![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.000b_01.jpg | 2011-03-07 16:28 | 1.1K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0001.html | 2013-12-16 13:14 | 12K | Ex parte MENDELL., In re BUTLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0001.pdf | 2011-11-01 10:30 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0003.html | 2013-12-16 13:14 | 9.8K | MENDELL v. The MARTIN WHITE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0003.pdf | 2011-11-01 10:30 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0004.html | 2013-12-16 13:14 | 19K | In re MENDELSOHN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0004.pdf | 2011-11-01 10:30 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0007.1.html | 2013-12-16 13:14 | 4.9K | MENDELSOHN v. The LOUISIANA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0007.1.pdf | 2011-11-01 10:30 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0007.2.html | 2013-12-16 13:14 | 1.2K | MENDELSOHN (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0007.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0008.1.html | 2013-12-16 13:14 | 1.2K | In re MENDENHALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0008.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0008.2.html | 2013-12-16 13:14 | 9.1K | In re MENDENHALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0008.2.pdf | 2011-11-01 10:30 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0009.html | 2013-12-16 13:14 | 6.7K | In re MENDENHALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0009.pdf | 2011-11-01 10:30 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0010.html | 2013-12-16 13:14 | 12K | In re MENDENHALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0010.pdf | 2011-11-01 10:30 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0012.html | 2013-12-16 13:14 | 20K | MENDENHALL v. CARTER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0012.pdf | 2011-11-01 10:30 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0015.1.html | 2013-12-16 13:14 | 1.2K | MENEDGER (HOPKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0015.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0015.2.html | 2013-12-16 13:14 | 1.2K | MENEDGER (MATTHEWS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0015.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0015.3.html | 2013-12-16 13:14 | 41K | The MENTOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0015.3.pdf | 2011-11-01 10:30 | 104K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0021.html | 2013-12-16 13:14 | 9.2K | The MENTOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0021.pdf | 2011-11-01 10:30 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0023.html | 2013-12-16 13:14 | 13K | MENZELL v. CHICAGO & N. W. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0023.pdf | 2011-11-01 10:30 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0025.1.html | 2013-12-16 13:14 | 2.6K | MENZIES v. The AGNES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0025.1.pdf | 2011-11-01 10:30 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0025.2.html | 2013-12-16 13:14 | 1.2K | MEPHAM (BISSELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0025.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0025.3.html | 2013-12-16 13:14 | 1.2K | MERCANTILE INS. CO. (FOLSOM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0025.3.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0025.4.html | 2013-12-16 13:14 | 3.7K | MERCANTILE INS. CO. v. The ORPHAN BOY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0025.4.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0025.5.html | 2013-12-16 13:14 | 25K | MERCANTILE TRUST CO. v. LAMOILLE VAL. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0025.5.pdf | 2011-11-01 10:30 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0029.1.html | 2013-12-16 13:14 | 1.2K | MERCED MINING CO. (FREMONT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0029.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0029.2.html | 2013-12-16 13:14 | 1.2K | MERCEIN (BARRY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0029.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0029.3.html | 2013-12-16 13:14 | 1.2K | MERCER (BARTLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0029.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0029.4.html | 2013-12-16 13:14 | 15K | MERCER v. The FLORIDA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0029.4.pdf | 2011-11-01 10:30 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0031.1.html | 2013-12-16 13:14 | 1.2K | MERCER (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0031.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0031.2.html | 2013-12-16 13:14 | 1.2K | MERCER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0031.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0031.3.html | 2013-12-16 13:14 | 22K | The MERCHANT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0031.3.pdf | 2011-11-01 10:30 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0035.html | 2013-12-16 13:14 | 8.1K | The MERCHANT., ACOSTA et al. v. The MERCHANT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0035.pdf | 2011-11-01 10:30 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0036.html | 2013-12-16 13:14 | 6.9K | The MERCHANT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0036.pdf | 2011-11-01 10:30 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0037.html | 2013-12-16 13:14 | 7.1K | MERCHANT et al. v. LEWIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0037.pdf | 2011-11-01 10:30 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0038.1.html | 2013-12-16 13:14 | 1.2K | MERCHANT (RUTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0038.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0038.2.html | 2013-12-16 13:14 | 11K | MERCHANTS' & MANUFACTURERS' BANK v. STAFFORD NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0038.2.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0040.1.html | 2013-12-16 13:14 | 6.8K | MERCHANTS' & MANUFACTURERS' NAT. BANK v. WHEELER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0040.1.pdf | 2011-11-01 10:30 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0040.2.html | 2013-12-16 13:14 | 1.2K | MERCHANTS', ETC., BANK (SANDY RIVER BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0040.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0040.3.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' BANK OF NEW ORLEANS v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0040.3.pdf | 2011-11-01 10:30 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0040.4.html | 2013-12-16 13:14 | 1.3K | MERCHANT SERVICE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0040.4.pdf | 2011-11-01 10:30 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0040.5.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' FIRE INS. CO. (HUCHBERGER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0040.5.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0041.html | 2013-12-16 13:14 | 18K | In re MERCHANTS' INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0041.pdf | 2011-11-01 10:30 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0043.html | 2013-12-16 13:14 | 17K | In re MERCHANTS' INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0043.pdf | 2011-11-01 10:30 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0046.html | 2013-12-16 13:14 | 11K | MERCHANTS' INS. CO. v. McCARTNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0046.pdf | 2011-11-01 10:30 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0047.1.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' INS. CO. (PEELE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0047.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0047.2.html | 2013-12-16 13:14 | 3.8K | MERCHANTS' INS. CO. v. SELLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0047.2.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0048.1.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' LOUISVILLE INS. CO. (WATERS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0048.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0048.2.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' MUT. LIFE INS. CO. v. The RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0048.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0048.3.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' NAT. BANK v. CHICAGO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0048.3.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0048.4.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' NAT. BANK v. JEFFERSON COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0048.4.pdf | 2011-11-01 10:30 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0048.5.html | 2013-12-16 13:14 | 25K | MERCHANTS' NAT. BANK v. LITTLE ROCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0048.5.pdf | 2011-11-01 10:30 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0052.1.html | 2013-12-16 13:14 | 5.0K | MERCHANTS' NAT. BANK v. NATIONAL BANK OF COMMERCE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0052.1.pdf | 2011-11-01 10:30 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0052.2.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' NAT. BANK v. PAPIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0052.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0053.1.html | 2013-12-16 13:14 | 1.4K | MERCHANTS' NAT. BANK v. VALLEY BANK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0053.1.pdf | 2011-11-01 10:30 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0053.2.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' NAT. BANK (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0053.2.pdf | 2011-11-01 10:30 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0053.3.html | 2013-12-16 13:14 | 12K | MERCHANTS' NAT. BANK OF BOSTON v. STATE NAT. BANK OF BOSTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0053.3.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0054.html | 2013-12-16 13:14 | 17K | MERCHANTS' NAT. BANK OF BOSTON v. STATE NAT. BANK OF BOSTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0054.pdf | 2011-11-01 10:30 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0057.html | 2013-12-16 13:14 | 9.9K | MERCHANTS' NAT. BANK OF CHICAGO v. MEARS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0057.pdf | 2011-11-01 10:30 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0058.html | 2013-12-16 13:14 | 6.8K | MERCHANTS' NAT. BANK OF HASTINGS v. TRUAX. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0058.pdf | 2011-11-01 10:30 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0059.html | 2013-12-16 13:14 | 7.4K | MERCHANTS' NAT. BANK OF LOWELL v. LELAND et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0059.pdf | 2011-11-01 10:30 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0060.1.html | 2013-12-16 13:14 | 1.2K | MERCHANTS' NAT. BANK OF ST. LOUIS v. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0060.1.pdf | 2011-11-01 10:30 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0060.2.html | 2013-12-16 13:14 | 6.0K | MERCHANTS' NAT. BANK OF TOLEDO v. CUMMING. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0060.2.pdf | 2011-11-01 10:30 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0061.html | 2013-12-16 13:14 | 6.3K | MERCHANTS' TRANSP. CO. v. The NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0061.pdf | 2011-11-01 10:30 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0062.html | 2013-12-16 13:14 | 11K | MERCIER v. LACHENMEYER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0062.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0063.html | 2013-12-16 13:14 | 4.1K | The MERCURY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0063.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0064.html | 2013-12-16 13:14 | 22K | MERCY v. OHIO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0064.pdf | 2011-11-01 10:30 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.1.html | 2013-12-16 13:14 | 1.2K | MEREDITH (BANK OF NORTH AMERICA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.2.html | 2013-12-16 13:14 | 1.2K | MEREDITH (CHOATE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.3.html | 2013-12-16 13:14 | 1.2K | MEREDITH (LEWIS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.4.html | 2013-12-16 13:14 | 1.2K | MEREDITH (SPEIGLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.4.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.5.html | 2013-12-16 13:14 | 1.2K | MERIDEN BRITANNIA CO. (STRONG MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.5.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0067.6.html | 2013-12-16 13:14 | 4.3K | In re MERKLE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0067.6.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0068.1.html | 2013-12-16 13:14 | 4.1K | The MERMAID. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0068.1.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0068.2.html | 2013-12-16 13:14 | 1.2K | MERMAID, The (BRITISH CONSUL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0068.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0068.3.html | 2013-12-16 13:14 | 22K | MERRIAM v. CLINCH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0068.3.pdf | 2011-11-01 10:30 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0072.html | 2013-12-16 13:14 | 15K | MERRIAM et al. v. DRAKE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0072.pdf | 2011-11-01 10:30 | 65K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.0072_01.jpg | 2011-04-04 15:46 | 8.3K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0074.1.html | 2013-12-16 13:14 | 1.2K | MERRIAM (KITTLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0074.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0074.2.html | 2013-12-16 13:14 | 1.2K | MERRIAM (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0074.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0074.3.html | 2013-12-16 13:14 | 5.7K | MERRIAM et al. v. VAN NEST et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0074.3.pdf | 2011-11-01 10:30 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0075.html | 2013-12-16 13:14 | 21K | In re MERRICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0075.pdf | 2011-11-01 10:30 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0078.html | 2013-12-16 13:14 | 11K | MERRICK v. BERNARD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0078.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0080.1.html | 2013-12-16 13:14 | 1.2K | MERRICK COUNTY (UNION PAC. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0080.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0080.2.html | 2013-12-16 13:14 | 6.0K | In re MERRIFIELD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0080.2.pdf | 2011-11-01 10:30 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0080.3.html | 2013-12-16 13:14 | 1.2K | MERRIL (SOHIER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0080.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0080.4.html | 2013-12-16 13:14 | 7.8K | In re MERRILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0080.4.pdf | 2011-11-01 10:30 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0082.html | 2013-12-16 13:14 | 12K | In re MERRILL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0082.pdf | 2011-11-01 10:30 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0083.1.html | 2013-12-16 13:14 | 1.2K | MERRILL (AIREY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0083.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0083.2.html | 2013-12-16 13:14 | 16K | MERRILL v. AREY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0083.2.pdf | 2011-11-01 10:30 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0086.html | 2013-12-16 13:14 | 124K | MERRILL v. DAWSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0086.pdf | 2011-11-01 10:30 | 254K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0105.1.html | 2013-12-16 13:14 | 1.2K | MERRILL (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0105.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0105.2.html | 2013-12-16 13:14 | 1.2K | MERRILL (ORR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0105.2.pdf | 2011-11-01 10:30 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0105.3.html | 2013-12-16 13:14 | 1.2K | MERRILL (PETTY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0105.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0105.4.html | 2013-12-16 13:14 | 26K | MERRILL v. PORTLAND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0105.4.pdf | 2011-11-01 10:30 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0109.html | 2013-12-16 13:14 | 22K | MERRILL et al. v. RINKER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0109.pdf | 2011-11-01 10:30 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0113.1.html | 2013-12-16 13:14 | 1.2K | MERRILL (SUFFOLK BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0113.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0113.2.html | 2013-12-16 13:14 | 1.2K | MERRILL (WATERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0113.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0113.3.html | 2013-12-16 13:14 | 27K | MERRILL v. YEOMANS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0113.3.pdf | 2011-11-01 10:30 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0117.html | 2013-12-16 13:14 | 18K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0117.pdf | 2011-11-01 10:30 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0120.html | 2013-12-16 13:14 | 7.4K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0120.pdf | 2011-11-01 10:30 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0121.1.html | 2013-12-16 13:14 | 4.7K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0121.1.pdf | 2011-11-01 10:30 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0121.2.html | 2013-12-16 13:14 | 5.6K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0121.2.pdf | 2011-11-01 10:30 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0122.html | 2013-12-16 13:14 | 27K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0122.pdf | 2011-11-01 10:30 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0126.html | 2013-12-16 13:14 | 28K | The MERRIMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0126.pdf | 2011-11-01 10:30 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0131.1.html | 2013-12-16 13:14 | 1.2K | MERRIMAC, The (FORBES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0131.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0131.2.html | 2013-12-16 13:14 | 1.2K | MERRIMAC HAT CO. (SANFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0131.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0131.3.html | 2013-12-16 13:14 | 1.3K | MERRIMACK: MANUF'G CO. (UNITED STATES & FOREIGN SALAMANDER FELTING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0131.3.pdf | 2011-11-01 10:30 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0131.4.html | 2013-12-16 13:14 | 18K | In re MERRIMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0131.4.pdf | 2011-11-01 10:30 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0133.html | 2013-12-16 13:14 | 14K | MERRIMAN v. BOURNE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0133.pdf | 2011-11-01 10:30 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0136.html | 2013-12-16 13:14 | 26K | MERRIMAN v. The MAY QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0136.pdf | 2011-11-01 10:30 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0140.1.html | 2013-12-16 13:14 | 1.3K | In re MERRITT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0140.1.pdf | 2011-11-01 10:30 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0140.2.html | 2013-12-16 13:14 | 3.6K | MERRITT et al. v. BREWER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0140.2.pdf | 2011-11-01 10:30 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0140.3.html | 2013-12-16 13:14 | 1.2K | MERRITT (FORSAITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0140.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0140.4.html | 2013-12-16 13:14 | 1.2K | MERRITT v. The J. B. LUNT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0140.4.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0140.5.html | 2013-12-16 13:14 | 13K | MERRITT et al. v. SACKETT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0140.5.pdf | 2011-11-01 10:30 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0142.1.html | 2013-12-16 13:14 | 1.2K | MERRITT HUNT, The (LUTHER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0142.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0142.2.html | 2013-12-16 13:14 | 13K | MERRIWETHER v. SALINE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0142.2.pdf | 2011-11-01 10:30 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0144.1.html | 2013-12-16 13:14 | 1.2K | MERRY (BUFFUM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0144.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0144.2.html | 2013-12-16 13:14 | 4.4K | MERRYFIELD et al. v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0144.2.pdf | 2011-11-01 10:30 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0144.3.html | 2013-12-16 13:14 | 51K | Ex parte MERRYMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0144.3.pdf | 2011-11-01 10:30 | 121K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0153.1.html | 2013-12-16 13:14 | 1.2K | MERS (CONOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0153.1.pdf | 2011-11-01 10:30 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0153.2.html | 2013-12-16 13:14 | 17K | MERSEROLE et al. v. UNION PAPER COLLAR CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0153.2.pdf | 2011-11-01 10:30 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0155.html | 2013-12-16 13:14 | 26K | The MERSEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0155.pdf | 2011-11-01 10:30 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0159.html | 2013-12-16 13:14 | 3.8K | The MERSEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0159.pdf | 2011-11-01 10:30 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0160.html | 2013-12-16 13:14 | 6.8K | MESA v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0160.pdf | 2011-11-01 10:30 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0161.1.html | 2013-12-16 13:14 | 5.7K | MESA v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0161.1.pdf | 2011-11-01 10:30 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0161.2.html | 2013-12-16 13:14 | 42K | MESNER et al. v. SUFFOLK BANK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0161.2.pdf | 2011-11-01 10:30 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0168.1.html | 2013-12-16 13:14 | 1.2K | MESRITZ (CHUCK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0168.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0168.2.html | 2013-12-16 13:14 | 1.2K | MESSENA v. The A. B. NEILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0168.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0168.3.html | 2013-12-16 13:14 | 15K | MESSENA et al. v. The NEILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0168.3.pdf | 2011-11-01 10:30 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0170.1.html | 2013-12-16 13:14 | 1.2K | MESSENGER, The (SMALL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0170.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0170.2.html | 2013-12-16 13:14 | 1.2K | MESSER (SANFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0170.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0170.3.html | 2013-12-16 13:14 | 5.4K | MESSEREAU v. The SOPHIA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0170.3.pdf | 2011-11-01 10:30 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0171.1.html | 2013-12-16 13:14 | 1.2K | MESSERSMITH (McVEIGH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0171.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0171.2.html | 2013-12-16 13:14 | 1.2K | MESSINGER (CARTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0171.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0171.3.html | 2013-12-16 13:14 | 1.2K | MESSMORE (TRADER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0171.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0171.4.html | 2013-12-16 13:14 | 6.4K | METAL STAMPING CO. v. CRANDALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0171.4.pdf | 2011-11-01 10:30 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0172.html | 2013-12-16 13:14 | 6.5K | In re METCALF et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0172.pdf | 2011-11-01 10:30 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0173.html | 2013-12-16 13:14 | 6.8K | METCALF v. DAVIES SCREW CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0173.pdf | 2011-11-01 10:30 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0174.html | 2013-12-16 13:14 | 20K | METCALF v. OFFICER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0174.pdf | 2011-11-01 10:30 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0177.html | 2013-12-16 13:14 | 6.7K | METCALF v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0177.pdf | 2011-11-01 10:30 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0178.html | 2013-12-16 13:14 | 182K | The METEOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0178.pdf | 2011-11-01 10:30 | 374K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0206.1.html | 2013-12-16 13:14 | 1.2K | METEOR. The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0206.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0206.2.html | 2013-12-16 13:14 | 12K | The METIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0206.2.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0208.html | 2013-12-16 13:14 | 8.5K | The METIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0208.pdf | 2011-11-01 10:30 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0209.html | 2013-12-16 13:14 | 29K | The METROPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0209.pdf | 2011-11-01 10:30 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0214.html | 2013-12-16 13:14 | 11K | The METROPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0214.pdf | 2011-11-01 10:30 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0216.html | 2013-12-16 13:14 | 13K | The METROPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0216.pdf | 2011-11-01 10:30 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0218.1.html | 2013-12-16 13:14 | 1.2K | The METROPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0218.