![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.0b_01.jpg | 2011-07-18 14:03 | 5.2K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0001.1.html | 2013-12-16 13:11 | 3.7K | CANA v. FRIEND. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0001.1.pdf | 2011-11-01 09:40 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0001.2.html | 2013-12-16 13:11 | 1.2K | CANADA, The (ALLEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0001.2.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0001.3.html | 2013-12-16 13:11 | 5.1K | The CANADIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0001.3.pdf | 2011-11-01 09:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0002.1.html | 2013-12-16 13:11 | 4.7K | In re CANADY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0002.1.pdf | 2011-11-01 09:40 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0002.2.html | 2013-12-16 13:11 | 1.2K | CANAHER v. BRENNAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0002.2.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0002.3.html | 2013-12-16 13:11 | 1.4K | CANAL BANK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0002.3.pdf | 2011-11-01 09:40 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0003.1.html | 2013-12-16 13:11 | 1.2K | CANAL BOAT (LOWRY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0003.1.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0003.2.html | 2013-12-16 13:11 | 1.2K | CANAL BOAT NO. 68 (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0003.2.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0003.3.html | 2013-12-16 13:11 | 1.2K | CANAL NAT. BANK (EMERY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0003.3.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0003.4.html | 2013-12-16 13:11 | 26K | CANBY v. McLEAR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0003.4.pdf | 2011-11-01 09:40 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0007.1.html | 2013-12-16 13:11 | 1.2K | CANBY (RANDOLPH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0007.1.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0007.2.html | 2013-12-16 13:11 | 11K | The CANDACE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0007.2.pdf | 2011-11-01 09:40 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0008.1.html | 2013-12-16 13:11 | 1.2K | CANDACE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0008.1.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0008.2.html | 2013-12-16 13:11 | 1.1K | CANDALERO, The (McGRATH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0008.2.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0008.3.html | 2013-12-16 13:11 | 1.1K | CANDEE (DAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0008.3.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0008.4.html | 2013-12-16 13:11 | 1.1K | CANDEE (EVORY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0008.4.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0008.5.html | 2013-12-16 13:11 | 3.3K | In re CANFIELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0008.5.pdf | 2011-11-01 09:40 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0009.html | 2013-12-16 13:11 | 15K | CANFIELD v. REED et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0009.pdf | 2011-11-01 09:40 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0011.1.html | 2013-12-16 13:11 | 1.2K | CANFIELD (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0011.1.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0011.2.html | 2013-12-16 13:11 | 13K | CANFIELD v. STATE NAT. BANK OF MINNEAPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0011.2.pdf | 2011-11-01 09:40 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0013.1.html | 2013-12-16 13:11 | 1.2K | CANIEO (CAMERON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0013.1.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0013.2.html | 2013-12-16 13:11 | 34K | CANIZARES v. The SANTISSIMA TRINIDAD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0013.2.pdf | 2011-11-01 09:40 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.1.html | 2013-12-16 13:11 | 2.7K | CANNELL v. MILBURN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.1.pdf | 2011-11-01 09:40 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.2.html | 2013-12-16 13:11 | 1.2K | CANNON (CONVERSE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.2.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.3.html | 2013-12-16 13:11 | 2.4K | CANNON v. DAVIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.3.pdf | 2011-11-01 09:40 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.4.html | 2013-12-16 13:11 | 1.2K | CANNON (LOCKE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.4.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.5.html | 2013-12-16 13:11 | 1.2K | CANNON (McNEIL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.5.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.6.html | 2013-12-16 13:11 | 1.2K | CANNON (PEOPLE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.6.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0018.7.html | 2013-12-16 13:11 | 24K | CANNON v. The POTOMAC. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0018.7.pdf | 2011-11-01 09:40 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0022.1.html | 2013-12-16 13:11 | 3.3K | CANNON et al. v. VOSE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0022.1.pdf | 2011-11-01 09:40 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0022.2.html | 2013-12-16 13:11 | 1.2K | CANOE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0022.2.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0023.html | 2013-12-16 13:11 | 42K | CANON CITY and; S. J. RY. CO. v. DENVERand; R. G. RY. CO., DENVER and; R. G. RY. CO. v. ALLING et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0023.pdf | 2011-11-01 09:40 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0029.1.html | 2013-12-16 13:11 | 1.2K | CANTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0029.1.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0029.2.html | 2013-12-16 13:11 | 1.2K | CANSEY v. The SHARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0029.2.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0029.3.html | 2013-12-16 13:11 | 15K | The CANTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0029.3.pdf | 2011-11-01 09:40 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0031.html | 2013-12-16 13:11 | 4.0K | In re CANTRELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0031.pdf | 2011-11-01 09:40 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0032.1.html | 2013-12-16 13:11 | 1.2K | CAPE ANN ISINGLASS and; GLUE CO. (MANNING v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0032.1.pdf | 2011-11-01 09:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0032.2.html | 2013-12-16 13:11 | 13K | CAPE GIRARDEAU and; S. L. R. R. v. WINSTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0032.2.pdf | 2011-11-01 09:40 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0034.1.html | 2013-12-16 13:11 | 1.2K | CAPE GIRARDEAU COUNTY (WESTERMANN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0034.1.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0034.2.html | 2013-12-16 13:11 | 23K | CAPELLE v. HALL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0034.2.pdf | 2011-11-01 09:40 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0038.html | 2013-12-16 13:11 | 39K | CAPELLE v. TRINITY M. E. CHURCH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0038.pdf | 2011-11-01 09:40 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0044.1.html | 2013-12-16 13:11 | 1.2K | CAPEN (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0044.1.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0044.2.html | 2013-12-16 13:11 | 1.2K | CAPITOL BANK (RIX v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0044.2.pdf | 2011-11-01 09:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0044.3.html | 2013-12-16 13:11 | 4.0K | The CAPT. GEO. W. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0044.3.pdf | 2011-11-01 09:40 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0044.4.html | 2013-12-16 13:11 | 5.1K | The CAPTAIN SPEDDEN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0044.4.pdf | 2011-11-01 09:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.1.html | 2013-12-16 13:11 | 1.1K | CARBARGA, The (INGERSOLL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.1.pdf | 2011-11-01 09:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.2.html | 2013-12-16 13:11 | 1.2K | CARBERY (MAYE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.2.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.3.html | 2013-12-16 13:11 | 1.1K | CARBERY (NEWTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.3.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.4.html | 2013-12-16 13:11 | 1.2K | CARBERY (READ v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.4.pdf | 2011-11-01 09:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.5.html | 2013-12-16 13:11 | 1.1K | CARBERY (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.5.pdf | 2011-11-01 09:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.6.html | 2013-12-16 13:11 | 1.2K | CARBERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.6.pdf | 2011-11-01 09:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.7.html | 2013-12-16 13:11 | 1.2K | CARBON STOVE CO. (THATCHER HEATING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.7.pdf | 2011-11-01 09:40 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.8.html | 2013-12-16 13:11 | 1.1K | CARD (DODGE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.8.pdf | 2011-11-01 09:40 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0045.9.html | 2013-12-16 13:11 | 18K | CARDINEL et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0045.9.pdf | 2011-11-01 09:40 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0048.1.html | 2013-12-16 13:11 | 1.2K | CARDWELL (DOWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0048.1.pdf | 2011-11-01 09:40 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0048.2.html | 2013-12-16 13:11 | 9.9K | CARDWELL v. REPUBLIC FIRE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0048.2.pdf | 2011-11-01 09:40 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0049.1.html | 2013-12-16 13:11 | 1.2K | CARENOUGH (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0049.1.pdf | 2011-11-01 09:40 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0049.2.html | 2013-12-16 13:11 | 43K | CAREW et al. v. BOSTON ELASTIC FABRIC CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0049.2.pdf | 2011-11-01 09:40 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0056.html | 2013-12-16 13:11 | 10K | CAREW et al. v. BOSTON ELASTIC FABRIC CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0056.pdf | 2011-11-01 09:40 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0058.1.html | 2013-12-16 13:11 | 5.4K | CAREY v. ATKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0058.1.pdf | 2011-11-01 09:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0058.2.html | 2013-12-16 13:11 | 4.0K | CAREY v. COLLIER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0058.2.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0059.1.html | 2013-12-16 13:11 | 2.8K | CAREY et al. v. The KITTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0059.1.pdf | 2011-11-01 09:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0059.2.html | 2013-12-16 13:11 | 9.1K | CAREY et al. v. The KITTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0059.2.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0060.html | 2013-12-16 13:11 | 10K | CAREY v. NAGLE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0060.pdf | 2011-11-01 09:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0062.html | 2013-12-16 13:11 | 28K | CAREY v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0062.pdf | 2011-11-01 09:41 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0066.html | 2013-12-16 13:11 | 5.2K | CARGO OF BRIMSTONE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0066.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0067.html | 2013-12-16 13:11 | 8.6K | CARGO OF SALT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0067.pdf | 2011-11-01 09:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.1.html | 2013-12-16 13:11 | 1.2K | CARGO OF SALT (FREEMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.2.html | 2013-12-16 13:11 | 1.1K | CARGO OF SUGAR (U. S. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.3.html | 2013-12-16 13:11 | 1.2K | CARHART v. AUSTIN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.3.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.4.html | 2013-12-16 13:11 | 1.2K | CARHART v. MILLER CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.5.html | 2013-12-16 13:11 | 1.2K | CARICO (U. S. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.6.html | 2013-12-16 13:11 | 2.4K | CARILLO et al. v. SHOOK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.6.pdf | 2011-11-01 09:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0068.7.html | 2013-12-16 13:11 | 18K | CARLETON v. DAVIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0068.7.pdf | 2011-11-01 09:41 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0071.1.html | 2013-12-16 13:11 | 1.2K | CARLETON (POOR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0071.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0071.2.html | 2013-12-16 13:11 | 6.2K | CARLETON v. The ROANOKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0071.2.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0072.1.html | 2013-12-16 13:11 | 1.2K | CARL HAASTED, The (WALSH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0072.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0072.2.html | 2013-12-16 13:11 | 18K | CARLISLE v. BUNDY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0072.2.pdf | 2011-11-01 09:41 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0075.1.html | 2013-12-16 13:11 | 1.2K | CARLISLE (CARTER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0075.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0075.2.html | 2013-12-16 13:11 | 5.6K | CARLISLE v. DAVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0075.2.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0075.3.html | 2013-12-16 13:11 | 1.2K | CARLISLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0075.3.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0075.4.html | 2013-12-16 13:11 | 1.2K | CARLISLE BANK (KREBS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0075.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0075.5.html | 2013-12-16 13:11 | 1.2K | CARLL (MAULDIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0075.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0076.1.html | 2013-12-16 13:11 | 4.4K | CARLOCK v. TAPPAN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0076.1.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0076.2.html | 2013-12-16 13:11 | 37K | The CARLOTTA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0076.2.pdf | 2011-11-01 09:41 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0082.html | 2013-12-16 13:11 | 13K | The CARLOTTA., GOMEZ v. The CARLOTTA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0082.pdf | 2011-11-01 09:41 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0084.1.html | 2013-12-16 13:11 | 2.9K | The CARLOTTA., BLISS v. GOMEZ. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0084.1.pdf | 2011-11-01 09:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0084.2.html | 2013-12-16 13:11 | 14K | The CARL SCHURZ. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0084.2.pdf | 2011-11-01 09:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0086.html | 2013-12-16 13:11 | 7.4K | Ex parte CARLTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0086.pdf | 2011-11-01 09:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0087.1.html | 2013-12-16 13:11 | 1.2K | CARLTON (BUCKLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0087.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0087.2.html | 2013-12-16 13:11 | 1.2K | CARLTON (McGINNIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0087.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0087.3.html | 2013-12-16 13:11 | 1.2K | CARLTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0087.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0087.4.html | 2013-12-16 13:11 | 12K | CARLWITZ v. GERMANIA FIRE INS CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0087.4.pdf | 2011-11-01 09:41 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0089.1.html | 2013-12-16 13:11 | 1.2K | CARMAN (ANDREWS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0089.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0089.2.html | 2013-12-16 13:11 | 1.2K | CARMAN (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0089.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0089.3.html | 2013-12-16 13:11 | 1.2K | CARMICHAEL (CRAGTN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0089.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0089.4.html | 2013-12-16 13:11 | 1.2K | CARNE (BURTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0089.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0089.5.html | 2013-12-16 13:11 | 3.2K | CARNE et al. v. McLANE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0089.5.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.1.html | 2013-12-16 13:11 | 1.2K | CARNES (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.2.html | 2013-12-16 13:11 | 4.8K | CARNES at al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.2.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.3.html | 2013-12-16 13:11 | 1.2K | CARNLEY (COMSTOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.4.html | 2013-12-16 13:11 | 1.2K | CARNOT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.5.html | 2013-12-16 13:11 | 1.2K | CAROLIN (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0090.6.html | 2013-12-16 13:11 | 15K | The CAROLINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0090.6.pdf | 2011-11-01 09:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0092.html | 2013-12-16 13:11 | 10K | The CAROLINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0092.pdf | 2011-11-01 09:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0094.1.html | 2013-12-16 13:11 | 1.2K | CAROLINE. The (BICTCFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0094.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0094.2.html | 2013-12-16 13:11 | 1.2K | CAROLINE, The (LEVY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0094.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0094.3.html | 2013-12-16 13:11 | 1.2K | CAROLINE, The (VIRDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0094.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0094.4.html | 2013-12-16 13:11 | 5.9K | The CAROLINE and; CORNELIA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0094.4.pdf | 2011-11-01 09:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0094.5.html | 2013-12-16 13:11 | 15K | The CAROLINE A. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0094.5.pdf | 2011-11-01 09:41 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0097.html | 2013-12-16 13:11 | 9.0K | The CAROLINE CASEY., POUNDER v. PROCEEDS OP THE CAROLINE CASEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0097.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0098.html | 2013-12-16 13:11 | 9.6K | The CAROLINE E. KELLY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0098.pdf | 2011-11-01 09:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0099.html | 2013-12-16 13:11 | 3.1K | The CAROLINE NESMITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0099.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0100.1.html | 2013-12-16 13:11 | 1.2K | CAROLINE V. CASEY, The (POUNDER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0100.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0100.2.html | 2013-12-16 13:11 | 9.2K | The CAROLUS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0100.2.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0101.1.html | 2013-12-16 13:11 | 1.2K | CARONDOLET MARINE RY., ETC. CO. v. The SAM KIRKMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0101.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0101.2.html | 2013-12-16 13:11 | 3.4K | CAROTHERS v. CHESAPEAKE and; O. CANAL CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0101.2.pdf | 2011-11-01 09:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0101.3.html | 2013-12-16 13:11 | 1.2K | CAROTHERS (PATTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0101.3.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0101.4.html | 2013-12-16 13:11 | 11K | In re CAROW. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0101.4.pdf | 2011-11-01 09:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0103.html | 2013-12-16 13:11 | 9.7K | In re CARPENTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0103.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0105.html | 2013-12-16 13:11 | 12K | CARPENTER v. AFRICAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0105.pdf | 2011-11-01 09:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0106.html | 2013-12-16 13:11 | 1.2K | CARPENTER (BARROWS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0106.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0107.html | 2013-12-16 13:11 | 13K | CARPENTER v. BUENA VISTA COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0107.pdf | 2011-11-01 09:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0108.html | 2013-12-16 13:11 | 1.2K | CARPENTER (BYRNE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0108.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0109.html | 2013-12-16 13:11 | 16K | CARPENTER v. The EMMA JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0109.pdf | 2011-11-01 09:41 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.1.html | 2013-12-16 13:11 | 1.2K | CARPENTER (FIEDLER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.2.html | 2013-12-16 13:11 | 1.2K | CARPENTER (FRAZER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.3.html | 2013-12-16 13:11 | 1.2K | CARPENTER (HAINES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.3.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.4.html | 2013-12-16 13:11 | 1.2K | CARPENTER (HOPKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.5.html | 2013-12-16 13:11 | 1.2K | CARPENTER (INNES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.5.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.6.html | 2013-12-16 13:11 | 1.2K | CARPENTER v. The ISLAND CITY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.6.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0111.7.html | 2013-12-16 13:11 | 24K | CARPENTER v. ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0111.7.pdf | 2011-11-01 09:41 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.1.html | 2013-12-16 13:11 | 1.2K | CARPENTER (ROSS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.2.html | 2013-12-16 13:11 | 1.1K | CARPENTER (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.3.html | 2013-12-16 13:11 | 1.2K | CARPENTER (TUCKER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.4.html | 2013-12-16 13:11 | 1.2K | CARPENTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.5.html | 2013-12-16 13:11 | 1.2K | CARPENTER (WILLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.5.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.6.html | 2013-12-16 13:11 | 1.2K | CARPENTLER (COURTOIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.6.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.7.html | 2013-12-16 13:11 | 1.2K | CARPENTTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.7.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0115.8.html | 2013-12-16 13:11 | 10K | In re CARR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0115.8.pdf | 2011-11-01 09:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0116.html | 2013-12-16 13:11 | 12K | CARR. v. GALE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0116.pdf | 2011-11-01 09:41 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0118.html | 2013-12-16 13:11 | 32K | CARR v. GALE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0118.pdf | 2011-11-01 09:41 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0123.html | 2013-12-16 13:11 | 62K | CARR v. GALE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0123.pdf | 2011-11-01 09:41 | 140K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0134.html | 2013-12-16 13:11 | 20K | CAEB v. HILTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0134.pdf | 2011-11-01 09:41 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0137.html | 2013-12-16 13:11 | 13K | CARE, v. HILTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0137.pdf | 2011-11-01 09:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0138.html | 2013-12-16 13:11 | 5.5K | CARR v. HOXIE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0138.