 2013-12-16 13:12 | 13K | FOSTER v. LINDSAY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0558.pdf | 2011-11-01 09:59 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0560.1.html | 2013-12-16 13:12 | 1.2K | FOSTER (McPHERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0560.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0560.2.html | 2013-12-16 13:11 | 24K | FOSTER v. The MIRANDA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0560.2.pdf | 2011-11-01 09:59 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0563.html | 2013-12-16 13:11 | 31K | FOSTER v. MOORE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0563.pdf | 2011-11-01 09:59 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0568.1.html | 2013-12-16 13:11 | 1.2K | FOSTER (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0568.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0568.2.html | 2013-12-16 13:12 | 1.2K | FOSTER (MORA v): |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0568.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0568.3.html | 2013-12-16 13:12 | 1.2K | FOSTER (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0568.3.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0568.4.html | 2013-12-16 13:11 | 8.1K | FOSTER v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0568.4.pdf | 2011-11-01 09:59 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0569.html | 2013-12-16 13:12 | 14K | FOSTER et al. v. The PILOT NO. 2. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0569.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0571.html | 2013-12-16 13:12 | 1.2K | FOSTER v. REMICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0571.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0572.1.html | 2013-12-16 13:12 | 5.7K | FOSTER v. RHODES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0572.1.pdf | 2011-11-01 09:59 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0572.2.html | 2013-12-16 13:11 | 6.3K | FOSTER et al. v. SAMPSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0572.2.pdf | 2011-11-01 09:59 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0573.html | 2013-12-16 13:11 | 34K | FOSTER et al. v. SIMMONS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0573.pdf | 2011-11-01 09:59 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0579.1.html | 2013-12-16 13:12 | 5.5K | FOSTER v. SIMMONS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0579.1.pdf | 2011-11-01 09:59 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0579.2.html | 2013-12-16 13:11 | 1.2K | FOSTER (SPRINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0579.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0579.3.html | 2013-12-16 13:11 | 26K | FOSTER et al. v. SWASEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0579.3.pdf | 2011-11-01 09:59 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0583.html | 2013-12-16 13:11 | 8.4K | FOSTER et al. v. SWASEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0583.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.1.html | 2013-12-16 13:12 | 1.2K | FOSTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.2.html | 2013-12-16 13:11 | 1.2K | FOSTER (WESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.2.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.3.html | 2013-12-16 13:11 | 1.2K | FOULKE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.4.html | 2013-12-16 13:12 | 1.2K | FOULKROD (MAYER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.4.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.5.html | 2013-12-16 13:12 | 1.2K | FOUR CASES CUTLERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.5.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.6.html | 2013-12-16 13:11 | 1.2K | FOUR CASES OF LASTINGS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.6.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.7.html | 2013-12-16 13:11 | 1.2K | FOUR CASES PRINTED MERINOES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.7.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0585.8.html | 2013-12-16 13:11 | 24K | FOUR CASES SILK RIBBONS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0585.8.pdf | 2011-11-01 09:59 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0589.1.html | 2013-12-16 13:11 | 1.2K | FOUR CRIBS OF LUMBER (TOME v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0589.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0589.2.html | 2013-12-16 13:12 | 14K | FOUR CUTTING MACHINES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0589.2.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0591.html | 2013-12-16 13:12 | 9.5K | FOUR HUNDRED AND SIX HOGSHEADS OF MOLASSES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0591.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0592.1.html | 2013-12-16 13:11 | 1.3K | FOUR HUNDRED AND SIXTY BARRELS OF FERMENTED LIQUORS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0592.1.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0592.2.html | 2013-12-16 13:12 | 1.3K | FOUR HUNDRED AND SIXTY-NINE BARRELS OF SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0592.2.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0592.3.html | 2013-12-16 13:12 | 1.3K | FOUR HUNDRED AND SIXTY-SEVEN BARS OF RAILROAD IRON (HARLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0592.3.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0592.4.html | 2013-12-16 13:11 | 1.3K | FOUR HUNDRED AND THIRTY-EIGHT BALES OF COTTON (SARATOGA, The, v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0592.4.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0592.5.html | 2013-12-16 13:11 | 62K | FOUR HUNDRED AND TWENTY MIN. CO. v. BULLION MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0592.5.pdf | 2011-11-01 09:59 | 139K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0602.1.html | 2013-12-16 13:12 | 1.2K | FOUR HUNDRED BARRELS OF SALT (WINSLOW v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0602.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0602.2.html | 2013-12-16 13:11 | 1.2K | FOUR HUNDRED BASKETS OF CHAMPAGNE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0602.2.pdf | 2011-11-01 09:59 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0602.3.html | 2013-12-16 13:11 | 1.2K | FOUR PART PIECES OF WOOLEN CLOTH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0602.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0602.4.html | 2013-12-16 13:12 | 13K | FOURTEEN HORSES, ETC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0602.4.pdf | 2011-11-01 09:59 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0604.1.html | 2013-12-16 13:12 | 1.2K | FOURTEEN PACKAGES OF PINS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0604.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0604.2.html | 2013-12-16 13:11 | 6.6K | FOURTH NAT. BANK v. NEYHARDT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0604.2.pdf | 2011-11-01 09:59 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0605.1.html | 2013-12-16 13:11 | 1.2K | FOURTH NAT. BANK v. PAPIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0605.1.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0605.2.html | 2013-12-16 13:12 | 8.6K | FOURTH NAT. BANK v. WALKER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0605.2.pdf | 2011-11-01 09:59 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0606.1.html | 2013-12-16 13:12 | 1.2K | FOUR THOUSAND AMERICAN GOLD COIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0606.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0606.2.html | 2013-12-16 13:11 | 1.3K | FOUR THOUSAND EIGHT HUNDRED AND EIGHTY-FIVE BAGS OF LINSEED (SEARS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0606.2.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0606.3.html | 2013-12-16 13:11 | 1.3K | FOUR THOUSAND EIGHT HUNDRED GALLONS OF SPIRITS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0606.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0606.4.html | 2013-12-16 13:12 | 1.3K | FOUR THOUSAND ONE HUNDRED AND TWENTY-FIVE CIGARS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0606.4.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0606.5.html | 2013-12-16 13:12 | 24K | FOWLE v. ALEXANDRIA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0606.5.pdf | 2011-11-01 09:59 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0610.1.html | 2013-12-16 13:12 | 2.7K | FOWLE et al. v. BOWIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0610.1.pdf | 2011-11-01 09:59 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0610.2.html | 2013-12-16 13:11 | 3.0K | FOWLE v. BOWIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0610.2.pdf | 2011-11-01 09:59 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0611.1.html | 2013-12-16 13:11 | 1.1K | FOWLE (HANSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0611.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0611.2.html | 2013-12-16 13:12 | 1.2K | FOWLE (McCLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0611.2.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0611.3.html | 2013-12-16 13:12 | 1.2K | FOWLE (PIERPONT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0611.3.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0611.4.html | 2013-12-16 13:11 | 14K | FOWLE v. SPEAR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0611.4.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0613.html | 2013-12-16 13:11 | 6.8K | In re FOWLER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0613.pdf | 2011-11-01 09:59 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0614.html | 2013-12-16 13:12 | 7.9K | In re FOWLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0614.pdf | 2011-11-01 09:59 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0615.html | 2013-12-16 13:12 | 8.2K | In re FOWLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0615.pdf | 2011-11-01 09:59 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0616.1.html | 2013-12-16 13:12 | 5.3K | FOWLER v. BYRD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0616.1.pdf | 2011-11-01 09:59 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0616.2.html | 2013-12-16 13:11 | 17K | FOWLER v. DILLON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0616.2.pdf | 2011-11-01 09:59 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0619.1.html | 2013-12-16 13:12 | 1.2K | FOWLER (FERRAND v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0619.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0619.2.html | 2013-12-16 13:11 | 6.1K | FOWLER v. HECKER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0619.2.pdf | 2011-11-01 09:59 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.1.html | 2013-12-16 13:11 | 3.4K | FOWLER v. MacDONALD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.1.pdf | 2011-11-01 09:59 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.2.html | 2013-12-16 13:12 | 1.2K | FOWLER (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.3.html | 2013-12-16 13:12 | 1.2K | FOWLER (RATHBONE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.4.html | 2013-12-16 13:11 | 2.5K | FOWLER v. REDFIELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.4.pdf | 2011-11-01 09:59 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.5.html | 2013-12-16 13:11 | 1.2K | FOWLER (TUCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.5.