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0218.2.html | 2013-12-16 13:14 | 1.2K | METROPOLIS, The (BANKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0218.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0218.3.html | 2013-12-16 13:14 | 30K | METROPOLITAN LIFE INS. CO. v. HARPER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0218.3.pdf | 2011-11-01 10:30 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0223.1.html | 2013-12-16 13:14 | 1.2K | METROPOLITAN NAT. BANK (EVANSVILLE NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0223.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0223.2.html | 2013-12-16 13:14 | 12K | METROPOLITAN R. CO. v. SLACK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0223.2.pdf | 2011-11-01 10:30 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0224.1.html | 2013-12-16 13:14 | 1.3K | METROPOLITAN R. R. CO. (RUBBER STEP MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0224.1.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0224.2.html | 2013-12-16 13:14 | 1.2K | METROPOLITAN WASHING—MACH. CO. v. EARLE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0224.2.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0224.3.html | 2013-12-16 13:14 | 17K | METROPOLITAN WASHING—MACH. CO. v. PROVIDENCE TOOL CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0224.3.pdf | 2011-11-01 10:30 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0227.html | 2013-12-16 13:14 | 13K | METROPOLITAN WRINGING MACH. CO. v. YOUNG et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0227.pdf | 2011-11-01 10:30 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0229.html | 2013-12-16 13:14 | 14K | In re METZ et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0229.pdf | 2011-11-01 10:30 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0231.html | 2013-12-16 13:14 | 4.7K | In re METZGER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0231.pdf | 2011-11-01 10:30 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0232.html | 2013-12-16 13:14 | 53K | In re METZGER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0232.pdf | 2011-11-01 10:30 | 126K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0240.html | 2013-12-16 13:14 | 11K | In re METZLER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0240.pdf | 2011-11-01 10:30 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0242.html | 2013-12-16 13:14 | 8.6K | MEWSTER v. SPALDING. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0242.pdf | 2011-11-01 10:30 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0243.html | 2013-12-16 13:14 | 5.5K | MEXICO SOUTH. BANK v. REED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0243.pdf | 2011-11-01 10:30 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0244.1.html | 2013-12-16 13:14 | 4.6K | In re MEYER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0244.1.pdf | 2011-11-01 10:30 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0244.2.html | 2013-12-16 13:14 | 14K | MEYER et al. v. BAILEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0244.2.pdf | 2011-11-01 10:30 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0246.1.html | 2013-12-16 13:14 | 1.2K | MEYER (BRAGG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0246.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0246.2.html | 2013-12-16 13:14 | 1.2K | MEYER (GRAHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0246.2.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0246.3.html | 2013-12-16 13:14 | 1.2K | MEYER (McNALLY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0246.3.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0246.4.html | 2013-12-16 13:14 | 1.2K | MEYER v. The NEWPORT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0246.4.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0246.5.html | 2013-12-16 13:14 | 16K | MEYER et al. v. PRITCHARD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0246.5.pdf | 2011-11-01 10:30 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0248.html | 2013-12-16 13:14 | 1.2K | MEYER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0248.pdf | 2011-11-01 10:30 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0249.html | 2013-12-16 13:14 | 12K | In re MEYERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0249.pdf | 2011-11-01 10:30 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0250.1.html | 2013-12-16 13:14 | 1.2K | MEYERS (ADAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0250.1.pdf | 2011-11-01 10:30 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0250.2.html | 2013-12-16 13:14 | 6.7K | MEYERS v. VALLEY NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0250.2.pdf | 2011-11-01 10:30 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0251.1.html | 2013-12-16 13:14 | 1.2K | MEYERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0251.1.pdf | 2011-11-01 10:30 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0251.2.html | 2013-12-16 13:14 | 15K | MEZES v. GREER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0251.2.pdf | 2011-11-01 10:31 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0253.html | 2013-12-16 13:14 | 1.2K | MIAMI COUNTY (PECK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0253.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0254.html | 2013-12-16 13:14 | 17K | The MIANTINOMI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0254.pdf | 2011-11-01 10:31 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0256.html | 2013-12-16 13:14 | 12K | The MICHAEL GROH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0256.pdf | 2011-11-01 10:31 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0258.html | 2013-12-16 13:14 | 6.3K | MICHAELSON v. DENISON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0258.pdf | 2011-11-01 10:31 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0259.1.html | 2013-12-16 13:14 | 1.2K | MICHELS v. JAMES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0259.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0259.2.html | 2013-12-16 13:14 | 15K | MICHENER v. PAYSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0259.2.pdf | 2011-11-01 10:31 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0261.1.html | 2013-12-16 13:14 | 1.3K | MICHENER v. PAYSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0261.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0261.2.html | 2013-12-16 13:14 | 1.2K | MICHENOR v. PAYSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0261.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0261.3.html | 2013-12-16 13:14 | 1.2K | MICHIGAN AIR LINE R. CO. (OSBORN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0261.3.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0261.4.html | 2013-12-16 13:14 | 6.3K | MICHIGAN CENTRAL R. CO. v. ANDES INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0261.4.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0262.1.html | 2013-12-16 13:14 | 1.2K | MICHIGAN CENT. R. CO. (KUTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0262.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0262.2.html | 2013-12-16 13:14 | 1.2K | MICHIGAN CENT. R. CO. (MYRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0262.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0262.3.html | 2013-12-16 13:14 | 1.2K | MICHIGAN CENT. R. CO. (NORTHERN INDIANA R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0262.3.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0262.4.html | 2013-12-16 13:14 | 6.2K | MICHIGAN CENT. R. CO. v. SLACK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0262.4.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0263.html | 2013-12-16 13:14 | 17K | MICHIGAN CENT. R. CO. v. SLACK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0263.pdf | 2011-11-01 10:31 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0265.html | 2013-12-16 13:14 | 15K | MICHIGAN INS. BANK v. ELDRED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0265.pdf | 2011-11-01 10:31 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.1.html | 2013-12-16 13:14 | 1.2K | MICHIGAN, L. S. R. CO. (KERP v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.2.html | 2013-12-16 13:14 | 1.2K | MICHIGAN MUT. LIFE INS. CO. (PRATHER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.3.html | 2013-12-16 13:14 | 1.3K | MICHIGAN SOUTHERN & NORTHERN INDIANA R. CO. (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.3.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.4.html | 2013-12-16 13:14 | 1.2K | MICHIGAN SOUTHERN R. CO. v. The HENDRIK HUDSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.4.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.5.html | 2013-12-16 13:14 | 1.2K | MICHIGAN STOVE CO. (DETROIT STOVE WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.5.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.6.html | 2013-12-16 13:14 | 1.2K | In re MICKEL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.6.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0268.7.html | 2013-12-16 13:14 | 24K | MICKEY v. STRATTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0268.7.pdf | 2011-11-01 10:31 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0271.1.html | 2013-12-16 13:14 | 1.2K | MICKEY v. WILLIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0271.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0271.2.html | 2013-12-16 13:14 | 1.2K | MICKLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0271.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0272.1.html | 2013-12-16 13:14 | 6.1K | MICKUM v. PAUL., MICKUM v. EDDS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0272.1.pdf | 2011-11-01 10:31 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0272.2.html | 2013-12-16 13:14 | 4.4K | The MIDAS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0272.2.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0273.html | 2013-12-16 13:14 | 11K | The MIDDLESEX. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0273.pdf | 2011-11-01 10:31 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0274.1.html | 2013-12-16 13:14 | 1.2K | MIDDLESEX CO. (WHIPPLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0274.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0274.2.html | 2013-12-16 13:14 | 1.2K | MIDDLETON (SHIELDS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0274.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0275.html | 2013-12-16 13:14 | 8.9K | MIDDLETON v. SINCLAIR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0275.pdf | 2011-11-01 10:31 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0276.1.html | 2013-12-16 13:14 | 1.2K | MIDDLETON (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0276.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0276.2.html | 2013-12-16 13:14 | 1.2K | MIDDLETON, The HENRY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0276.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0276.3.html | 2013-12-16 13:14 | 1.3K | MIDDLETOWN TOOL CO. v. FITCH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0276.3.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0276.4.html | 2013-12-16 13:14 | 16K | MIDDLETOWN TOOL CO. v. JUDD et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0276.4.pdf | 2011-11-01 10:31 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0278.html | 2013-12-16 13:14 | 5.0K | Ex parte MIFFLIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0278.pdf | 2011-11-01 10:31 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0279.1.html | 2013-12-16 13:14 | 1.2K | MIFFLIN (VASSE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0279.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0279.2.html | 2013-12-16 13:14 | 8.7K | In re MIGEL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0279.2.pdf | 2011-11-01 10:31 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0280.html | 2013-12-16 13:14 | 14K | MILAN DISTILLING CO. v. TILLSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0280.pdf | 2011-11-01 10:31 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0282.html | 2013-12-16 13:14 | 6.8K | MILBOURNE et al. v. The DANIEL AUGUSTA., VICKERS et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0282.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0283.1.html | 2013-12-16 13:14 | 2.7K | MILBURN v. BURTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0283.1.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0283.2.html | 2013-12-16 13:14 | 1.2K | MILBURN (CANNELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0283.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0283.3.html | 2013-12-16 13:14 | 1.2K | MILBURN (THECKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0283.3.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0283.4.html | 2013-12-16 13:14 | 1.2K | MILBURN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0283.4.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0283.5.html | 2013-12-16 13:14 | 5.6K | MILBURNE v. BYRNE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0283.5.pdf | 2011-11-01 10:31 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0284.1.html | 2013-12-16 13:14 | 2.3K | MILBURNE v. KEARNES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0284.1.pdf | 2011-11-01 10:31 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0284.2.html | 2013-12-16 13:14 | 1.2K | MILES (BLAGGE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0284.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0284.3.html | 2013-12-16 13:14 | 4.7K | MILES v. JAMES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0284.3.pdf | 2011-11-01 10:31 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0285.html | 2013-12-16 13:14 | 20K | MILES v. RECEIVERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0285.pdf | 2011-11-01 10:31 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0288.1.html | 2013-12-16 13:14 | 3.0K | MILES v. ROSE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0288.1.pdf | 2011-11-01 10:31 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0288.2.html | 2013-12-16 13:14 | 1.2K | MILES (SNOW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0288.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0288.3.html | 2013-12-16 13:14 | 1.2K | MILES (WILLINK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0288.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0288.4.html | 2013-12-16 13:14 | 5.0K | The MILETUS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0288.4.pdf | 2011-11-01 10:31 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0289.1.html | 2013-12-16 13:14 | 1.2K | MILETUS, The (WESTRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0289.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0289.2.html | 2013-12-16 13:14 | 1.2K | MILFORD (VARNUM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0289.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0289.3.html | 2013-12-16 13:14 | 6.9K | MILLAR, et al. v. MILLAR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0289.3.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0290.1.html | 2013-12-16 13:14 | 1.2K | MILLARD (BABCOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0290.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0290.2.html | 2013-12-16 13:14 | 2.4K | MILLARD v. CRAIG. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0290.2.pdf | 2011-11-01 10:31 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0290.3.html | 2013-12-16 13:14 | 4.2K | MILLARD et al. v. CRAIG et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0290.3.pdf | 2011-11-01 10:31 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0290.4.html | 2013-12-16 13:14 | 1.2K | MILLARD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0290.4.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0290.5.html | 2013-12-16 13:14 | 11K | MILLEDOLLAR v. BELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0290.5.pdf | 2011-11-01 10:31 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0292.html | 2013-12-16 13:14 | 8.0K | Ex parte MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0292.pdf | 2011-11-01 10:31 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0293.html | 2013-12-16 13:14 | 13K | In re MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0293.pdf | 2011-11-01 10:31 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0295.1.html | 2013-12-16 13:14 | 4.3K | In re MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0295.1.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0295.2.html | 2013-12-16 13:14 | 9.0K | In re MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0295.2.pdf | 2011-11-01 10:31 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0297.1.html | 2013-12-16 13:14 | 1.3K | In re MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0297.1.pdf | 2011-11-01 10:31 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0297.2.html | 2013-12-16 13:14 | 7.8K | In re MILLER. Ex parte MONSON SAVINGS BANK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0297.2.pdf | 2011-11-01 10:31 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0298.html | 2013-12-16 13:14 | 13K | In re MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0298.pdf | 2011-11-01 10:31 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0300.1.html | 2013-12-16 13:14 | 1.4K | MILLER'S APPLICATION. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0300.1.pdf | 2011-11-01 10:31 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0300.2.html | 2013-12-16 13:14 | 7.1K | MILLER'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0300.2.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0301.1.html | 2013-12-16 13:14 | 1.2K | MILLER (ADAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0301.1.pdf | 2011-11-01 10:31 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0301.2.html | 2013-12-16 13:14 | 1.2K | MILLER v. The ALICE GETTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0301.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0301.3.html | 2013-12-16 13:14 | 19K | MILLER v. ANDROSCOGGIN PULP CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0301.3.pdf | 2011-11-01 10:31 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0304.1.html | 2013-12-16 13:14 | 1.2K | MILLER (AUSTEN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0304.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0304.2.html | 2013-12-16 13:14 | 14K | MILLER v. BALTIMORE & O. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0304.2.pdf | 2011-11-01 10:31 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0306.1.html | 2013-12-16 13:14 | 3.6K | MILLER v. BALTIMORE & O. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0306.1.pdf | 2011-11-01 10:31 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0306.2.html | 2013-12-16 13:14 | 1.2K | MILLER (BANKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0306.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0306.3.html | 2013-12-16 13:14 | 1.2K | MILLER (BARGER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0306.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0306.4.html | 2013-12-16 13:14 | 1.2K | MILLER (BATTLES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0306.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0306.5.html | 2013-12-16 13:14 | 16K | MILLER v. BERLIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0306.5.pdf | 2011-11-01 10:31 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0309.1.html | 2013-12-16 13:14 | 1.2K | MILLER (BOUYSSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0309.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0309.2.html | 2013-12-16 13:14 | 18K | MILLER et al. v. BRIDGEPORT BRASS CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0309.2.pdf | 2011-11-01 10:31 | 86K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.0309_01.jpg | 2011-04-05 11:57 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0312.1.html | 2013-12-16 13:14 | 1.2K | MILLER (BRYDIE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0312.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0312.2.html | 2013-12-16 13:14 | 15K | MILLER v. BROOKLYN LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0312.2.pdf | 2011-11-01 10:31 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0314.1.html | 2013-12-16 13:14 | 3.3K | MILLER v. BUTLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0314.1.pdf | 2011-11-01 10:31 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0314.2.html | 2013-12-16 13:14 | 1.2K | MILLER (BUTTNER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0314.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0314.3.html | 2013-12-16 13:14 | 2.7K | MILLER v. DELAWARE, L. & W. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0314.3.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0314.4.html | 2013-12-16 13:14 | 1.2K | MILLER (DUNBAR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0314.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0314.5.html | 2013-12-16 13:14 | 6.4K | MILLER et al. v. The EASTERN RAILROAD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0314.5.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0315.html | 2013-12-16 13:14 | 11K | MILLER v. ELLIOT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0315.pdf | 2011-11-01 10:31 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0317.1.html | 2013-12-16 13:14 | 2.5K | MILLER v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0317.1.pdf | 2011-11-01 10:31 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0317.2.html | 2013-12-16 13:14 | 1.3K | MILLER v. FALLS CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0317.2.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0317.3.html | 2013-12-16 13:14 | 1.2K | MILLER (FORMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0317.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0317.4.html | 2013-12-16 13:14 | 1.2K | MILLER (GADSBY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0317.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0317.5.html | 2013-12-16 13:14 | 3.4K | MILLER v. GAGES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0317.5.pdf | 2011-11-01 10:31 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0318.html | 2013-12-16 13:14 | 16K | MILLER v. HALSTED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0318.pdf | 2011-11-01 10:31 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0320.1.html | 2013-12-16 13:14 | 1.2K | MILLER (HALSTED v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0320.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0320.2.html | 2013-12-16 13:14 | 1.2K | MILLER (HOLLENBACK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0320.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0320.3.html | 2013-12-16 13:14 | 4.4K | MILLER et al. v. HOOE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0320.3.pdf | 2011-11-01 10:31 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0321.html | 2013-12-16 13:14 | 11K | MILLER et al. v. HUBBARD et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0321.pdf | 2011-11-01 10:31 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0322.1.html | 2013-12-16 13:14 | 1.2K | MILLER (INDIANA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0322.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0322.2.html | 2013-12-16 13:14 | 1.3K | MILLER v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0322.2.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0322.3.html | 2013-12-16 13:14 | 1.2K | MILLER (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0322.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0322.4.html | 2013-12-16 13:14 | 26K | MILLER v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0322.4.pdf | 2011-11-01 10:31 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0326.html | 2013-12-16 13:14 | 12K | MILLER v. KELLY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0326.pdf | 2011-11-01 10:31 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0328.html | 2013-12-16 13:14 | 7.9K | MILLER v. KEYS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0328.pdf | 2011-11-01 10:31 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0329.html | 2013-12-16 13:14 | 13K | MILLER v. LERCH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0329.pdf | 2011-11-01 10:31 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0331.html | 2013-12-16 13:14 | 6.8K | MILLER v. LINDSEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0331.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0332.html | 2013-12-16 13:14 | 4.3K | MILLER v. LONG ISLAND R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0332.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0333.1.html | 2013-12-16 13:14 | 1.2K | MILLER (LYALL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0333.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0333.2.html | 2013-12-16 13:14 | 1.2K | MILLER (LYELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0333.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0333.3.html | 2013-12-16 13:14 | 1.2K | MILLER (McCLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0333.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0333.4.html | 2013-12-16 13:14 | 11K | MILLER v. McELROY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0333.4.pdf | 2011-11-01 10:31 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0334.html | 2013-12-16 13:14 | 6.4K | MILLER v. McINTIRE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0334.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0335.html | 2013-12-16 13:14 | 34K | MILLER v. McQUERRY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0335.pdf | 2011-11-01 10:31 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0341.1.html | 2013-12-16 13:14 | 1.2K | MILLER (MASSOLETTI v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0341.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0341.2.html | 2013-12-16 13:14 | 1.2K | MILLER (MAZE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0341.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0341.3.html | 2013-12-16 13:14 | 2.8K | MILLER v. MOORE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0341.3.