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0139.1.html | 2013-12-16 13:11 | 1.2K | CARR (HOXIE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0139.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0139.2.html | 2013-12-16 13:11 | 6.9K | CARR v. RICE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0139.2.pdf | 2011-11-01 09:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0140.html | 2013-12-16 13:11 | 39K | CARR v. RICE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0140.pdf | 2011-11-01 09:41 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0146.html | 2013-12-16 13:11 | 4.4K | CARR. v. TWEEDY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0146.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0147.1.html | 2013-12-16 13:11 | 1.1K | CARR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0147.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0147.2.html | 2013-12-16 13:11 | 1.2K | CARR (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0147.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0147.3.html | 2013-12-16 13:11 | 14K | CARRAHER v. BRENNAN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0147.3.pdf | 2011-11-01 09:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.1.html | 2013-12-16 13:11 | 1.5K | CARRICK v. HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.1.pdf | 2011-11-01 09:41 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.2.html | 2013-12-16 13:11 | 2.0K | CARRICO v. KIRBY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.2.pdf | 2011-11-01 09:41 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.3.html | 2013-12-16 13:11 | 1.2K | CARRICO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.4.html | 2013-12-16 13:11 | 1.2K | CARRIE BROOKS, The (REYLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.5.html | 2013-12-16 13:11 | 3.7K | In re CARRIER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.5.pdf | 2011-11-01 09:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0149.6.html | 2013-12-16 13:11 | 6.8K | CARRIGAN v. The CHARLES PITMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0149.6.pdf | 2011-11-01 09:41 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0150.1.html | 2013-12-16 13:11 | 1.2K | CARRIGO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0150.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0150.2.html | 2013-12-16 13:11 | 1.1K | CARRTLLO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0150.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0150.3.html | 2013-12-16 13:11 | 21K | CARRINGTON v. The ANN C. PRATT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0150.3.pdf | 2011-11-01 09:41 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0154.html | 2013-12-16 13:11 | 24K | CARRINGTON et al. v. BRENTS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0154.pdf | 2011-11-01 09:41 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0158.1.html | 2013-12-16 13:11 | 4.2K | CARRINGTON v. FLORIDA R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0158.1.pdf | 2011-11-01 09:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0158.2.html | 2013-12-16 13:11 | 4.6K | CARRINGTON v. FLORIDA R. CO. et al.[9 Blatchf. 468.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0158.2.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0159.1.html | 2013-12-16 13:11 | 4.6K | CARRINGTON v. FORD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0159.1.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0159.2.html | 2013-12-16 13:11 | 1.2K | CARRINGTON, The (HANNAH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0159.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0159.3.html | 2013-12-16 13:11 | 1.2K | CARRINGTON (McKAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0159.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0159.4.html | 2013-12-16 13:11 | 4.7K | CARRINGTON v. STIMSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0159.4.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0160.html | 2013-12-16 13:11 | 15K | The CARROLL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0160.pdf | 2011-11-01 09:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0162.1.html | 2013-12-16 13:11 | 1.2K | CARROLL (ANTHONY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0162.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0162.2.html | 2013-12-16 13:11 | 3.1K | CARROLL v. DOWSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0162.2.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0162.3.html | 2013-12-16 13:11 | 3.6K | CARROLL v. FINNAGAN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0162.3.pdf | 2011-11-01 09:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0163.html | 2013-12-16 13:11 | 9.2K | CARROLL v. GAMBRILL et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0163.pdf | 2011-11-01 09:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0164.1.html | 2013-12-16 13:11 | 1.2K | CARROLL (GRAMMER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0164.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0164.2.html | 2013-12-16 13:11 | 16K | CARROLL et al. v. The LEATHERS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0164.2.pdf | 2011-11-01 09:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0167.1.html | 2013-12-16 13:11 | 1.2K | CARROLL (LE ROY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0167.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0167.2.html | 2013-12-16 13:11 | 11K | CARROLL v. PERRY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0167.2.pdf | 2011-11-01 09:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0168.1.html | 2013-12-16 13:11 | 1.2K | CARROLL (TINGEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0168.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0168.2.html | 2013-12-16 13:11 | 19K | CARROLL v. WATKINS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0168.2.pdf | 2011-11-01 09:41 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0171.1.html | 2013-12-16 13:11 | 3.6K | CARROLL v. WHITCROFT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0171.1.pdf | 2011-11-01 09:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0171.2.html | 2013-12-16 13:11 | 1.2K | CARROLL, The (WINNE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0171.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0171.3.html | 2013-12-16 13:11 | 1.2K | CARRONI, The (SEAVER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0171.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0171.4.html | 2013-12-16 13:11 | 1.2K | CARRUTH (SNOW v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0171.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0171.5.html | 2013-12-16 13:11 | 5.2K | Ex parte CARSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0171.5.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0172.1.html | 2013-12-16 13:11 | 3.2K | In re CARSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0172.1.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0172.2.html | 2013-12-16 13:11 | 7.5K | In re CARSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0172.2.pdf | 2011-11-01 09:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0173.1.html | 2013-12-16 13:11 | 1.2K | CARSON (ARMSTRONG v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0173.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0173.2.html | 2013-12-16 13:11 | 1.3K | CARSON v. BLAZER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0173.2.pdf | 2011-11-01 09:41 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0174.1.html | 2013-12-16 13:11 | 6.3K | CARSON v. BOUDINOT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0174.1.pdf | 2011-11-01 09:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0174.2.html | 2013-12-16 13:11 | 6.9K | CARSON v. GORDEN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0174.2.pdf | 2011-11-01 09:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0175.html | 2013-12-16 13:11 | 14K | CARSON v. JENNINGS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0175.pdf | 2011-11-01 09:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0177.html | 2013-12-16 13:11 | 1.2K | CARSON (JENNINGS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0177.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0178.html | 2013-12-16 13:11 | 11K | CARSON et al. v. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0178.pdf | 2011-11-01 09:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0179.html | 2013-12-16 13:11 | 57K | CARSON v. ROBERTSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0179.pdf | 2011-11-01 09:41 | 130K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0188.1.html | 2013-12-16 13:11 | 1.2K | CARSON (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0188.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0188.2.html | 2013-12-16 13:11 | 19K | CARSTAEDT v. UNITED STATES CORSET CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0188.2.pdf | 2011-11-01 09:41 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0191.html | 2013-12-16 13:11 | 9.5K | CARSTAEDT v. UNITED STATES CORSET CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0191.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0192.html | 2013-12-16 13:11 | 4.6K | In re CARSTENS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0192.pdf | 2011-11-01 09:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0193.1.html | 2013-12-16 13:11 | 1.2K | CARTACHO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0193.1.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0193.2.html | 2013-12-16 13:11 | 8.6K | In re CARTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0193.2.pdf | 2011-11-01 09:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0194.html | 2013-12-16 13:11 | 4.9K | In re CARTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0194.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0195.html | 2013-12-16 13:11 | 46K | CARTER et al. v. BAKER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0195.pdf | 2011-11-01 09:41 | 107K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0202.1.html | 2013-12-16 13:11 | 1.2K | CARTER (BRETT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0202.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0202.2.html | 2013-12-16 13:11 | 14K | CARTER v. The BYZANTIUM. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0202.2.pdf | 2011-11-01 09:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0204.html | 2013-12-16 13:11 | 6.6K | CARTER v. CARLISLE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0204.pdf | 2011-11-01 09:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0205.html | 2013-12-16 13:11 | 46K | CARTER et al. v. CARTER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0205.pdf | 2011-11-01 09:41 | 111K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0213.1.html | 2013-12-16 13:11 | 3.5K | CARTER v. CUTTING et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0213.1.pdf | 2011-11-01 09:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0213.2.html | 2013-12-16 13:11 | 1.2K | CARTER (FISHER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0213.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0213.3.html | 2013-12-16 13:11 | 1.2K | CARTER v. HAIGH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0213.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0213.4.html | 2013-12-16 13:11 | 1.2K | CARTER (LAMB v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0213.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0213.5.html | 2013-12-16 13:11 | 3.5K | CARTER v. LANE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0213.5.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0214.1.html | 2013-12-16 13:11 | 1.1K | CARTER v. McGEHEE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0214.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0214.2.html | 2013-12-16 13:11 | 1.2K | CARTER (MENDENHALL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0214.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0214.3.html | 2013-12-16 13:11 | 23K | CARTER v. MESSINGER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0214.3.pdf | 2011-11-01 09:41 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0217.1.html | 2013-12-16 13:11 | 1.2K | CARTER (SARGENT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0217.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0217.2.html | 2013-12-16 13:11 | 6.4K | CARTER v. SWIFT et al. [1 Lowell, 398.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0217.2.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0218.html | 2013-12-16 13:11 | 59K | CARTER v. TREADWELL et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0218.pdf | 2011-11-01 09:41 | 132K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0228.1.html | 2013-12-16 13:11 | 1.1K | CARTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0228.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0228.2.html | 2013-12-16 13:11 | 1.2K | CARTER (WHITNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0228.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0228.3.html | 2013-12-16 13:11 | 3.2K | CARTRIGHT v. BOSTWICK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0228.3.pdf | 2011-11-01 09:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0228.4.html | 2013-12-16 13:11 | 1.2K | CARTTER (WESTLAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0228.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0228.5.html | 2013-12-16 13:11 | 21K | CARTWELL et al. v. The JOHN TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0228.5.pdf | 2011-11-01 09:41 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0231.1.html | 2013-12-16 13:11 | 1.2K | CARTWRIGHT (GOODWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0231.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0231.2.html | 2013-12-16 13:11 | 1.2K | CARTWRIGHT (LORAINE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0231.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0231.3.html | 2013-12-16 13:11 | 9.3K | CARTWRIGHT et al. v. The OTHELLO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0231.3.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0232.html | 2013-12-16 13:11 | 1.2K | CARTZLER (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0232.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0233.html | 2013-12-16 13:11 | 16K | CARUANA v. BRITISH and; N. A. ROYAL MATT, STEAM-PACKET CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0233.pdf | 2011-11-01 09:41 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0235.1.html | 2013-12-16 13:11 | 1.2K | CARUSI (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0235.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0235.2.html | 2013-12-16 13:11 | 43K | CARVER v. BRAINTREE MANUF;G CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0235.2.pdf | 2011-11-01 09:41 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.1.html | 2013-12-16 13:11 | 1.2K | CARY (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.1.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.2.html | 2013-12-16 13:11 | 1.1K | CARY v. NAGEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.3.html | 2013-12-16 13:11 | 1.2K | CARY (SAN FRANCISCO SAVINGS and; LOAN SOCIETY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.4.html | 2013-12-16 13:11 | 1.2K | CARY (STURGESS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.5.html | 2013-12-16 13:11 | 1.2K | CARY (STURGIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.6.html | 2013-12-16 13:11 | 1.2K | CASANAVE (WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.6.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0242.7.html | 2013-12-16 13:11 | 21K | The CASCO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0242.7.pdf | 2011-11-01 09:41 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0245.html | 2013-12-16 13:11 | 17K | CASE v. BEAUREGARD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0245.pdf | 2011-11-01 09:41 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0248.html | 2013-12-16 13:11 | 20K | CASE v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0248.pdf | 2011-11-01 09:41 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0251.html | 2013-12-16 13:11 | 22K | CASE v. CITIZENS; BANK OF LOUISIANA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0251.pdf | 2011-11-01 09:41 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0254.html | 2013-12-16 13:11 | 5.6K | CASE v. CLARKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0254.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0255.html | 2013-12-16 13:11 | 6.5K | CASE et al. v. DOUGLAS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0255.pdf | 2011-11-01 09:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0256.1.html | 2013-12-16 13:11 | 1.4K | CASE v. KELLY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0256.1.pdf | 2011-11-01 09:41 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0256.2.html | 2013-12-16 13:11 | 1.2K | CASE (LANNING v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0256.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0256.3.html | 2013-12-16 13:11 | 1.2K | CASE (MORRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0256.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0256.4.html | 2013-12-16 13:11 | 13K | CASE v. NEW ORLEANS and; C. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0256.4.pdf | 2011-11-01 09:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0258.html | 2013-12-16 13:11 | 12K | CASE v. REDFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0258.pdf | 2011-11-01 09:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0259.1.html | 2013-12-16 13:11 | 1.5K | CASE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0259.1.pdf | 2011-11-01 09:41 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0259.2.html | 2013-12-16 13:11 | 18K | In re CASEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0259.2.pdf | 2011-11-01 09:41 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0262.html | 2013-12-16 13:11 | 27K | CASEY v. LA SOCIETE DE CREDIT MOBILIER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0262.pdf | 2011-11-01 09:41 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0266.html | 2013-12-16 13:11 | 9.2K | CASEY et al. v. LEARY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0266.pdf | 2011-11-01 09:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0268.1.html | 2013-12-16 13:11 | 1.2K | CASEY (SEDGWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0268.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0268.2.html | 2013-12-16 13:11 | 1.2K | CASEY v. SOCIETE DE CREDIT MOBILIER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0268.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0268.3.html | 2013-12-16 13:11 | 1.2K | CASH (HOUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0268.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0268.4.html | 2013-12-16 13:11 | 14K | CASH V. ONE THOUSAND TWO HUNDRED AND SEVENTY—SEVEN DOLLARS AND FIVE CENTS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0268.4.pdf | 2011-11-01 09:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0270.html | 2013-12-16 13:11 | 9.1K | CASHAU v. NORTHWESTERN NAT. INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0270.pdf | 2011-11-01 09:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0271.1.html | 2013-12-16 13:11 | 1.2K | CASHIEL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0271.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0271.2.html | 2013-12-16 13:11 | 6.1K | CASKIE v. WEBSTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0271.2.pdf | 2011-11-01 09:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.1.html | 2013-12-16 13:11 | 1.3K | CASKIN (LEONARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.1.pdf | 2011-11-01 09:41 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.2.html | 2013-12-16 13:11 | 1.2K | CASS (CITIZENS; NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.3.html | 2013-12-16 13:11 | 1.2K | CASSALLY McNAUGHTER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.4.html | 2013-12-16 13:11 | 1.1K | CASS COUNTY (JORDAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.5.html | 2013-12-16 13:11 | 1.2K | CASS COUNTY (KENNARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.6.html | 2013-12-16 13:11 | 1.2K | CASS COUNTY (WASHBURN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.6.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.7.html | 2013-12-16 13:11 | 1.2K | CASSEDY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.7.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0272.8.html | 2013-12-16 13:11 | 11K | CASSEDY v. WILLLAMS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0272.8.pdf | 2011-11-01 09:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0274.html | 2013-12-16 13:11 | 19K | CASSEL v. DOWS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0274.pdf | 2011-11-01 09:41 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0277.html | 2013-12-16 13:11 | 9.4K | CASSELS v. VERNON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0277.pdf | 2011-11-01 09:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.1.html | 2013-12-16 13:11 | 1.2K | CASSILY (McVAUGHTER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.1.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.2.html | 2013-12-16 13:11 | 1.2K | CASSIN (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.2.pdf | 2011-11-01 09:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.3.html | 2013-12-16 13:11 | 1.2K | CASSIN (PALMER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.4.html | 2013-12-16 13:11 | 1.2K | CASSIUS, The (ARTHUR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.5.html | 2013-12-16 13:11 | 1.2K | CASSIUS, The (KETLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.6.html | 2013-12-16 13:11 | 1.2K | CASTEEL (HENDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.6.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0278.7.html | 2013-12-16 13:11 | 11K | CASTELLO v. BOUTEILLE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0278.7.pdf | 2011-11-01 09:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0280.1.html | 2013-12-16 13:11 | 5.0K | CASTER v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0280.1.pdf | 2011-11-01 09:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0280.2.html | 2013-12-16 13:11 | 1.2K | CASTILLERO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0280.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0281.html | 2013-12-16 13:11 | 8.7K | CASTLE v. LEE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0281.pdf | 2011-11-01 09:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0282.html | 2013-12-16 13:11 | 11K | CASTOR v. MITCHEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0282.pdf | 2011-11-01 09:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0283.1.html | 2013-12-16 13:11 | 1.2K | CASTOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0283.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0283.2.html | 2013-12-16 13:11 | 1.3K | CASTRO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0283.2.pdf | 2011-11-01 09:41 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0283.3.html | 2013-12-16 13:11 | 4.1K | CASTBO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0283.3.pdf | 2011-11-01 09:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0284.1.html | 2013-12-16 13:11 | 1.1K | CASTRO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0284.1.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0284.2.html | 2013-12-16 13:11 | 1.2K | CATALINO (BUSSARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0284.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0284.3.html | 2013-12-16 13:11 | 1.2K | CATARA (KLEINE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0284.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0284.4.html | 2013-12-16 13:11 | 6.1K | The CATAWANTEAK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0284.4.pdf | 2011-11-01 09:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.1.html | 2013-12-16 13:11 | 1.3K | CATEAUX v. BABNEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.1.pdf | 2011-11-01 09:41 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.2.html | 2013-12-16 13:11 | 1.2K | CATHAEINA. The (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.2.