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.6.html | 2013-12-16 13:12 | 1.2K | FOWLER (VORE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.6.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0620.7.html | 2013-12-16 13:12 | 3.4K | FOWLER v. WARFIELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0620.7.pdf | 2011-11-01 09:59 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0621.1.html | 2013-12-16 13:12 | 1.2K | FOWLER (WARNER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0621.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0621.2.html | 2013-12-16 13:11 | 1.2K | FOWLER (WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0621.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0621.3.html | 2013-12-16 13:11 | 1.2K | FOWLER (WITHROW v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0621.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0621.4.html | 2013-12-16 13:12 | 1.2K | FOWLER (WYMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0621.4.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0621.5.html | 2013-12-16 13:12 | 11K | FOWLKES v. FOWLKES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0621.5.pdf | 2011-11-01 09:59 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0623.1.html | 2013-12-16 13:12 | 1.3K | In re FOX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0623.1.pdf | 2011-11-01 09:59 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0623.2.html | 2013-12-16 13:11 | 9.0K | In re FOX et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0623.2.pdf | 2011-11-01 09:59 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0624.1.html | 2013-12-16 13:11 | 1.2K | FOX (AVERY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0624.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0624.2.html | 2013-12-16 13:12 | 11K | FOX v. BLOSSOM. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0624.2.pdf | 2011-11-01 09:59 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0625.1.html | 2013-12-16 13:12 | 1.2K | FOX (BOUCICAULT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0625.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0625.2.html | 2013-12-16 13:11 | 1.3K | FOX (CHILLICOTHE BRANCH OF THE STATE BANK OF THE STATE BANK OF OHIO v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0625.2.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0625.3.html | 2013-12-16 13:11 | 1.1K | FOX (DE VARAIGNE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0625.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0626.html | 2013-12-16 13:11 | 7.4K | FOX v. ECKSTEIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0626.pdf | 2011-11-01 09:59 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0627.1.html | 2013-12-16 13:12 | 1.2K | FOX (FARMERS' BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0627.1.pdf | 2011-11-01 09:59 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0627.2.html | 2013-12-16 13:11 | 1.2K | FOX (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0627.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0627.3.html | 2013-12-16 13:11 | 9.9K | FOX v. HEMPFIELD R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0627.3.pdf | 2011-11-01 09:59 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0628.html | 2013-12-16 13:12 | 11K | FOX v. HEMPFIELD R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0628.pdf | 2011-11-01 09:59 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0630.1.html | 2013-12-16 13:11 | 1.2K | FOX (HOLMEAD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0630.1.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0630.2.html | 2013-12-16 13:12 | 55K | FOX et al. v. HOLT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0630.2.pdf | 2011-11-01 09:59 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0638.html | 2013-12-16 13:12 | 26K | FOX v. The LUCY A. BLOSSOM. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0638.pdf | 2011-11-01 09:59 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0642.html | 2013-12-16 13:12 | 13K | FOX v. PAINE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0642.pdf | 2011-11-01 09:59 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0644.1.html | 2013-12-16 13:12 | 1.2K | FOX v. REVENUE CUTTER NO. 1. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0644.1.pdf | 2011-11-01 09:59 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0644.2.html | 2013-12-16 13:11 | 1.2K | FOX (ROCHE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0644.2.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0644.3.html | 2013-12-16 13:11 | 1.2K | FOX (SHANNON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0644.3.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0644.4.html | 2013-12-16 13:12 | 1.2K | FOX (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0644.4.pdf | 2011-11-01 09:59 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0644.5.html | 2013-12-16 13:12 | 2.6K | FOXALL v. LEVL |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0644.5.pdf | 2011-11-01 09:59 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0645.html | 2013-12-16 13:11 | 17K | FOXALL v. McKENNEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0645.pdf | 2011-11-01 09:59 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0647.1.html | 2013-12-16 13:11 | 1.2K | FOXALL (TURNER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0647.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0647.2.html | 2013-12-16 13:12 | 1.2K | FOXCROFT (MALLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0647.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0647.3.html | 2013-12-16 13:12 | 1.2K | FOY (FLEMING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0647.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0647.4.html | 2013-12-16 13:11 | 4.4K | FOY et al. v. HUNTER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0647.4.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0648.1.html | 2013-12-16 13:11 | 5.1K | FOY et al. v. HUNTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0648.1.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0648.2.html | 2013-12-16 13:12 | 4.0K | FOY v. HUNTER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0648.2.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0649.1.html | 2013-12-16 13:12 | 4.0K | FOY v. TALBURT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0649.1.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0649.2.html | 2013-12-16 13:11 | 5.1K | In re FOYE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0649.2.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0650.1.html | 2013-12-16 13:12 | 3.1K | FOYE v. DABNEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0650.1.pdf | 2011-11-01 10:00 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0650.2.html | 2013-12-16 13:11 | 5.3K | FOYE v. LECKIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0650.2.pdf | 2011-11-01 10:00 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0651.1.html | 2013-12-16 13:11 | 1.2K | FOYE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0651.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0651.2.html | 2013-12-16 13:12 | 1.2K | FOYLES (DOBBIN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0651.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0651.3.html | 2013-12-16 13:12 | 1.2K | FOYLES (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0651.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0651.4.html | 2013-12-16 13:11 | 7.3K | FOYLES v. LAW. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0651.4.pdf | 2011-11-01 10:00 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0652.html | 2013-12-16 13:12 | 12K | FRALOFF v. NEW YORK CENT. & H. R. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0652.pdf | 2011-11-01 10:00 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0654.html | 2013-12-16 13:11 | 18K | FRALOFF v. NEW YORK CENT. & H. R. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0654.pdf | 2011-11-01 10:00 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0656.1.html | 2013-12-16 13:12 | 1.2K | FRAME (MYERS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0656.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0656.2.html | 2013-12-16 13:11 | 1.1K | FRAME (PEEK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0656.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0657.html | 2013-12-16 13:12 | 22K | FRANCE et ux. v. AETNA LIFE INS. CO. (two cases). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0657.pdf | 2011-11-01 10:00 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0660.1.html | 2013-12-16 13:11 | 5.2K | FRANCE v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0660.1.pdf | 2011-11-01 10:00 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0660.2.html | 2013-12-16 13:12 | 10K | The FRANCESCA CURRO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0660.2.pdf | 2011-11-01 10:00 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0662.1.html | 2013-12-16 13:11 | 1.2K | FRANCESCA CURRO, The (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0662.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0662.2.html | 2013-12-16 13:12 | 13K | The FRANCESCA T. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0662.2.pdf | 2011-11-01 10:00 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0664.1.html | 2013-12-16 13:11 | 1.2K | FRANCESTOWN SOAP-STONE STORE CO. (HENRY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0664.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0664.2.html | 2013-12-16 13:12 | 37K | In re FRANCIS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0664.2.pdf | 2011-11-01 10:00 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0670.html | 2013-12-16 13:11 | 14K | The FRANCIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0670.pdf | 2011-11-01 10:00 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0672.html | 2013-12-16 13:12 | 4.8K | The FRANCIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0672.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0673.html | 2013-12-16 13:12 | 11K | The FRANCIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0673.pdf | 2011-11-01 10:00 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0674.html | 2013-12-16 13:11 | 5.9K | The FRANCIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0674.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0675.html | 2013-12-16 13:11 | 14K | The FRANCIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0675.pdf | 2011-11-01 10:00 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0677.html | 2013-12-16 13:12 | 4.5K | FRANCIS v. BASSETT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0677.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0678.1.html | 2013-12-16 13:12 | 1.2K | FRANCIS (CAMAC v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0678.