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0341.4.html | 2013-12-16 13:14 | 27K | MILLER v. NEW YORK et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0341.4.pdf | 2011-11-01 10:31 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0345.html | 2013-12-16 13:14 | 8.9K | MILLER v. O'BRIEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0345.pdf | 2011-11-01 10:31 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0346.1.html | 2013-12-16 13:14 | 1.2K | MILLER v. PROCEEDS OF THE KATE HINCHMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0346.1.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0346.2.html | 2013-12-16 13:14 | 1.2K | MILLER v. QUERRY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0346.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0346.3.html | 2013-12-16 13:14 | 1.2K | MILLER (READ v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0346.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0346.4.html | 2013-12-16 13:14 | 1.2K | MILLER (REARDON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0346.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0346.5.html | 2013-12-16 13:14 | 4.2K | MILLER v. The REBECCA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0346.5.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0347.html | 2013-12-16 13:14 | 19K | MILLER v. The RESOLUTION. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0347.pdf | 2011-11-01 10:31 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.1.html | 2013-12-16 13:14 | 1.2K | MILLER (RICHARDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.2.html | 2013-12-16 13:14 | 1.2K | MILLER (ROBERTSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.3.html | 2013-12-16 13:14 | 1.2K | MILLER v. The ST. JOSEPH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.3.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.4.html | 2013-12-16 13:14 | 1.2K | MILLER (SANGSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.5.html | 2013-12-16 13:14 | 1.2K | MILLER (SCHRENKEISEN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.5.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.6.html | 2013-12-16 13:14 | 1.2K | MILLER v. SCOTT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.6.pdf | 2011-11-01 10:31 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0350.7.html | 2013-12-16 13:14 | 8.6K | MILLER v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0350.7.pdf | 2011-11-01 10:31 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0351.html | 2013-12-16 13:14 | 7.8K | MILLER v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0351.pdf | 2011-11-01 10:31 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0352.1.html | 2013-12-16 13:14 | 1.2K | MILLER (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0352.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0352.2.html | 2013-12-16 13:14 | 19K | MILLER v. STEWART. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0352.2.pdf | 2011-11-01 10:31 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0355.html | 2013-12-16 13:14 | 12K | MILLER v. SULLIVAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0355.pdf | 2011-11-01 10:31 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.1.html | 2013-12-16 13:14 | 1.2K | MILLER (THAMES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.2.html | 2013-12-16 13:14 | 1.3K | MILLER v. TOWBOAT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.2.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.3.html | 2013-12-16 13:14 | 1.2K | MILLER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.4.html | 2013-12-16 13:14 | 1.2K | MILLER (VAN KLEECK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.5.html | 2013-12-16 13:14 | 1.2K | MILLER (VAN MARTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.5.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.6.html | 2013-12-16 13:14 | 1.2K | MILLER (WATERBURY BRASS CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.6.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.7.html | 2013-12-16 13:14 | 1.2K | MILLER (WEED v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.7.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.8.html | 2013-12-16 13:14 | 1.2K | MILLER (WELLFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.8.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0357.9.html | 2013-12-16 13:14 | 36K | MILLER v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0357.9.pdf | 2011-11-01 10:31 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0363.html | 2013-12-16 13:14 | 13K | MILLER v. The W. G. HEWES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0363.pdf | 2011-11-01 10:31 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0365.1.html | 2013-12-16 13:14 | 2.3K | MILLER v. WHEATON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0365.1.pdf | 2011-11-01 10:31 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0365.2.html | 2013-12-16 13:14 | 5.9K | MILLER v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0365.2.pdf | 2011-11-01 10:31 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0365.3.html | 2013-12-16 13:14 | 1.2K | MILLER (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0365.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0366.html | 2013-12-16 13:14 | 20K | MILLER & PETERS MANUF'G CO. v. DUBRUL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0366.pdf | 2011-11-01 10:31 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0369.1.html | 2013-12-16 13:14 | 1.2K | MILLER COUNTY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0369.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0369.2.html | 2013-12-16 13:14 | 9.0K | MILLER'S FALLS CO. v. BACKUS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0369.2.pdf | 2011-11-01 10:31 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0370.html | 2013-12-16 13:14 | 25K | MILLER'S FALLS CO. v. IVES et al. (two cases). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0370.pdf | 2011-11-01 10:31 | 88K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.0370_01.jpg | 2011-04-05 12:00 | 8.5K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.0371_01.jpg | 2011-04-05 12:01 | 14K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0374.html | 2013-12-16 13:14 | 4.1K | MILLETT v. SNOWDEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0374.pdf | 2011-11-01 10:31 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0375.1.html | 2013-12-16 13:14 | 4.7K | MILLICK et al. v. PETERSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0375.1.pdf | 2011-11-01 10:31 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0375.2.html | 2013-12-16 13:14 | 7.3K | MILLIGAN v. The B. F. BRUCE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0375.2.pdf | 2011-11-01 10:31 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0376.1.html | 2013-12-16 13:14 | 1.2K | MILLIGAN (CRAWFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0376.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0376.2.html | 2013-12-16 13:14 | 12K | MILLIGAN & DICKSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0376.2.pdf | 2011-11-01 10:31 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0378.html | 2013-12-16 13:14 | 9.9K | MILLIGAN v. DICKSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0378.pdf | 2011-11-01 10:31 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0380.html | 2013-12-16 13:14 | 24K | MILLIGAN v. HOVEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0380.pdf | 2011-11-01 10:31 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0383.html | 2013-12-16 13:14 | 4.3K | MILLIGAN v. MAYNE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0383.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0384.1.html | 2013-12-16 13:14 | 1.2K | MILLIGAN (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0384.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0384.2.html | 2013-12-16 13:14 | 46K | MILLIGAN & HIGGINS GLUE CO. v. UPTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0384.2.pdf | 2011-11-01 10:31 | 111K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0391.1.html | 2013-12-16 13:14 | 2.1K | In re MILLIKEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0391.1.pdf | 2011-11-01 10:31 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0391.2.html | 2013-12-16 13:14 | 1.2K | MILLIKEN (GOODENOW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0391.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0391.3.html | 2013-12-16 13:14 | 6.8K | The MILLINOCKET., BETHEL et al. v. The MILLINOCKET. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0391.3.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0392.html | 2013-12-16 13:14 | 7.6K | MILLNER v. SCHOFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0392.pdf | 2011-11-01 10:31 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0393.1.html | 2013-12-16 13:14 | 1.2K | MILL RIVER WOOLEN MANUF'G CO. (HARWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0393.1.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0393.2.html | 2013-12-16 13:14 | 12K | In re MILLS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0393.2.pdf | 2011-11-01 10:31 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0395.html | 2013-12-16 13:14 | 13K | In re MILLS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0395.pdf | 2011-11-01 10:31 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0397.1.html | 2013-12-16 13:14 | 4.4K | In re MILLS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0397.1.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0397.2.html | 2013-12-16 13:14 | 1.3K | MILLS v. The BAY STATE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0397.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0397.3.html | 2013-12-16 13:14 | 7.7K | MILLS v. CHAPMAN et ux. (two cases). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0397.3.pdf | 2011-11-01 10:31 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0398.html | 2013-12-16 13:14 | 1.2K | MILLS (ISH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0398.pdf | 2011-11-01 10:31 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0399.1.html | 2013-12-16 13:14 | 1.2K | MILLS (MAINv.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0399.1.pdf | 2011-11-01 10:31 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0399.2.html | 2013-12-16 13:14 | 1.2K | MILLS The MARY E, PEREW. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0399.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0399.3.html | 2013-12-16 13:14 | 19K | MILLS et al. v. The NATHANIEL HOLMES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0399.3.pdf | 2011-11-01 10:31 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0402.1.html | 2013-12-16 13:14 | 1.3K | MILLS v. RUSSELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0402.1.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0402.2.html | 2013-12-16 13:14 | 7.7K | MILLS et al. v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0402.2.pdf | 2011-11-01 10:31 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.1.html | 2013-12-16 13:14 | 1.2K | MILLS (STOBAUGH V:) |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.2.html | 2013-12-16 13:14 | 1.2K | MILLS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.3.html | 2013-12-16 13:14 | 2.7K | MILLS v. WILSON |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.3.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.4.html | 2013-12-16 13:14 | 1.2K | MILLS COUNTY (BROOKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.4.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.5.html | 2013-12-16 13:14 | 1.2K | MILLWARD (HODGSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.5.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.6.html | 2013-12-16 13:14 | 1.2K | MILLWARD (SEDGWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.6.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.7.html | 2013-12-16 13:14 | 1.2K | MILN (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.7.pdf | 2011-11-01 10:31 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0403.8.html | 2013-12-16 13:14 | 20K | MILNE et al. v. HUBER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0403.8.pdf | 2011-11-01 10:31 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0406.1.html | 2013-12-16 13:14 | 2.8K | MILNE v. The JOHN COOK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0406.1.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0406.2.html | 2013-12-16 13:14 | 1.2K | MILNE (MANCHESTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0406.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0406.3.html | 2013-12-16 13:14 | 6.8K | MILNE ads. NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0406.3.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0407.1.html | 2013-12-16 13:14 | 1.2K | MILNER (BAILEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0407.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0407.2.html | 2013-12-16 13:14 | 28K | MILNER v. PENSACOLA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0407.2.pdf | 2011-11-01 10:31 | 83K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.0408_01.jpg | 2011-07-14 16:01 | 3.7K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0411.html | 2013-12-16 13:14 | 1.2K | MILNOR v. NEWARK PLANK ROAD CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0411.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0412.html | 2013-12-16 13:14 | 74K | MILNOR v. NEW JERSEY R. CO. et al. SHARDLOW v. SAME. BIGELOW v. SAME. MILNOR v. NEWARK PLANK ROAD CO. et al. SHARDLOW v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0412.pdf | 2011-11-01 10:31 | 165K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0424.1.html | 2013-12-16 13:14 | 5.2K | MILTENBERGER et al. v. PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0424.1.pdf | 2011-11-01 10:31 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0424.2.html | 2013-12-16 13:14 | 1.3K | MILTON v. WILGUS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0424.2.pdf | 2011-11-01 10:31 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0424.3.html | 2013-12-16 13:14 | 7.2K | In re MILWAIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0424.3.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0425.html | 2013-12-16 13:14 | 4.8K | MILWARD v. McSAUL |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0425.pdf | 2011-11-01 10:31 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0426.html | 2013-12-16 13:14 | 5.8K | The MILWAUKEE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0426.pdf | 2011-11-01 10:31 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0427.html | 2013-12-16 13:14 | 46K | The MILWAUKEE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0427.pdf | 2011-11-01 10:31 | 123K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.1.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE (HUNNEMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.2.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (BARNES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.2.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.3.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (BRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.3.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.4.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (DREW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.4.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.5.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.5.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.6.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (KELLOGG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.6.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.7.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (MINNETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.7.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.8.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & ST. P. R. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.8.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.9.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE & S. R. CO. (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.9.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0434.10.html | 2013-12-16 13:14 | 14K | The MILWAUKEE BELLE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0434.10.pdf | 2011-11-01 10:31 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0436.1.html | 2013-12-16 13:14 | 1.2K | MILWAUKEE R. CO. (SECOMBE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0436.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0436.2.html | 2013-12-16 13:14 | 5.9K | The MIMI., ROBERTS et al v. The MIMI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0436.2.pdf | 2011-11-01 10:31 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0437.1.html | 2013-12-16 13:14 | 1.2K | MINA, The (TOWNSHEND v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0437.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0437.2.html | 2013-12-16 13:14 | 3.2K | MINCHIN v. DOCKER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0437.2.pdf | 2011-11-01 10:31 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0437.3.html | 2013-12-16 13:14 | 6.2K | MINER v. HARBECK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0437.3.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0438.html | 2013-12-16 13:14 | 10K | MINER v. McLEAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0438.pdf | 2011-11-01 10:31 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0440.1.html | 2013-12-16 13:14 | 1.2K | MINER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0440.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0440.2.html | 2013-12-16 13:14 | 38K | MINGE v. GILMOUR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0440.2.pdf | 2011-11-01 10:31 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.1.html | 2013-12-16 13:14 | 1.2K | MINGO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.2.html | 2013-12-16 13:14 | 1.2K | MINGOS (VICTOR SEWING-MACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.3.html | 2013-12-16 13:14 | 1.3K | MINI v. ADAMS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.3.pdf | 2011-11-01 10:31 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.4.html | 2013-12-16 13:14 | 2.0K | MINIFIE v. DUCKWORTH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.4.pdf | 2011-11-01 10:31 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.5.html | 2013-12-16 13:14 | 1.2K | MINIFIE (NEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.5.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.6.html | 2013-12-16 13:14 | 1.2K | MINIFIE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.6.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0446.7.html | 2013-12-16 13:14 | 7.6K | The MINNA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0446.7.pdf | 2011-11-01 10:31 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0447.html | 2013-12-16 13:14 | 12K | MINNESOTA LINSEED OIL CO. v. COLLIER WHITE LEAD CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0447.pdf | 2011-11-01 10:31 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0449.html | 2013-12-16 13:14 | 11K | MINNETT v. MILWAUKEE & ST, P. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0449.pdf | 2011-11-01 10:31 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0451.1.html | 2013-12-16 13:14 | 1.3K | The MINNIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0451.1.pdf | 2011-11-01 10:31 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0451.2.html | 2013-12-16 13:14 | 1.2K | MINNIE, The (MARSH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0451.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0451.3.html | 2013-12-16 13:14 | 5.5K | The MINNIE MILLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0451.3.pdf | 2011-11-01 10:31 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0451.4.html | 2013-12-16 13:14 | 7.6K | The MINNIE R. CHILDS., The R. P. NOBLE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0451.4.pdf | 2011-11-01 10:31 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0452.html | 2013-12-16 13:14 | 11K | The MINNIE R. CHILDS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0452.pdf | 2011-11-01 10:31 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0454.1.html | 2013-12-16 13:14 | 1.2K | MINNIE R. CHILDS. The (HUDSON COAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0454.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0454.2.html | 2013-12-16 13:14 | 6.7K | MINON v. VAN NOSTRAND et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0454.2.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0455.html | 2013-12-16 13:14 | 13K | MINON v. VAN NOSTRAND et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0455.pdf | 2011-11-01 10:31 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.1.html | 2013-12-16 13:14 | 4.3K | Ex parte MINOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.1.pdf | 2011-11-01 10:31 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.2.html | 2013-12-16 13:14 | 1.2K | MINOR (GONZALES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.3.html | 2013-12-16 13:14 | 1.2K | MINOR (MECHANICS' BANK OF ALEXANDRIA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.3.pdf | 2011-11-01 10:31 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.4.html | 2013-12-16 13:14 | 1.2K | MINOR (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.4.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.5.html | 2013-12-16 13:14 | 1.2K | MINOR (SLADE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.5.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0457.6.html | 2013-12-16 13:14 | 3.3K | MINORS et al. v. The MARY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0457.6.pdf | 2011-11-01 10:31 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0458.html | 2013-12-16 13:14 | 46K | MINOT v. PHILADELPHIA, W. & B. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0458.pdf | 2011-11-01 10:31 | 114K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0465.1.html | 2013-12-16 13:14 | 1.2K | MINOT (WAGENER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0465.1.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0465.2.html | 2013-12-16 13:14 | 1.2K | MINOT (WESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0465.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0465.3.html | 2013-12-16 13:14 | 1.2K | MINTURN (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0465.3.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0465.4.html | 2013-12-16 13:14 | 59K | MINTURN v. LARUE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0465.4.pdf | 2011-11-01 10:31 | 135K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0475.html | 2013-12-16 13:14 | 7.2K | MINTURN v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0475.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0476.1.html | 2013-12-16 13:14 | 1.2K | MINTURN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0476.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0476.2.html | 2013-12-16 13:14 | 1.2K | MIRANDA, The (FOSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0476.2.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0476.3.html | 2013-12-16 13:14 | 6.8K | MIRICK v. HEMPHILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0476.3.pdf | 2011-11-01 10:31 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0477.html | 2013-12-16 13:14 | 6.7K | The MISPAH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0477.pdf | 2011-11-01 10:31 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0478.1.html | 2013-12-16 13:14 | 4.0K | The MISSISQUOI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0478.1.pdf | 2011-11-01 10:31 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0478.2.html | 2013-12-16 13:14 | 3.4K | The MISSISSIPPI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0478.2.pdf | 2011-11-01 10:31 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0478.3.html | 2013-12-16 13:14 | 5.8K | The MISSISSIPPI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0478.3.pdf | 2011-11-01 10:31 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.1.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI & M. R. CO. (MUSCATINE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.1.pdf | 2011-11-01 10:31 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.2.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI & M. R. CO. (WARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.2.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.3.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI & RUM RIVER BOOM CO. (PATTERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.3.pdf | 2011-11-01 10:31 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.4.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI, ETC., BOOM CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.5.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI CENT. R. CO. (ILLINOIS CENT. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.5.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.6.html | 2013-12-16 13:14 | 1.2K | MISSISSIPPI VAL. & W. R. CO. (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.6.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0479.7.html | 2013-12-16 13:14 | 25K | The MISSOURI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0479.7.pdf | 2011-11-01 10:32 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0483.html | 2013-12-16 13:14 | 9.4K | The MISSOURI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0483.pdf | 2011-11-01 10:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0484.html | 2013-12-16 13:14 | 33K | The MISSOURI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0484.pdf | 2011-11-01 10:32 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.1.html | 2013-12-16 13:14 | 1.2K | MISSOURI, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.2.html | 2013-12-16 13:14 | 1.2K | MISSOURI, K. & T. R. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.3.html | 2013-12-16 13:14 | 1.2K | MISSOURI, K. & T. R. CO. (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.4.html | 2013-12-16 13:14 | 1.3K | MISSOURI RIVER, FT. S. & G. R. CO. (ARMSWORTHY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.4.pdf | 2011-11-01 10:32 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.5.html | 2013-12-16 13:14 | 1.2K | MISSOURI RIVER, FT. S. & G. R. CO. (STROUD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.5.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.6.html | 2013-12-16 13:14 | 1.2K | MISSOURI VAL. LIFE INS. CO. (CLIPPINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.6.