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.3.html | 2013-12-16 13:11 | 1.2K | CATHAEINA MARIA The (JURGENSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.3.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.4.html | 2013-12-16 13:11 | 1.2K | CATHARINE, The (DICKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.4.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.5.html | 2013-12-16 13:11 | 1.2K | CATHARINE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0285.6.html | 2013-12-16 13:11 | 9.9K | The CATHARINE AND MARTHA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0285.6.pdf | 2011-11-01 09:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.1.html | 2013-12-16 13:11 | 1.1K | CATHCART (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.1.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.2.html | 2013-12-16 13:11 | 1.2K | CATHCART (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.2.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.3.html | 2013-12-16 13:11 | 1.2K | CATHERINA, The (NORDLINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.3.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.4.html | 2013-12-16 13:11 | 1.2K | CATHERINA MARIA, The (WEEKS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.4.pdf | 2011-11-01 09:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.5.html | 2013-12-16 13:11 | 1.2K | CATHERINE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.5.pdf | 2011-11-01 09:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0286.6.html | 2013-12-16 13:11 | 7.8K | CATHERWOOD et al. v. GAPETE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0286.6.pdf | 2011-11-01 09:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0287.html | 2013-12-16 13:11 | 21K | CATLETT v. COLUMBIAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0287.pdf | 2011-11-01 09:41 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0290.html | 2013-12-16 13:11 | 3.3K | CATLETT v. COOKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0290.pdf | 2011-11-01 09:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0291.1.html | 2013-12-16 13:11 | 2.6K | CATLETT et ux. v. FAIRFAX. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0291.1.pdf | 2011-11-01 09:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0291.2.html | 2013-12-16 13:11 | 54K | CATLETT et al. v. PACIFIC INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0291.2.pdf | 2011-11-01 09:42 | 125K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0299.html | 2013-12-16 13:11 | 1.2K | CATLETT (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0299.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0300.html | 2013-12-16 13:11 | 20K | CATLIN v. CURRIER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0300.pdf | 2011-11-01 09:42 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0303.html | 2013-12-16 13:11 | 26K | CATLIN v. FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0303.pdf | 2011-11-01 09:42 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0307.1.html | 2013-12-16 13:11 | 4.9K | CATLIN v. GLADDING. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0307.1.pdf | 2011-11-01 09:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0307.2.html | 2013-12-16 13:11 | 17K | CATLIN v. HOFFMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0307.2.pdf | 2011-11-01 09:42 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0310.html | 2013-12-16 13:11 | 28K | CATLIN v. SPRINGFIELD FIRE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0310.pdf | 2011-11-01 09:42 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0314.html | 2013-12-16 13:11 | 4.3K | CATLIN v. UNDERHILL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0314.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0315.html | 2013-12-16 13:11 | 6.1K | CATLIN v. UNDERHILL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0315.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0316.1.html | 2013-12-16 13:11 | 1.1K | CATO, The (RYAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0316.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0316.2.html | 2013-12-16 13:11 | 1.2K | CATO. The (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0316.2.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0316.3.html | 2013-12-16 13:11 | 1.2K | CATON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0316.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0316.4.html | 2013-12-16 13:11 | 6.4K | CAUJOLLE et al. v. FERRIE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0316.4.pdf | 2011-11-01 09:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0317.1.html | 2013-12-16 13:11 | 1.2K | CAULKINS (SIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0317.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0317.2.html | 2013-12-16 13:11 | 5.7K | CAUSEY v. The SHARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0317.2.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0317.3.html | 2013-12-16 13:11 | 2.4K | CAUSIN v. CHUBB. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0317.3.pdf | 2011-11-01 09:42 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0318.1.html | 2013-12-16 13:11 | 1.2K | CAUSIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0318.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0318.2.html | 2013-12-16 13:11 | 1.2K | CAVALIER, The (BLANCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0318.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0318.3.html | 2013-12-16 13:11 | 8.8K | In re CAVAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0318.3.pdf | 2011-11-01 09:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0319.1.html | 2013-12-16 13:11 | 1.1K | CAVAN v. The D. S. GREGORY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0319.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0319.2.html | 2013-12-16 13:11 | 1.2K | CAVAROC (BENJAMIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0319.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0319.3.html | 2013-12-16 13:11 | 6.8K | CAVAROC v. COLLECTOR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0319.3.pdf | 2011-11-01 09:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0320.1.html | 2013-12-16 13:11 | 1.2K | CAVAROC (EAMES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0320.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0320.2.html | 2013-12-16 13:11 | 1.2K | CAVAZOS (BROWNSVILLE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0320.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0320.3.html | 2013-12-16 13:11 | 1.2K | CAVE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0320.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0320.4.html | 2013-12-16 13:11 | 11K | CAVENDER v. GROVE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0320.4.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0322.1.html | 2013-12-16 13:11 | 4.1K | CAWOOD v. NICHOLS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0322.1.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0322.2.html | 2013-12-16 13:11 | 17K | The CAYENNE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0322.2.pdf | 2011-11-01 09:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0325.1.html | 2013-12-16 13:11 | 1.3K | The CAYENNE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0325.1.pdf | 2011-11-01 09:42 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0325.2.html | 2013-12-16 13:11 | 11K | Ex parte CAYLUS et al., In re HOLBROOK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0325.2.pdf | 2011-11-01 09:42 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0326.html | 2013-12-16 13:11 | 8.9K | The CAYUGA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0326.pdf | 2011-11-01 09:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0328.html | 2013-12-16 13:11 | 9.3K | The CAYUGA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0328.pdf | 2011-11-01 09:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0329.html | 2013-12-16 13:11 | 17K | The CAYUGA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0329.pdf | 2011-11-01 09:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0332.1.html | 2013-12-16 13:11 | 1.2K | CAZARES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0332.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0332.2.html | 2013-12-16 13:11 | 1.1K | CAZE (LAMALERE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0332.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0332.3.html | 2013-12-16 13:11 | 34K | CAZE et al. v. REILLY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0332.3.pdf | 2011-11-01 09:42 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0337.html | 2013-12-16 13:11 | 4.2K | CAZENOVE v. DARREL et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0337.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.1.html | 2013-12-16 13:11 | 1.2K | C. B. CHURCH, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.2.html | 2013-12-16 13:11 | 1.2K | C. D., The (LALLANDE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.2.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.3.html | 2013-12-16 13:11 | 1.2K | C. D., JR., The (INSURANCE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.4.html | 2013-12-16 13:11 | 1.2K | C. DURANT, The (GOODWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.5.html | 2013-12-16 13:11 | 4.3K | In re CEASE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.5.pdf | 2011-11-01 09:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0338.6.html | 2013-12-16 13:11 | 35K | The CELESTINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0338.6.pdf | 2011-11-01 09:42 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0344.html | 2013-12-16 13:11 | 12K | The CELLA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0344.pdf | 2011-11-01 09:42 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0345.1.html | 2013-12-16 13:11 | 1.2K | CELLULOID HARNESS TRIMMING CO. (ALBRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0345.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0345.2.html | 2013-12-16 13:11 | 36K | CELLULOID MANUF;G CO. v. GOODYEAR DENTAL VULCANITE CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0345.2.pdf | 2011-11-01 09:42 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0351.html | 2013-12-16 13:11 | 8.9K | The CEMENT ROCK and The VENTURE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0351.pdf | 2011-11-01 09:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0352.html | 2013-12-16 13:11 | 22K | CENTENNIAL BOARD OF FINANCE v. PATTERSON, et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0352.pdf | 2011-11-01 09:42 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0356.html | 2013-12-16 13:11 | 5.5K | CENTENNIAL CATALOGUE CO. v. PORTER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0356.pdf | 2011-11-01 09:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0357.1.html | 2013-12-16 13:11 | 4.2K | In re CENTRAL BANK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0357.1.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0357.2.html | 2013-12-16 13:11 | 1.2K | CENTRAL BANK (PATRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0357.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0357.3.html | 2013-12-16 13:11 | 5.4K | CENTRAL BANK v. TAYLOE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0357.3.pdf | 2011-11-01 09:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0358.html | 2013-12-16 13:11 | 9.1K | In re CENTRAL BANK OF BROOKLYN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0358.pdf | 2011-11-01 09:42 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0359.html | 2013-12-16 13:11 | 22K | CENTBAL OHIO RAILROAD et al. v. THOMSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0359.pdf | 2011-11-01 09:42 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0363.1.html | 2013-12-16 13:11 | 7.0K | CENTRAL PAC. R. CO. v. BENITY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0363.1.pdf | 2011-11-01 09:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0363.2.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (CODY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0363.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0364.html | 2013-12-16 13:11 | 31K | CENTRAL PAC. R. CO. v. DYER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0364.pdf | 2011-11-01 09:42 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.1.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (HUNTINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.2.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (QUIGLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.3.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (RYAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.4.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.5.html | 2013-12-16 13:11 | 1.2K | CENTRAL PAC. R. CO. (VAUGHAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.5.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.6.html | 2013-12-16 13:11 | 1.2K | CENTRAL R. CO. (CLYMER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.6.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.7.html | 2013-12-16 13:11 | 1.2K | CENTRAL R. CO. (LEHIGH COAL, ETC., CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.7.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.8.html | 2013-12-16 13:11 | 1.2K | CENTRAL R. CO. OF NEW JERSEY (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.8.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.9.html | 2013-12-16 13:11 | 1.2K | CENTRAL R. CO. OF NEW JERSEY (JIACKAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.9.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.10.html | 2013-12-16 13:11 | 1.2K | CENTRAL RAILROAD OF IOWA (ALEXANDER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.10.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.11.html | 2013-12-16 13:11 | 1.2K | CENTRAL RAILROAD OF IOWA (FARMERS; LOAN and; TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.11.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.12.html | 2013-12-16 13:11 | 1.2K | CENTRAL RAILWAY (CURTIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.12.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.13.html | 2013-12-16 13:11 | 1.2K | CENTRAL VERMONT R. CO. (WELLS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.13.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0368.14.html | 2013-12-16 13:11 | 2.9K | CENTRE v. KEENE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0368.14.pdf | 2011-11-01 09:42 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0369.html | 2013-12-16 13:11 | 22K | The CENTURION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0369.pdf | 2011-11-01 09:42 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0372.1.html | 2013-12-16 13:11 | 1.3K | The CERES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0372.1.pdf | 2011-11-01 09:42 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0372.2.html | 2013-12-16 13:11 | 1.2K | CERES, The (SIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0372.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0372.3.html | 2013-12-16 13:11 | 6.0K | In re CERF. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0372.3.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.1.html | 2013-12-16 13:11 | 4.1K | The CERRO GOBDO., FRANKLIN v. The CERRO GORDO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.1.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.2.html | 2013-12-16 13:11 | 1.2K | CERTAIN CASKS OF GLASSWARE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.3.html | 2013-12-16 13:11 | 1.2K | CERTAIN CIGARS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.4.html | 2013-12-16 13:11 | 1.3K | CERTAIN DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.4.pdf | 2011-11-01 09:42 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.5.html | 2013-12-16 13:11 | 1.2K | CERTAIN GOODS (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.5.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0373.6.html | 2013-12-16 13:11 | 1.2K | CERTAIN HOGSHEADS OF MOLASSES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0373.6.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0374.html | 2013-12-16 13:11 | 39K | CERTAIN LOGS OF MAHOGANY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0374.pdf | 2011-11-01 09:42 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0380.1.html | 2013-12-16 13:11 | 1.2K | CERTAIN PIECE OF LAND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0380.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0380.2.html | 2013-12-16 13:11 | 1.2K | CERTAIN QUANTITY OF WHEAT (STRONG v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0380.2.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0380.3.html | 2013-12-16 13:11 | 1.2K | CERTAIN SLAVES (ALMEIDA v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0380.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0380.4.html | 2013-12-16 13:11 | 29K | CERVANTES v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0380.4.pdf | 2011-11-01 09:42 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0384.1.html | 2013-12-16 13:11 | 1.2K | CERVANTES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0384.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0384.2.html | 2013-12-16 13:11 | 1.7K | The C. F. ACKERMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0384.2.pdf | 2011-11-01 09:42 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0384.3.html | 2013-12-16 13:11 | 6.2K | The C. F. ACKERMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0384.3.pdf | 2011-11-01 09:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0385.html | 2013-12-16 13:11 | 6.0K | The C. F. ACKERMAN., The PALESTINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0385.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0386.html | 2013-12-16 13:11 | 7.0K | The C. F. ACKERMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0386.pdf | 2011-11-01 09:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0387.1.html | 2013-12-16 13:11 | 3.9K | The C. F. STARIN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0387.1.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0387.2.html | 2013-12-16 13:11 | 1.2K | CHABOLLA (LE ROY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0387.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0387.3.html | 2013-12-16 13:11 | 8.5K | CHABOLLA v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0387.3.pdf | 2011-11-01 09:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0389.html | 2013-12-16 13:11 | 11K | CHABOT v. AMERICAN BUTTON-HOLE and; OVERSEAMING CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0389.pdf | 2011-11-01 09:42 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0390.1.html | 2013-12-16 13:11 | 1.1K | CHABOYA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0390.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0390.2.html | 2013-12-16 13:11 | 51K | CHACON v. EIGHTY-NINE BALES OF COCHINEAL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0390.2.pdf | 2011-11-01 09:42 | 121K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0398.1.html | 2013-12-16 13:11 | 1.2K | CHACON (ELDBEDGE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0398.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0398.2.html | 2013-12-16 13:11 | 18K | In re CHADWICK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0398.2.pdf | 2011-11-01 09:42 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0401.html | 2013-12-16 13:11 | 14K | In re CHADWICK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0401.pdf | 2011-11-01 09:42 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0403.html | 2013-12-16 13:11 | 8.3K | CHADWICK et al. v. The ADELAIDE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0403.pdf | 2011-11-01 09:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0404.html | 2013-12-16 13:11 | 13K | CHAFEE v. COGGSHALL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0404.pdf | 2011-11-01 09:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0406.1.html | 2013-12-16 13:11 | 1.2K | CHAFFEE (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0406.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0406.2.html | 2013-12-16 13:11 | 1.2K | CHAFFEE (MAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0406.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0406.3.html | 2013-12-16 13:11 | 1.2K | CHAFFEE v. N. E. CAR-SPRING CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0406.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0406.4.html | 2013-12-16 13:11 | 1.1K | CHAFFEE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0406.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0406.5.html | 2013-12-16 13:11 | 11K | CHAFFIN v. ST. LOUIS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0406.5.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0408.html | 2013-12-16 13:11 | 13K | CHAFFIN v. ST. LOUIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0408.pdf | 2011-11-01 09:42 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.1.html | 2013-12-16 13:11 | 1.2K | CHAFLIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.2.html | 2013-12-16 13:11 | 1.2K | CHAIN AND ANCHOR (CROWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.2.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.3.html | 2013-12-16 13:11 | 1.2K | CHAIN CABLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.4.html | 2013-12-16 13:11 | 1.1K | CHALMERS v. HOWELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.5.html | 2013-12-16 13:11 | 4.2K | CHALMERS SPENCE PAT. NON-CONDUCTOR CO. v. CRAMP et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.5.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.6.html | 2013-12-16 13:11 | 1.2K | CHALMETTE, The (The BOLIVAR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.6.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.7.html | 2013-12-16 13:11 | 1.2K | CHALONER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.7.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0410.8.html | 2013-12-16 13:11 | 18K | In re CHAMBERLAIN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0410.8.pdf | 2011-11-01 09:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0413.html | 2013-12-16 13:11 | 12K | CHAMBERLAIN et al. v. CHANDLER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0413.pdf | 2011-11-01 09:42 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0415.1.html | 2013-12-16 13:11 | 4.0K | CHAMBERLAIN v. ECKERT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0415.1.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0415.2.html | 2013-12-16 13:11 | 13K | CHAMBERLAIN v. ECKERT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0415.2.pdf | 2011-11-01 09:42 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0417.1.html | 2013-12-16 13:11 | 1.1K | CHAMBERLAIN (EMIGH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0417.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0417.2.html | 2013-12-16 13:11 | 1.1K | CHAMBERLAIN (GLADSTONE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0417.2.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0417.3.html | 2013-12-16 13:11 | 1.2K | CHAMBERLAIN (LYMAN VENTILATING and; REFRIGERATOR CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0417.3.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0417.4.html | 2013-12-16 13:11 | 1.2K | CHAMBERLAIN v. The McDONALD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0417.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0417.5.html | 2013-12-16 13:11 | 26K | CHAMBERLAIN v. ST. PAUL and; S. C. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0417.5.pdf | 2011-11-01 09:42 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0421.html | 2013-12-16 13:11 | 7.5K | CHAMBERLAIN et al. v. STANTON et al. [2 Woods, 164.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0421.pdf | 2011-11-01 09:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0422.1.html | 2013-12-16 13:11 | 1.2K | CHAMBERLAIN v. The THOMAS SPARKS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0422.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0422.2.html | 2013-12-16 13:11 | 1.2K | CHAMBERLAIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0422.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0422.3.html | 2013-12-16 13:11 | 1.2K | CHAMBERLAIN (WALDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0422.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0422.4.html | 2013-12-16 13:11 | 1.2K | CHAMBEBLAIN (WARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0422.4.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0422.5.html | 2013-12-16 13:11 | 11K | In re CHAMBERLIN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0422.5.