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0678.2.html | 2013-12-16 13:11 | 49K | FRANCIS et al. v. The HARRISON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0678.2.pdf | 2011-11-01 10:00 | 113K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0685.1.html | 2013-12-16 13:11 | 1.2K | FRANCIS v. MAHN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0685.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0685.2.html | 2013-12-16 13:12 | 20K | FRANCIS et al. v. MELLOR et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0685.2.pdf | 2011-11-01 10:00 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0688.html | 2013-12-16 13:11 | 6.2K | The FRANCIS ASHBY., PACKER v. The FRANCIS ASHBY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0688.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0689.html | 2013-12-16 13:11 | 7.9K | FRANCIS v. SLACK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0689.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0690.1.html | 2013-12-16 13:12 | 1.2K | FRANCIS A. PALMER, The (ALLAIRE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0690.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0690.2.html | 2013-12-16 13:11 | 1.2K | FRANCIS A. PALMER. The (HARBECK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0690.2.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0690.3.html | 2013-12-16 13:11 | 1.2K | FRANCISCO, The (SOMERVILLE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0690.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0690.4.html | 2013-12-16 13:12 | 1.2K | FRANCIS HATCH, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0690.4.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0690.5.html | 2013-12-16 13:12 | 8.9K | The FRANCIS KING. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0690.5.pdf | 2011-11-01 10:00 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0691.html | 2013-12-16 13:11 | 4.6K | The FRANCIS KING. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0691.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0692.1.html | 2013-12-16 13:12 | 1.2K | FRANCIS PALMER, The (HARBECK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0692.1.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0692.2.html | 2013-12-16 13:11 | 1.2K | FRANCIS SKIDDY, The (HOVEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0692.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0692.3.html | 2013-12-16 13:11 | 30K | The FRANCIS WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0692.3.pdf | 2011-11-01 10:00 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0696.html | 2013-12-16 13:12 | 4.7K | In re FRANCKE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0696.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0697.html | 2013-12-16 13:12 | 16K | In re FRANCKE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0697.pdf | 2011-11-01 10:00 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0699.html | 2013-12-16 13:11 | 11K | Ex parte FRANCOIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0699.pdf | 2011-11-01 10:00 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0701.html | 2013-12-16 13:11 | 8.4K | FRANCONET v. The F. W. BACKUS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0701.pdf | 2011-11-01 10:00 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0702.html | 2013-12-16 13:12 | 12K | The FRANCONIA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0702.pdf | 2011-11-01 10:00 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0704.html | 2013-12-16 13:11 | 12K | In re FRANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0704.pdf | 2011-11-01 10:00 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0706.1.html | 2013-12-16 13:12 | 3.7K | FRANK v. CHETWOOD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0706.1.pdf | 2011-11-01 10:00 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0706.2.html | 2013-12-16 13:11 | 1.2K | FRANK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0706.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0706.3.html | 2013-12-16 13:11 | 2.0K | The FRANK A. HALL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0706.3.pdf | 2011-11-01 10:00 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0706.4.html | 2013-12-16 13:12 | 17K | FRANKLE et al. v. PENNSYLVANIA FIRE INS. CO., SAME v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0706.4.pdf | 2011-11-01 10:00 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0709.1.html | 2013-12-16 13:12 | 4.6K | In re FRANKLIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0709.1.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0709.2.html | 2013-12-16 13:11 | 1.2K | FRANKLIN (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0709.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0709.3.html | 2013-12-16 13:11 | 8.6K | FRANKLIN v. HEISER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0709.3.pdf | 2011-11-01 10:00 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0710.1.html | 2013-12-16 13:12 | 1.2K | FEANKLIN, The (SWAIM v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0710.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0710.2.html | 2013-12-16 13:11 | 1.2K | FRANKLIN v. TERRY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0710.2.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0710.3.html | 2013-12-16 13:11 | 1.2K | FRANKLIN, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0710.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.1.html | 2013-12-16 13:11 | 4.6K | FRANKLINv. WARD et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.1.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.2.html | 2013-12-16 13:12 | 1.2K | FRANKLIN (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.3.html | 2013-12-16 13:11 | 1.2K | FRANKLIN AVENUE GERMAN SAV. INST. (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.4.html | 2013-12-16 13:11 | 2.7K | FRANKLIN BANK v. HIPKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.4.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.5.html | 2013-12-16 13:11 | 1.2K | FRANKLIN CANAL CO. (CLEVELAND, P. & A. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.5.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.6.html | 2013-12-16 13:12 | 1.2K | FRANKLIN FIRE INS. CO. (BETTS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.6.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.7.html | 2013-12-16 13:12 | 1.2K | FRANKLIN HEMP & BAGGING CO. (COCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.7.pdf | 2011-11-01 10:00 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.8.html | 2013-12-16 13:11 | 1.2K | FRANKLIN HEMP & FLAX MANUF'G CO. (COCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.8.pdf | 2011-11-01 10:00 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0711.9.html | 2013-12-16 13:11 | 1.2K | FRANKLIN INS. CO. (HOLTZMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0711.9.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0712.html | 2013-12-16 13:12 | 19K | FRANKLIN INS. CO. v. LORD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0712.pdf | 2011-11-01 10:00 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0715.html | 2013-12-16 13:11 | 19K | ESTATE OF FRANKLIN SAV. FUND SOC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0715.pdf | 2011-11-01 10:00 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0718.1.html | 2013-12-16 13:11 | 2.0K | In re FRANKLIN SAV. FUND SOC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0718.1.pdf | 2011-11-01 10:00 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0718.2.html | 2013-12-16 13:12 | 20K | The FRANK MOFFAT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0718.2.pdf | 2011-11-01 10:00 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0721.1.html | 2013-12-16 13:12 | 4.8K | FRANZ & POPE KNITTING—MACH. CO. v. BICKFORD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0721.1.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0721.2.html | 2013-12-16 13:11 | 4.5K | FRANZ & POPE KNITTING—MACH. CO. v. LAMB KNITTING—MACH. MANUF'G CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0721.2.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0722.html | 2013-12-16 13:12 | 7.8K | The FRANZ SIGEL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0722.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0723.html | 2013-12-16 13:12 | 13K | FRASER et al. v. HUNTER et al |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0723.pdf | 2011-11-01 10:00 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0725.html | 2013-12-16 13:11 | 5.1K | FRASER v. WELLER et al |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0725.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0726.1.html | 2013-12-16 13:11 | 2.7K | FRASER v. WOLCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0726.1.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0726.2.html | 2013-12-16 13:12 | 13K | FRATES et al. v. HOWLAND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0726.2.pdf | 2011-11-01 10:00 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0728.html | 2013-12-16 13:11 | 11K | FRAYSER et al. v. RUSSEDLL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0728.pdf | 2011-11-01 10:00 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0729.html | 2013-12-16 13:11 | 9.4K | In re FRAZER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0729.pdf | 2011-11-01 10:00 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0731.html | 2013-12-16 13:11 | 29K | FRAZER v. CARPENTER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0731.pdf | 2011-11-01 10:00 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0735.1.html | 2013-12-16 13:12 | 1.2K | FRAZER (DAGGS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0735.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0735.2.html | 2013-12-16 13:11 | 1.2K | FRAZER (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0735.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0735.3.html | 2013-12-16 13:11 | 1.2K | FRAZER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0735.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0735.4.html | 2013-12-16 13:12 | 8.9K | In re FRAZIER., Ex parte ANTHONY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0735.4.pdf | 2011-11-01 10:00 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0737.1.html | 2013-12-16 13:12 | 2.2K | FRAZIER v. BRACKENRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0737.1.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0737.2.html | 2013-12-16 13:11 | 1.2K | FRAZIER (IRVING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0737.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0737.3.html | 2013-12-16 13:11 | 2.3K | FRAZIER v. LOMAX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0737.3.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0737.4.html | 2013-12-16 13:12 | 5.6K | FRAZIER et al. v. McDONALD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0737.4.