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.7.html | 2013-12-16 13:14 | 1.2K | MISSOURI VAL. LIFE INS. CO. (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.7.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0490.8.html | 2013-12-16 13:14 | 9.8K | MISTON v. LORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0490.8.pdf | 2011-11-01 10:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0491.1.html | 2013-12-16 13:14 | 1.2K | MITCHEL (CASTOR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0491.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0491.2.html | 2013-12-16 13:14 | 1.2K | MITCHEL (VAN METER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0491.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0491.3.html | 2013-12-16 13:14 | 1.2K | MITCHEL (VEIL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0491.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0491.4.html | 2013-12-16 13:14 | 5.9K | In re MITCHELL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0491.4.pdf | 2011-11-01 10:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0492.html | 2013-12-16 13:14 | 4.8K | In re MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0492.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0493.html | 2013-12-16 13:14 | 7.6K | In re MITCHELL., Ex parte SHERWIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0493.pdf | 2011-11-01 10:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0494.1.html | 2013-12-16 13:14 | 3.6K | MITCHELL v. BARCLAY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0494.1.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0494.2.html | 2013-12-16 13:14 | 1.4K | MITCHELL v. BUTLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0494.2.pdf | 2011-11-01 10:32 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0494.3.html | 2013-12-16 13:14 | 1.2K | MITCHELL (DANIEL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0494.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0494.4.html | 2013-12-16 13:14 | 15K | MITCHELL v. DEGRAND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0494.4.pdf | 2011-11-01 10:32 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0496.1.html | 2013-12-16 13:14 | 1.2K | MITCHELL (DENNETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0496.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0496.2.html | 2013-12-16 13:14 | 31K | MITCHELL v. GREAT WORKS MILLING & MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0496.2.pdf | 2011-11-01 10:32 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0501.1.html | 2013-12-16 13:14 | 1.2K | MITCHELL (HARMONY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0501.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0501.2.html | 2013-12-16 13:14 | 1.2K | MITCHELL (HAWLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0501.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0501.3.html | 2013-12-16 13:14 | 13K | MITCHELL v. KELSEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0501.3.pdf | 2011-11-01 10:32 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0503.1.html | 2013-12-16 13:14 | 3.2K | MITCHELL v. KELSEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0503.1.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0503.2.html | 2013-12-16 13:14 | 1.2K | MITCHELL (KIKINDAL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0503.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0503.3.html | 2013-12-16 13:14 | 1.2K | MITCHELL (KIRKENDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0503.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0503.4.html | 2013-12-16 13:14 | 19K | MITCHELL v. LIPPINCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0503.4.pdf | 2011-11-01 10:32 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0506.html | 2013-12-16 13:14 | 55K | MITCHELL v. McKIBBIN |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0506.pdf | 2011-11-01 10:32 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0515.1.html | 2013-12-16 13:14 | 1.2K | MITCHELL (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0515.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0515.2.html | 2013-12-16 13:14 | 1.2K | MITCHELL (NOELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0515.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0515.3.html | 2013-12-16 13:14 | 6.6K | MITCHELL v. The OROZIMBO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0515.3.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0516.html | 2013-12-16 13:14 | 12K | MITCHELL v. PRATT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0516.pdf | 2011-11-01 10:32 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0518.1.html | 2013-12-16 13:14 | 1.2K | MITCHELL (SHAW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0518.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0518.2.html | 2013-12-16 13:14 | 1.2K | MITCHELL (SICKELS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0518.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0518.3.html | 2013-12-16 13:14 | 1.2K | MITCHELL (SILVERTHAIN'S ASSIGNEE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0518.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0518.4.html | 2013-12-16 13:14 | 28K | MITCHELL v. THOMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0518.4.pdf | 2011-11-01 10:32 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0522.1.html | 2013-12-16 13:14 | 1.2K | MITCHELL (TILGHMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0522.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0522.2.html | 2013-12-16 13:14 | 1.2K | MITCHELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0522.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0522.3.html | 2013-12-16 13:14 | 1.2K | MITCHELL (VAN METRE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0522.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0522.4.html | 2013-12-16 13:14 | 8.5K | MITCHELL v. WALKER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0522.4.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0523.html | 2013-12-16 13:14 | 4.7K | MITCHELL v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0523.pdf | 2011-11-01 10:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0524.html | 2013-12-16 13:14 | 23K | MITCHELL v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0524.pdf | 2011-11-01 10:32 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0527.html | 2013-12-16 13:14 | 45K | MITCHELL v. WINSLOW et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0527.pdf | 2011-11-01 10:32 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0534.html | 2013-12-16 13:14 | 19K | In re MITTELDORFER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0534.pdf | 2011-11-01 10:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0537.html | 2013-12-16 13:14 | 14K | In re MITTELDORFER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0537.pdf | 2011-11-01 10:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0539.html | 2013-12-16 13:14 | 8.8K | MITTLEBURGER v. STANTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0539.pdf | 2011-11-01 10:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0540.1.html | 2013-12-16 13:14 | 1.1K | MIX (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0540.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0540.2.html | 2013-12-16 13:14 | 1.2K | MIX (LAMSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0540.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0540.3.html | 2013-12-16 13:14 | 14K | MIX v. PERKINS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0540.3.pdf | 2011-11-01 10:32 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0542.html | 2013-12-16 13:14 | 1.2K | MIXTER (GORHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0542.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0543.html | 2013-12-16 13:14 | 20K | MIZNER et al. v. VAUGHN. LAMB v. SAME. SQUIRES v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0543.pdf | 2011-11-01 10:32 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0546.html | 2013-12-16 13:14 | 11K | The M. K. RAWLEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0546.pdf | 2011-11-01 10:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0547.html | 2013-12-16 13:14 | 4.6K | The M. M. CALEB. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0547.pdf | 2011-11-01 10:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0548.1.html | 2013-12-16 13:14 | 3.4K | The M. M. CALEB. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0548.1.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0548.2.html | 2013-12-16 13:14 | 4.9K | The M. M. CALEB. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0548.2.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0549.html | 2013-12-16 13:14 | 19K | The M. M. CALEB. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0549.pdf | 2011-11-01 10:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0552.html | 2013-12-16 13:14 | 19K | The M. M. CHASE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0552.pdf | 2011-11-01 10:32 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.1.html | 2013-12-16 13:14 | 1.2K | MOBERLY (JARROTT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.2.html | 2013-12-16 13:14 | 1.2K | MOBILE (KIMBALL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.3.html | 2013-12-16 13:14 | 1.2K | MOBILE (SIBLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.4.html | 2013-12-16 13:14 | 1.2K | MOBILE & O. R. CO. (DUNCAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.5.html | 2013-12-16 13:14 | 1.2K | MOBILE & O. R. CO. (KETCHUM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.5.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.6.html | 2013-12-16 13:14 | 1.2K | MOBILE LIFE INS. CO. (BERRY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.6.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.7.html | 2013-12-16 13:14 | 1.2K | MOBILE SAV. BANK (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.7.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.8.html | 2013-12-16 13:14 | 1.2K | MOCKBEE (GODDARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.8.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0555.9.html | 2013-12-16 13:14 | 15K | The M. M. HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0555.9.pdf | 2011-11-01 10:32 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0557.html | 2013-12-16 13:14 | 8.7K | MOAN v. WILMARTH et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0557.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0558.html | 2013-12-16 13:14 | 4.5K | MOCKBEE et al. v. UPPERMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0558.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0559.1.html | 2013-12-16 13:14 | 1.2K | MOE (ANDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0559.1.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0559.2.html | 2013-12-16 13:14 | 1.2K | MOFFAT. The (DE GRAFF v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0559.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0559.3.html | 2013-12-16 13:14 | 15K | MOFFAT et al. v. SOLEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0559.3.pdf | 2011-11-01 10:32 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0561.html | 2013-12-16 13:14 | 16K | MOFFIT et al. v. VARDEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0561.pdf | 2011-11-01 10:32 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0563.html | 2013-12-16 13:14 | 12K | MOFFITT v. GAAR et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0563.pdf | 2011-11-01 10:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0565.html | 2013-12-16 13:14 | 7.7K | MOFFITT v. ROGERS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0565.pdf | 2011-11-01 10:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0566.1.html | 2013-12-16 13:14 | 1.3K | The MOHAWK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0566.1.pdf | 2011-11-01 10:32 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0566.2.html | 2013-12-16 13:14 | 5.5K | The MOHAWK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0566.2.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0567.1.html | 2013-12-16 13:14 | 1.9K | MOHR v. COTZHAUSEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0567.1.pdf | 2011-11-01 10:32 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0567.2.html | 2013-12-16 13:14 | 17K | MOHR et al. v. MANIERRE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0567.2.pdf | 2011-11-01 10:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0569.1.html | 2013-12-16 13:14 | 1.2K | MOIES (LONSDALE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0569.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0569.2.html | 2013-12-16 13:14 | 31K | MOIR v. The DUBUQUE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0569.2.pdf | 2011-11-01 10:32 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0574.1.html | 2013-12-16 13:14 | 1.2K | MOIR v. The DU SAQUE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0574.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0574.2.html | 2013-12-16 13:14 | 2.3K | MOITEZ v. The SOUTH CAROLINA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0574.2.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0574.3.html | 2013-12-16 13:14 | 12K | MOKE et al. v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0574.3.pdf | 2011-11-01 10:32 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0576.html | 2013-12-16 13:14 | 16K | In re MOLLER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0576.pdf | 2011-11-01 10:32 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0579.html | 2013-12-16 13:14 | 17K | In re MOLLER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0579.pdf | 2011-11-01 10:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0581.1.html | 2013-12-16 13:14 | 1.2K | MOLLER (HICKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0581.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0581.2.html | 2013-12-16 13:14 | 1.2K | MOLLER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0581.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0581.3.html | 2013-12-16 13:14 | 1.2K | MOLLIE. The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0581.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0581.4.html | 2013-12-16 13:14 | 10K | The MOLLIE MOHLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0581.4.pdf | 2011-11-01 10:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0583.html | 2013-12-16 13:14 | 9.7K | MOLSON et al. v. HAWLEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0583.pdf | 2011-11-01 10:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0584.html | 2013-12-16 13:14 | 11K | MOLYNEAUX v. MARSH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0584.pdf | 2011-11-01 10:32 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0586.html | 2013-12-16 13:14 | 20K | The MONADNOCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0586.pdf | 2011-11-01 10:32 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0589.html | 2013-12-16 13:14 | 23K | MONCE et al. v. ADAMS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0589.pdf | 2011-11-01 10:32 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0592.html | 2013-12-16 13:14 | 17K | MONCE v. WOODWORTH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0592.pdf | 2011-11-01 10:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0595.html | 2013-12-16 13:14 | 36K | MONCURE et al. v. DERMOTT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0595.pdf | 2011-11-01 10:32 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0601.1.html | 2013-12-16 13:14 | 1.2K | MONCURE v. DUBUCLET. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0601.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0601.2.html | 2013-12-16 13:14 | 1.2K | MONELL (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0601.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0601.3.html | 2013-12-16 13:14 | 1.2K | MONIRE v. The THOMAS MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0601.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0601.4.html | 2013-12-16 13:14 | 4.6K | The MONITOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0601.4.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0601.5.html | 2013-12-16 13:14 | 4.3K | The MONITOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0601.5.pdf | 2011-11-01 10:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0602.1.html | 2013-12-16 13:14 | 5.2K | The MONITOR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0602.1.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0602.2.html | 2013-12-16 13:14 | 8.5K | The MONITOR and The HILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0602.2.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0604.1.html | 2013-12-16 13:14 | 4.4K | The MONONGAHELA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0604.1.pdf | 2011-11-01 10:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0604.2.html | 2013-12-16 13:14 | 1.2K | MONONGAHELA BRIDGE CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0604.2.pdf | 2011-11-01 10:32 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0604.3.html | 2013-12-16 13:14 | 2.3K | MONROE v. BRADLEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0604.3.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0604.4.html | 2013-12-16 13:14 | 5.8K | MONROE v. DOVER STAMPING CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0604.4.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0605.1.html | 2013-12-16 13:14 | 2.4K | MONROE v. HARKNESS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0605.1.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0605.2.html | 2013-12-16 13:14 | 1.2K | MONSON SAV. BANK, Ex parte. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0605.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0605.3.html | 2013-12-16 13:14 | 1.2K | MONSON & B. MANUF'G CO. (ELY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0605.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0605.4.html | 2013-12-16 13:14 | 1.2K | MONSON & B. MANUF'G CO. (POWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0605.4.pdf | 2011-11-01 10:32 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0605.5.html | 2013-12-16 13:14 | 5.6K | The MONSOON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0605.5.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0606.1.html | 2013-12-16 13:14 | 1.2K | MONTAGUE (JOBBINS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0606.1.pdf | 2011-11-01 10:32 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0606.2.html | 2013-12-16 13:14 | 7.4K | The MONTAUK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0606.2.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0607.1.html | 2013-12-16 13:14 | 1.3K | The MONTE CHRISTO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0607.1.pdf | 2011-11-01 10:32 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0607.2.html | 2013-12-16 13:14 | 5.5K | The MONTE CHRISTO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0607.2.pdf | 2011-11-01 10:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0608.html | 2013-12-16 13:14 | 8.5K | The MONTE CHRISTO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0608.pdf | 2011-11-01 10:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0609.1.html | 2013-12-16 13:14 | 1.2K | MONTE CHRISTO, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0609.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0609.2.html | 2013-12-16 13:14 | 8.1K | MONTEITH et al. v. KIRKPATRICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0609.2.pdf | 2011-11-01 10:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0610.html | 2013-12-16 13:14 | 11K | MONTEJO et al. v. OWEN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0610.pdf | 2011-11-01 10:32 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0612.html | 2013-12-16 13:14 | 21K | MONTELL v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0612.pdf | 2011-11-01 10:32 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0615.1.html | 2013-12-16 13:14 | 1.2K | MONTELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0615.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0615.2.html | 2013-12-16 13:14 | 7.9K | MONTELL v. The WILLIAM H. RUTAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0615.2.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0616.html | 2013-12-16 13:14 | 7.5K | MONTFORD v. HUNT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0616.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0617.html | 2013-12-16 13:14 | 8.9K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0617.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0618.html | 2013-12-16 13:14 | 5.5K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0618.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0619.html | 2013-12-16 13:14 | 9.9K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0619.pdf | 2011-11-01 10:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0620.html | 2013-12-16 13:14 | 7.0K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0620.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0621.html | 2013-12-16 13:14 | 8.9K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0621.pdf | 2011-11-01 10:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0622.html | 2013-12-16 13:14 | 12K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0622.pdf | 2011-11-01 10:32 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0624.html | 2013-12-16 13:14 | 19K | In re MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0624.pdf | 2011-11-01 10:32 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0627.1.html | 2013-12-16 13:14 | 1.2K | The MONTGOMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0627.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0627.2.html | 2013-12-16 13:14 | 4.5K | The MONTGOMERY v. The BETSEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0627.2.pdf | 2011-11-01 10:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0628.html | 2013-12-16 13:14 | 77K | MONTGOMERY v. BEVANS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0628.pdf | 2011-11-01 10:32 | 168K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.1.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (BOUDEREAU v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.2.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (CHISHOLM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.3.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (FAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.4.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (GRESHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.4.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.5.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (RICE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.5.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0640.6.html | 2013-12-16 13:14 | 28K | MONTGOMERY et al. v. The T. P. LEATHERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0640.6.pdf | 2011-11-01 10:32 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0644.1.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY v. TYSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0644.1.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0644.2.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0644.2.pdf | 2011-11-01 10:32 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0645.1.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY, The (WALTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0645.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0645.2.html | 2013-12-16 13:14 | 12K | MONTGOMERY v. WHARTON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0645.2.pdf | 2011-11-01 10:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.1.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY & E. R. CO. (OTIS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.2.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY & E. R. CO. (STRANG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.3.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY & E. R. CO. (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.4.html | 2013-12-16 13:14 | 1.2K | MONTGOMERY COUNTY (THAYER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.5.html | 2013-12-16 13:14 | 1.2K | The MONTICELLO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.5.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0646.6.html | 2013-12-16 13:14 | 14K | The MONTICELLO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0646.6.pdf | 2011-11-01 10:32 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0649.1.html | 2013-12-16 13:14 | 1.2K | MONTICELLO, The (DOLNER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0649.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0649.2.html | 2013-12-16 13:14 | 1.2K | MONTREAL OCEAN STEAMSHIP CO. (CRERAR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0649.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0649.3.html | 2013-12-16 13:14 | 9.8K | The MONTSERAT., GEIGER et al. v. The MONTSERAT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0649.3.pdf | 2011-11-01 10:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0650.html | 2013-12-16 13:14 | 4.4K | MOODIE v. The AMITY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0650.pdf | 2011-11-01 10:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0651.html | 2013-12-16 13:14 | 17K | MOODIE v. The BETTY CARTHCART. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0651.pdf | 2011-11-01 10:32 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0653.html | 2013-12-16 13:14 | 5.9K | MOODIE v. The BROTHERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0653.pdf | 2011-11-01 10:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0654.html | 2013-12-16 13:14 | 7.7K | MOODIE v. The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0654.pdf | 2011-11-01 10:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0655.html | 2013-12-16 13:14 | 18K | MOODY v. FISKE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0655.pdf | 2011-11-01 10:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0658.1.html | 2013-12-16 13:14 | 3.3K | MOODY v. FULLER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0658.1.