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0424.1.html | 2013-12-16 13:11 | 1.2K | CHAMBERLIN (DOW v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0424.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0424.2.html | 2013-12-16 13:11 | 10K | In re CHAMBERS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0424.2.pdf | 2011-11-01 09:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0426.1.html | 2013-12-16 13:11 | 1.2K | CHAMBERS (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0426.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0426.2.html | 2013-12-16 13:11 | 3.8K | CHAMBERS et al. v. The HENRY KNEELAND. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0426.2.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0426.3.html | 2013-12-16 13:11 | 1.2K | CHAMBERS (MARVIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0426.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0426.4.html | 2013-12-16 13:11 | 8.2K | CHAMBERS v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0426.4.pdf | 2011-11-01 09:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0427.html | 2013-12-16 13:11 | 4.1K | The CHAMPION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0427.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0428.html | 2013-12-16 13:11 | 40K | The CHAMPION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0428.pdf | 2011-11-01 09:42 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0434.html | 2013-12-16 13:11 | 13K | The CHAMPION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0434.pdf | 2011-11-01 09:42 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0436.1.html | 2013-12-16 13:11 | 1.2K | CHAMPION, The (HURLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0436.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0436.2.html | 2013-12-16 13:11 | 2.7K | CHAMPION v. BOSS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0436.2.pdf | 2011-11-01 09:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0436.3.html | 2013-12-16 13:11 | 1.2K | CHAMPION (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0436.3.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0436.4.html | 2013-12-16 13:11 | 1.2K | CHAMPLIN (SANDS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0436.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0436.5.html | 2013-12-16 13:11 | 10K | CHAMPLIN v. TILLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0436.5.pdf | 2011-11-01 09:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0438.html | 2013-12-16 13:11 | 7.4K | CHAMPNEY v. BANCROFT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0438.pdf | 2011-11-01 09:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0439.1.html | 2013-12-16 13:11 | 1.2K | CHANA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0439.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0439.2.html | 2013-12-16 13:11 | 1.6K | CHANCE v. UNION MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0439.2.pdf | 2011-11-01 09:42 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0439.3.html | 2013-12-16 13:11 | 29K | The CHANCELLOR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0439.3.pdf | 2011-11-01 09:42 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0443.html | 2013-12-16 13:11 | 22K | In re CHANDLER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0443.pdf | 2011-11-01 09:42 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0447.html | 2013-12-16 13:11 | 17K | In re CHANDLER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0447.pdf | 2011-11-01 09:42 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0449.html | 2013-12-16 13:11 | 3.2K | CHANDLER v. The ANNIE BUCKMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0449.pdf | 2011-11-01 09:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0450.1.html | 2013-12-16 13:11 | 1.2K | CHANDLER (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0450.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0450.2.html | 2013-12-16 13:11 | 4.9K | CHANDLER v. BYRD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0450.2.pdf | 2011-11-01 09:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0450.3.html | 2013-12-16 13:11 | 1.2K | CHANDLER (CHAMBERLAIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0450.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0450.4.html | 2013-12-16 13:11 | 9.2K | CHANDLER v. DODGE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0450.4.pdf | 2011-11-01 09:42 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0452.html | 2013-12-16 13:11 | 43K | CHANDLER v. LADD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0452.pdf | 2011-11-01 09:42 | 261K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.0452_01.jpg | 2011-07-18 14:04 | 61K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.0452_02.jpg | 2011-07-18 14:03 | 55K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.0453_01.jpg | 2011-07-18 14:03 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0459.1.html | 2013-12-16 13:11 | 1.2K | CHANDLER (MANKIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0459.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0459.2.html | 2013-12-16 13:11 | 1.2K | CHANDLER (PRITCHABD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0459.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0459.3.html | 2013-12-16 13:11 | 7.8K | CHANDLER v. SIDDLE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0459.3.pdf | 2011-11-01 09:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0460.html | 2013-12-16 13:11 | 11K | CHANEY v. BASKET et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0460.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0462.html | 2013-12-16 13:11 | 9.7K | CHAINING v. REILEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0462.pdf | 2011-11-01 09:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0463.1.html | 2013-12-16 13:11 | 1.2K | CHAPEL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0463.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0463.2.html | 2013-12-16 13:11 | 1.2K | CHAPELS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0463.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0463.3.html | 2013-12-16 13:11 | 7.0K | CHAPIN v. The E. BRAINARD., BRAINARD et al. v. The TRAVELLER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0463.3.pdf | 2011-11-01 09:42 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0464.html | 2013-12-16 13:11 | 13K | CHAPIN et al. v. The HATTIE ROSS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0464.pdf | 2011-11-01 09:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0466.html | 2013-12-16 13:11 | 16K | CHAPIN et al. v. NORTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0466.pdf | 2011-11-01 09:42 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0468.html | 2013-12-16 13:11 | 10K | CHAPIN v. SIGER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0468.pdf | 2011-11-01 09:42 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0470.html | 2013-12-16 13:11 | 5.8K | In re CHAPMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0470.pdf | 2011-11-01 09:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0471.html | 2013-12-16 13:11 | 35K | The CHAPMAN. [4 Sawy. 501.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0471.pdf | 2011-11-01 09:42 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.1.html | 2013-12-16 13:11 | 5.0K | CHAPMAN v. BARGER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.1.pdf | 2011-11-01 09:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.2.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (BUTTS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.3.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (CRUMP v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.4.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (ELLICOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.5.html | 2013-12-16 13:11 | 1.2K | CHAPMAN v. The EMPIRE STATE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.5.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0477.6.html | 2013-12-16 13:11 | 24K | CHAPMAN v. FENWICK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0477.6.pdf | 2011-11-01 09:42 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.1.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (JAYCOX v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.2.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.3.html | 2013-12-16 13:11 | 3.4K | CHAPMAN v. The LUCERNE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.3.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.4.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (PETTERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.5.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (READ v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.5.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0481.6.html | 2013-12-16 13:11 | 11K | CHAPMAN v. REPUBLIC LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0481.6.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0483.html | 2013-12-16 13:11 | 24K | CHAPMAN v. SCHOOL DISTRICT et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0483.pdf | 2011-11-01 09:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0487.html | 2013-12-16 13:11 | 58K | CHAPMAN v. SCHOOL DISTRICT et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0487.pdf | 2011-11-01 09:42 | 131K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0496.html | 2013-12-16 13:11 | 3.5K | CHAPMAN et al. v. SCOTT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0496.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0497.1.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (THORNTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0497.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0497.2.html | 2013-12-16 13:11 | 23K | CHAPMAN et al. v: TOY LONG et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0497.2.pdf | 2011-11-01 09:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0500.1.html | 2013-12-16 13:11 | 1.1K | CHAPMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0500.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0500.2.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (WELLS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0500.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0500.3.html | 2013-12-16 13:11 | 1.2K | CHAPMAN (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0500.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0500.4.html | 2013-12-16 13:11 | 12K | CHAPON v. SMYTHE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0500.4.pdf | 2011-11-01 09:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0502.1.html | 2013-12-16 13:11 | 4.4K | In re CHAPPEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0502.1.pdf | 2011-11-01 09:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0502.2.html | 2013-12-16 13:11 | 1.2K | CHAPPEL v. The JOHN E. CLAYTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0502.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0503.html | 2013-12-16 13:11 | 23K | CHAPPELLE v. OLNEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0503.pdf | 2011-11-01 09:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0506.html | 2013-12-16 13:11 | 3.8K | CHABD v. The KATE L. BEUCE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0506.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0507.1.html | 2013-12-16 13:11 | 1.2K | CHARLES, The (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0507.1.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0507.2.html | 2013-12-16 13:11 | 9.9K | CHARLES v. MATLOCK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0507.2.pdf | 2011-11-01 09:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0508.1.html | 2013-12-16 13:11 | 1.2K | CHARLES (MUTUAL BENEFIT LIFE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0508.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0508.2.html | 2013-12-16 13:11 | 1.2K | CHABLES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0508.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0508.3.html | 2013-12-16 13:11 | 1.2K | CHABLES AVERY, The (SPENCEB v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0508.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0508.4.html | 2013-12-16 13:11 | 5.8K | The CHABLES F. PERRY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0508.4.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0509.html | 2013-12-16 13:11 | 16K | The CHARLES HENRY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0509.pdf | 2011-11-01 09:42 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0511.1.html | 2013-12-16 13:11 | 1.2K | CHARLES MEARS, The (PARMLEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0511.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0511.2.html | 2013-12-16 13:11 | 13K | The CHARLES MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0511.2.pdf | 2011-11-01 09:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0513.1.html | 2013-12-16 13:11 | 1.2K | CHARLES MORGAN, The (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0513.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0513.2.html | 2013-12-16 13:11 | 1.2K | CHARLES PITMAN, The (CARRIGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0513.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0513.3.html | 2013-12-16 13:11 | 1.4K | The CHARLES R. STONE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0513.3.pdf | 2011-11-01 09:42 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0513.4.html | 2013-12-16 13:11 | 5.8K | The CHARLES R. STONE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0513.4.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0514.1.html | 2013-12-16 13:11 | 1.2K | CHARLESTON (GILCHRIST v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0514.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0514.2.html | 2013-12-16 13:11 | 1.2K | CHARLESTON GASLIGHT CO. (PERDICARIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0514.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0514.3.html | 2013-12-16 13:11 | 1.2K | CHARLESTOWN (MARSH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0514.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0514.4.html | 2013-12-16 13:11 | 6.4K | The CHARLOTTE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0514.4.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0515.1.html | 2013-12-16 13:11 | 1.2K | CHARLOTTE MINERVA, The (ENEAS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0515.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0515.2.html | 2013-12-16 13:11 | 8.5K | The CHARLOTTE RAAB. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0515.2.pdf | 2011-11-01 09:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0516.1.html | 2013-12-16 13:11 | 1.2K | CHARLOTTESVILLE NAT. BANK (JOHNSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0516.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0516.2.html | 2013-12-16 13:11 | 1.2K | CHARLOTTESVILLE NAT. BANK (SELIGMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0516.2.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0516.3.html | 2013-12-16 13:11 | 1.2K | CHARLOTTE VANDERBILT, The (SQUIRES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0516.3.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0516.4.html | 2013-12-16 13:11 | 6.2K | CHARTER OAK FIRE INS. CO. v. STAR INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0516.4.pdf | 2011-11-01 09:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0517.1.html | 2013-12-16 13:11 | 1.2K | CHARTER OAK LIFE INS. CO. (McGOWAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0517.1.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0517.2.html | 2013-12-16 13:11 | 14K | In re CHASE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0517.2.pdf | 2011-11-01 09:42 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0519.1.html | 2013-12-16 13:11 | 1.1K | CHASE v. The ALICE TAINTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0519.1.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0519.2.html | 2013-12-16 13:11 | 1.2K | CHASE (BOWEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0519.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0519.3.html | 2013-12-16 13:11 | 1.2K | CHASE v. CHASE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0519.3.pdf | 2011-11-01 09:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0519.4.html | 2013-12-16 13:11 | 1.2K | CHASE (CLARKE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0519.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0519.5.html | 2013-12-16 13:11 | 8.9K | CHASE et al. v. CRARY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0519.5.pdf | 2011-11-01 09:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0520.1.html | 2013-12-16 13:11 | 1.2K | CHASE (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0520.1.pdf | 2011-11-01 09:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0520.2.html | 2013-12-16 13:11 | 1.2K | CHASE (MATTHEW v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0520.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0521.1.html | 2013-12-16 13:11 | 3.8K | CHASE v. SABIN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0521.1.pdf | 2011-11-01 09:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0521.2.html | 2013-12-16 13:11 | 16K | CHASE v. SANBORN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0521.2.pdf | 2011-11-01 09:42 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0523.html | 2013-12-16 13:11 | 2.9K | CHASE v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0523.pdf | 2011-11-01 09:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0524.1.html | 2013-12-16 13:11 | 1.1K | CHASE (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0524.1.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0524.2.html | 2013-12-16 13:11 | 1.1K | CHASE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0524.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0524.3.html | 2013-12-16 13:11 | 1.2K | CHASE v. VERMONT VAL. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0524.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0524.4.html | 2013-12-16 13:11 | 13K | CHASE et al. v. WALKER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0524.4.pdf | 2011-11-01 09:42 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0526.1.html | 2013-12-16 13:11 | 4.6K | CHASE v. WESSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0526.1.pdf | 2011-11-01 09:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0526.2.html | 2013-12-16 13:11 | 1.2K | CHASKEL (NEW YORK RUBBER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0526.2.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0526.3.html | 2013-12-16 13:11 | 1.2K | CHASSELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0526.3.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0526.4.html | 2013-12-16 13:11 | 1.2K | CHASTENEY (WALDRON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0526.4.pdf | 2011-11-01 09:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0526.5.html | 2013-12-16 13:11 | 4.9K | Ex parte CHATFIELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0526.5.pdf | 2011-11-01 09:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0527.html | 2013-12-16 13:11 | 5.4K | CHATFIELD v. The WOLGA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0527.pdf | 2011-11-01 09:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0528.1.html | 2013-12-16 13:11 | 1.2K | CHAUNCEY v. The MARY BELLE ROBERTS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0528.1.pdf | 2011-11-01 09:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0528.2.html | 2013-12-16 13:11 | 1.2K | CHEEK (WAGGENER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0528.2.pdf | 2011-11-01 09:42 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0528.3.html | 2013-12-16 13:11 | 1.2K | CHEESEBROUGH (NEAFIE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0528.3.pdf | 2011-11-01 09:42 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0528.4.html | 2013-12-16 13:11 | 1.2K | CHEESEMAN (FEARING v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0528.4.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0528.5.html | 2013-12-16 13:11 | 36K | The CHEESEMAN et al. v. TWO FERRYBOATS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0528.5.pdf | 2011-11-01 09:43 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0534.1.html | 2013-12-16 13:11 | 1.2K | CHEESEMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0534.1.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0534.2.html | 2013-12-16 13:11 | 22K | CHEEVER. v. SHEDD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0534.2.pdf | 2011-11-01 09:43 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0537.1.html | 2013-12-16 13:11 | 1.2K | CHELSEA, The (WILLIAMSBURG FERRY CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0537.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0537.2.html | 2013-12-16 13:11 | 11K | CHEMICAL NAT. BANK v. BATLEY et al., NELSON v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0537.2.pdf | 2011-11-01 09:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0539.1.html | 2013-12-16 13:11 | 1.2K | CHENAULT (DORSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0539.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0539.2.html | 2013-12-16 13:11 | 1.2K | CHENAULT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0539.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0539.3.html | 2013-12-16 13:11 | 16K | In re CHENEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0539.3.pdf | 2011-11-01 09:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0541.html | 2013-12-16 13:11 | 19K | In re CHENEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0541.pdf | 2011-11-01 09:43 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0544.1.html | 2013-12-16 13:11 | 1.2K | CHENEY (KNIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0544.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0544.2.html | 2013-12-16 13:11 | 1.2K | CHENOWETH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0544.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0544.3.html | 2013-12-16 13:11 | 22K | CHEONGWO v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0544.3.pdf | 2011-11-01 09:43 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0548.html | 2013-12-16 13:11 | 16K | The CHEROKEE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0548.pdf | 2011-11-01 09:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0550.html | 2013-12-16 13:11 | 41K | The CHEROKEE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0550.pdf | 2011-11-01 09:43 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0557.1.html | 2013-12-16 13:11 | 3.5K | CHERRY v. SWEENY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0557.1.pdf | 2011-11-01 09:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0557.2.html | 2013-12-16 13:11 | 1.2K | CHERUB, The (RICH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0557.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0557.3.html | 2013-12-16 13:11 | 15K | The CHESAPEAKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0557.3.pdf | 2011-11-01 09:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0560.1.html | 2013-12-16 13:11 | 6.7K | The CHESAPEAKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0560.1.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0560.2.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE INS. CO. (BUCK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0560.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0560.3.html | 2013-12-16 13:11 | 2.7K | CHESAPEAKE and; O. CANAL CO. v. BAR-CROFT et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0560.3.pdf | 2011-11-01 09:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0561.html | 2013-12-16 13:11 | 8.3K | CHESAPEAKE and; O. CANAL CO. v. BINNEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0561.pdf | 2011-11-01 09:43 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0562.1.html | 2013-12-16 13:11 | 2.4K | CHESAPEAKE and; O. CANAL CO. v. BRADLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0562.1.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0562.2.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE and; O. CANAL CO. (CAMERON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0562.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0562.3.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE and; O. CANAL CO. (CARO-THERS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0562.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0562.4.html | 2013-12-16 13:11 | 4.6K | CHESAPEAKE and; O. CANAL. CO. v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0562.4.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0563.1.