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0738.html | 2013-12-16 13:11 | 14K | In re FREAR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0738.pdf | 2011-11-01 10:00 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0740.html | 2013-12-16 13:12 | 9.4K | In re FREDENBERG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0740.pdf | 2011-11-01 10:00 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0741.1.html | 2013-12-16 13:11 | 1.3K | In re FREDERICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0741.1.pdf | 2011-11-01 10:00 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0741.2.html | 2013-12-16 13:11 | 2.9K | FREDERICK et al. v. The FANNY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0741.2.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0741.3.html | 2013-12-16 13:12 | 11K | The FREDERICK M. WILSON., The GENERAL SHERIDAN., The YORK RIVER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0741.3.pdf | 2011-11-01 10:00 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0743.1.html | 2013-12-16 13:11 | 1.2K | FREDERICKSON (BANK OF UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0743.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0743.2.html | 2013-12-16 13:12 | 1.2K | FRED LORENTS. The (WHITAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0743.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0743.3.html | 2013-12-16 13:12 | 7.1K | FREEBORN et al. v. The FALCON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0743.3.pdf | 2011-11-01 10:00 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0744.html | 2013-12-16 13:12 | 14K | Ex parte FREEDLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0744.pdf | 2011-11-01 10:00 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0746.html | 2013-12-16 13:11 | 10K | FREEDMAN v. SIGEL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0746.pdf | 2011-11-01 10:00 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0748.1.html | 2013-12-16 13:11 | 1.3K | FREEDMEN'S SAV. & TRUST CO. (STATE NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0748.1.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0748.2.html | 2013-12-16 13:12 | 1.2K | FREELAND (ROBBINS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0748.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0748.3.html | 2013-12-16 13:12 | 13K | FREELANDER et al. v. HOLLOMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0748.3.pdf | 2011-11-01 10:00 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0750.html | 2013-12-16 13:12 | 7.1K | In re FREEMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0750.pdf | 2011-11-01 10:00 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0751.html | 2013-12-16 13:12 | 19K | In re FREEMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0751.pdf | 2011-11-01 10:00 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0753.html | 2013-12-16 13:11 | 3.6K | FREEMAN et al. v. The ALBANY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0753.pdf | 2011-11-01 10:00 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0754.html | 2013-12-16 13:12 | 25K | FREEMAN et al. v. BAKER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0754.pdf | 2011-11-01 10:00 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0758.1.html | 2013-12-16 13:11 | 1.3K | FREEMAN v. CARGO OF SALT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0758.1.pdf | 2011-11-01 10:00 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0758.2.html | 2013-12-16 13:12 | 1.2K | FREEMAN (DUTTON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0758.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0758.3.html | 2013-12-16 13:12 | 3.3K | FREEMAN v. The JANE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0758.3.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0758.4.html | 2013-12-16 13:11 | 1.2K | FREEMAN (KENDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0758.4.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0758.5.html | 2013-12-16 13:11 | 5.9K | FREEMAN v. PEROT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0758.5.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0759.html | 2013-12-16 13:12 | 7.6K | FREEMAN v. STEWART et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0759.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0760.1.html | 2013-12-16 13:11 | 1.2K | FREEMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0760.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0760.2.html | 2013-12-16 13:12 | 10K | FREEMAN'S NAT. BANK v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0760.2.pdf | 2011-11-01 10:00 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0762.html | 2013-12-16 13:11 | 45K | The FREE STATE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0762.pdf | 2011-11-01 10:00 | 109K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0769.1.html | 2013-12-16 13:11 | 1.2K | FREESTONE. The (RUSK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0769.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0769.2.html | 2013-12-16 13:12 | 3.2K | The FREE TRADER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0769.2.pdf | 2011-11-01 10:00 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0769.3.html | 2013-12-16 13:12 | 7.9K | In re FREIDERICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0769.3.pdf | 2011-11-01 10:00 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0770.1.html | 2013-12-16 13:11 | 1.2K | FREIDMAN v. SIGEL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0770.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0770.2.html | 2013-12-16 13:12 | 2.2K | FRELIGH v. CARROLL et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0770.2.pdf | 2011-11-01 10:00 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0770.3.html | 2013-12-16 13:12 | 6.0K | The FREMONT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0770.3.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0771.html | 2013-12-16 13:12 | 7.9K | The FREMONT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0771.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0772.html | 2013-12-16 13:11 | 8.7K | FREMONT v. MERCED MIX. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0772.pdf | 2011-11-01 10:00 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.1.html | 2013-12-16 13:11 | 1.2K | FREMONT, The (SCHENCK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.2.html | 2013-12-16 13:12 | 1.2K | FREMONT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.3.html | 2013-12-16 13:12 | 1.2K | FRENCH (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.4.html | 2013-12-16 13:11 | 1.2K | FRENCH (BANK OF COLUMBIA v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.4.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.5.html | 2013-12-16 13:11 | 1.2K | FRENCH (BOWMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.5.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0774.6.html | 2013-12-16 13:12 | 24K | FRENCH v. BREWER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0774.6.pdf | 2011-11-01 10:00 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0777.html | 2013-12-16 13:11 | 1.2K | FRENCH (BRIGGS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0777.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0778.html | 2013-12-16 13:12 | 20K | FRENCH v. EDWARDS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0778.pdf | 2011-11-01 10:00 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0781.html | 2013-12-16 13:12 | 32K | FRENCH v. EDWARDS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0781.pdf | 2011-11-01 10:00 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0786.1.html | 2013-12-16 13:12 | 1.2K | FRENCH (FARRELL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0786.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0786.2.html | 2013-12-16 13:11 | 7.0K | FRENCH v. FIRST NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0786.2.pdf | 2011-11-01 10:00 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0787.html | 2013-12-16 13:11 | 7.7K | FRENCH v. FIRST NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0787.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0788.1.html | 2013-12-16 13:11 | 1.2K | FRENCH (GREEN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0788.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0788.2.html | 2013-12-16 13:12 | 1.2K | FRENCH (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0788.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0788.3.html | 2013-12-16 13:12 | 1.3K | FRENCH v. KINGSDAND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0788.3.pdf | 2011-11-01 10:00 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0788.4.html | 2013-12-16 13:11 | 16K | FRENCH et al. v. LAFAYETTE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0788.4.pdf | 2011-11-01 10:00 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0790.1.html | 2013-12-16 13:12 | 1.2K | FRENCH (PIGOU v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0790.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0790.2.html | 2013-12-16 13:11 | 45K | FRENCH et al. v. ROGERS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0790.2.pdf | 2011-11-01 10:00 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0798.1.html | 2013-12-16 13:11 | 1.2K | FRENCH (SHOEMAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0798.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0798.2.html | 2013-12-16 13:12 | 1.2K | FRENCH (SOMMERVILLE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0798.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0798.3.html | 2013-12-16 13:12 | 1.2K | FRENCH (STEWART v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0798.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0798.4.html | 2013-12-16 13:11 | 5.9K | FRENCH et al. v. The SUPERB. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0798.4.pdf | 2011-11-01 10:00 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0798.5.html | 2013-12-16 13:11 | 17K | FRENCH v. TUMLIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0798.5.pdf | 2011-11-01 10:00 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0801.html | 2013-12-16 13:11 | 4.7K | FRENCH v. TUNSTALL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0801.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0802.1.html | 2013-12-16 13:12 | 1.2K | FRENCH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0802.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0802.2.html | 2013-12-16 13:11 | 4.0K | FRENCH v. VENABLE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0802.2.pdf | 2011-11-01 10:00 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0802.3.html | 2013-12-16 13:11 | 17K | FRENCH v. The VICTORIA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0802.3.pdf | 2011-11-01 10:00 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0805.1.html | 2013-12-16 13:11 | 2.6K | FRERE v. MUDD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0805.1.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0805.2.html | 2013-12-16 13:12 | 1.4K | FREREZ v. The GENESEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0805.2.pdf | 2011-11-01 10:00 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0805.3.html | 2013-12-16 13:12 | 1.2K | FRERICHS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0805.