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0658.2.html | 2013-12-16 13:14 | 8.5K | MOODY v. TABER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0658.2.pdf | 2011-11-01 10:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0659.1.html | 2013-12-16 13:14 | 1.2K | MOON (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0659.1.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0659.2.html | 2013-12-16 13:14 | 1.2K | MOON (PIPER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0659.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0659.3.html | 2013-12-16 13:14 | 9.3K | In re MOONEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0659.3.pdf | 2011-11-01 10:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0661.1.html | 2013-12-16 13:14 | 5.6K | In re MOORE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0661.1.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0661.2.html | 2013-12-16 13:14 | 8.2K | In re MOORE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0661.2.pdf | 2011-11-01 10:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0663.html | 2013-12-16 13:14 | 26K | In re MOORE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0663.pdf | 2011-11-01 10:32 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0667.html | 2013-12-16 13:14 | 8.6K | In re MOORE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0667.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.1.html | 2013-12-16 13:14 | 1.2K | MOORE (ALEXANDRIA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.2.html | 2013-12-16 13:14 | 1.2K | MOORE (BANK OF COLUMBIA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.3.html | 2013-12-16 13:14 | 1.2K | MOORE (BANK OF METROPOLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.4.html | 2013-12-16 13:14 | 1.2K | MOORE (BANK OF UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.5.html | 2013-12-16 13:14 | 1.2K | MOORE (BEBEE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.5.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0668.6.html | 2013-12-16 13:14 | 6.5K | MOORE v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0668.6.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0669.html | 2013-12-16 13:14 | 7.4K | MOORE et al. v. The CARIBON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0669.pdf | 2011-11-01 10:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0670.html | 2013-12-16 13:14 | 16K | MOORE v. The CHARLES MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0670.pdf | 2011-11-01 10:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0672.html | 2013-12-16 13:14 | 30K | MOORE v. CONNECTICUT MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0672.pdf | 2011-11-01 10:32 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0677.html | 2013-12-16 13:14 | 5.3K | MOORE v. The C. P. MOREY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0677.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0678.1.html | 2013-12-16 13:14 | 1.2K | MOORE (DEVIGNY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0678.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0678.2.html | 2013-12-16 13:14 | 3.3K | MOORE v. DOVE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0678.2.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0678.3.html | 2013-12-16 13:14 | 1.2K | MOORE (DRIGGS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0678.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0678.4.html | 2013-12-16 13:14 | 2.6K | MOORE v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0678.4.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0678.5.html | 2013-12-16 13:14 | 3.0K | MOORE v. DUNLOP. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0678.5.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0679.1.html | 2013-12-16 13:14 | 1.2K | MOORE v. The FASHION. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0679.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0679.2.html | 2013-12-16 13:14 | 4.7K | MOORE et al. v. FOSTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0679.2.pdf | 2011-11-01 10:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0679.3.html | 2013-12-16 13:14 | 1.2K | MOORE (FOSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0679.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0679.4.html | 2013-12-16 13:14 | 5.1K | MOORE v. FOWLER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0679.4.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0680.1.html | 2013-12-16 13:14 | 2.5K | MOORE v. GADSBY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0680.1.pdf | 2011-11-01 10:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0680.2.html | 2013-12-16 13:14 | 1.2K | MOORE (GIRARDEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0680.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0680.3.html | 2013-12-16 13:14 | 23K | MOORE v. GREENE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0680.3.pdf | 2011-11-01 10:32 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0684.1.html | 2013-12-16 13:14 | 3.4K | MOORE et al. v. HARLEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0684.1.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0684.2.html | 2013-12-16 13:14 | 3.7K | MOORE v. HOFFMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0684.2.pdf | 2011-11-01 10:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0684.3.html | 2013-12-16 13:14 | 7.2K | MOORE et al. v. HOLLIDAY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0684.3.pdf | 2011-11-01 10:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0685.1.html | 2013-12-16 13:14 | 1.2K | MOORE (HOMANS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0685.1.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0685.2.html | 2013-12-16 13:14 | 3.9K | MOORE v. HOUGH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0685.2.pdf | 2011-11-01 10:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0686.1.html | 2013-12-16 13:14 | 3.4K | MOORE v. JACOBS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0686.1.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0686.2.html | 2013-12-16 13:14 | 27K | MOORE v. JONES et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0686.2.pdf | 2011-11-01 10:32 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0690.html | 2013-12-16 13:14 | 9.3K | MOORE et al. v. JONES et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0690.pdf | 2011-11-01 10:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0691.1.html | 2013-12-16 13:14 | 1.2K | MOORE (JUDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0691.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0691.2.html | 2013-12-16 13:14 | 1.2K | MOORE (LATIMER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0691.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0691.3.html | 2013-12-16 13:14 | 1.2K | MOORE (LIVINGSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0691.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0691.4.html | 2013-12-16 13:14 | 1.2K | MOORE (McDONALD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0691.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0692.1.html | 2013-12-16 13:14 | 1.2K | MOORE (McIVER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0692.1.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0692.2.html | 2013-12-16 13:14 | 1.2K | MOORE (MAYOR & COMMONALTY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0692.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0692.3.html | 2013-12-16 13:14 | 1.2K | MOORE (MEISTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0692.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0692.4.html | 2013-12-16 13:14 | 1.2K | MOORE (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0692.4.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0692.5.html | 2013-12-16 13:14 | 18K | MOORE v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0692.5.pdf | 2011-11-01 10:32 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0694.1.html | 2013-12-16 13:14 | 1.2K | MOORE (NATIONAL EXCH. BANK v.) |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0694.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0694.2.html | 2013-12-16 13:14 | 5.9K | MOORE v. NELSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0694.2.pdf | 2011-11-01 10:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0695.html | 2013-12-16 13:14 | 18K | MOORE et al. v. NEWBURY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0695.pdf | 2011-11-01 10:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0698.1.html | 2013-12-16 13:14 | 3.6K | MOORE v. PAXTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0698.1.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0698.2.html | 2013-12-16 13:14 | 1.2K | MOORE (PLASTIC STATE-ROOFING JOINT-STOCK CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0698.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0698.3.html | 2013-12-16 13:14 | 1.2K | MOORE v. REED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0698.3.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0698.4.html | 2013-12-16 13:14 | 2.7K | MOORE v. RINGGOLD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0698.4.pdf | 2011-11-01 10:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0699.1.html | 2013-12-16 13:14 | 1.2K | MOORE (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0699.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0699.2.html | 2013-12-16 13:14 | 1.2K | MOORE (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0699.2.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0699.3.html | 2013-12-16 13:14 | 5.3K | MOORE v. ROSENBERGER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0699.3.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0699.4.html | 2013-12-16 13:14 | 1.2K | MOORE (RUTHERFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0699.4.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0699.5.html | 2013-12-16 13:14 | 4.3K | MOORE v. SEARCY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0699.5.pdf | 2011-11-01 10:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.1.html | 2013-12-16 13:14 | 3.7K | MOORE v. SHIELDS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.1.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.2.html | 2013-12-16 13:14 | 1.2K | MOORE (SHULTS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.3.html | 2013-12-16 13:14 | 1.2K | MOORE (SHULTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.3.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.4.html | 2013-12-16 13:14 | 1.2K | MOORE (STARR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.4.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.5.html | 2013-12-16 13:14 | 1.2K | MOORE (SUMNER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.5.pdf | 2011-11-01 10:32 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.6.html | 2013-12-16 13:14 | 1.2K | MOORE (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.6.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0700.7.html | 2013-12-16 13:14 | 19K | MOORE et al. v. THOMAS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0700.7.pdf | 2011-11-01 10:32 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0703.html | 2013-12-16 13:14 | 29K | MOORE v. UNION MUTUAL LIFE INS. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0703.pdf | 2011-11-01 10:32 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0707.1.html | 2013-12-16 13:14 | 1.2K | MOORE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0707.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0707.2.html | 2013-12-16 13:14 | 3.0K | MOORE v. VOSS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0707.2.pdf | 2011-11-01 10:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0708.1.html | 2013-12-16 13:14 | 1.2K | MOORE (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0708.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0708.2.html | 2013-12-16 13:14 | 14K | MOORE et al. v. WALTON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0708.2.pdf | 2011-11-01 10:32 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0710.1.html | 2013-12-16 13:14 | 3.6K | MOORE v. WATERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0710.1.pdf | 2011-11-01 10:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0710.2.html | 2013-12-16 13:14 | 2.6K | MOORE v. WILMARTH et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0710.2.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0711.html | 2013-12-16 13:14 | 21K | MOORE v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0711.pdf | 2011-11-01 10:32 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0714.1.html | 2013-12-16 13:14 | 1.2K | MOOREHOUSE (BROOKS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0714.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0714.2.html | 2013-12-16 13:14 | 5.5K | MOORES et al. v. CARTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0714.2.pdf | 2011-11-01 10:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0714.3.html | 2013-12-16 13:14 | 1.2K | MOORHEAD (SCOFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0714.3.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0715.html | 2013-12-16 13:14 | 31K | MOORMAN et al. v. HOGE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0715.pdf | 2011-11-01 10:32 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0720.html | 2013-12-16 13:14 | 11K | MORA v. FOSTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0720.pdf | 2011-11-01 10:32 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0721.1.html | 2013-12-16 13:14 | 1.2K | MORA (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0721.1.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0721.2.html | 2013-12-16 13:14 | 1.2K | MORAGA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0721.2.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0721.3.html | 2013-12-16 13:14 | 10K | MORAN v. BAUDIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0721.3.pdf | 2011-11-01 10:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0723.1.html | 2013-12-16 13:14 | 4.9K | MORAN et al. v. SCHNUGG et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0723.1.pdf | 2011-11-01 10:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0723.2.html | 2013-12-16 13:14 | 7.9K | MORAN v. STRAUSS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0723.2.pdf | 2011-11-01 10:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0724.html | 2013-12-16 13:14 | 8.4K | MORANCY et al. v. QUARLES et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0724.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0725.html | 2013-12-16 13:14 | 17K | The MORAVIAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0725.pdf | 2011-11-01 10:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0728.1.html | 2013-12-16 13:14 | 2.4K | MORDECAI et al. v. The MARY EDDY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0728.1.pdf | 2011-11-01 10:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0728.2.html | 2013-12-16 13:14 | 1.2K | MORE (SADLER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0728.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0728.3.html | 2013-12-16 13:14 | 8.0K | MOREHEAD v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0728.3.pdf | 2011-11-01 10:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0729.html | 2013-12-16 13:14 | 50K | MOREHEAD v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0729.pdf | 2011-11-01 10:32 | 122K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0738.html | 2013-12-16 13:14 | 20K | MOREHOUSE et al. v. The JEFFERSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0738.pdf | 2011-11-01 10:32 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0741.1.html | 2013-12-16 13:14 | 1.2K | MOREL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0741.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0741.2.html | 2013-12-16 13:14 | 17K | MORELAND v. MARION COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0741.2.pdf | 2011-11-01 10:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0743.1.html | 2013-12-16 13:14 | 1.2K | MOREWOOD (IREGUIST v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0743.1.pdf | 2011-11-01 10:32 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0743.2.html | 2013-12-16 13:14 | 1.2K | MOREY (FLETCHER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0743.2.pdf | 2011-11-01 10:32 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0743.3.html | 2013-12-16 13:14 | 11K | MOREY v. NEW YORK LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0743.3.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0745.html | 2013-12-16 13:14 | 6.3K | In re MORFORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0745.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0746.1.html | 2013-12-16 13:14 | 6.1K | In re MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0746.1.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0746.2.html | 2013-12-16 13:14 | 3.5K | In re MORGAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0746.2.pdf | 2011-11-01 10:33 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0747.1.html | 2013-12-16 13:14 | 1.2K | MORGAN v. The BEN FLINT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0747.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0747.2.html | 2013-12-16 13:14 | 1.2K | MORGAN (COOKINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0747.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0747.3.html | 2013-12-16 13:14 | 1.2K | MORGAN (CROFFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0747.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0747.4.html | 2013-12-16 13:14 | 1.2K | MORGAN (CROSS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0747.4.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0747.5.html | 2013-12-16 13:14 | 11K | MORGAN v. CURTENIUS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0747.5.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0748.1.html | 2013-12-16 13:14 | 1.2K | MORGAN (DIBBLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0748.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0748.2.html | 2013-12-16 13:14 | 2.9K | MORGAN v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0748.2.pdf | 2011-11-01 10:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0749.1.html | 2013-12-16 13:14 | 5.9K | MORGAN v. GRAHAM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0749.1.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0749.2.html | 2013-12-16 13:14 | 1.2K | MORGAN (HAMPDEN BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0749.2.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0749.3.html | 2013-12-16 13:14 | 1.2K | MORGAN (HUBBARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0749.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0749.4.html | 2013-12-16 13:14 | 21K | MORGAN v. ILLINOIS & ST. L. BRIDGE CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0749.4.pdf | 2011-11-01 10:33 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0752.html | 2013-12-16 13:14 | 11K | MORGAN et al. v. MASTICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0752.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0754.html | 2013-12-16 13:14 | 27K | MORGAN v. NEW ORLEANS, M. & T. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0754.pdf | 2011-11-01 10:33 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0758.html | 2013-12-16 13:14 | 7.1K | MORGAN v. The PHILIP DE PEYSTER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0758.pdf | 2011-11-01 10:33 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0759.html | 2013-12-16 13:14 | 11K | MORGAN v. RAILROAD CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0759.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0761.1.html | 2013-12-16 13:14 | 1.2K | MORGAN (REINTZEL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0761.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0761.2.html | 2013-12-16 13:14 | 2.7K | MORGAN v. ROWAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0761.2.pdf | 2011-11-01 10:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0761.3.html | 2013-12-16 13:14 | 1.2K | MORGAN (SANTIAGO v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0761.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0761.4.html | 2013-12-16 13:14 | 4.5K | MORGAN v. TAPSCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0761.4.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0762.1.html | 2013-12-16 13:14 | 1.2K | MORGAN (TARDY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0762.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0762.2.html | 2013-12-16 13:14 | 31K | MORGAN et al. v. TIPTON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0762.2.pdf | 2011-11-01 10:33 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0767.1.html | 2013-12-16 13:14 | 1.2K | MORGAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0767.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0767.2.html | 2013-12-16 13:14 | 14K | MORGAN v. VAN DYCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0767.2.pdf | 2011-11-01 10:33 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0769.1.html | 2013-12-16 13:14 | 2.6K | MORGAN v. VOSS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0769.1.pdf | 2011-11-01 10:33 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0769.2.html | 2013-12-16 13:14 | 2.3K | MORGAN v. VOSS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0769.2.pdf | 2011-11-01 10:33 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0769.3.html | 2013-12-16 13:14 | 1.2K | MORGAN (WATERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0769.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0769.4.html | 2013-12-16 13:14 | 1.2K | MORGAN ENVELOPE CO. (CONE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0769.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0769.5.html | 2013-12-16 13:14 | 3.9K | In re MORGANTHAL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0769.5.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0770.1.html | 2013-12-16 13:14 | 1.2K | MORIATY (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0770.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0770.2.html | 2013-12-16 13:14 | 1.2K | MORIN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0770.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0770.3.html | 2013-12-16 13:14 | 4.2K | In re MORITZ et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0770.3.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0770.4.html | 2013-12-16 13:14 | 13K | MORLOT v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0770.4.pdf | 2011-11-01 10:33 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0772.html | 2013-12-16 13:14 | 4.9K | MORLOT v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0772.pdf | 2011-11-01 10:33 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0773.1.html | 2013-12-16 13:14 | 1.2K | MORNING GLORY, The (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0773.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0773.2.html | 2013-12-16 13:14 | 29K | The MORNING STAR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0773.2.pdf | 2011-11-01 10:33 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0777.html | 2013-12-16 13:14 | 6.7K | The MORNING STAR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0777.pdf | 2011-11-01 10:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0778.html | 2013-12-16 13:14 | 5.0K | MORRELL v. CRAEFE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0778.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0779.1.html | 2013-12-16 13:14 | 1.2K | MORREN v. KEEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0779.1.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0779.2.html | 2013-12-16 13:14 | 12K | In re MORRILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0779.2.pdf | 2011-11-01 10:33 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0781.html | 2013-12-16 13:14 | 13K | In re MORRILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0781.pdf | 2011-11-01 10:33 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0783.1.html | 2013-12-16 13:14 | 3.3K | MORRILL v. ARMSTRONG. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0783.1.pdf | 2011-11-01 10:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0783.2.html | 2013-12-16 13:14 | 1.2K | MORRILL (McKAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0783.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0783.3.html | 2013-12-16 13:14 | 12K | Ex parte MORRIS., In re FOYE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0783.3.pdf | 2011-11-01 10:33 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0785.1.html | 2013-12-16 13:14 | 6.2K | In re MORRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0785.1.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0785.2.html | 2013-12-16 13:14 | 141K | In re MORRIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0785.2.pdf | 2011-11-01 10:33 | 289K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0809.1.html | 2013-12-16 13:14 | 2.2K | MORRIS v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0809.1.pdf | 2011-11-01 10:33 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0809.2.html | 2013-12-16 13:14 | 11K | MORRIS v. BARRETT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0809.2.pdf | 2011-11-01 10:33 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0810.1.html | 2013-12-16 13:14 | 1.2K | MORRIS (BARRON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0810.1.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0810.2.html | 2013-12-16 13:14 | 1.2K | MORRIS (BOWDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0810.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0810.3.html | 2013-12-16 13:14 | 1.2K | MORRIS (BOWERBANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0810.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0810.4.html | 2013-12-16 13:14 | 21K | MORRIS et al. v. BRUSH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0810.4.pdf | 2011-11-01 10:33 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0814.1.html | 2013-12-16 13:14 | 1.2K | MORRIS (COMMITTEE OF WEST NEW JERSEY SOCIETY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0814.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0814.2.html | 2013-12-16 13:14 | 22K | MORRIS v. CORNELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0814.2.pdf | 2011-11-01 10:33 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0817.html | 2013-12-16 13:14 | 4.7K | MORRIS et al. v. GARDNER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0817.