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE and; O. CANAL CO. (HOLMEAD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0563.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0563.2.html | 2013-12-16 13:11 | 3.8K | CHESAPEAKE and; O. CANAL CO. v. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0563.2.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0563.3.html | 2013-12-16 13:11 | 35K | CHESAPEAKE and; O. CANAL CO. v. KEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0563.3.pdf | 2011-11-01 09:43 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0569.1.html | 2013-12-16 13:11 | 2.8K | CHESAPEAKE and; O. CANAL CO. v. MASON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0569.1.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0569.2.html | 2013-12-16 13:11 | 3.6K | CHESAPEAKE and; O. CANAL CO. v. POOR. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0569.2.pdf | 2011-11-01 09:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0569.3.html | 2013-12-16 13:11 | 4.5K | CHESAPEAKE and; O. CANAL CO. v. ROBERTSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0569.3.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0570.1.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE and; O. CANAL CO. (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0570.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0570.2.html | 2013-12-16 13:11 | 18K | CHESAPEAKE and; O. CANAL CO. v. UNION BANK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0570.2.pdf | 2011-11-01 09:43 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0573.1.html | 2013-12-16 13:11 | 4.3K | CHESAPEAKE and; O. CANAL CO. v. UNION BANK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0573.1.pdf | 2011-11-01 09:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0573.2.html | 2013-12-16 13:11 | 1.2K | CHESAPEAKE and; O. R. CO. (RICHARDS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0573.2.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0573.3.html | 2013-12-16 13:11 | 27K | The CHESHIRE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0573.3.pdf | 2011-11-01 09:43 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0578.1.html | 2013-12-16 13:11 | 6.6K | The CHESHIRE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0578.1.pdf | 2011-11-01 09:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0578.2.html | 2013-12-16 13:11 | 6.1K | The CHESHIRE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0578.2.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0579.html | 2013-12-16 13:11 | 8.3K | The CHESHIRE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0579.pdf | 2011-11-01 09:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0580.html | 2013-12-16 13:11 | 5.4K | CHESHIRE PROVIDENT INST. v. JOHNSTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0580.pdf | 2011-11-01 09:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0581.1.html | 2013-12-16 13:11 | 1.2K | CHESNEY (WALLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0581.1.pdf | 2011-11-01 09:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0581.2.html | 2013-12-16 13:11 | 1.2K | CHESNUT (VANHORN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0581.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0581.3.html | 2013-12-16 13:11 | 13K | CHESTER et al. v. BENNER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0581.3.pdf | 2011-11-01 09:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0583.html | 2013-12-16 13:11 | 6.2K | CHESTER et al. v. CURTIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0583.pdf | 2011-11-01 09:43 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0584.1.html | 2013-12-16 13:11 | 1.2K | CHESTER (RIGGS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0584.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0584.2.html | 2013-12-16 13:11 | 18K | CHESTER et al. v. WELLFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0584.2.pdf | 2011-11-01 09:43 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0587.1.html | 2013-12-16 13:11 | 1.2K | CHETWOOD (FRANK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0587.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0587.2.html | 2013-12-16 13:11 | 1.2K | CHEVALLIE (GALLEGO v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0587.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0587.3.html | 2013-12-16 13:11 | 6.7K | CHEW v. BAKER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0587.3.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.1.html | 2013-12-16 13:11 | 1.2K | CHEW (DECATUR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.2.html | 2013-12-16 13:11 | 1.2K | CHEW (GEORGETOWN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.3.html | 2013-12-16 13:11 | 1.2K | C. H. FROST, The (ROOSEVELT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.4.html | 2013-12-16 13:11 | 1.2K | CHICAGO (BRADY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.5.html | 2013-12-16 13:11 | 1.2K | CHICAGO (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.5.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.6.html | 2013-12-16 13:11 | 1.2K | CHICAGO (COLLINS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.6.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0588.7.html | 2013-12-16 13:11 | 15K | CHICAGO v. GAGE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0588.7.pdf | 2011-11-01 09:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.1.html | 2013-12-16 13:11 | 1.2K | CHICAGO (GARRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.2.html | 2013-12-16 13:11 | 1.2K | CHICAGO (GOODRICH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.3.html | 2013-12-16 13:11 | 1.2K | CHICAGO (LOMBARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.4.html | 2013-12-16 13:11 | 1.2K | CHICAGO (NICHOLSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.5.html | 2013-12-16 13:11 | 1.2K | CHICAGO (NORTHERN TRANSP. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.5.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.6.html | 2013-12-16 13:11 | 1.2K | CHICAGO (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.6.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.7.html | 2013-12-16 13:11 | 1.2K | CHICAGO (STOW v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.7.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.8.html | 2013-12-16 13:11 | 1.2K | CHICAGO (UNION NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.8.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.9.html | 2013-12-16 13:11 | 1.2K | CHICAGO, A. and; St. L. R. CO. (DENNISTON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.9.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.10.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; A. R. CO. (BARLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.10.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.11.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; A. R. CO. (ILLINOIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.11.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.12.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; A. R. Co. (JESSUP v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.12.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0590.13.html | 2013-12-16 13:11 | 24K | CHICAGO and; N. W. R. CO. v. CHICAGO and; P. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0590.13.pdf | 2011-11-01 09:43 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.1.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; N. W. RY. CO. (MENZELL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.2.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; N. W. RY. CO. (PIEK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.3.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; N. W. R. CO. (SAYLES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.4.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; N. W. R. CO. (WHITON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.5.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; P. B. CO. (CHICAGO and; N. W. B. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.5.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.6.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; S. R. CO. (SMYTHE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.6.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.7.html | 2013-12-16 13:11 | 1.2K | CHICAGO and; S. W. RY. CO. (DOWS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.7.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0594.8.html | 2013-12-16 13:11 | 26K | CHICAGO, B. and; Q. R. CO. v. ATTORNEY GENERAL et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0594.8.pdf | 2011-11-01 09:43 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0598.1.html | 2013-12-16 13:11 | 1.2K | CHICAGO, B. and; Q. R. CO. (EMIGH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0598.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0598.2.html | 2013-12-16 13:11 | 1.2K | CHICAGO, B. and; Q. R. CO. (FINLAYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0598.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0598.3.html | 2013-12-16 13:11 | 1.2K | CHICAGO, B. and; Q. R. CO. (HAZARD v.) |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0598.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0598.4.html | 2013-12-16 13:11 | 13K | CHICAGO, B. and; Q. R. CO. v. OTOE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0598.4.pdf | 2011-11-01 09:43 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0600.html | 2013-12-16 13:11 | 17K | CHICAGO, B. and; Q. R. CO. v. PAGE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0600.pdf | 2011-11-01 09:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0603.1.html | 2013-12-16 13:11 | 1.2K | CHICAGO, B. and; Q. R. CO. (SAYLES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0603.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0603.2.html | 2013-12-16 13:11 | 1.2K | CHICAGO, B. and; Q. RY. CO. (SEYMOUR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0603.2.pdf | 2011-11-01 09:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0603.3.html | 2013-12-16 13:11 | 1.2K | CHICAGO, D. and; M. R. CO. (BUBNHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0603.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0603.4.html | 2013-12-16 13:11 | 1.2K | CHICAGO, D. and; V. R. CO. (OSGOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0603.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0603.5.html | 2013-12-16 13:11 | 21K | CHICAGO FRUIT-HOUSE CO. v. BUSCH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0603.5.pdf | 2011-11-01 09:43 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.1.html | 2013-12-16 13:11 | 1.2K | CHICAGO, I. and; N. R. Co. (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.1.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.2.html | 2013-12-16 13:11 | 1.2K | CHICAGO, M. and; ST. P. R. CO. (BARNES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.2.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.3.html | 2013-12-16 13:11 | 1.2K | CHICAGO MANUF;G CO. (DANE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.3.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.4.html | 2013-12-16 13:11 | 1.2K | CHICAGO, P. ETC., R. CO. (FARMERS; LOAN and; TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.4.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.5.html | 2013-12-16 13:11 | 1.2K | CHICAGO. R. I. and; P. R. CO. (ATLANTIC and; P. TEL. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.5.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.6.html | 2013-12-16 13:11 | 1.2K | CHICAGO, R. I. and; P. R. CO. (HATCH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.6.pdf | 2011-11-01 09:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0606.7.html | 2013-12-16 13:11 | 17K | CHICAGO, ST. L. and; N. O. R. CO. v. McCOMB et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0606.7.pdf | 2011-11-01 09:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0609.html | 2013-12-16 13:11 | 24K | CHICKERING v. HATCH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0609.pdf | 2011-11-01 09:43 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0613.1.html | 2013-12-16 13:11 | 4.6K | CHICKERING v. HATCH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0613.1.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0613.2.html | 2013-12-16 13:11 | 18K | CHILD v. ADAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0613.2.pdf | 2011-11-01 09:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0616.html | 2013-12-16 13:11 | 5.5K | CHILD v. BOSTON and; F. IBON WORKS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0616.pdf | 2011-11-01 09:43 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0617.html | 2013-12-16 13:11 | 15K | CHILD v. BOSTON and; F. IBON WORKS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0617.pdf | 2011-11-01 09:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0619.1.html | 2013-12-16 13:11 | 1.2K | CHILD (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0619.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0619.2.html | 2013-12-16 13:11 | 1.2K | CHILD (FILLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0619.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0619.3.html | 2013-12-16 13:11 | 21K | The CHILDE HAROLD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0619.3.pdf | 2011-11-01 09:43 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0622.html | 2013-12-16 13:11 | 11K | CHILDS v. CORP. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0622.pdf | 2011-11-01 09:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0624.html | 2013-12-16 13:11 | 22K | CHILDS et al. v. GLADDING et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0624.pdf | 2011-11-01 09:43 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0627.html | 2013-12-16 13:11 | 1.3K | CHILDS et al. v. GLADDING, et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0627.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0628.1.html | 2013-12-16 13:11 | 5.0K | CHILDS v. LENIG. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0628.1.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0628.2.html | 2013-12-16 13:11 | 1.2K | CHILDS (SAMUEL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0628.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0628.3.html | 2013-12-16 13:11 | 12K | CHILDS v. SHOEMAKER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0628.3.pdf | 2011-11-01 09:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0630.html | 2013-12-16 13:11 | 12K | CHILDS v. SOMERSET and; K. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0630.pdf | 2011-11-01 09:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0632.1.html | 2013-12-16 13:11 | 1.2K | CHILDS (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0632.1.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0632.2.html | 2013-12-16 13:11 | 1.2K | CHILLICOTHE BRANCH BANK (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0632.2.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0632.3.html | 2013-12-16 13:11 | 11K | CHILLICOTHE BRANCH OF STATE BANK OF OHIO v. FOX et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0632.3.pdf | 2011-11-01 09:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0634.1.html | 2013-12-16 13:11 | 1.2K | CHILLICOTHE BRANCH OF STATE BANK (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0634.1.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0634.2.html | 2013-12-16 13:11 | 1.2K | CHINA, The (WALSH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0634.2.pdf | 2011-11-01 09:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0634.3.html | 2013-12-16 13:11 | 4.5K | CHINN v. DARNELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0634.3.pdf | 2011-11-01 09:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0634.4.html | 2013-12-16 13:11 | 8.1K | CHINN v. HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0634.4.pdf | 2011-11-01 09:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0635.1.html | 2013-12-16 13:11 | 1.2K | CHIPMAN v. WENTWORTH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0635.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0635.2.html | 2013-12-16 13:11 | 33K | CHISHOLM v. MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0635.2.pdf | 2011-11-01 09:43 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0640.html | 2013-12-16 13:11 | 13K | In re CHISOLM et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0640.pdf | 2011-11-01 09:43 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0642.html | 2013-12-16 13:11 | 15K | CHITTENDEN et al. v. DARDEN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0642.pdf | 2011-11-01 09:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0644.html | 2013-12-16 13:11 | 6.6K | The C. H. NORTHAM. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0644.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0645.html | 2013-12-16 13:11 | 4.4K | The C. H. NORTHAM. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0645.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0646.1.html | 2013-12-16 13:11 | 1.2K | C. H. NORTHRAM, The (LONAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0646.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0646.2.html | 2013-12-16 13:11 | 1.2K | CHOAT (RAMBLER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0646.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0646.3.html | 2013-12-16 13:11 | 17K | CHOATE et al. v. CROWNINSHIELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0646.3.pdf | 2011-11-01 09:43 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0648.html | 2013-12-16 13:11 | 6.9K | CHOATE et al. v. MEREDITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0648.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0649.html | 2013-12-16 13:11 | 13K | CHOMQUA v. MASON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0649.pdf | 2011-11-01 09:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.1.html | 2013-12-16 13:11 | 1.4K | CHOTEAU v. RICE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.1.pdf | 2011-11-01 09:43 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.2.html | 2013-12-16 13:11 | 1.4K | CHOTEAU v. RICE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.2.pdf | 2011-11-01 09:43 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.3.html | 2013-12-16 13:11 | 1.2K | CHOTEAU (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.4.html | 2013-12-16 13:11 | 1.2K | CHOUTEAU (AMBLER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.5.html | 2013-12-16 13:11 | 1.7K | CHOUTEAU v. REDPIELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.5.pdf | 2011-11-01 09:43 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0651.6.html | 2013-12-16 13:11 | 4.4K | CHRIST et al. v. BAKER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0651.6.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0652.html | 2013-12-16 13:11 | 7.1K | CHRIST et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0652.pdf | 2011-11-01 09:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.1.html | 2013-12-16 13:11 | 4.7K | CHRIST et al. v. SCHELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.1.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.2.html | 2013-12-16 13:11 | 1.3K | CHRISTIAN (AMERICAN MIDDLINGS PURIFIER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.3.html | 2013-12-16 13:11 | 1.2K | CHRISTIANSON (GOULD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.4.html | 2013-12-16 13:11 | 2.0K | CHRISTIE v. BUCKEYE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.4.pdf | 2011-11-01 09:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.5.html | 2013-12-16 13:11 | 1.3K | The CHRISTINA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.5.pdf | 2011-11-01 09:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0653.6.html | 2013-12-16 13:11 | 1.2K | CHRISTINA, The (WALING v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0653.6.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0654.1.html | 2013-12-16 13:11 | 5.6K | In re CHRISTLEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0654.1.pdf | 2011-11-01 09:43 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0654.2.html | 2013-12-16 13:11 | 4.1K | CHRISTMAN v. HAYNES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0654.2.pdf | 2011-11-01 09:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0655.html | 2013-12-16 13:11 | 30K | CHRISTMAN et al. v. RUMSEY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0655.pdf | 2011-11-01 09:43 | 139K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.0655_01.jpg | 2011-07-18 14:04 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0659.html | 2013-12-16 13:11 | 7.5K | The CHRISTOPHER COLUMBUS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0659.pdf | 2011-11-01 09:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0660.html | 2013-12-16 13:11 | 6.5K | The CHRISTOPHER COLUMBUS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0660.pdf | 2011-11-01 09:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0661.html | 2013-12-16 13:11 | 6.3K | The CHRISTOPHER NORTH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0661.pdf | 2011-11-01 09:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0662.1.html | 2013-12-16 13:11 | 3.3K | CHRISTY et al. v. CUMMINS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0662.1.pdf | 2011-11-01 09:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0662.2.html | 2013-12-16 13:11 | 1.2K | CHRISTY (HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0662.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0662.3.html | 2013-12-16 13:11 | 1.2K | CHUBB (CAUSIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0662.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0663.html | 2013-12-16 13:11 | 20K | CHUBB et al. v. SEVEN THOUSAND EIGHT HUNDRED BUSHELS OF OATS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0663.pdf | 2011-11-01 09:43 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0666.html | 2013-12-16 13:11 | 7.6K | CHUCK et al. v. MESRITZ. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0666.pdf | 2011-11-01 09:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0667.1.html | 2013-12-16 13:11 | 1.2K | CHURCH (FISK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0667.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0667.2.html | 2013-12-16 13:11 | 3.0K | CHURCH v. The H. L. SCANTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0667.2.pdf | 2011-11-01 09:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0667.3.html | 2013-12-16 13:11 | 10K | CHURCH v. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0667.3.pdf | 2011-11-01 09:43 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0669.1.html | 2013-12-16 13:11 | 1.4K | CHURCH v. SEVENTEEN HUNDRED AND SIXTY DOLLARS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0669.1.pdf | 2011-11-01 09:43 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0669.2.html | 2013-12-16 13:11 | 33K | CHURCH v. SEVENTEEN HUNDRED AND TWELVE DOLLARS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0669.2.pdf | 2011-11-01 09:43 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0674.html | 2013-12-16 13:11 | 15K | CHURCH et al. v. SHELTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0674.pdf | 2011-11-01 09:43 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0676.html | 2013-12-16 13:11 | 18K | CHURCHILL et al. v. The BRITISH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0676.pdf | 2011-11-01 09:43 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0679.html | 2013-12-16 13:11 | 6.0K | The CHUSAN.[1 Spr. 39.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0679.pdf | 2011-11-01 09:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0680.html | 2013-12-16 13:11 | 38K | The CHUSAN.[2 Story, 455.] |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0680.pdf | 2011-11-01 09:43 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0686.1.html | 2013-12-16 13:11 | 4.5K | The CIMBUS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0686.1.pdf | 2011-11-01 09:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0686.2.html | 2013-12-16 13:11 | 1.2K | CINCINNATI (ROGERS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0686.2.pdf | 2011-11-01 09:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0686.3.html | 2013-12-16 13:11 | 1.2K | CINCINNATI and; C. A. L. R. CO. (PULLAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0686.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0686.4.html | 2013-12-16 13:11 | 1.2K | CINCINNATI COAL CO. (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0686.