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0805.4.html | 2013-12-16 13:11 | 4.3K | FRERICKS v. COSTER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0805.4.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0805.5.html | 2013-12-16 13:11 | 7.5K | FRESE et al. v. BACHOF. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0805.5.pdf | 2011-11-01 10:00 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0806.html | 2013-12-16 13:12 | 17K | FRESE et al. v. BACHOF. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0806.pdf | 2011-11-01 10:00 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0809.html | 2013-12-16 13:11 | 4.4K | FRESE et al. v. BIEDENFELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0809.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0810.1.html | 2013-12-16 13:12 | 6.4K | FRESH v. GILSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0810.1.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0810.2.html | 2013-12-16 13:11 | 6.6K | In re FREUDENFELS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0810.2.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0811.html | 2013-12-16 13:11 | 5.7K | FREVALL v. BACHE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0811.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0812.1.html | 2013-12-16 13:12 | 3.4K | In re FREY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0812.1.pdf | 2011-11-01 10:00 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0812.2.html | 2013-12-16 13:11 | 15K | In re FREYVOGEL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0812.2.pdf | 2011-11-01 10:00 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.1.html | 2013-12-16 13:11 | 1.2K | FRICK (ALBERS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.2.html | 2013-12-16 13:12 | 1.2K | FRICK (KARTHAUS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.3.html | 2013-12-16 13:12 | 1.2K | FRICK (RIGGS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.4.html | 2013-12-16 13:11 | 1.2K | FRICKE v. HUM. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.4.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.5.html | 2013-12-16 13:11 | 1.2K | FRICTION MATCH MACHINERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.5.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.6.html | 2013-12-16 13:12 | 1.2K | FRIDENBERG (SEDGWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.6.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.7.html | 2013-12-16 13:12 | 1.2K | FRIDENBERG (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.7.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.8.html | 2013-12-16 13:11 | 1.2K | FRIDGE (RAVERTY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.8.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.9.html | 2013-12-16 13:11 | 3.6K | In re FRIEDBERG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.9.pdf | 2011-11-01 10:00 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0815.10.html | 2013-12-16 13:11 | 13K | FRIEDLANDER et al. v. JOHNSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0815.10.pdf | 2011-11-01 10:00 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0817.html | 2013-12-16 13:12 | 6.0K | In re FRIEDLOB. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0817.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0818.html | 2013-12-16 13:11 | 19K | FRIEDMAN v. GOODWIN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0818.pdf | 2011-11-01 10:00 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0821.1.html | 2013-12-16 13:12 | 1.3K | FRIEMANSDORF v. WATERTOWN INS. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0821.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0821.2.html | 2013-12-16 13:11 | 6.1K | In re FRIEND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0821.2.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0822.1.html | 2013-12-16 13:11 | 1.2K | FRIEND (CANA v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0822.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0822.2.html | 2013-12-16 13:12 | 2.4K | FRIEND v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0822.2.pdf | 2011-11-01 10:00 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0822.3.html | 2013-12-16 13:12 | 1.3K | The FRIENDSHIP. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0822.3.pdf | 2011-11-01 10:00 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0822.4.html | 2013-12-16 13:11 | 4.7K | The FRIENDSHIP. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0822.4.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0822.5.html | 2013-12-16 13:11 | 18K | The FRIENDSHIP. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0822.5.pdf | 2011-11-01 10:00 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0825.html | 2013-12-16 13:11 | 6.3K | The FRIENDSHIP. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0825.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0826.1.html | 2013-12-16 13:11 | 1.2K | FRIENDSHIP, The (DELIESSLINE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0826.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0826.2.html | 2013-12-16 13:12 | 1.2K | FRIENDSHIP, The (PARTER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0826.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0826.3.html | 2013-12-16 13:12 | 1.2K | FRIENDSHIP, The (STANNICK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0826.3.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0826.4.html | 2013-12-16 13:11 | 577K | Case of FRIES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0826.4.pdf | 2011-11-01 10:00 | 1.1M | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0924.html | 2013-12-16 13:12 | 179K | Case of FRIES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0924.pdf | 2011-11-01 10:00 | 352K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0949.1.html | 2013-12-16 13:12 | 1.2K | FRIES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0949.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0949.2.html | 2013-12-16 13:11 | 55K | FRINK v. PETRY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0949.2.pdf | 2011-11-01 10:00 | 168K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0950_01.jpg | 2011-04-25 21:36 | 21K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.0951_01.jpg | 2011-04-25 21:36 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0958.1.html | 2013-12-16 13:11 | 1.2K | FRINK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0958.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0958.2.html | 2013-12-16 13:12 | 8.8K | In re FRISBEE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0958.2.pdf | 2011-11-01 10:00 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0959.html | 2013-12-16 13:11 | 9.9K | In re FRISBEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0959.pdf | 2011-11-01 10:00 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0961.html | 2013-12-16 13:11 | 17K | In re FRISBIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0961.pdf | 2011-11-01 10:00 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0963.1.html | 2013-12-16 13:12 | 1.2K | FRISBIE (VOORHEES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0963.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0963.2.html | 2013-12-16 13:11 | 1.2K | FRITCHERY (SHAFFER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0963.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0964.html | 2013-12-16 13:11 | 7.5K | In re FRIZELLE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0964.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0965.1.html | 2013-12-16 13:12 | 3.8K | In re FRIZELLE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0965.1.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0965.2.html | 2013-12-16 13:11 | 1.2K | FROLIC, The (RISHER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0965.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0965.3.html | 2013-12-16 13:11 | 13K | In re FROST. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0965.3.pdf | 2011-11-01 10:00 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0967.html | 2013-12-16 13:12 | 13K | In re FROST et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0967.pdf | 2011-11-01 10:00 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.1.html | 2013-12-16 13:11 | 1.2K | FROST (ARNOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.1.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.2.html | 2013-12-16 13:11 | 1.2K | FROST (BINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.3.html | 2013-12-16 13:12 | 1.2K | FROST (BRADLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.3.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.4.html | 2013-12-16 13:11 | 1.2K | FROST (FOOTE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.4.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.5.html | 2013-12-16 13:11 | 1.2K | FROST (KITTLE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.5.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.6.html | 2013-12-16 13:12 | 1.2K | FROST (PROVIDENCE COUNTY SAV. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.6.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.7.html | 2013-12-16 13:12 | 1.2K | FROST (REDICK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.7.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.8.html | 2013-12-16 13:11 | 1.3K | FROST v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.8.pdf | 2011-11-01 10:00 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.9.html | 2013-12-16 13:11 | 1.3K | FROST v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.9.pdf | 2011-11-01 10:00 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.10.html | 2013-12-16 13:12 | 1.2K | FROSTEL (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.10.pdf | 2011-11-01 10:00 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.11.html | 2013-12-16 13:12 | 1.2K | FRY v. COOK et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.11.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.12.html | 2013-12-16 13:11 | 1.2K | FRY (GREEN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.12.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0969.13.html | 2013-12-16 13:11 | 5.8K | FRY v. GRIGG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0969.13.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0970.1.html | 2013-12-16 13:11 | 1.2K | FRY (HOLLINGSWORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0970.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0970.2.html | 2013-12-16 13:12 | 6.2K | FRY v. QUINLAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0970.2.pdf | 2011-11-01 10:00 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0971.1.html | 2013-12-16 13:12 | 4.4K | FRY v. ROUSSEAU. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0971.1.pdf | 2011-11-01 10:00 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0971.2.html | 2013-12-16 13:11 | 2.7K | FRY v. YEATON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0971.2.pdf | 2011-11-01 10:00 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0972.1.html | 2013-12-16 13:11 | 1.2K | FRY (ZAHM v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0972.