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0818.1.html | 2013-12-16 13:14 | 1.2K | MORRIS (HARMER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0818.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0818.2.html | 2013-12-16 13:14 | 22K | MORRIS v. HUNTINGTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0818.2.pdf | 2011-11-01 10:33 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0821.html | 2013-12-16 13:14 | 4.7K | MORRIS v. HURST. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0821.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0822.html | 2013-12-16 13:14 | 14K | MORRIS et al. v. LOWELL MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0822.pdf | 2011-11-01 10:33 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0824.1.html | 2013-12-16 13:14 | 1.2K | MORRIS (LUCAS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0824.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0824.2.html | 2013-12-16 13:14 | 5.6K | MORRIS v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0824.2.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0824.3.html | 2013-12-16 13:14 | 1.2K | MORRIS (NEW ORLEANS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0824.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0824.4.html | 2013-12-16 13:14 | 1.2K | MORRIS (PRICE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0824.4.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0825.html | 2013-12-16 13:14 | 27K | MORRIS v. ROYER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0825.pdf | 2011-11-01 10:33 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0829.1.html | 2013-12-16 13:14 | 5.0K | MORRIS et al. v. SHELBOURNE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0829.1.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0829.2.html | 2013-12-16 13:14 | 3.1K | MORRIS v. SUMMERL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0829.2.pdf | 2011-11-01 10:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0830.1.html | 2013-12-16 13:14 | 1.2K | MORRIS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0830.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0830.2.html | 2013-12-16 13:14 | 6.1K | The MORRISANIA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0830.2.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0831.1.html | 2013-12-16 13:14 | 1.3K | MORRIS AQUEDUCT (HAIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0831.1.pdf | 2011-11-01 10:33 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0831.2.html | 2013-12-16 13:14 | 5.5K | In re MORRISON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0831.2.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0831.3.html | 2013-12-16 13:14 | 5.6K | MORRISON v. ALEXANDER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0831.3.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0832.html | 2013-12-16 13:14 | 10K | MORRISON et al. v. AMERICAN POPULAR LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0832.pdf | 2011-11-01 10:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0833.html | 2013-12-16 13:14 | 15K | MORRISON et al v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0833.pdf | 2011-11-01 10:33 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0836.1.html | 2013-12-16 13:14 | 6.3K | MORRISON v. BENNET et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0836.1.pdf | 2011-11-01 10:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0836.2.html | 2013-12-16 13:14 | 6.1K | MORRISON v. BUCKNER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0836.2.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0837.html | 2013-12-16 13:14 | 5.7K | MORRISON et al. v. CASE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0837.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0838.1.html | 2013-12-16 13:14 | 2.4K | MORRISON v. CLIFFORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0838.1.pdf | 2011-11-01 10:33 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0838.2.html | 2013-12-16 13:14 | 1.2K | MORRISON (CRANE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0838.2.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0838.3.html | 2013-12-16 13:14 | 12K | MORRISON et al. v. The JOHN L. STEPHENS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0838.3.pdf | 2011-11-01 10:33 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0840.1.html | 2013-12-16 13:14 | 1.2K | MORRISON (NETTLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0840.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0840.2.html | 2013-12-16 13:14 | 1.2K | MORRISON (PATAPSCO GUANO CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0840.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0840.3.html | 2013-12-16 13:14 | 9.0K | MORRISON v. The PETALUMA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0840.3.pdf | 2011-11-01 10:33 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0841.1.html | 2013-12-16 13:14 | 1.2K | MORRISON (PHILADELPHIA & R. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0841.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0841.2.html | 2013-12-16 13:14 | 1.2K | MORRISON (STATE NAT. BANK OF MINNEAPOLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0841.2.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0841.3.html | 2013-12-16 13:14 | 25K | MORRISON et al. v. The UNICORN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0841.3.pdf | 2011-11-01 10:33 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0845.1.html | 2013-12-16 13:14 | 1.2K | MORRISON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0845.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0845.2.html | 2013-12-16 13:14 | 1.2K | MORRISON (WOODWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0845.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0845.3.html | 2013-12-16 13:14 | 7.2K | Ex parte MORROW et al., In re YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0845.3.pdf | 2011-11-01 10:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0846.1.html | 2013-12-16 13:14 | 1.2K | MORROW (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0846.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0846.2.html | 2013-12-16 13:14 | 13K | In re MORSE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0846.2.pdf | 2011-11-01 10:33 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0848.html | 2013-12-16 13:14 | 12K | In re MORSE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0848.pdf | 2011-11-01 10:33 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0850.html | 2013-12-16 13:14 | 11K | In re MORSE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0850.pdf | 2011-11-01 10:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0852.1.html | 2013-12-16 13:14 | 5.2K | In re MORSE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0852.1.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0852.2.html | 2013-12-16 13:14 | 1.2K | MORSE (BAIN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0852.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0852.3.html | 2013-12-16 13:14 | 1.2K | MORSE v. BAIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0852.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0852.4.html | 2013-12-16 13:14 | 14K | MORSE v. DAVIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0852.4.pdf | 2011-11-01 10:33 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0854.1.html | 2013-12-16 13:14 | 1.2K | MORSE (GASSETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0854.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0854.2.html | 2013-12-16 13:14 | 62K | MORSE v. GODFREY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0854.2.pdf | 2011-11-01 10:33 | 142K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0864.html | 2013-12-16 13:14 | 1.2K | MORSE (KELLOGG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0864.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0865.html | 2013-12-16 13:14 | 16K | MORSE et al. v. MASSACHUSETTS NAT. BANK., FISKE v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0865.pdf | 2011-11-01 10:33 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0867.html | 2013-12-16 13:14 | 23K | MORSE et al. v. O'REILLY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0867.pdf | 2011-11-01 10:33 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0871.html | 2013-12-16 13:14 | 15K | MORSE et al. v. O'REILLY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0871.pdf | 2011-11-01 10:33 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0873.1.html | 2013-12-16 13:14 | 1.2K | MORSE (O'REILLY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0873.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0873.2.html | 2013-12-16 13:14 | 2.2K | MORSE v. REED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0873.2.pdf | 2011-11-01 10:33 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0873.3.html | 2013-12-16 13:14 | 1.2K | MORSE (TILGHMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0873.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0873.4.html | 2013-12-16 13:14 | 1.2K | MORSE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0873.4.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0873.5.html | 2013-12-16 13:14 | 9.9K | MORSE & BAIN TEL. CASE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0873.5.pdf | 2011-11-01 10:33 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0875.html | 2013-12-16 13:14 | 19K | MORSE FOUNTAIN PEN CO. v. ESTERBROOK STEEL PEN MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0875.pdf | 2011-11-01 10:33 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0877.1.html | 2013-12-16 13:14 | 1.2K | MORTE (ALICE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0877.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0877.2.html | 2013-12-16 13:14 | 1.2K | MORTE (SAWYER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0877.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0877.3.html | 2013-12-16 13:14 | 1.2K | MORTEE (POWERS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0877.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0877.4.html | 2013-12-16 13:14 | 1.3K | MORTIMER v. ROSSTEUSCHER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0877.4.pdf | 2011-11-01 10:33 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0878.1.html | 2013-12-16 13:14 | 1.2K | MORTIMER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0878.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0878.2.html | 2013-12-16 13:14 | 10K | The MORTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0878.2.pdf | 2011-11-01 10:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.1.html | 2013-12-16 13:14 | 1.2K | MORTON (ATHON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.1.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.2.html | 2013-12-16 13:14 | 1.2K | MORTON (BARNARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.3.html | 2013-12-16 13:14 | 1.2K | MORTON (COOTS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.3.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.4.html | 2013-12-16 13:14 | 1.2K | MORTON (HOWE v.) |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.5.html | 2013-12-16 13:14 | 1.2K | MORTON (KRIESLER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.5.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0879.6.html | 2013-12-16 13:14 | 30K | MORTON v. NEW YORK EYE INFIRMARY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0879.6.pdf | 2011-11-01 10:33 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0884.html | 2013-12-16 13:14 | 9.2K | MORTON v. ROOT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0884.pdf | 2011-11-01 10:33 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0885.html | 2013-12-16 13:14 | 8.8K | MORTON v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0885.pdf | 2011-11-01 10:33 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0886.1.html | 2013-12-16 13:14 | 1.2K | MORTON (SWANSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0886.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0886.2.html | 2013-12-16 13:14 | 1.2K | MORTON (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0886.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0886.3.html | 2013-12-16 13:14 | 1.2K | MORTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0886.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0886.4.html | 2013-12-16 13:14 | 1.2K | MORTON (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0886.4.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0886.5.html | 2013-12-16 13:14 | 15K | In re MOSELEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0886.5.pdf | 2011-11-01 10:33 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0889.1.html | 2013-12-16 13:14 | 1.2K | MOSELEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0889.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0889.2.html | 2013-12-16 13:14 | 6.8K | In re MOSES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0889.2.pdf | 2011-11-01 10:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0890.1.html | 2013-12-16 13:14 | 1.2K | In re MOSES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0890.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0890.2.html | 2013-12-16 13:14 | 8.9K | MOSES et al. v. BOYD et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0890.2.pdf | 2011-11-01 10:33 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0891.html | 2013-12-16 13:14 | 11K | MOSES v. DELAWARE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0891.pdf | 2011-11-01 10:33 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0892.html | 2013-12-16 13:14 | 2.3K | MOSES v. DUNNAHO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0892.pdf | 2011-11-01 10:33 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0893.1.html | 2013-12-16 13:14 | 1.2K | MOSES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0893.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0893.2.html | 2013-12-16 13:14 | 7.7K | The MOSHER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0893.2.pdf | 2011-11-01 10:33 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0894.html | 2013-12-16 13:14 | 28K | The MOSLEM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0894.pdf | 2011-11-01 10:33 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0898.html | 2013-12-16 13:14 | 15K | The MOSLEM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0898.pdf | 2011-11-01 10:33 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0900.html | 2013-12-16 13:14 | 1.2K | MOSOROP (ELLZEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0900.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0901.1.html | 2013-12-16 13:14 | 4.4K | In re MOSS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0901.1.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0901.2.html | 2013-12-16 13:14 | 1.2K | MOSS, The (MAGEE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0901.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0901.3.html | 2013-12-16 13:14 | 1.2K | MOSS (RIDDLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0901.3.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0901.4.html | 2013-12-16 13:14 | 1.2K | MOTHERSHED (HEALY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0901.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0901.5.html | 2013-12-16 13:14 | 4.8K | In re MOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0901.5.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0902.html | 2013-12-16 13:14 | 7.6K | In re MOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0902.pdf | 2011-11-01 10:33 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0903.html | 2013-12-16 13:14 | 7.0K | In re MOTT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0903.pdf | 2011-11-01 10:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0904.html | 2013-12-16 13:14 | 7.6K | In re MOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0904.pdf | 2011-11-01 10:33 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0905.1.html | 2013-12-16 13:14 | 5.9K | MOTT v. MARIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0905.1.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0905.2.html | 2013-12-16 13:14 | 1.2K | MOTT (RIDDLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0905.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0905.3.html | 2013-12-16 13:14 | 12K | MOTT v. RUCKMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0905.3.pdf | 2011-11-01 10:33 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0907.1.html | 2013-12-16 13:14 | 1.2K | MOTT (SHERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0907.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0907.2.html | 2013-12-16 13:14 | 2.6K | MOTT v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0907.2.pdf | 2011-11-01 10:33 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0907.3.html | 2013-12-16 13:14 | 1.2K | MOTT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0907.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0907.4.html | 2013-12-16 13:14 | 15K | MOTT v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0907.4.pdf | 2011-11-01 10:33 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0909.html | 2013-12-16 13:14 | 47K | MOTTE v. BENNETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0909.pdf | 2011-11-01 10:33 | 113K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.1.html | 2013-12-16 13:14 | 1.2K | MOULSON (FIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.2.html | 2013-12-16 13:14 | 3.2K | In re MOULTON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.2.pdf | 2011-11-01 10:33 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.3.html | 2013-12-16 13:14 | 1.2K | MOULTON (BACHELDER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.4.html | 2013-12-16 13:14 | 1.2K | MOULTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.5.html | 2013-12-16 13:14 | 1.2K | MOUNGER (POE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.5.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0917.6.html | 2013-12-16 13:14 | 5.8K | In re MOUNT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0917.6.pdf | 2011-11-01 10:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0918.html | 2013-12-16 13:14 | 44K | MOUNT DIABLO MILL & MINING CO. v. CALLISON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0918.pdf | 2011-11-01 10:33 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0925.1.html | 2013-12-16 13:14 | 1.2K | MOUNTFORD (WILMARTH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0925.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0925.2.html | 2013-12-16 13:14 | 1.2K | MOUNTJOY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0925.2.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0925.3.html | 2013-12-16 13:14 | 1.2K | MOUNT PLEASANT (FOOTE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0925.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0925.4.html | 2013-12-16 13:14 | 16K | The MOUNT WASHINGTON., GEIGER v. The MOUNT WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0925.4.pdf | 2011-11-01 10:33 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0928.1.html | 2013-12-16 13:14 | 5.5K | The MOUNT WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0928.1.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0928.2.html | 2013-12-16 13:14 | 1.2K | MOUNTZ (HODGSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0928.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0928.3.html | 2013-12-16 13:14 | 4.3K | MOUNTZ v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0928.3.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0929.1.html | 2013-12-16 13:14 | 3.5K | MOWATT v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0929.1.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0929.2.html | 2013-12-16 13:14 | 1.2K | MOWATT (STOKES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0929.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0929.3.html | 2013-12-16 13:14 | 1.2K | MOWBRAY (ATLANTIC GIANT POWDER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0929.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0929.4.html | 2013-12-16 13:14 | 3.5K | MOWER et al. v. BURDICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0929.4.pdf | 2011-11-01 10:33 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0930.html | 2013-12-16 13:14 | 34K | MOWREY v. INDIANAPOLIS & C. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0930.pdf | 2011-11-01 10:33 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0935.html | 2013-12-16 13:14 | 13K | MOWRY v. BARBER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0935.pdf | 2011-11-01 10:33 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0936.html | 2013-12-16 13:14 | 1.2K | MOWRY (DUNLEVY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0936.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0937.html | 2013-12-16 13:14 | 20K | MOWRY et al. v. GRAND STREET & N. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0937.pdf | 2011-11-01 10:33 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0940.1.html | 2013-12-16 13:14 | 1.2K | MOWRY (WHITNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0940.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0940.2.html | 2013-12-16 13:14 | 16K | The MOXEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0940.2.pdf | 2011-11-01 10:33 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0942.1.html | 2013-12-16 13:14 | 1.2K | MOXLEY (HAYMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0942.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0942.2.html | 2013-12-16 13:14 | 1.2K | MOXLEY (NAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0942.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0942.3.html | 2013-12-16 13:14 | 1.2K | MOXLEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0942.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0942.4.html | 2013-12-16 13:14 | 35K | MOXON et al. v. The FANNY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0942.4.pdf | 2011-11-01 10:33 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0948.1.html | 2013-12-16 13:14 | 1.2K | The MOXY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0948.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0948.2.html | 2013-12-16 13:14 | 1.2K | MOYER (DIXON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0948.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0948.3.html | 2013-12-16 13:14 | 19K | MOYNAHAN v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0948.3.pdf | 2011-11-01 10:33 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0951.1.html | 2013-12-16 13:14 | 1.2K | M. P. RICH, The (BURKE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0951.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0951.2.html | 2013-12-16 13:14 | 11K | The M. R. BRAZOS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0951.2.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0952.html | 2013-12-16 13:14 | 9.1K | The M. S. BACON v. ERIE & W. TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0952.pdf | 2011-11-01 10:33 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.1.html | 2013-12-16 13:14 | 1.2K | MUCKEY (GOODFELLOW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.2.html | 2013-12-16 13:14 | 2.2K | Ex parte MUDD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.2.pdf | 2011-11-01 10:33 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.3.html | 2013-12-16 13:14 | 3.8K | MUDD v. CLEMENTS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.3.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.4.html | 2013-12-16 13:14 | 1.2K | MUDD (CRIPPS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.5.html | 2013-12-16 13:14 | 1.2K | MUDD (FRERE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.5.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.6.html | 2013-12-16 13:14 | 1.2K | MUGGRIDGE (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.6.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.7.html | 2013-12-16 13:14 | 1.2K | MUIR, In re. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.7.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0954.8.html | 2013-12-16 13:14 | 12K | MUIR et al. v. The BRISK et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0954.8.pdf | 2011-11-01 10:33 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0956.1.html | 2013-12-16 13:14 | 2.5K | MUIR v. GEIGER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0956.1.pdf | 2011-11-01 10:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0956.2.html | 2013-12-16 13:14 | 4.9K | MUIR v. JENKINS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0956.2.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0957.html | 2013-12-16 13:14 | 11K | MUIRHEAD v. ALDRIDGE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0957.pdf | 2011-11-01 10:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0958.html | 2013-12-16 13:14 | 4.5K | In re MULDAUR et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0958.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0959.1.html | 2013-12-16 13:14 | 3.8K | In re MULDAUR et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0959.1.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0959.2.html | 2013-12-16 13:14 | 13K | MULFORD et al. v. PEARCE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0959.2.pdf | 2011-11-01 10:33 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0961.html | 2013-12-16 13:14 | 8.3K | MULFORD et al. v. PEARCE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0961.pdf | 2011-11-01 10:33 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0962.1.html | 2013-12-16 13:14 | 1.2K | The MULGRAVE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0962.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0962.2.html | 2013-12-16 13:14 | 38K | The MULHOUSE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0962.2.pdf | 2011-11-01 10:33 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0968.1.html | 2013-12-16 13:14 | 1.2K | MULLANY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0968.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0968.2.html | 2013-12-16 13:14 | 15K | In re MULLEE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0968.2.pdf | 2011-11-01 10:33 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0971.1.html | 2013-12-16 13:14 | 1.2K | MULLEE (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0971.