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0686.5.html | 2013-12-16 13:11 | 15K | In re CINCINNATI ENQUIRER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0686.5.pdf | 2011-11-01 09:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.1.html | 2013-12-16 13:11 | 1.2K | CINCINNATI ENQUIRER (GIBSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.2.html | 2013-12-16 13:11 | 1.3K | CINCINNATI GAS-LIGHT and; COKE CO. (STILWELL and; BIERCE MANUF;G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.2.pdf | 2011-11-01 09:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.3.html | 2013-12-16 13:11 | 1.2K | CINCINNATI, H. and; D. R. CO. (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.3.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.4.html | 2013-12-16 13:11 | 1.2K | CINCINNATI, PERU and; CHICAGO R. CO. (DUNHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.4.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.5.html | 2013-12-16 13:11 | 1.2K | CINCINNATI, W. and; Z. R. CO. (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.5.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.6.html | 2013-12-16 13:11 | 1.2K | CINQUE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.6.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0688.7.html | 2013-12-16 13:11 | 1.2K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0688.7.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0689.html | 2013-12-16 13:11 | 23K | The CIRCASSIAN., WICKES v. The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0689.pdf | 2011-11-01 09:43 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0692.html | 2013-12-16 13:11 | 58K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0692.pdf | 2011-11-01 09:43 | 132K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0702.1.html | 2013-12-16 13:11 | 5.2K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0702.1.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0702.2.html | 2013-12-16 13:11 | 7.1K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0702.2.pdf | 2011-11-01 09:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0703.html | 2013-12-16 13:11 | 43K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0703.pdf | 2011-11-01 09:43 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0710.html | 2013-12-16 13:11 | 6.8K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0710.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0711.html | 2013-12-16 13:11 | 4.0K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0711.pdf | 2011-11-01 09:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0712.html | 2013-12-16 13:11 | 17K | The CIRCASSIAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0712.pdf | 2011-11-01 09:43 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0714.html | 2013-12-16 13:11 | 17K | In re CIRCUIT COURT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0714.pdf | 2011-11-01 09:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0717.1.html | 2013-12-16 13:11 | 1.2K | CISCO (VICTOR v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0717.1.pdf | 2011-11-01 09:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0717.2.html | 2013-12-16 13:11 | 1.2K | CISNA (CURTS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0717.2.pdf | 2011-11-01 09:43 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0717.3.html | 2013-12-16 13:11 | 1.2K | CISNA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0717.3.pdf | 2011-11-01 09:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0717.4.html | 2013-12-16 13:11 | 14K | CISSEL v. McDONALD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0717.4.pdf | 2011-11-01 09:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0719.1.html | 2013-12-16 13:11 | 1.2K | CITIZEN, The (BIBBINS v.) |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0719.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0719.2.html | 2013-12-16 13:11 | 1.2K | CITIZENS; SAV. BANK (WATSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0719.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0719.3.html | 2013-12-16 13:11 | 90K | CITIZENS; BANK v. NANTUCKET STEAMBOAT CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0719.3.pdf | 2011-11-01 09:43 | 191K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0733.html | 2013-12-16 13:11 | 12K | CITIZENS; BANK v. OBER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0733.pdf | 2011-11-01 09:43 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0735.1.html | 2013-12-16 13:11 | 1.2K | CITIZENS; BANK v. OBER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0735.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0735.2.html | 2013-12-16 13:11 | 1.2K | CITIZENS; BANK OF LOUISIANA (CASE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0735.2.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0735.3.html | 2013-12-16 13:11 | 1.2K | CITIZENS; BANK OF TOPEKA (FIRST NAT. BANK OF MANHATTAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0735.3.pdf | 2011-11-01 09:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0735.4.html | 2013-12-16 13:11 | 11K | CITIZENS; NAT. BANK v. CASS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0735.4.pdf | 2011-11-01 09:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0737.1.html | 2013-12-16 13:11 | 1.4K | CITIZENS; NAT. BANK v. LEMTNG et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0737.1.pdf | 2011-11-01 09:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0737.2.html | 2013-12-16 13:11 | 6.3K | CITIZENS; SAV. ASS;N v. TOPEKA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0737.2.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0738.html | 2013-12-16 13:11 | 6.7K | In re CITIZENS; SAV. BANK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0738.pdf | 2011-11-01 09:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0739.1.html | 2013-12-16 13:11 | 1.2K | CITY BANK (JAUDON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0739.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0739.2.html | 2013-12-16 13:11 | 1.2K | CITY BANK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0739.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0739.3.html | 2013-12-16 13:11 | 1.2K | CITY BANK (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0739.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0739.4.html | 2013-12-16 13:11 | 1.2K | CITY BANK OF NEW YORK v. YONGE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0739.4.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0739.5.html | 2013-12-16 13:11 | 32K | CITY BANK OF COLUMBUS v. BEACH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0739.5.pdf | 2011-11-01 09:43 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0744.html | 2013-12-16 13:11 | 18K | CITY BANK OF COLUMBUS v. BEACH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0744.pdf | 2011-11-01 09:43 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0746.html | 2013-12-16 13:11 | 4.4K | CITY BANK OF COLUMBUS v. FARMERS; and; PLANTERS; BANK OF BALTIMORE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0746.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0747.html | 2013-12-16 13:11 | 18K | CITY BANK OF NEW-YORK v. SKELTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0747.pdf | 2011-11-01 09:43 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0749.html | 2013-12-16 13:11 | 8.1K | CITY BANK OF NEW YORK v. SKELTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0749.pdf | 2011-11-01 09:43 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0750.html | 2013-12-16 13:11 | 12K | CITY BANK OP RACINE v. BABCOCK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0750.pdf | 2011-11-01 09:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0752.1.html | 2013-12-16 13:11 | 1.2K | CITY BANK OF ST. PAUL (VANDERHOOF v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0752.1.pdf | 2011-11-01 09:43 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0752.2.html | 2013-12-16 13:11 | 16K | In re CITY BANK OP SAVINGS, LOAN and; DISCOUNT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0752.2.pdf | 2011-11-01 09:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0755.1.html | 2013-12-16 13:11 | 1.2K | CITY FIRE INS. CO. (SEMMES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0755.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0755.2.html | 2013-12-16 13:11 | 1.2K | CITY INS. CO. (ROTH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0755.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0755.3.html | 2013-12-16 13:11 | 1.2K | CITY TNS. CO. (TROTT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0755.3.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0755.4.html | 2013-12-16 13:11 | 33K | CITY NAT. BANK v. PADUCAH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0755.4.pdf | 2011-11-01 09:43 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0760.html | 2013-12-16 13:11 | 5.2K | The CITY OF BALTIMORE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0760.pdf | 2011-11-01 09:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0761.1.html | 2013-12-16 13:11 | 4.0K | The CITY OF BRUSSELS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0761.1.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0761.2.html | 2013-12-16 13:11 | 1.2K | CITY OF DUBLIN, The (ROWE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0761.2.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0761.3.html | 2013-12-16 13:11 | 6.4K | The CITY OF FREMONT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0761.3.pdf | 2011-11-01 09:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0762.html | 2013-12-16 13:11 | 10K | The CITY OF GUATEMALA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0762.pdf | 2011-11-01 09:43 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0763.html | 2013-12-16 13:11 | 11K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0763.pdf | 2011-11-01 09:43 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0765.html | 2013-12-16 13:11 | 11K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0765.pdf | 2011-11-01 09:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0767.html | 2013-12-16 13:11 | 7.3K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0767.pdf | 2011-11-01 09:43 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0768.html | 2013-12-16 13:11 | 11K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0768.pdf | 2011-11-01 09:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0769.html | 2013-12-16 13:11 | 12K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0769.pdf | 2011-11-01 09:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0771.html | 2013-12-16 13:11 | 13K | The CITY OF HARTFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0771.pdf | 2011-11-01 09:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0773.1.html | 2013-12-16 13:11 | 1.3K | The CITY OP HOUSTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0773.1.pdf | 2011-11-01 09:43 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0773.2.html | 2013-12-16 13:11 | 1.4K | The CITY OF HOUSTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0773.2.pdf | 2011-11-01 09:43 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0773.3.html | 2013-12-16 13:11 | 8.1K | The CITY OF MEXICO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0773.3.pdf | 2011-11-01 09:43 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0774.1.html | 2013-12-16 13:11 | 1.2K | CITY OF MEXICO, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0774.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0774.2.html | 2013-12-16 13:11 | 15K | The CITY OP NEW BEDFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0774.2.pdf | 2011-11-01 09:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0777.html | 2013-12-16 13:11 | 8.6K | The CITY OF NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0777.pdf | 2011-11-01 09:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0778.html | 2013-12-16 13:11 | 13K | The CITY OF NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0778.pdf | 2011-11-01 09:43 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0780.1.html | 2013-12-16 13:11 | 1.2K | CITY OF NEW YORK, The (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0780.1.pdf | 2011-11-01 09:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0780.2.html | 2013-12-16 13:11 | 12K | The CITY OF NORWICH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0780.2.pdf | 2011-11-01 09:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0781.html | 2013-12-16 13:11 | 4.3K | The CITY OF NORWICH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0781.pdf | 2011-11-01 09:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0782.html | 2013-12-16 13:11 | 25K | The CITY OF NORWICH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0782.pdf | 2011-11-01 09:43 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0786.html | 2013-12-16 13:11 | 7.1K | The CITY OF NORWICH et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0786.pdf | 2011-11-01 09:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0787.1.html | 2013-12-16 13:11 | 1.2K | CITY OF NORWICH, The (PLACE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0787.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0787.2.html | 2013-12-16 13:11 | 8.2K | The CITY OP PANAMA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0787.2.pdf | 2011-11-01 09:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0788.html | 2013-12-16 13:11 | 19K | The CITY OF PARIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0788.pdf | 2011-11-01 09:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0791.html | 2013-12-16 13:11 | 8.3K | The CITY OP PARIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0791.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0792.html | 2013-12-16 13:11 | 25K | The CITY OP PARIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0792.pdf | 2011-11-01 09:44 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0796.1.html | 2013-12-16 13:11 | 1.3K | The CITY OF PHILADELPHIA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0796.1.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0796.2.html | 2013-12-16 13:11 | 13K | The CITY OF TROY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0796.2.pdf | 2011-11-01 09:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0798.html | 2013-12-16 13:11 | 7.9K | The CITY OF WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0798.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0799.html | 2013-12-16 13:11 | 8.0K | The CITY OF WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0799.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0800.html | 2013-12-16 13:11 | 7.0K | The CITY OF WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0800.pdf | 2011-11-01 09:44 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0801.1.html | 2013-12-16 13:11 | 1.2K | CITY SCHOOLS (BERTONNEAU v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0801.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0801.2.html | 2013-12-16 13:11 | 1.3K | CIVIL RIGHTS ACT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0801.2.pdf | 2011-11-01 09:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0801.3.html | 2013-12-16 13:11 | 1.3K | CIVIL RIGHTS BILL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0801.3.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0801.4.html | 2013-12-16 13:11 | 32K | The CIVILTA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0801.4.pdf | 2011-11-01 09:44 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0806.html | 2013-12-16 13:11 | 8.1K | CLAFLIN v. ROBBINS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0806.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0807.1.html | 2013-12-16 13:11 | 1.2K | CLAFLIN (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0807.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0807.2.html | 2013-12-16 13:11 | 7.4K | CLAFLIN v. STEINBERG. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0807.2.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0808.1.html | 2013-12-16 13:11 | 1.2K | CLAFLIN (TOBEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0808.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0808.2.html | 2013-12-16 13:11 | 1.1K | CLAFLIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0808.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0808.3.html | 2013-12-16 13:11 | 1.1K | CLAFLIN v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0808.3.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0808.4.html | 2013-12-16 13:11 | 6.2K | CLAGETT et al. v. GIBSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0808.4.pdf | 2011-11-01 09:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0809.1.html | 2013-12-16 13:11 | 1.2K | CLAGETT (QUANDO v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0809.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0809.2.html | 2013-12-16 13:11 | 2.3K | Case of CLAGGETT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0809.2.pdf | 2011-11-01 09:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0809.3.html | 2013-12-16 13:11 | 3.2K | CLAGGETT v. WARD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0809.3.pdf | 2011-11-01 09:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0810.1.html | 2013-12-16 13:11 | 1.2K | CLAIRBORNE, The (JARVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0810.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0810.2.html | 2013-12-16 13:11 | 6.5K | In re CLATIRMONT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0810.2.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0810.3.html | 2013-12-16 13:11 | 1.2K | CLANCEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0810.3.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0811.html | 2013-12-16 13:11 | 21K | In re CLANCY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0811.pdf | 2011-11-01 09:44 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0814.html | 2013-12-16 13:11 | 16K | In re CLAP., Ex parte TARBELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0814.pdf | 2011-11-01 09:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0816.html | 2013-12-16 13:11 | 17K | In re CLAP., Ex parte SMITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0816.pdf | 2011-11-01 09:44 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0819.1.html | 2013-12-16 13:11 | 6.2K | In re CLAPP et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0819.1.pdf | 2011-11-01 09:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0819.2.html | 2013-12-16 13:11 | 1.2K | CLAPP (FORSYTH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0819.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0819.3.html | 2013-12-16 13:11 | 1.2K | CLAPP (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0819.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0819.4.html | 2013-12-16 13:11 | 1.2K | CLAPP (WILSON PACKING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0819.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0819.5.html | 2013-12-16 13:11 | 22K | CLAPP v. YOUNG et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0819.5.pdf | 2011-11-01 09:44 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0823.html | 2013-12-16 13:11 | 8.0K | The CLARA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0823.pdf | 2011-11-01 09:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0824.html | 2013-12-16 13:11 | 24K | The CLARA., The CLARA CLARITA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0824.pdf | 2011-11-01 09:44 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0828.html | 2013-12-16 13:11 | 5.5K | The CLARA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0828.pdf | 2011-11-01 09:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0829.1.html | 2013-12-16 13:11 | 2.7K | CLARA v. EWELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0829.1.pdf | 2011-11-01 09:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0829.2.html | 2013-12-16 13:11 | 2.6K | The CLARA DAVIDSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0829.2.pdf | 2011-11-01 09:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0829.3.html | 2013-12-16 13:11 | 13K | The CLARA M. PORTER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0829.3.pdf | 2011-11-01 09:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0831.html | 2013-12-16 13:11 | 4.3K | CLARE v. NATIONAL CITY BANK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0831.pdf | 2011-11-01 09:44 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.1.html | 2013-12-16 13:11 | 1.2K | CLAREMONT BANK (KTTTREDGE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.1.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.2.html | 2013-12-16 13:11 | 1.2K | CLARENCE, The (BERSEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.3.html | 2013-12-16 13:11 | 1.2K | CLARENDON (LEWIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.3.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.4.html | 2013-12-16 13:11 | 1.3K | The CLARION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.4.pdf | 2011-11-01 09:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.5.html | 2013-12-16 13:11 | 3.1K | The CLARION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.5.pdf | 2011-11-01 09:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.6.html | 2013-12-16 13:11 | 1.2K | CLARISSA ANN, The (GRIGG v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.6.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.7.html | 2013-12-16 13:11 | 1.3K | Case of CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.7.pdf | 2011-11-01 09:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0832.8.html | 2013-12-16 13:11 | 9.2K | Ex parte CLARK., In re HEALEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0832.8.pdf | 2011-11-01 09:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0833.html | 2013-12-16 13:11 | 9.7K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0833.pdf | 2011-11-01 09:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0835.html | 2013-12-16 13:11 | 24K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0835.pdf | 2011-11-01 09:44 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0838.html | 2013-12-16 13:11 | 12K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0838.pdf | 2011-11-01 09:44 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0840.html | 2013-12-16 13:11 | 6.3K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0840.pdf | 2011-11-01 09:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0841.html | 2013-12-16 13:11 | 18K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0841.pdf | 2011-11-01 09:44 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0844.html | 2013-12-16 13:11 | 15K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0844.pdf | 2011-11-01 09:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0846.html | 2013-12-16 13:11 | 15K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0846.pdf | 2011-11-01 09:44 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0848.1.html | 2013-12-16 13:11 | 1.3K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0848.1.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0848.2.html | 2013-12-16 13:11 | 8.7K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0848.2.pdf | 2011-11-01 09:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0850.1.html | 2013-12-16 13:11 | 4.4K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0850.1.pdf | 2011-11-01 09:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0850.2.html | 2013-12-16 13:11 | 8.0K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0850.2.pdf | 2011-11-01 09:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0851.html | 2013-12-16 13:11 | 6.9K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0851.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0852.html | 2013-12-16 13:11 | 7.9K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0852.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0853.html | 2013-12-16 13:11 | 9.8K | In re CLARK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0853.pdf | 2011-11-01 09:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0855.1.html | 2013-12-16 13:11 | 4.1K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0855.1.pdf | 2011-11-01 09:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0855.2.html | 2013-12-16 13:11 | 3.8K | In re CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0855.2.pdf | 2011-11-01 09:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0856.1.html | 2013-12-16 13:11 | 1.1K | CLARK (ABBE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0856.1.