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0972.2.html | 2013-12-16 13:11 | 8.1K | Ex parte FRY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0972.2.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.1.html | 2013-12-16 13:12 | 1.2K | FRYE (HASKILL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.2.html | 2013-12-16 13:11 | 1.2K | FRYE (PATRIOTIC BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.3.html | 2013-12-16 13:11 | 3.3K | FRYE v. SCOTT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.3.pdf | 2011-11-01 10:00 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.4.html | 2013-12-16 13:12 | 1.2K | FRYE (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.4.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.5.html | 2013-12-16 13:12 | 1.2K | FRYE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.5.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0973.6.html | 2013-12-16 13:11 | 15K | FUENTES et al. v. GAINES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0973.6.pdf | 2011-11-01 10:00 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0975.1.html | 2013-12-16 13:12 | 1.1K | FUENTES v. GAINES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0975.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0975.2.html | 2013-12-16 13:11 | 1.2K | FUERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0975.2.pdf | 2011-11-01 10:00 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0975.3.html | 2013-12-16 13:11 | 2.8K | FUGATE v. BRONAUGH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0975.3.pdf | 2011-11-01 10:00 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0976.html | 2013-12-16 13:12 | 16K | Ex parte FULLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0976.pdf | 2011-11-01 10:00 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0978.html | 2013-12-16 13:11 | 15K | In re FULLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0978.pdf | 2011-11-01 10:00 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0980.html | 2013-12-16 13:11 | 35K | FULLER v. COLBY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0980.pdf | 2011-11-01 10:00 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0986.1.html | 2013-12-16 13:12 | 1.2K | FULLER v. GOODRICH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0986.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0986.2.html | 2013-12-16 13:11 | 8.3K | FULLER et al. v. IVES et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0986.2.pdf | 2011-11-01 10:00 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0987.1.html | 2013-12-16 13:11 | 1.2K | FULLER. (MOODY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0987.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0987.2.html | 2013-12-16 13:12 | 1.2K | FULLER (POTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0987.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0987.3.html | 2013-12-16 13:12 | 23K | FULLER et al. v. YENTZER et al. SAME v. SAME. SAME v. GOODRICH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0987.3.pdf | 2011-11-01 10:00 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0991.1.html | 2013-12-16 13:11 | 1.2K | FULLERTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0991.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0991.2.html | 2013-12-16 13:12 | 1.2K | FULLERTON (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0991.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0991.3.html | 2013-12-16 13:12 | 8.8K | FULLINGS v. FULLINGS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0991.3.pdf | 2011-11-01 10:00 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0992.html | 2013-12-16 13:12 | 4.2K | FULMER v. PATTERSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0992.pdf | 2011-11-01 10:00 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0993.html | 2013-12-16 13:12 | 16K | FULTON v. BLAKE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0993.pdf | 2011-11-01 10:00 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0995.html | 2013-12-16 13:11 | 8.0K | FULTON v. GILMORE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0995.pdf | 2011-11-01 10:00 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0996.html | 2013-12-16 13:12 | 11K | FULTON v. GOLDEN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0996.pdf | 2011-11-01 10:00 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0998.1.html | 2013-12-16 13:11 | 1.2K | FULTON (MARBLE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0998.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0998.2.html | 2013-12-16 13:12 | 1.2K | FULTON (SCAIFE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0998.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.0998.3.html | 2013-12-16 13:12 | 37K | In re FULTZ. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.0998.3.pdf | 2011-11-01 10:00 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1004.1.html | 2013-12-16 13:12 | 1.2K | FUNK (SWARTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1004.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1004.2.html | 2013-12-16 13:11 | 11K | In re FUNKENSTEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1004.2.pdf | 2011-11-01 10:00 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1005.html | 2013-12-16 13:12 | 13K | In re FUNKENSTEIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1005.pdf | 2011-11-01 10:00 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1007.1.html | 2013-12-16 13:11 | 1.2K | FUNKHOUSER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1007.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1007.2.html | 2013-12-16 13:12 | 1.2K | FURBER (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1007.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1007.3.html | 2013-12-16 13:12 | 8.9K | In re FURBISH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1007.3.pdf | 2011-11-01 10:00 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1009.html | 2013-12-16 13:12 | 9.9K | FURBISH v. SEARS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1009.pdf | 2011-11-01 10:00 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.1.html | 2013-12-16 13:12 | 1.2K | FURBUR (SHERIDAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.1.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.2.html | 2013-12-16 13:11 | 1.2K | FURBUSH v. BRADFORD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.2.pdf | 2011-11-01 10:00 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.3.html | 2013-12-16 13:11 | 2.9K | FURLONG v. COLEMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.3.pdf | 2011-11-01 10:00 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.4.html | 2013-12-16 13:12 | 1.2K | FURLONG (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.5.html | 2013-12-16 13:12 | 1.2K | FURNISS (DIBBLEE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.5.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1010.6.html | 2013-12-16 13:11 | 16K | FURNISS et al. v. ELLIS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1010.6.pdf | 2011-11-01 10:01 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1013.html | 2013-12-16 13:11 | 24K | FURNISS et al. v. The MAGOUN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1013.pdf | 2011-11-01 10:01 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1017.html | 2013-12-16 13:11 | 10K | FUTTERER v. ABENHEIM. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1017.pdf | 2011-11-01 10:01 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1018.html | 2013-12-16 13:11 | 14K | FUZZARD WADDING MANUF'G CO. v. DICKINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1018.pdf | 2011-11-01 10:01 | 82K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.1019_01.jpg | 2011-04-25 21:36 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1020.html | 2013-12-16 13:12 | 28K | The F. W. GIFFORD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1020.pdf | 2011-11-01 10:01 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1025.1.html | 2013-12-16 13:11 | 1.2K | F. W. JOHNSON, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1025.1.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1025.2.html | 2013-12-16 13:11 | 1.2K | GAAR (MOFFITT v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1025.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1025.3.html | 2013-12-16 13:11 | 3.9K | GADSBY v. MILLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1025.3.pdf | 2011-11-01 10:01 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1025.4.html | 2013-12-16 13:12 | 1.2K | GADSBY (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1025.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1025.5.html | 2013-12-16 13:12 | 1.2K | GADSBY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1025.5.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1026.1.html | 2013-12-16 13:11 | 4.8K | GAFFNEY et al. v. GILLETTE et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1026.1.pdf | 2011-11-01 10:01 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1026.2.html | 2013-12-16 13:12 | 7.0K | GAFFNEY'S ASSIGNEE v. SIGNAIGO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1026.2.pdf | 2011-11-01 10:01 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.1.html | 2013-12-16 13:12 | 1.2K | GAGE (CHICAGO v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.2.html | 2013-12-16 13:11 | 1.2K | GAGE (HAWES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.3.html | 2013-12-16 13:11 | 1.2K | GAGE (HERRING v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.4.html | 2013-12-16 13:12 | 1.2K | GAGE (TOMPKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.4.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.5.html | 2013-12-16 13:12 | 1.2K | GAGE (YELLOW JACKET SILVER MIN. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.5.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1027.6.html | 2013-12-16 13:11 | 22K | GAGER v. The A. D. PATCHIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1027.6.pdf | 2011-11-01 10:01 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1031.1.html | 2013-12-16 13:12 | 6.0K | GAGER v. HARRISON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1031.1.pdf | 2011-11-01 10:01 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1031.2.html | 2013-12-16 13:11 | 31K | GAGER v. HENRY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1031.2.pdf | 2011-11-01 10:01 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1036.1.html | 2013-12-16 13:11 | 1.2K | GAGES (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1036.