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0971.2.html | 2013-12-16 13:14 | 25K | In re MULLER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0971.2.pdf | 2011-11-01 10:33 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0975.html | 2013-12-16 13:14 | 16K | MULLER'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0975.pdf | 2011-11-01 10:33 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0977.html | 2013-12-16 13:14 | 5.0K | MULLER v. BOHLENS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0977.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0978.1.html | 2013-12-16 13:14 | 1.2K | MULLER v. ERICH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0978.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0978.2.html | 2013-12-16 13:14 | 25K | MULLER v. HENRY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0978.2.pdf | 2011-11-01 10:33 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.1.html | 2013-12-16 13:14 | 4.0K | MULLER et al. v. The IGINIA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.1.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.2.html | 2013-12-16 13:14 | 1.2K | MULLER (JENNINGS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.3.html | 2013-12-16 13:14 | 1.2K | MULLER (POTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.4.html | 2013-12-16 13:14 | 1.2K | MULVANEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.5.html | 2013-12-16 13:14 | 2.5K | MUMFORD v. MUMFORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.5.pdf | 2011-11-01 10:33 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0982.6.html | 2013-12-16 13:14 | 6.3K | MUMM v. OWENS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0982.6.pdf | 2011-11-01 10:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0983.html | 2013-12-16 13:14 | 3.6K | MUNCASTER v. MASON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0983.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0984.1.html | 2013-12-16 13:14 | 1.2K | MUNCASTER (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0984.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0984.2.html | 2013-12-16 13:14 | 13K | HUNCH et al. v. The SUCKER STATE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0984.2.pdf | 2011-11-01 10:33 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0985.html | 2013-12-16 13:14 | 1.2K | MUNCIE NAT. BANK (BARNETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0985.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0986.1.html | 2013-12-16 13:14 | 1.3K | MUNCIE NAT. BANK v. BARNITS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0986.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0986.2.html | 2013-12-16 13:14 | 1.2K | MUNDELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0986.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0986.3.html | 2013-12-16 13:14 | 1.2K | MUNFORD (ALSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0986.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0986.4.html | 2013-12-16 13:14 | 1.2K | MUNFORD v. BALCH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0986.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0986.5.html | 2013-12-16 13:14 | 18K | In re MUNGER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0986.5.pdf | 2011-11-01 10:33 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0988.1.html | 2013-12-16 13:14 | 1.2K | MUNGER (CURRAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0988.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0988.2.html | 2013-12-16 13:14 | 1.2K | MUNGER (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0988.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0989.1.html | 2013-12-16 13:14 | 4.8K | MUNGOSAH v. STEINBROOK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0989.1.pdf | 2011-11-01 10:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0989.2.html | 2013-12-16 13:14 | 23K | In re MUNN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0989.2.pdf | 2011-11-01 10:33 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0993.html | 2013-12-16 13:14 | 30K | MUNNS v. DE NEMOURS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0993.pdf | 2011-11-01 10:33 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0997.1.html | 2013-12-16 13:14 | 1.2K | MUNNS v. DE WEMOURS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0997.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0997.2.html | 2013-12-16 13:14 | 1.2K | MUNRO (PAGE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0997.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0997.3.html | 2013-12-16 13:14 | 3.5K | MUNRO v. ROBERTSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0997.3.pdf | 2011-11-01 10:33 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.1.html | 2013-12-16 13:14 | 4.2K | MUNROE v. COOKE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.1.pdf | 2011-11-01 10:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.2.html | 2013-12-16 13:14 | 1.2K | MUNROE (DEXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.2.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.3.html | 2013-12-16 13:14 | 1.2K | MUNROE (DUNLOP v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.3.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.4.html | 2013-12-16 13:14 | 1.2K | MUNROE (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.4.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.5.html | 2013-12-16 13:14 | 3.2K | MUNROE v. MANDEVILLE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.5.pdf | 2011-11-01 10:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0998.6.html | 2013-12-16 13:14 | 3.9K | MUNROE v. TOWERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0998.6.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0999.1.html | 2013-12-16 13:14 | 1.2K | MUNROE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0999.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0999.2.html | 2013-12-16 13:14 | 3.8K | MUNS v. DE NEMOURS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0999.2.pdf | 2011-11-01 10:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.0999.3.html | 2013-12-16 13:14 | 5.2K | MUNSELL et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.0999.3.pdf | 2011-11-01 10:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1000.html | 2013-12-16 13:14 | 8.8K | Ex parte MUNSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1000.pdf | 2011-11-01 10:33 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1001.1.html | 2013-12-16 13:14 | 1.2K | MUNSON (BLACK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1001.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1001.2.html | 2013-12-16 13:14 | 7.1K | MUNSON et al. v. GILBERT & B. MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1001.2.pdf | 2011-11-01 10:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1002.html | 2013-12-16 13:14 | 22K | MUNSON v. LYONS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1002.pdf | 2011-11-01 10:33 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1005.1.html | 2013-12-16 13:14 | 1.2K | MUNSON (TILLOTSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1005.1.pdf | 2011-11-01 10:33 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1005.2.html | 2013-12-16 13:14 | 18K | MURATI v. LUCIANI. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1005.2.pdf | 2011-11-01 10:33 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1008.1.html | 2013-12-16 13:14 | 1.2K | MURDOCH (KEITH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1008.1.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1008.2.html | 2013-12-16 13:14 | 1.2K | MURDOCH v. SHACKELFORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1008.2.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1008.3.html | 2013-12-16 13:14 | 1.2K | MURDOCH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1008.3.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1008.4.html | 2013-12-16 13:14 | 1.2K | MURDOCH (WHETMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1008.4.pdf | 2011-11-01 10:33 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1008.5.html | 2013-12-16 13:14 | 11K | MURDOCK et al. v. SHACKELFORD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1008.5.pdf | 2011-11-01 10:33 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1010.1.html | 2013-12-16 13:14 | 1.2K | In re MURDOCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1010.1.pdf | 2011-11-01 10:33 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1010.2.html | 2013-12-16 13:14 | 14K | In re MURDOCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1010.2.pdf | 2011-11-01 10:34 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1012.html | 2013-12-16 13:14 | 4.4K | MURDOCK v. The EMMA GRAHAM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1012.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1013.html | 2013-12-16 13:14 | 30K | MURDOCK et al. v. HUNTER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1013.pdf | 2011-11-01 10:34 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1017.1.html | 2013-12-16 13:14 | 1.2K | MURDOCK (WHETMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1017.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1017.2.html | 2013-12-16 13:14 | 54K | MURDOCK et al. v. WOODSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1017.2.pdf | 2011-11-01 10:34 | 128K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1026.1.html | 2013-12-16 13:14 | 1.2K | MURGATROYD (DUSAR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1026.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1026.2.html | 2013-12-16 13:14 | 2.6K | MURGATROYD v. McLURE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1026.2.pdf | 2011-11-01 10:34 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1026.3.html | 2013-12-16 13:14 | 9.7K | The MURIEL., WILLIAMS v. SHALLCROSS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1026.3.pdf | 2011-11-01 10:34 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1027.1.html | 2013-12-16 13:14 | 1.2K | MURNEY v. The SYLVESTER HALE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1027.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1027.2.html | 2013-12-16 13:14 | 1.2K | MURPHEY (WILKINGS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1027.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1027.3.html | 2013-12-16 13:14 | 14K | MURPHREY et al. v. OLD DOMINION INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1027.3.pdf | 2011-11-01 10:34 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1030.1.html | 2013-12-16 13:14 | 3.7K | In re MURPHY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1030.1.pdf | 2011-11-01 10:34 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1030.2.html | 2013-12-16 13:14 | 15K | In re MURPHY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1030.2.pdf | 2011-11-01 10:34 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1032.1.html | 2013-12-16 13:14 | 1.2K | MURPHY (BENSUSAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1032.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1032.2.html | 2013-12-16 13:14 | 1.2K | MURPHY (BRUCE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1032.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1032.3.html | 2013-12-16 13:14 | 4.8K | MURPHY v. BYRD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1032.3.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1033.1.html | 2013-12-16 13:14 | 4.1K | MURPHY v. BYRD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1033.1.pdf | 2011-11-01 10:34 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1033.2.html | 2013-12-16 13:14 | 2.6K | MURPHY v. CAMAC. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1033.2.pdf | 2011-11-01 10:34 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1034.1.html | 2013-12-16 13:14 | 1.2K | MURPHY (COMMONWEALTH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1034.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1034.2.html | 2013-12-16 13:14 | 1.2K | MURPHY (DUDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1034.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1034.3.html | 2013-12-16 13:14 | 12K | MURPHY et al. v. EASTHAM et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1034.3.pdf | 2011-11-01 10:34 | 61K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.1034_01.jpg | 2011-04-06 08:45 | 10K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1035.html | 2013-12-16 13:14 | 1.2K | MURPHY (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1035.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1036.1.html | 2013-12-16 13:14 | 5.5K | MURPHY v. HOWARD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1036.1.pdf | 2011-11-01 10:34 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1036.2.html | 2013-12-16 13:14 | 1.2K | MURPHY (JAFFRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1036.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1036.3.html | 2013-12-16 13:14 | 5.8K | MURPHY et al. v. KISSLING et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1036.3.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1037.1.html | 2013-12-16 13:14 | 1.2K | MURPHY (LENG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1037.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1037.2.html | 2013-12-16 13:14 | 4.6K | MURPHY v. LEWIS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1037.2.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1038.1.html | 2013-12-16 13:14 | 4.1K | MURPHY v. McVICKER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1038.1.pdf | 2011-11-01 10:34 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1038.2.html | 2013-12-16 13:14 | 1.2K | MURPHY (MARRETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1038.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1038.3.html | 2013-12-16 13:14 | 12K | MURPHY v. PAYNTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1038.3.pdf | 2011-11-01 10:34 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1040.1.html | 2013-12-16 13:14 | 1.2K | MURPHY v. The SANTIAGO DE CUBA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1040.1.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1040.2.html | 2013-12-16 13:14 | 3.7K | MURPHY v. TINDALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1040.2.pdf | 2011-11-01 10:34 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1040.3.html | 2013-12-16 13:14 | 1.2K | MURPHY (ULLMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1040.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1040.4.html | 2013-12-16 13:14 | 1.2K | MURPHY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1040.4.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1040.5.html | 2013-12-16 13:14 | 7.6K | In re MURRAY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1040.5.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1041.html | 2013-12-16 13:14 | 10K | In re MURRAY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1041.pdf | 2011-11-01 10:34 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1043.html | 2013-12-16 13:14 | 17K | MURRAY v. AETNA INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1043.pdf | 2011-11-01 10:34 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1045.1.html | 2013-12-16 13:14 | 1.3K | MURRAY (AMERICAN BUTTON—HOLE, OVER—SEAMING & SEWING—MACHINE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1045.1.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1045.2.html | 2013-12-16 13:14 | 8.2K | MURRAY v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1045.2.pdf | 2011-11-01 10:34 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1046.html | 2013-12-16 13:14 | 3.1K | MURRAY v. BECK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1046.pdf | 2011-11-01 10:34 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1047.1.html | 2013-12-16 13:14 | 1.2K | MURRAY (COX v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1047.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1047.2.html | 2013-12-16 13:14 | 3.6K | MURRAY v. DONNELLY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1047.2.pdf | 2011-11-01 10:34 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1047.3.html | 2013-12-16 13:14 | 2.7K | MURRAY v. DOWLING. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1047.3.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1047.4.html | 2013-12-16 13:14 | 2.3K | MURRAY v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1047.4.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1048.1.html | 2013-12-16 13:14 | 1.2K | MURRAY (DUSTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1048.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1048.2.html | 2013-12-16 13:14 | 1.2K | MURRAY (FORBES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1048.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1048.3.html | 2013-12-16 13:14 | 1.2K | MURRAY (GALLAGHER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1048.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1048.4.html | 2013-12-16 13:14 | 1.2K | MURRAY (HILL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1048.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1048.5.html | 2013-12-16 13:14 | 11K | MURRAY et al. v. INSURANCE CO. OF PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1048.5.pdf | 2011-11-01 10:34 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1049.html | 2013-12-16 13:14 | 18K | MURRAY et al. v. LAZARUS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1049.pdf | 2011-11-01 10:34 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1052.html | 2013-12-16 13:14 | 39K | MURRAY v. LOVEJOY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1052.pdf | 2011-11-01 10:34 | 98K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1057.html | 2013-12-16 13:14 | 14K | MURRAY v. McLANE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1057.pdf | 2011-11-01 10:34 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1059.1.html | 2013-12-16 13:14 | 1.2K | MURRAY (MAIN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1059.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1059.2.html | 2013-12-16 13:14 | 5.3K | MURRAY et al. v. MARSH et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1059.2.pdf | 2011-11-01 10:34 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1060.html | 2013-12-16 13:14 | 6.5K | MURRAY v. MASON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1060.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1061.1.html | 2013-12-16 13:14 | 1.2K | MURRAY (NICHOLAS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1061.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1061.2.html | 2013-12-16 13:14 | 1.2K | MURRAY (OTT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1061.2.pdf | 2011-11-01 10:34 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1061.3.html | 2013-12-16 13:14 | 9.6K | MURRAY et al. v. PATRIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1061.3.pdf | 2011-11-01 10:34 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1062.1.html | 2013-12-16 13:14 | 1.2K | MURRAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1062.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1062.2.html | 2013-12-16 13:14 | 1.2K | MURRAY (WOOLFOLK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1062.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1062.3.html | 2013-12-16 13:14 | 16K | In re MURRIN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1062.3.pdf | 2011-11-01 10:34 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1065.1.html | 2013-12-16 13:14 | 1.2K | MURRIN v. OWEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1065.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1065.2.html | 2013-12-16 13:14 | 3.2K | MURTAGH v. PHILADELPHIA et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1065.2.pdf | 2011-11-01 10:34 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1065.3.html | 2013-12-16 13:14 | 1.2K | MURTHA (KNOX v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1065.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1065.4.html | 2013-12-16 13:14 | 12K | MUSCAN HAIR MANUF'G CO. v. AMERICAN HAIR MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1065.4.pdf | 2011-11-01 10:34 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1067.html | 2013-12-16 13:14 | 22K | MUSCATINE v. MISSISSIPPI & M. R. CO. et al. MUSCATINE COUNTY v. SAME. LETZ et al. v. CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1067.pdf | 2011-11-01 10:34 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1070.1.html | 2013-12-16 13:14 | 1.2K | MUSCATINE COUNTY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1070.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1070.2.html | 2013-12-16 13:14 | 1.2K | MUSE (COATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1070.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1070.3.html | 2013-12-16 13:14 | 1.2K | MUSGROVE (INGERSOLL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1070.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1070.4.html | 2013-12-16 13:14 | 9.6K | MUSSEL WHITE et al. v. RECEIVERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1070.4.pdf | 2011-11-01 10:34 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1072.1.html | 2013-12-16 13:14 | 6.8K | MUSSER v. CURRY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1072.1.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1072.2.html | 2013-12-16 13:14 | 1.2K | MUSST (DUPONTI v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1072.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1072.3.html | 2013-12-16 13:14 | 1.2K | MUSTIN (THRUSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1072.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1073.1.html | 2013-12-16 13:14 | 2.3K | MUTTER v. HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1073.1.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1073.2.html | 2013-12-16 13:14 | 11K | MUTUAL BENEFIT LIFE INS. CO. v. CHARLES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1073.2.pdf | 2011-11-01 10:34 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.1.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (DESMAZES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.2.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (MARKEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.3.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (NEWTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.4.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS CO. (NIMICK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.4.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.5.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.5.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.6.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (SPARROW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.6.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1074.7.html | 2013-12-16 13:14 | 1.2K | MUTUAL BENEFIT LIFE INS. CO. (TISDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1074.7.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1075.html | 2013-12-16 13:14 | 9.9K | In re MUTUAL BUILDING FUND SOC. & DOLLAR SAV. BANK., Ex parte BEATTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1075.pdf | 2011-11-01 10:34 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1076.html | 2013-12-16 13:14 | 13K | MUTUAL BUILDING FUND SOC. & DOLLAR SAV. BANK v. BOSSIEUX et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1076.pdf | 2011-11-01 10:34 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.1.html | 2013-12-16 13:14 | 1.2K | MUTUAL, COMMERCIAL MARINE INS. CO. (OLIVER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.2.html | 2013-12-16 13:14 | 4.3K | MUTUAL FIRE INS. CO. v. The S. G. ANDREWS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.2.pdf | 2011-11-01 10:34 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.3.html | 2013-12-16 13:14 | 1.2K | MUTUAL, INS. CO. (SHERWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.4.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (ANDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.4.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.5.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (BATTLE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.5.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.6.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.6.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.7.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.7.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.8.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (NEWCOMB v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.8.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.9.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (QUIGLEY v.) |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.9.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.10.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (SHATTUCK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.10.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.11.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (SNYDER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.11.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1078.12.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (WATERS v.) |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1078.12.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1079.html | 2013-12-16 13:14 | 13K | MUTUAL LIFE INS. CO. v. WILCOX et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1079.pdf | 2011-11-01 10:34 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1081.html | 2013-12-16 13:14 | 12K | MUTUAL LIFE INS. CO. v. WILCOX. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1081.pdf | 2011-11-01 10:34 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1082.1.html | 2013-12-16 13:14 | 1.2K | MUTUAL LIFE INS. CO. (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1082.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1082.2.html | 2013-12-16 13:14 | 35K | MUTUAL SAFETY INS. CO. et al. v. CARGO OF THE GEORGE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1082.2.pdf | 2011-11-01 10:34 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1088.html | 2013-12-16 13:14 | 35K | MUTUAL SAFETY INS. CO. et al. v. CARGO OF THE GEORGE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1088.pdf | 2011-11-01 10:34 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1093.1.html | 2013-12-16 13:14 | 1.2K | MUTUAL SAFETY INSURANCE CO. (HENSHAW v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1093.1.