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0856.2.html | 2013-12-16 13:11 | 1.3K | CLABK v. BAILEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0856.2.pdf | 2011-11-01 09:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0856.3.html | 2013-12-16 13:11 | 17K | CLARK et al. v. BAILEY., WORK et al. v. BAILEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0856.3.pdf | 2011-11-01 09:44 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0858.1.html | 2013-12-16 13:11 | 1.2K | CLARK (BEECHER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0858.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0858.2.html | 2013-12-16 13:11 | 1.3K | CLARK v. BININGER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0858.2.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0858.3.html | 2013-12-16 13:11 | 1.2K | CLARK (BOWEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0858.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0858.4.html | 2013-12-16 13:11 | 30K | CLARK v. BURNHAM. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0858.4.pdf | 2011-11-01 09:44 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0863.html | 2013-12-16 13:11 | 9.1K | CLARK v. CHICAGO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0863.pdf | 2011-11-01 09:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0865.1.html | 2013-12-16 13:11 | 1.2K | CLARK (CORY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0865.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0865.2.html | 2013-12-16 13:11 | 1.2K | CLARK (CRABTREE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0865.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0865.3.html | 2013-12-16 13:11 | 2.8K | CLARK et al. v. CROPPER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0865.3.pdf | 2011-11-01 09:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0865.4.html | 2013-12-16 13:11 | 1.2K | CLARK (DELAWARE and; H. CANAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0865.4.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0865.5.html | 2013-12-16 13:11 | 17K | CLARK v. DICK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0865.5.pdf | 2011-11-01 09:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0867.html | 2013-12-16 13:11 | 1.2K | CLARK (DOXLE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0867.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0868.1.html | 2013-12-16 13:11 | 5.9K | CLARK v. The ELLEN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0868.1.pdf | 2011-11-01 09:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0868.2.html | 2013-12-16 13:11 | 7.0K | CLARK v. FORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0868.2.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0869.1.html | 2013-12-16 13:11 | 1.1K | CLARK v. FOSS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0869.1.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0869.2.html | 2013-12-16 13:11 | 1.1K | CLARK (GARRETSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0869.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0869.3.html | 2013-12-16 13:11 | 16K | CLARK et al. v. GIBBONEY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0869.3.pdf | 2011-11-01 09:44 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0872.html | 2013-12-16 13:11 | 16K | CLARK et al. v. GILBERT et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0872.pdf | 2011-11-01 09:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0874.1.html | 2013-12-16 13:11 | 1.2K | CLABK (GONG BELL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0874.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0874.2.html | 2013-12-16 13:11 | 1.2K | CLABK (GREENOUGH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0874.2.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0874.3.html | 2013-12-16 13:11 | 32K | CLARK v. HACKETT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0874.3.pdf | 2011-11-01 09:44 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0879.html | 2013-12-16 13:11 | 1.2K | CLARK (HARDY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0879.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0880.html | 2013-12-16 13:11 | 11K | CLARK v. ISELIN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0880.pdf | 2011-11-01 09:44 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0881.html | 2013-12-16 13:11 | 19K | CLARK v. ISELIN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0881.pdf | 2011-11-01 09:44 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0884.html | 2013-12-16 13:11 | 22K | CLARK v. KENNEDY MANUF;G CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0884.pdf | 2011-11-01 09:44 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0888.1.html | 2013-12-16 13:11 | 1.2K | CLARK (LANMON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0888.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0888.2.html | 2013-12-16 13:11 | 5.1K | CLARK et al. v. LAWRENCE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0888.2.pdf | 2011-11-01 09:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0888.3.html | 2013-12-16 13:11 | 6.5K | CLARK v. The LEOPARD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0888.3.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0889.html | 2013-12-16 13:11 | 53K | CLARK et al. v. MANUFACTURERS; INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0889.pdf | 2011-11-01 09:44 | 123K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0898.html | 2013-12-16 13:11 | 13K | CLARK v. MARX. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0898.pdf | 2011-11-01 09:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0900.1.html | 2013-12-16 13:11 | 1.1K | CLARK (NIETO v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0900.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0900.2.html | 2013-12-16 13:11 | 1.2K | CLARK (NORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0900.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0900.3.html | 2013-12-16 13:11 | 1.2K | CLARK (PACKWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0900.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0900.4.html | 2013-12-16 13:11 | 50K | CLARK et al. v. PEASLEE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0900.4.pdf | 2011-11-01 09:44 | 117K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0908.html | 2013-12-16 13:11 | 6.5K | CLARK v. PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0908.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0909.html | 2013-12-16 13:11 | 53K | CLARK et al. v. PROTECTION INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0909.pdf | 2011-11-01 09:44 | 126K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0917.1.html | 2013-12-16 13:11 | 1.2K | CLABK (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0917.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0917.2.html | 2013-12-16 13:11 | 34K | CLARK et al. v. SCOTT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0917.2.pdf | 2011-11-01 09:44 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0923.html | 2013-12-16 13:11 | 6.1K | CLARK v. SHELTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0923.pdf | 2011-11-01 09:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0924.html | 2013-12-16 13:11 | 7.8K | CLARK v. SHELTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0924.pdf | 2011-11-01 09:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0925.1.html | 2013-12-16 13:11 | 1.2K | CLARK (SHERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0925.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0925.2.html | 2013-12-16 13:11 | 1.2K | CLARK v. SICKEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0925.2.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0925.3.html | 2013-12-16 13:11 | 5.5K | CLARK v. SKILTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0925.3.pdf | 2011-11-01 09:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0925.4.html | 2013-12-16 13:11 | 1.2K | CLARK (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0925.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0925.5.html | 2013-12-16 13:11 | 20K | CLARK v. SOHIER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0925.5.pdf | 2011-11-01 09:44 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0928.html | 2013-12-16 13:11 | 11K | CLARK v. SPARHAWK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0928.pdf | 2011-11-01 09:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0930.1.html | 2013-12-16 13:11 | 1.2K | CLARK (THOMAS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0930.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0930.2.html | 2013-12-16 13:11 | 15K | CLARK v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0930.2.pdf | 2011-11-01 09:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0932.html | 2013-12-16 13:11 | 15K | CLARK v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0932.pdf | 2011-11-01 09:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0934.1.html | 2013-12-16 13:11 | 1.1K | CLARK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0934.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0934.2.html | 2013-12-16 13:11 | 1.2K | CLARK (WALLACE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0934.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0934.3.html | 2013-12-16 13:11 | 11K | CLABK v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0934.3.pdf | 2011-11-01 09:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0936.1.html | 2013-12-16 13:11 | 1.3K | CLARK v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0936.1.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0936.2.html | 2013-12-16 13:11 | 15K | CLARK v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0936.2.pdf | 2011-11-01 09:44 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0938.1.html | 2013-12-16 13:11 | 1.2K | CLARK, The JULIET C. v. WELSH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0938.1.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0938.2.html | 2013-12-16 13:11 | 5.5K | In re CLARKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0938.2.pdf | 2011-11-01 09:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0939.html | 2013-12-16 13:11 | 17K | In re CLABKE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0939.pdf | 2011-11-01 09:44 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0942.1.html | 2013-12-16 13:11 | 2.7K | In re CLARKE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0942.1.pdf | 2011-11-01 09:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0942.2.html | 2013-12-16 13:11 | 1.2K | CLARKE (BANK OF ALEXANDRIA v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0942.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0942.3.html | 2013-12-16 13:11 | 1.2K | CLARKE (BOONE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0942.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0942.4.html | 2013-12-16 13:11 | 1.2K | CLARKE (CASE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0942.4.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0942.5.html | 2013-12-16 13:11 | 8.9K | CLARKE et al. v. CHASE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0942.5.pdf | 2011-11-01 09:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0943.html | 2013-12-16 13:11 | 13K | CLARKE et al. v. CLARKE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0943.pdf | 2011-11-01 09:44 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0945.html | 2013-12-16 13:11 | 16K | CLARKE et al. v. CRABTREE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0945.pdf | 2011-11-01 09:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0948.html | 2013-12-16 13:11 | 6.7K | CLARKE v. CRAMER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0948.pdf | 2011-11-01 09:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0949.html | 2013-12-16 13:11 | 22K | CLARKE et al. v. The DODGE HEALY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0949.pdf | 2011-11-01 09:44 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0952.1.html | 2013-12-16 13:11 | 3.0K | CLARKE et al. v. DRUET. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0952.1.pdf | 2011-11-01 09:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0952.2.html | 2013-12-16 13:11 | 16K | CLARKE v. The FASHION. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0952.2.pdf | 2011-11-01 09:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0955.html | 2013-12-16 13:11 | 41K | CLARKE v. FOSS et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0955.pdf | 2011-11-01 09:44 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0961.html | 2013-12-16 13:11 | 1.3K | CLARKE v. HEMPSTONE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0961.pdf | 2011-11-01 09:44 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0962.html | 2013-12-16 13:11 | 20K | CLARKE v. JANESVILLE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0962.pdf | 2011-11-01 09:44 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0965.html | 2013-12-16 13:11 | 20K | CLARKE v. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0965.pdf | 2011-11-01 09:44 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0968.html | 2013-12-16 13:11 | 26K | CLARKE et al. v. JOHNSTON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0968.pdf | 2011-11-01 09:44 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0972.1.html | 2013-12-16 13:11 | 1.2K | CLARKE (KOUNSALAER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0972.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0972.2.html | 2013-12-16 13:11 | 1.2K | CLARKE (LORMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0972.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0972.3.html | 2013-12-16 13:11 | 1.2K | CLARICE (McCOMBER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0972.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0972.4.html | 2013-12-16 13:11 | 10K | CLARKE v. MATHEWSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0972.4.pdf | 2011-11-01 09:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0973.html | 2013-12-16 13:11 | 3.8K | CLARKE v. MAYFIELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0973.pdf | 2011-11-01 09:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0974.1.html | 2013-12-16 13:11 | 1.2K | CLARKE (NEVITT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0974.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0974.2.html | 2013-12-16 13:11 | 26K | CLARKE v. NEW JERSEY STEAM NAV. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0974.2.pdf | 2011-11-01 09:44 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0978.1.html | 2013-12-16 13:11 | 1.2K | CLARKE (ORME v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0978.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0978.2.html | 2013-12-16 13:11 | 1.2K | CLARKE (PELTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0978.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0978.3.html | 2013-12-16 13:11 | 1.3K | CLARKE v. PROTECTION INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0978.3.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0978.4.html | 2013-12-16 13:11 | 20K | CLARKE v. RIST et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0978.4.pdf | 2011-11-01 09:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0981.1.html | 2013-12-16 13:11 | 3.6K | CLARK v. SICKEL. FABNUM v. SAME. LEA v. LEEDS. SELLEBS v. SICKEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0981.1.pdf | 2011-11-01 09:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0981.2.html | 2013-12-16 13:11 | 1.2K | CLARKE (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0981.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0981.3.html | 2013-12-16 13:11 | 19K | CLABKE v. SOUTHWICK. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0981.3.pdf | 2011-11-01 09:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0984.html | 2013-12-16 13:11 | 15K | CLARKE v. STRICKLAND et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0984.pdf | 2011-11-01 09:44 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0987.1.html | 2013-12-16 13:11 | 1.2K | CLARKE (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0987.1.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0987.2.html | 2013-12-16 13:11 | 3.7K | CLARKE et al. v. THRELKELD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0987.2.pdf | 2011-11-01 09:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0987.3.html | 2013-12-16 13:11 | 1.1K | CLARKE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0987.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0987.4.html | 2013-12-16 13:11 | 1.1K | CLARKE (WHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0987.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0987.5.html | 2013-12-16 13:11 | 19K | CLABK PATENT STEAM and; FIRE REGULATOR CO v. COPELAND. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0987.5.pdf | 2011-11-01 09:44 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.1.html | 2013-12-16 13:11 | 1.6K | CLARKSON v. MANSON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.1.pdf | 2011-11-01 09:44 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.2.html | 2013-12-16 13:11 | 1.2K | CLARKSVILLE (GAUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.3.html | 2013-12-16 13:11 | 1.2K | CLARKSVILLE (NORTHWESTERN UNION PACKET CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.3.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.4.html | 2013-12-16 13:11 | 1.2K | CLARK THREAD CO. (WILLIMANTIC LINEN CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.5.html | 2013-12-16 13:11 | 1.2K | CLASEN (PHELPS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.5.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0990.6.html | 2013-12-16 13:11 | 7.5K | CLASON et al. v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0990.6.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0991.1.html | 2013-12-16 13:11 | 1.2K | CLAUDIUS (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0991.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0991.2.html | 2013-12-16 13:11 | 1.2K | CLAUSON (BREWERS; FIRE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0991.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0991.3.html | 2013-12-16 13:11 | 15K | CLAY v. McCALLY et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0991.3.pdf | 2011-11-01 09:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0994.1.html | 2013-12-16 13:11 | 5.8K | The CLAYTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0994.1.pdf | 2011-11-01 09:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0994.2.html | 2013-12-16 13:11 | 1.2K | CLAYTON (BATTEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0994.2.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0994.3.html | 2013-12-16 13:11 | 1.2K | CLAYTON (GRUBB v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0994.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0994.4.html | 2013-12-16 13:11 | 1.2K | CLAYTON (HAMMEKIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0994.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0994.5.html | 2013-12-16 13:11 | 30K | CLAYTON et al. v. The HARMONY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0994.5.pdf | 2011-11-01 09:44 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0999.1.html | 2013-12-16 13:11 | 1.2K | CLAYTON (HOUSER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0999.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0999.2.html | 2013-12-16 13:11 | 1.2K | CLAYTON (LE ROY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0999.2.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.0999.3.html | 2013-12-16 13:11 | 30K | CLAYTON et al. v. STONE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.0999.3.pdf | 2011-11-01 09:44 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1003.1.html | 2013-12-16 13:11 | 1.2K | CLAYTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1003.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1003.2.html | 2013-12-16 13:11 | 1.2K | C. L. B. REED, The (MANHATTAN FIRE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1003.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1003.3.html | 2013-12-16 13:11 | 1.3K | CLEARY v. MARTZ. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1003.3.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1003.4.html | 2013-12-16 13:11 | 30K | CLEAVELAND v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1003.4.pdf | 2011-11-01 09:44 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1008.1.html | 2013-12-16 13:11 | 1.2K | CLEAVELAND (TREADWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1008.1.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1008.2.html | 2013-12-16 13:11 | 1.2K | CLEAVER (FIRST NAT. BANK OF ASHLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1008.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1008.3.html | 2013-12-16 13:11 | 1.2K | CLEINS (ATLANTIC and; PAC. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1008.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1008.4.html | 2013-12-16 13:11 | 11K | The CLEMATIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1008.4.pdf | 2011-11-01 09:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1009.html | 2013-12-16 13:11 | 11K | The CLEMATIS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1009.pdf | 2011-11-01 09:44 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1011.html | 2013-12-16 13:11 | 12K | In re CLEMENS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1011.pdf | 2011-11-01 09:44 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1013.html | 2013-12-16 13:11 | 16K | In re CLEMENS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1013.pdf | 2011-11-01 09:44 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1015.html | 2013-12-16 13:11 | 19K | The CLEMENT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1015.pdf | 2011-11-01 09:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1018.html | 2013-12-16 13:11 | 9.6K | The CLEMENT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1018.pdf | 2011-11-01 09:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1020.html | 2013-12-16 13:11 | 14K | CLEMENT et al. v. PHOENIX INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1020.pdf | 2011-11-01 09:44 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1022.html | 2013-12-16 13:11 | 19K | CLEMENT et al. v. PHOENIX INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1022.pdf | 2011-11-01 09:44 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1025.1.html | 2013-12-16 13:11 | 1.2K | CLEMENT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1025.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1025.2.html | 2013-12-16 13:11 | 26K | CLEMENT;S EX;RS v. DICKEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1025.2.pdf | 2011-11-01 09:44 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.1.html | 2013-12-16 13:11 | 1.2K | CLEMENTS (MUDD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.1.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.2.html | 2013-12-16 13:11 | 1.2K | CLEMENTS (ODORLESS EXCAVATING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.2.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.3.html | 2013-12-16 13:11 | 1.2K | CLEMENTS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.4.html | 2013-12-16 13:11 | 2.6K | CLEMENTSON v. BEATTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.4.pdf | 2011-11-01 09:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.5.html | 2013-12-16 13:11 | 1.7K | CLEMENTSON v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.5.pdf | 2011-11-01 09:44 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.6.html | 2013-12-16 13:11 | 1.2K | CLEMSON (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.6.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1029.7.html | 2013-12-16 13:11 | 7.0K | The CLEOPATRA. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1029.7.pdf | 2011-11-01 09:44 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1030.1.html | 2013-12-16 13:11 | 1.3K | CLEOPATRA, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1030.1.pdf | 2011-11-01 09:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1030.2.html | 2013-12-16 13:11 | 1.2K | CLEVELAND, The (HUNT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1030.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1030.3.html | 2013-12-16 13:11 | 1.2K | CLEVELAND (BHOLEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1030.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1030.4.html | 2013-12-16 13:11 | 1.2K | CLEVELAND (DRAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1030.4.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1030.5.html | 2013-12-16 13:11 | 45K | CLEVELAND v. LA CROSSE and; M. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1030.5.pdf | 2011-11-01 09:44 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.1.html | 2013-12-16 13:11 | 4.5K | CLEVELAND v. TOWLE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.1.pdf | 2011-11-01 09:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.2.html | 2013-12-16 13:11 | 1.2K | CLEVELAND and; P. R. CO. (EVANS v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.3.html | 2013-12-16 13:11 | 1.2K | CLEVELAND CO-OPERATIVE STOVE CO. (HENDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.4.html | 2013-12-16 13:11 | 1.2K | CLEVELAND. C. and; C. R. CO. (TOPPAN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.5.html | 2013-12-16 13:11 | 1.2K | CLEVELAND INS. CO. (GLOBE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.5.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1038.6.html | 2013-12-16 13:11 | 35K | CLEVELAND INS. CO. v. REED et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1038.6.pdf | 2011-11-01 09:44 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1044.1.html | 2013-12-16 13:11 | 1.2K | CLEVELAND INS. CO. (STARKWEATHER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1044.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1044.2.html | 2013-12-16 13:11 | 23K | CLEVELAND, P. and; A. R. CO. v. FRANKLIN CANAL CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1044.2.pdf | 2011-11-01 09:44 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1047.1.html | 2013-12-16 13:11 | 1.2K | CLEVELAND ROLLING-MILL CO. (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1047.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1047.2.html | 2013-12-16 13:11 | 1.2K | CLEW (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1047.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1047.3.html | 2013-12-16 13:11 | 6.9K | In re CLEWS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1047.3.pdf | 2011-11-01 09:44 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1048.html | 2013-12-16 13:11 | 13K | CLEWS et al. v. LEE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1048.pdf | 2011-11-01 09:44 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1050.html | 2013-12-16 13:11 | 15K | In re CLIFFORD. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1050.pdf | 2011-11-01 09:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.1.html | 2013-12-16 13:11 | 1.2K | CLIFFORD (ARNOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.1.pdf | 2011-11-01 09:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.2.html | 2013-12-16 13:11 | 3.0K | CLIFFORD v. COLEMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.2.pdf | 2011-11-01 09:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.3.html | 2013-12-16 13:11 | 1.2K | CLIFFORD (MORRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.4.html | 2013-12-16 13:11 | 1.2K | CLIFFORD (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.4.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.5.html | 2013-12-16 13:11 | 1.2K | CLIFTON (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.5.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1053.6.html | 2013-12-16 13:11 | 9.8K | CLIFTON v. QUANTITY OF COTTON. SHELDON v. The WATER WITCH. BROWER et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1053.6.pdf | 2011-11-01 09:44 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1054.1.html | 2013-12-16 13:11 | 1.2K | CLIFTON v. QUANTITY OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1054.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1054.2.html | 2013-12-16 13:11 | 1.2K | CLINCH (MERRIAM v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1054.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1054.3.html | 2013-12-16 13:11 | 1.2K | CLINCH (ROPES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1054.3.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1054.4.html | 2013-12-16 13:11 | 7.8K | In re CLINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1054.4.pdf | 2011-11-01 09:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1055.html | 2013-12-16 13:11 | 1.3K | CLINE v. HULERY |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1055.pdf | 2011-11-01 09:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1056.1.html | 2013-12-16 13:11 | 1.2K | CLINTON (GROVER and; BAKER SEWING MACH. CO v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1056.1.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1056.2.html | 2013-12-16 13:11 | 8.3K | CLINTON v. The HANNAH, ETC. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1056.2.pdf | 2011-11-01 09:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1057.html | 2013-12-16 13:11 | 21K | CLINTON et al. v. MAYO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1057.pdf | 2011-11-01 09:44 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1060.1.html | 2013-12-16 13:11 | 1.2K | CLINTON (QUIRK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1060.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1060.2.html | 2013-12-16 13:11 | 1.2K | CLINTON and; S. R. CO. (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1060.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1060.3.html | 2013-12-16 13:11 | 35K | In re CLINTON BRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1060.3.pdf | 2011-11-01 09:44 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1066.1.html | 2013-12-16 13:11 | 1.2K | CLINTON LINE EXTENSION R. CO. (GRIFFIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1066.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1066.2.html | 2013-12-16 13:11 | 1.2K | CLINTON LINE R. CO. (LUDLOW v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1066.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1066.3.html | 2013-12-16 13:11 | 1.2K | CLIPPER MOWER. ETC., CO. (WHEELER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1066.3.pdf | 2011-11-01 09:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1066.4.html | 2013-12-16 13:11 | 13K | CLIPPINGER v. MISSOURI VAL. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1066.4.pdf | 2011-11-01 09:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1068.1.html | 2013-12-16 13:11 | 1.2K | CLOSE (LONGWORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1068.1.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1068.2.html | 2013-12-16 13:11 | 1.2K | CLOSE (RICH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1068.2.pdf | 2011-11-01 09:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1068.3.html | 2013-12-16 13:11 | 47K | The CLOTH CASES. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1068.3.pdf | 2011-11-01 09:45 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1075.html | 2013-12-16 13:11 | 43K | The CLOTILDA |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1075.pdf | 2011-11-01 09:45 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1083.html | 2013-12-16 13:11 | 20K | CLOUD v. HEWITT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1083.pdf | 2011-11-01 09:45 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1086.html | 2013-12-16 13:11 | 8.0K | In re CLOUGH. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1086.pdf | 2011-11-01 09:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1087.html | 2013-12-16 13:11 | 26K | CLOUGH v. GILBERT and; B. MANUF;G CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1087.pdf | 2011-11-01 09:45 | 416K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1087_01.jpg | 2011-07-18 14:04 | 34K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1087_02.jpg | 2011-07-18 14:03 | 35K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1087_03.jpg | 2011-07-18 14:03 | 6.9K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1087_04.jpg | 2011-07-18 14:03 | 35K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_01.jpg | 2011-07-18 14:04 | 20K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_02.jpg | 2011-07-18 14:03 | 21K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_03.jpg | 2011-07-18 14:03 | 21K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_04.jpg | 2011-07-18 14:03 | 19K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_05.jpg | 2011-07-18 14:03 | 23K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_06.jpg | 2011-07-18 14:03 | 21K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_07.jpg | 2011-07-18 14:04 | 20K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_08.jpg | 2011-07-18 14:04 | 26K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_09.jpg | 2011-07-18 14:04 | 22K | |
![[IMG]](/html/icons/compressed.gif) | 0005.f.cas.1088_10.jpg | 2011-07-18 14:04 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1091.1.html | 2013-12-16 13:11 | 1.2K | CLOUTMAN (SWEENEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1091.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1091.2.html | 2013-12-16 13:11 | 25K | CLOUTMAN v. TUNISON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1091.2.pdf | 2011-11-01 09:45 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1095.html | 2013-12-16 13:11 | 10K | The CLOVER. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1095.pdf | 2011-11-01 09:45 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1097.1.html | 2013-12-16 13:11 | 4.0K | CLOWSER v. JOPLIN MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1097.1.pdf | 2011-11-01 09:45 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1097.2.html | 2013-12-16 13:11 | 40K | CLUM v. BREWER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1097.2.pdf | 2011-11-01 09:45 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1103.html | 2013-12-16 13:11 | 7.0K | CLUM et al. v. BREWER et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1103.pdf | 2011-11-01 09:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1104.html | 2013-12-16 13:11 | 3.2K | CLUTE et al. v. GOODELL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1104.pdf | 2011-11-01 09:45 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1105.1.html | 2013-12-16 13:11 | 1.2K | CLYBURN (STRACHEN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1105.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1105.2.html | 2013-12-16 13:11 | 5.6K | CLYMER v. CENTRAL R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1105.2.pdf | 2011-11-01 09:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1106.html | 2013-12-16 13:11 | 36K | The CLYTIE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1106.pdf | 2011-11-01 09:45 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1111.1.html | 2013-12-16 13:11 | 1.3K | The CLYTIE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1111.1.pdf | 2011-11-01 09:45 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1111.2.html | 2013-12-16 13:11 | 1.2K | CLYTIE, The (HITCHCOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1111.2.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1111.3.html | 2013-12-16 13:11 | 1.2K | COAL BARGES (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1111.3.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.1.html | 2013-12-16 13:11 | 1.2K | COAL BLUFF NO. 2. The (HARTUPEE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.2.html | 2013-12-16 13:11 | 1.2K | COAL BLUFF NO. 2, The (McCASKEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.2.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.3.html | 2013-12-16 13:11 | 1.2K | COAL VALLEY, The (BAYARD, The, v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.3.pdf | 2011-11-01 09:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.4.html | 2013-12-16 13:11 | 5.1K | In re COAN and; TEN BROEKE MANUF;G CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.4.pdf | 2011-11-01 09:45 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.5.html | 2013-12-16 13:11 | 1.2K | COATES (DUNDORE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.5.pdf | 2011-11-01 09:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1112.6.html | 2013-12-16 13:11 | 22K | COATES v. MUSE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1112.6.pdf | 2011-11-01 09:45 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1116.html | 2013-12-16 13:11 | 27K | COATES v. MUSE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1116.pdf | 2011-11-01 09:45 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1120.html | 2013-12-16 13:11 | 21K | COATES v. MUSE et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1120.pdf | 2011-11-01 09:45 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1123.1.html | 2013-12-16 13:11 | 1.2K | COBANKS v. The MIDLAND. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1123.1.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1123.2.html | 2013-12-16 13:11 | 1.3K | COBANKS v. The ROSLYN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1123.2.pdf | 2011-11-01 09:45 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1123.3.html | 2013-12-16 13:11 | 14K | In re COBB. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1123.3.pdf | 2011-11-01 09:45 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1125.1.html | 2013-12-16 13:11 | 1.2K | COBB (BUCK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1125.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1125.2.html | 2013-12-16 13:11 | 19K | COBB et al. v. GLOBE MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1125.2.pdf | 2011-11-01 09:45 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1128.html | 2013-12-16 13:11 | 27K | COBB v. HAMLIN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1128.pdf | 2011-11-01 09:45 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1132.html | 2013-12-16 13:11 | 7.0K | COBB v. HAYDOCK et. al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1132.pdf | 2011-11-01 09:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1133.html | 2013-12-16 13:11 | 7.1K | COBB v. HOWARD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1133.pdf | 2011-11-01 09:45 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1134.html | 2013-12-16 13:11 | 34K | COBB v. HOWARD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1134.pdf | 2011-11-01 09:45 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.1.html | 2013-12-16 13:11 | 1.1K | COBB (HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.2.html | 2013-12-16 13:11 | 1.2K | COBB (HOWE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.2.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.3.html | 2013-12-16 13:11 | 1.2K | COBB (McCLOSKEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.3.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.4.html | 2013-12-16 13:11 | 1.2K | COBB (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.4.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.5.html | 2013-12-16 13:11 | 1.2K | COBIN (OWSLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.5.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1140.6.html | 2013-12-16 13:11 | 12K | COBLENS v. ABEL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1140.6.pdf | 2011-11-01 09:45 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1141.html | 2013-12-16 13:11 | 1.3K | COBLIDGE v. GUTHRIE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1141.pdf | 2011-11-01 09:45 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1142.1.html | 2013-12-16 13:11 | 1.2K | COBURN (CROPPER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1142.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1142.2.html | 2013-12-16 13:11 | 1.2K | COCHECO MANUF;G CO (SPRAGUE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1142.2.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1142.3.html | 2013-12-16 13:11 | 1.2K | COCHRAN (GERNON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1142.3.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1142.4.html | 2013-12-16 13:11 | 1.2K | COCHRAN (LAKE SHORE and; M. S. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1142.4.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1142.5.html | 2013-12-16 13:11 | 15K | COCHRAN v. McLEAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1142.5.pdf | 2011-11-01 09:45 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1144.1.html | 2013-12-16 13:11 | 1.2K | COCHRAN (SPARHAWK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1144.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1144.2.html | 2013-12-16 13:11 | 1.2K | COCHRAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1144.2.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1144.3.html | 2013-12-16 13:11 | 1.2K | COCHRANE (BADISCHE ANILIN and; SODA FABRIK v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1144.3.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1144.4.html | 2013-12-16 13:11 | 9.6K | COCHRANE v. SWARTOUT. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1144.4.pdf | 2011-11-01 09:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1145.html | 2013-12-16 13:11 | 17K | COCHRANE v. WATERMAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1145.pdf | 2011-11-01 09:45 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1148.html | 2013-12-16 13:11 | 6.9K | COCKE v. HENSON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1148.pdf | 2011-11-01 09:45 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1149.html | 2013-12-16 13:11 | 6.2K | COCKE v. KENDALL. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1149.pdf | 2011-11-01 09:45 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1150.1.html | 2013-12-16 13:11 | 1.2K | COOKE (MUNROE v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1150.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1150.2.html | 2013-12-16 13:11 | 6.2K | COCKER et al. v. FRANKLIN HEMP and; BAGGING CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1150.2.pdf | 2011-11-01 09:45 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1151.html | 2013-12-16 13:11 | 9.0K | COCKER et al. v. FRANKLIN HEMP and; BAGGING CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1151.pdf | 2011-11-01 09:45 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1152.html | 2013-12-16 13:11 | 12K | COCKER et al. v. FRANKLIN HEMP and; FLAX MANUF;G CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1152.pdf | 2011-11-01 09:45 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.1.html | 2013-12-16 13:11 | 1.2K | COCKERILL (CONNER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.2.html | 2013-12-16 13:11 | 1.2K | COOKREM (BIRD v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.2.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.3.html | 2013-12-16 13:11 | 1.2K | COCKRIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.3.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.4.html | 2013-12-16 13:11 | 1.2K | COCKRUN v. McLEAN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.4.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.5.html | 2013-12-16 13:11 | 3.0K | In re COCKS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.5.pdf | 2011-11-01 09:45 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1154.6.html | 2013-12-16 13:11 | 17K | COCKS v. IZARD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1154.6.pdf | 2011-11-01 09:45 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1157.1.html | 2013-12-16 13:11 | 1.2K | CODDINGTON (HATCH v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1157.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1157.2.html | 2013-12-16 13:11 | 1.2K | CODMAN (ROBISON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1157.2.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1157.3.html | 2013-12-16 13:11 | 30K | CODMAN et al. v. VERMONT and; C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1157.3.pdf | 2011-11-01 09:45 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1162.html | 2013-12-16 13:11 | 11K | CODMAN et al. v. VERMONT and; C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1162.pdf | 2011-11-01 09:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1163.html | 2013-12-16 13:11 | 8.0K | CODRINGTON v. ADAMS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1163.pdf | 2011-11-01 09:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1164.html | 2013-12-16 13:11 | 17K | CODWISE et al. v. GLEASON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1164.pdf | 2011-11-01 09:45 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1167.html | 2013-12-16 13:11 | 8.8K | CODWISE et al. v. GLEASON et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1167.pdf | 2011-11-01 09:45 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1168.html | 2013-12-16 13:11 | 12K | CODY v. CENTRAL PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1168.pdf | 2011-11-01 09:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1170.html | 2013-12-16 13:11 | 11K | COE v. BEADLEY. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1170.pdf | 2011-11-01 09:45 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1172.1.html | 2013-12-16 13:11 | 1.2K | COE (KEYSER v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1172.1.pdf | 2011-11-01 09:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1172.2.html | 2013-12-16 13:11 | 38K | COE v. PENNOCK et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1172.2.pdf | 2011-10-29 16:23 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1178.html | 2013-12-16 13:11 | 7.8K | COE v. RANKIN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1178.pdf | 2011-11-01 09:45 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1179.1.html | 2013-12-16 13:11 | 2.6K | COELLE v. LOEKHEAD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1179.1.pdf | 2011-11-01 09:45 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1179.2.html | 2013-12-16 13:11 | 25K | The COERNINE. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1179.2.pdf | 2011-11-01 09:45 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1183.html | 2013-12-16 13:11 | 4.8K | COFFEE v. EASTLAND. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1183.pdf | 2011-11-01 09:45 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1184.html | 2013-12-16 13:11 | 15K | COFFEEN v. BRUNTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1184.pdf | 2011-11-01 09:45 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1186.html | 2013-12-16 13:11 | 12K | COFPEEN v. BBUNTON. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1186.pdf | 2011-11-01 09:45 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1188.1.html | 2013-12-16 13:11 | 1.2K | COFFIN (GODDAED v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1188.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1188.2.html | 2013-12-16 13:11 | 30K | COFFIN v. JENKINS. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1188.2.pdf | 2011-11-01 09:45 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1193.html | 2013-12-16 13:11 | 17K | COFFIN et al. v. The JOHN SHAW. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1193.pdf | 2011-11-01 09:45 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1195.html | 2013-12-16 13:11 | 29K | COFFIN v. OGDEN et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1195.pdf | 2011-11-01 09:45 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1200.1.html | 2013-12-16 13:11 | 1.1K | COFFIN (PAYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1200.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1200.2.html | 2013-12-16 13:11 | 8.4K | COFFIN v. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1200.2.pdf | 2011-10-29 16:24 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1201.html | 2013-12-16 13:11 | 12K | COFFIN v. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1201.pdf | 2011-10-29 16:24 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1203.1.html | 2013-12-16 13:11 | 1.2K | COFFIN (SWEENEY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1203.1.pdf | 2011-11-01 09:45 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1203.2.html | 2013-12-16 13:11 | 1.1K | COFFIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1203.2.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1203.3.html | 2013-12-16 13:11 | 15K | COFFIN v. WELD et al. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1203.3.pdf | 2011-10-29 16:24 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1205.1.html | 2013-12-16 13:11 | 1.2K | COFFIN (WIGGIN v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1205.1.pdf | 2011-11-01 09:45 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1205.2.html | 2013-12-16 13:11 | 1.2K | COFFIN v. The WITCH QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1205.2.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.1205.3.html | 2013-12-16 13:11 | 1.2K | COFFMAN (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.1205.3.pdf | 2011-11-01 09:45 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.back.html | 2013-12-16 13:11 | 251K | Federal Cases, Volume 5 |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.back.pdf | 2011-10-29 16:24 | 198K | |
![[Text]](/html/icons/compressed.gif) | 0005.f.cas.front.html | 2013-12-16 13:11 | 2.5K | Federal Cases, Volume 5 |
![[ ]](/html/icons/compressed.gif) | 0005.f.cas.front.pdf | 2011-10-31 12:09 | 37K | |
|