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1036.2.html | 2013-12-16 13:12 | 21K | GAINES v. AGNELLY et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1036.2.pdf | 2011-11-01 10:01 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.1.html | 2013-12-16 13:11 | 1.1K | GAINES v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.2.html | 2013-12-16 13:12 | 1.1K | GAINES v. COMPTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.3.html | 2013-12-16 13:12 | 1.1K | GAINES v. CRONAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.4.html | 2013-12-16 13:11 | 1.2K | GAINES v. DE LA CROIX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.5.html | 2013-12-16 13:11 | 1.2K | GAINES (FUENTES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.5.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.6.html | 2013-12-16 13:11 | 1.1K | GAINES v. HERMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.6.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1039.7.html | 2013-12-16 13:12 | 18K | GAINES v. LIZARDI et al., SAME v. DE LA CROIX et al., SAME v. NEW ORLEANS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1039.7.pdf | 2011-11-01 10:01 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1042.html | 2013-12-16 13:12 | 39K | GAINES v. LIZARDI et al., FUENTES et al. v. GAINES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1042.pdf | 2011-11-01 10:01 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1048.1.html | 2013-12-16 13:11 | 1.2K | GAINES v. LIZARDI. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1048.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1048.2.html | 2013-12-16 13:12 | 1.1K | GAINES v. LOUQUE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1048.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1049.html | 2013-12-16 13:11 | 15K | GAINES v. MAUSSEAUX et al. GAINES v. CRONAN et al. GAINES v. COMPTON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1049.pdf | 2011-11-01 10:01 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1051.1.html | 2013-12-16 13:11 | 1.2K | GAINES v. MOUSSEAUX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1051.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1051.2.html | 2013-12-16 13:12 | 23K | GAINES v. NEW ORLEANS., GAINES v. LIZARDI et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1051.2.pdf | 2011-11-01 10:01 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1054.1.html | 2013-12-16 13:12 | 1.2K | GAINES v. NEW ORLEANS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1054.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1054.2.html | 2013-12-16 13:11 | 35K | GAINES et al. v. SPANN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1054.2.pdf | 2011-11-01 10:01 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1060.1.html | 2013-12-16 13:11 | 1.2K | GAINES (TEXAS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1060.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1060.2.html | 2013-12-16 13:12 | 12K | GAINES v. TRAVIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1060.2.pdf | 2011-11-01 10:01 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1062.html | 2013-12-16 13:11 | 24K | GAINES v. TRAVIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1062.pdf | 2011-11-01 10:01 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1065.1.html | 2013-12-16 13:11 | 1.2K | GAINES v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1065.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1065.2.html | 2013-12-16 13:11 | 4.5K | In re GAINEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1065.2.pdf | 2011-11-01 10:01 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1066.1.html | 2013-12-16 13:11 | 1.2K | GAITHER (FARMERS' & MECHANICS' BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1066.1.pdf | 2011-11-01 10:01 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1066.2.html | 2013-12-16 13:12 | 1.2K | GAITHER (GREENWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1066.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1066.3.html | 2013-12-16 13:12 | 5.0K | GAITHER v. LEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1066.3.pdf | 2011-11-01 10:01 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1067.1.html | 2013-12-16 13:12 | 1.2K | GALACAR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1067.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1067.2.html | 2013-12-16 13:11 | 22K | GALA PLAID. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1067.2.pdf | 2011-11-01 10:01 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1070.html | 2013-12-16 13:11 | 22K | The GALATEA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1070.pdf | 2011-11-01 10:01 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1073.html | 2013-12-16 13:12 | 12K | The GALATEA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1073.pdf | 2011-11-01 10:01 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1075.html | 2013-12-16 13:11 | 11K | The GALAXY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1075.pdf | 2011-11-01 10:01 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1077.1.html | 2013-12-16 13:12 | 4.9K | Ex parte GALBRAITH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1077.1.pdf | 2011-11-01 10:01 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1077.2.html | 2013-12-16 13:11 | 1.2K | GALBRAITH (COOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1077.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1077.3.html | 2013-12-16 13:11 | 1.2K | GALBRAITH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1077.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1077.4.html | 2013-12-16 13:12 | 5.5K | GALE v. BABCOCK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1077.4.pdf | 2011-11-01 10:01 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1078.1.html | 2013-12-16 13:12 | 1.3K | GALE v. BEHLIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1078.1.pdf | 2011-11-01 10:01 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1078.2.html | 2013-12-16 13:11 | 1.1K | GALE (CARR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1078.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1078.3.html | 2013-12-16 13:11 | 8.7K | GALE v. NORRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1078.3.pdf | 2011-11-01 10:01 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1079.html | 2013-12-16 13:11 | 11K | GALE et al. v. SAUERWEIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1079.pdf | 2011-11-01 10:01 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1081.html | 2013-12-16 13:11 | 8.6K | GALE MANUF'G CO. v. PRUTZMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1081.pdf | 2011-11-01 10:01 | 58K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.1081_01.jpg | 2011-04-25 21:36 | 14K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1082.1.html | 2013-12-16 13:12 | 1.2K | GALES (HARRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1082.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1082.2.html | 2013-12-16 13:11 | 1.2K | GALES (LAPEYRE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1082.2.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1082.3.html | 2013-12-16 13:11 | 1.2K | GALINDO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1082.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1082.4.html | 2013-12-16 13:12 | 1.2K | GALLAGAN (McPHERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1082.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1082.5.html | 2013-12-16 13:12 | 26K | In re GALLAGHER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1082.5.pdf | 2011-11-01 10:01 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1087.1.html | 2013-12-16 13:11 | 1.2K | GALLAGHER (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1087.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1087.2.html | 2013-12-16 13:12 | 1.2K | GALLAGHER (BUNCE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1087.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1087.3.html | 2013-12-16 13:12 | 1.2K | GALLAGHER (DOOLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1087.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1087.4.html | 2013-12-16 13:11 | 10K | GALLAGHER et al. v. MURRAY et al., CONDON v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1087.4.pdf | 2011-11-01 10:01 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1088.html | 2013-12-16 13:11 | 5.7K | GALLAGHER v. ROBERTS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1088.pdf | 2011-11-01 10:01 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1089.html | 2013-12-16 13:11 | 12K | GALLAGHEB v. ROBERTS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1089.pdf | 2011-11-01 10:01 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1090.1.html | 2013-12-16 13:12 | 1.2K | GALLAGHER (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1090.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1090.2.html | 2013-12-16 13:11 | 1.2K | GALLAGHER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1090.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1091.html | 2013-12-16 13:11 | 16K | GALLAGHER v. The YANKEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1091.pdf | 2011-11-01 10:01 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1093.1.html | 2013-12-16 13:11 | 1.2K | GALLAGHER (YANKEE, The, v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1093.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1093.2.html | 2013-12-16 13:12 | 1.3K | In re GALLAHER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1093.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1093.3.html | 2013-12-16 13:11 | 40K | GALLAHUE et al. v. BUTTERFIELD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1093.3.pdf | 2011-11-01 10:01 | 168K | |
![[IMG]](/html/icons/compressed.gif) | 0009.f.cas.1094_01.jpg | 2011-04-25 21:36 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1100.1.html | 2013-12-16 13:12 | 1.2K | GALLATIN. The (DELANO v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1100.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1100.2.html | 2013-12-16 13:11 | 13K | GALLATIN et al. v. The PILOT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1100.2.pdf | 2011-11-01 10:01 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1102.html | 2013-12-16 13:12 | 20K | GALLEGO v. CHEVALLIE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1102.pdf | 2011-11-01 10:01 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1105.html | 2013-12-16 13:11 | 18K | GALLEGO et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1105.pdf | 2011-11-01 10:01 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1108.1.html | 2013-12-16 13:11 | 1.2K | GALLIER (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1108.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1108.2.html | 2013-12-16 13:12 | 8.8K | In re GALLINGER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1108.2.pdf | 2011-11-01 10:01 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1109.html | 2013-12-16 13:11 | 13K | In re GALLISON et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1109.pdf | 2011-11-01 10:01 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.1.html | 2013-12-16 13:11 | 1.2K | GALLOWAY (ALEXANDER v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.1.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.2.html | 2013-12-16 13:12 | 1.2K | GALLOWAY (BANK OF COLUMBIA v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.3.html | 2013-12-16 13:12 | 1.2K | GALLOWAY (BARR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.3.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.4.html | 2013-12-16 13:11 | 1.2K | GALLOWAY (BRADBURY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.5.html | 2013-12-16 13:11 | 1.2K | GALLOWAY (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.5.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1111.6.html | 2013-12-16 13:11 | 11K | The GALLOWAY C. MORRIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1111.6.pdf | 2011-11-01 10:01 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1113.html | 2013-12-16 13:12 | 81K | GALPIN v. PAGE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1113.pdf | 2011-11-01 10:01 | 172K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1126.html | 2013-12-16 13:12 | 82K | GALPIN v. PAGE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1126.pdf | 2011-11-01 10:01 | 170K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1139.1.html | 2013-12-16 13:11 | 1.2K | GALVESTON (HITCHCOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1139.1.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1139.2.html | 2013-12-16 13:12 | 4.0K | GALVIN v. BOUTWELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1139.2.pdf | 2011-11-01 10:01 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1140.1.html | 2013-12-16 13:12 | 3.8K | GALVIN v. BOYD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1140.1.pdf | 2011-11-01 10:01 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1140.2.html | 2013-12-16 13:11 | 1.2K | GAMBLE (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1140.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1140.3.html | 2013-12-16 13:11 | 9.5K | GAMBLE et al. v. MASON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1140.3.pdf | 2011-11-01 10:01 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.1.html | 2013-12-16 13:12 | 1.2K | GAMBLE (SPAIN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.2.html | 2013-12-16 13:11 | 1.2K | GAMBRILL (CARROLL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.2.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.3.html | 2013-12-16 13:11 | 1.1K | GAMES (DUNN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.3.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.4.html | 2013-12-16 13:12 | 4.6K | GAMMELL v. SKINNER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.4.pdf | 2011-11-01 10:01 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.5.html | 2013-12-16 13:12 | 1.2K | GAMMON (GRAHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.5.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1142.6.html | 2013-12-16 13:11 | 5.6K | GANNON v. DONN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1142.6.pdf | 2011-11-01 10:01 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1143.html | 2013-12-16 13:11 | 14K | GANT v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1143.pdf | 2011-11-01 10:01 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1145.html | 2013-12-16 13:12 | 5.8K | GANTT v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1145.pdf | 2011-11-01 10:01 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1146.1.html | 2013-12-16 13:12 | 1.2K | GAPETE (CATHERWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1146.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1146.2.html | 2013-12-16 13:11 | 9.1K | GARBER v. GLOBE MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1146.2.pdf | 2011-11-01 10:01 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1147.1.html | 2013-12-16 13:11 | 1.2K | GARBER (WARREN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1147.1.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1147.2.html | 2013-12-16 13:12 | 1.2K | GARCIA (McKAY v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1147.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1147.3.html | 2013-12-16 13:12 | 9.7K | GARCIA v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1147.3.pdf | 2011-11-01 10:01 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1149.1.html | 2013-12-16 13:12 | 1.2K | GARCIA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1149.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1149.2.html | 2013-12-16 13:11 | 25K | GARD et al. v. DURANT et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1149.2.pdf | 2011-11-01 10:01 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1153.1.html | 2013-12-16 13:11 | 1.2K | GARDEN, ETC., AIR-BRAKE CO. (WESTINGHOUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1153.1.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1153.2.html | 2013-12-16 13:12 | 9.2K | GARDEN CITY MANUF'G CO. v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1153.2.pdf | 2011-11-01 10:01 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1154.html | 2013-12-16 13:12 | 20K | GARDENER v. WAGANER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1154.pdf | 2011-11-01 10:01 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1157.1.html | 2013-12-16 13:11 | 1.2K | GARDINER (GOODYEAR DENTAL VULCANITE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1157.1.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1157.2.html | 2013-12-16 13:12 | 5.7K | GARDINER et al. v. HOWE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1157.2.pdf | 2011-11-01 10:01 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1158.html | 2013-12-16 13:12 | 8.8K | GARDNER v. ANDERSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1158.pdf | 2011-11-01 10:01 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1159.1.html | 2013-12-16 13:12 | 1.2K | GARDNER (BABBEL v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1159.1.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1159.2.html | 2013-12-16 13:11 | 2.2K | GARDNER v. BAILEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1159.2.pdf | 2011-11-01 10:01 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1159.3.html | 2013-12-16 13:11 | 1.2K | GARDNER (BEATTIE v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1159.3.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1159.4.html | 2013-12-16 13:12 | 20K | GARDNER v. BIBBINS et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1159.4.pdf | 2011-11-01 10:01 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1162.html | 2013-12-16 13:11 | 15K | GARDNER v. COLLINS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1162.pdf | 2011-11-01 10:01 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1165.1.html | 2013-12-16 13:12 | 4.4K | GARDNER v. COLUMBIAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1165.1.pdf | 2011-11-01 10:01 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1165.2.html | 2013-12-16 13:11 | 3.5K | GARDNER v. COLUMBIAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1165.2.pdf | 2011-11-01 10:01 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1165.3.html | 2013-12-16 13:11 | 12K | GARDNER v. COOK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1165.3.pdf | 2011-11-01 10:01 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1167.html | 2013-12-16 13:11 | 116K | GARDNER et al. v. GARDNER et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1167.pdf | 2011-11-01 10:01 | 238K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1186.1.html | 2013-12-16 13:12 | 1.3K | GARDNER v. GOODYEAR DENTAL VULCANITE CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1186.1.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1186.2.html | 2013-12-16 13:11 | 1.2K | GARDNER (GOODYEAR DENTAL VULCANITE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1186.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1186.3.html | 2013-12-16 13:11 | 16K | GARDNER et al. v. HERZ et al. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1186.3.pdf | 2011-11-01 10:01 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1188.html | 2013-12-16 13:12 | 21K | GARDNER v. ISAACSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1188.pdf | 2011-11-01 10:01 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1191.html | 2013-12-16 13:12 | 4.2K | GARDNER v. LINDO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1191.pdf | 2011-11-01 10:01 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1192.1.html | 2013-12-16 13:12 | 2.2K | GARDNER v. LINDO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1192.1.pdf | 2011-11-01 10:01 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1192.2.html | 2013-12-16 13:11 | 1.2K | GARDNER (MORRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1192.2.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1192.3.html | 2013-12-16 13:11 | 23K | GARDNER et al. v. The NEW JERSEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1192.3.pdf | 2011-11-01 10:01 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1196.1.html | 2013-12-16 13:11 | 3.5K | GARDNER v. PEYTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1196.1.pdf | 2011-11-01 10:01 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1196.2.html | 2013-12-16 13:11 | 4.3K | GARDNER et al. v. The ROSEDALE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1196.2.pdf | 2011-11-01 10:01 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1196.3.html | 2013-12-16 13:11 | 1.2K | GARDNER (RUAN v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1196.3.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1196.4.html | 2013-12-16 13:12 | 33K | GARDNER v. SHARP. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1196.4.pdf | 2011-11-01 10:01 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1202.1.html | 2013-12-16 13:11 | 3.8K | GARDNER v. SIMPSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1202.1.pdf | 2011-11-01 10:01 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1202.2.html | 2013-12-16 13:12 | 1.2K | GARDNER (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1202.2.pdf | 2011-11-01 10:01 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1202.3.html | 2013-12-16 13:12 | 2.7K | GARDNER et al. v. TENNISON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1202.3.pdf | 2011-11-01 10:01 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1202.4.html | 2013-12-16 13:11 | 1.2K | GARDNER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1202.4.pdf | 2011-11-01 10:01 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1202.5.html | 2013-12-16 13:11 | 7.3K | GARDNER v. The WHITE SQUALL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1202.5.pdf | 2011-11-01 10:01 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.1203.html | 2013-12-16 13:11 | 1.2K | GARELLY (BOOTH v.). |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.1203.pdf | 2011-11-01 10:01 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.back.html | 2013-12-16 13:11 | 252K | Federal Cases, Volume 9 |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.back.pdf | 2011-10-31 12:27 | 348K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.cas.front.html | 2013-12-16 13:11 | 2.9K | Federal Cases, Volume 9 |
![[ ]](/html/icons/compressed.gif) | 0009.f.cas.front.pdf | 2011-10-31 12:27 | 43K | |
|