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1093.2.html | 2013-12-16 13:14 | 1.2K | MUXLOW (WIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1093.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1093.3.html | 2013-12-16 13:14 | 1.2K | MUZZY IRON WORKS (HUTCHINGS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1093.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1093.4.html | 2013-12-16 13:14 | 23K | The M. W. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1093.4.pdf | 2011-11-01 10:34 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1097.1.html | 2013-12-16 13:14 | 1.2K | MYER (STETTINIUS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1097.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1097.2.html | 2013-12-16 13:14 | 8.6K | In re MYERS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1097.2.pdf | 2011-11-01 10:34 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1098.1.html | 2013-12-16 13:14 | 1.2K | MYERS (COOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1098.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1098.2.html | 2013-12-16 13:14 | 26K | MYERS v. COTTRILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1098.2.pdf | 2011-11-01 10:34 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1102.1.html | 2013-12-16 13:14 | 1.2K | MYERS (CUTTING v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1102.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1102.2.html | 2013-12-16 13:14 | 8.2K | MYERS v. DAVIS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1102.2.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1103.html | 2013-12-16 13:14 | 9.0K | MYERS et al. v. D'MEZA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1103.pdf | 2011-11-01 10:34 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1105.html | 2013-12-16 13:14 | 22K | MYERS v. DORR et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1105.pdf | 2011-11-01 10:34 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1108.html | 2013-12-16 13:14 | 6.2K | MYERS et al. v. DUKER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1108.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1109.html | 2013-12-16 13:14 | 10K | MYERS et al. v. DUNBAR et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1109.pdf | 2011-11-01 10:34 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1110.1.html | 2013-12-16 13:14 | 1.2K | MYERS v. DUNBAR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1110.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1110.2.html | 2013-12-16 13:14 | 1.2K | MYERS v. EUNSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1110.2.pdf | 2011-11-01 10:34 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1110.3.html | 2013-12-16 13:14 | 37K | MYERS v. FRAME et al. MYERS v. DUNBAR et al. SAME v. SWIFT. EUNSON et al. v. PEDDIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1110.3.pdf | 2011-11-01 10:34 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1116.html | 2013-12-16 13:14 | 6.0K | MYERS v. The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1116.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1117.1.html | 2013-12-16 13:14 | 1.2K | MYERS (HILL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1117.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1117.2.html | 2013-12-16 13:14 | 6.0K | MYERS v. The LIZZIE HOPKINS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1117.2.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1117.3.html | 2013-12-16 13:14 | 1.2K | MYERS (LYMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1117.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1118.1.html | 2013-12-16 13:14 | 1.2K | MYERS (PENNSYLVANIA SALT MANUF'G. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1118.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1118.2.html | 2013-12-16 13:14 | 1.2K | MYERS (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1118.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1118.3.html | 2013-12-16 13:14 | 10K | MYERS v. SEELEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1118.3.pdf | 2011-11-01 10:34 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1119.1.html | 2013-12-16 13:14 | 1.2K | MYERS v. SWIFT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1119.1.pdf | 2011-11-01 10:34 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1119.2.html | 2013-12-16 13:14 | 7.0K | MYERS v. TYSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1119.2.pdf | 2011-11-01 10:34 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1120.html | 2013-12-16 13:14 | 16K | MYERS v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1120.pdf | 2011-11-01 10:34 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1122.1.html | 2013-12-16 13:14 | 1.2K | MYERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1122.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1122.2.html | 2013-12-16 13:14 | 1.2K | MYERS (VALLEY NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1122.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1122.3.html | 2013-12-16 13:14 | 1.2K | MYERS (WYTHE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1122.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1122.4.html | 2013-12-16 13:14 | 27K | MYERS v. YORK & C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1122.4.pdf | 2011-11-01 10:34 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1127.html | 2013-12-16 13:14 | 20K | MYGATT v. GREEN BAY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1127.pdf | 2011-11-01 10:34 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1130.1.html | 2013-12-16 13:14 | 1.2K | MYNDERSE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1130.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1130.2.html | 2013-12-16 13:14 | 7.3K | In re MYRICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1130.2.pdf | 2011-11-01 10:34 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1131.1.html | 2013-12-16 13:14 | 4.8K | In re MYRICK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1131.1.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1131.2.html | 2013-12-16 13:14 | 28K | MYRICK v. MICHIGAN CENT. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1131.2.pdf | 2011-11-01 10:34 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1135.1.html | 2013-12-16 13:14 | 1.2K | MYRICK (WATERBURY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1135.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1135.2.html | 2013-12-16 13:14 | 1.2K | MYTINGER v. The FLOATING ZEPHYR. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1135.2.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1136.html | 2013-12-16 13:14 | 22K | The NABOB. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1136.pdf | 2011-11-01 10:34 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1139.1.html | 2013-12-16 13:14 | 1.2K | NABORS v. ALEXANDER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1139.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1139.2.html | 2013-12-16 13:14 | 41K | NACHTRIEB v. The HARMONY SETTLEMENT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1139.2.pdf | 2011-11-01 10:34 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.1.html | 2013-12-16 13:14 | 1.2K | NAGLE (CAREY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.2.html | 2013-12-16 13:14 | 1.2K | NAGLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.3.html | 2013-12-16 13:14 | 2.5K | NAILOR v. KEARNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.3.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.4.html | 2013-12-16 13:14 | 1.2K | NAILOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.5.html | 2013-12-16 13:14 | 1.2K | NAIRAC (ECHEVERIA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.5.pdf | 2011-11-01 10:34 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.6.html | 2013-12-16 13:14 | 1.2K | NAIRN (COUMBE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.6.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.7.html | 2013-12-16 13:14 | 1.2K | NALAN (COOMBS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.7.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1146.8.html | 2013-12-16 13:14 | 8.1K | NALL et al. v. The ILLINOIS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1146.8.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1147.1.html | 2013-12-16 13:14 | 2.4K | NALLY v. LAMBBLL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1147.1.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1147.2.html | 2013-12-16 13:14 | 2.5K | NAN et al. v. MOXLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1147.2.pdf | 2011-11-01 10:34 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.1.html | 2013-12-16 13:14 | 6.6K | The NANCY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.1.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.2.html | 2013-12-16 13:14 | 1.2K | NANCY, The (BRICE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.3.html | 2013-12-16 13:14 | 1.2K | NANCY, The (BRITISH CONSUL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.4.html | 2013-12-16 13:14 | 1.2K | NANCY, The (SCHUTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.5.html | 2013-12-16 13:14 | 1.2K | NANCY, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.5.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.6.html | 2013-12-16 13:14 | 1.2K | NANNY, The (THOMSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.6.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1148.7.html | 2013-12-16 13:14 | 1.2K | NANTUCKET STEAMBOAT CO. (CITIZENS' BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1148.7.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1149.1.html | 2013-12-16 13:14 | 6.0K | NAPIER et al. v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1149.1.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1149.2.html | 2013-12-16 13:14 | 8.3K | NAPIER et al. v. SERVER et al |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1149.2.pdf | 2011-11-01 10:34 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1150.html | 2013-12-16 13:14 | 17K | The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1150.pdf | 2011-11-01 10:34 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1153.html | 2013-12-16 13:14 | 9.5K | The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1153.pdf | 2011-11-01 10:34 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1154.html | 2013-12-16 13:14 | 13K | The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1154.pdf | 2011-11-01 10:34 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1156.html | 2013-12-16 13:14 | 7.8K | The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1156.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1157.html | 2013-12-16 13:14 | 16K | The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1157.pdf | 2011-11-01 10:34 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1160.1.html | 2013-12-16 13:14 | 1.2K | NAPOLEON, The (PEASE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1160.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1160.2.html | 2013-12-16 13:14 | 10K | The NARRAGANSETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1160.2.pdf | 2011-11-01 10:34 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1161.html | 2013-12-16 13:14 | 16K | The NARRAGANSETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1161.pdf | 2011-11-01 10:34 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1164.html | 2013-12-16 13:14 | 8.6K | The NARRAGANSETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1164.pdf | 2011-11-01 10:34 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1165.html | 2013-12-16 13:14 | 22K | The NARRAGANSETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1165.pdf | 2011-11-01 10:34 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1169.html | 2013-12-16 13:14 | 16K | The NARRAGANSETT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1169.pdf | 2011-11-01 10:34 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1171.1.html | 2013-12-16 13:14 | 1.2K | NARRAGANSETT STEAMSHIP CO. v. CONNOLLY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1171.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1171.2.html | 2013-12-16 13:14 | 1.2K | NARRAGANSETT STEAMSHIP CO. v. PONTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1171.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1171.3.html | 2013-12-16 13:14 | 1.2K | NARVAEZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1171.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1171.4.html | 2013-12-16 13:14 | 1.2K | NASBAUM v. EMERY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1171.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1171.5.html | 2013-12-16 13:14 | 26K | NASH v. LE CLERCQ et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1171.5.pdf | 2011-11-01 10:34 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1175.html | 2013-12-16 13:14 | 8.1K | NASH v. The THEBES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1175.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1176.1.html | 2013-12-16 13:14 | 1.2K | NASH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1176.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1176.2.html | 2013-12-16 13:14 | 1.2K | NASH (WESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1176.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1176.3.html | 2013-12-16 13:14 | 16K | The NASHVILLE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1176.3.pdf | 2011-11-01 10:34 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1179.1.html | 2013-12-16 13:14 | 1.2K | NASHVILLE & C. R. CO. (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1179.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1179.2.html | 2013-12-16 13:14 | 5.7K | NASON et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1179.2.pdf | 2011-11-01 10:34 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1179.3.html | 2013-12-16 13:14 | 5.9K | The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1179.3.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1180.html | 2013-12-16 13:14 | 5.5K | The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1180.pdf | 2011-11-01 10:34 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1181.html | 2013-12-16 13:14 | 17K | The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1181.pdf | 2011-11-01 10:34 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1183.html | 2013-12-16 13:14 | 4.6K | The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1183.pdf | 2011-11-01 10:34 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.1.html | 2013-12-16 13:14 | 1.2K | NASSAU, The (HARLAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.2.html | 2013-12-16 13:14 | 1.2K | NATCHEZ, The (BATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.3.html | 2013-12-16 13:14 | 1.2K | NATCHEZ, The (FAWCETT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.4.html | 2013-12-16 13:14 | 1.2K | NATHAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.5.html | 2013-12-16 13:14 | 2.9K | The NATHAN HANNAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.5.pdf | 2011-11-01 10:34 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.6.html | 2013-12-16 13:14 | 1.2K | NATHANIEL HOLMES, The (MILLS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.6.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1184.7.html | 2013-12-16 13:14 | 5.1K | The NATHANIEL HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1184.7.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1185.1.html | 2013-12-16 13:14 | 1.3K | The NATHANIEL HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1185.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1185.2.html | 2013-12-16 13:14 | 97K | The NATHANIEL HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1185.2.pdf | 2011-11-01 10:34 | 218K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1201.html | 2013-12-16 13:14 | 6.1K | The NATHANIEL KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1201.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.1.html | 2013-12-16 13:14 | 1.4K | NATIONAL BANK v. COLTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.1.pdf | 2011-11-01 10:34 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.2.html | 2013-12-16 13:14 | 1.3K | NATIONAL BANK v. DODGE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.2.pdf | 2011-11-01 10:34 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.3.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK-NOTE CO. (TAPPAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.4.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK-NOTE CO. (TOPPAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.4.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.5.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK OF CLEVELAND v. SIMMONS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.5.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.6.html | 2013-12-16 13:14 | 4.6K | NATIONAL BANK OF COMMERCE v. BOOTH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.6.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.7.html | 2013-12-16 13:14 | 1.3K | NATIONAL BANK OF COMMERCE (MERCHANTS' NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.7.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.8.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK OF FAYETTEVILLE (MEAD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.8.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1202.9.html | 2013-12-16 13:14 | 27K | NATIONAL BANK OF FREDERICKSBURG v. CONWAY et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1202.9.pdf | 2011-11-01 10:34 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1207.html | 2013-12-16 13:14 | 9.1K | NATIONAL BANK OF MADISON v. DAVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1207.pdf | 2011-11-01 10:34 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1208.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK OF MISSOURI (LEVI v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1208.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1208.2.html | 2013-12-16 13:14 | 1.2K | NATIONAL BANK OF MISSOURI v. PAPIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1208.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1208.3.html | 2013-12-16 13:14 | 8.3K | NATIONAL BANK OF THE REPUBLIC v. BROOKLYN CITY & N. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1208.3.pdf | 2011-11-01 10:34 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1209.html | 2013-12-16 13:14 | 12K | NATIONAL BANK OF WESTERN ARKANSAS v. SEBASTIAN COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1209.pdf | 2011-11-01 10:34 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1211.html | 2013-12-16 13:14 | 26K | NATIONAL EXCH. BANK v. MOORE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1211.pdf | 2011-11-01 10:34 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1215.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL EXP. & TRANSP. CO. (REYNOLDS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1215.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1215.2.html | 2013-12-16 13:14 | 23K | NATIONAL FILTERING OIL CO. v. ARCTIC OIL CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1215.2.pdf | 2011-11-01 10:34 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1218.html | 2013-12-16 13:14 | 21K | NATIONAL FIRE & MARINE INS. CO. v. LESTER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1218.pdf | 2011-11-01 10:34 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1222.1.html | 2013-12-16 13:14 | 2.9K | NATIONAL HAY-RAKE CO. v. HARBERT et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1222.1.pdf | 2011-11-01 10:34 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1222.2.html | 2013-12-16 13:14 | 6.4K | In re NATIONAL IRON CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1222.2.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1223.html | 2013-12-16 13:14 | 8.4K | In re NATIONAL LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1223.pdf | 2011-11-01 10:34 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1224.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL LOAN BANK (HAMILTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1224.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1224.2.html | 2013-12-16 13:14 | 1.2K | NATIONAL MECHANICS' BANK (SHOEMAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1224.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1224.3.html | 2013-12-16 13:14 | 26K | NATIONAL PARK BANK v. NICHOLS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1224.3.pdf | 2011-11-01 10:34 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1228.html | 2013-12-16 13:14 | 5.6K | NATIONAL PARK BANK v. NICHOLS et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1228.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1229.html | 2013-12-16 13:14 | 12K | NATIONAL PARK BANK v. PEOPLE'S BANK et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1229.pdf | 2011-11-01 10:34 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1231.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL RUBBER CO. (COHN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1231.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1231.2.html | 2013-12-16 13:14 | 5.9K | NATIONAL SCHOOL FURNITURE CO. v. PATON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1231.2.pdf | 2011-11-01 10:34 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1231.3.html | 2013-12-16 13:14 | 1.3K | NATIONAL SHOE-TOE PROTECTOR CO. (AMERICAN SHOE-TIP CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1231.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1232.html | 2013-12-16 13:14 | 41K | NATIONAL SPRING CO. v. UNION CAR SPRING MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1232.pdf | 2011-11-01 10:34 | 128K | |
![[IMG]](/html/icons/compressed.gif) | 0017.f.cas.1233_01.jpg | 2011-04-06 08:46 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1238.html | 2013-12-16 13:14 | 4.9K | NATIONAL STATE BANK v. PIERCE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1238.pdf | 2011-11-01 10:34 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL STEAM-GAUGE CO. (FARLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.2.html | 2013-12-16 13:14 | 1.2K | NATIONAL STEAM-NAV. CO. (DYER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.3.html | 2013-12-16 13:14 | 1.2K | NATIONAL STEAMSHIP CO. (DYER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.3.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.4.html | 2013-12-16 13:14 | 1.2K | NATIONAL STEAMSHIP CO. (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.4.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.5.html | 2013-12-16 13:14 | 1.2K | NATIONAL STEAMSHIP CO. (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.5.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.6.html | 2013-12-16 13:14 | 1.2K | NATIONAL TUBE CO. (LA MOTHE MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.6.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1239.7.html | 2013-12-16 13:14 | 18K | NATIONAL UNION BANK v. DODGE et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1239.7.pdf | 2011-11-01 10:34 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1242.1.html | 2013-12-16 13:14 | 1.2K | NATIONAL UNION BANK OF MARYLAND (STEWART v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1242.1.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1242.2.html | 2013-12-16 13:14 | 6.3K | The NATIVE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1242.2.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1242.3.html | 2013-12-16 13:14 | 1.2K | NATIVE, The (BEACH v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1242.3.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1243.html | 2013-12-16 13:14 | 51K | NATTERSTROM v. The HAZARD. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1243.pdf | 2011-11-01 10:34 | 123K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.1.html | 2013-12-16 13:14 | 1.2K | NAUGATUCK NAV. CO. v. The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.1.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.2.html | 2013-12-16 13:14 | 1.3K | NAUGATUCK NAV. CO. v. The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.2.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.3.html | 2013-12-16 13:14 | 1.2K | NAUGATUCK TRANSP. CO. v. The RHODE ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.3.pdf | 2011-11-01 10:34 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.4.html | 2013-12-16 13:14 | 1.2K | NAUMKEAG STEAM COTTON CO. (The EDWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.4.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.5.html | 2013-12-16 13:14 | 2.7K | NAUNTON v. The OREGON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.5.pdf | 2011-11-01 10:34 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1251.6.html | 2013-12-16 13:14 | 14K | The NAUTILUS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1251.6.pdf | 2011-11-01 10:34 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1253.html | 2013-12-16 13:14 | 6.9K | The NAVARRO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1253.pdf | 2011-11-01 10:34 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1254.1.html | 2013-12-16 13:14 | 1.2K | The NAYADE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1254.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1254.2.html | 2013-12-16 13:14 | 1.2K | NAYADE. The (INGRAHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1254.2.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1254.3.html | 2013-12-16 13:14 | 33K | NAYLOR et al. v. BALTZELL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1254.3.pdf | 2011-11-01 10:34 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1259.1.html | 2013-12-16 13:14 | 1.2K | NAYLOR (McDERMOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1259.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1259.2.html | 2013-12-16 13:14 | 1.2K | NAYLOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1259.2.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1259.3.html | 2013-12-16 13:14 | 8.8K | NAZRO v. CRAGIN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1259.3.pdf | 2011-11-01 10:34 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1260.html | 2013-12-16 13:14 | 9.8K | The NEAFFIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1260.pdf | 2011-11-01 10:34 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1262.html | 2013-12-16 13:14 | 5.7K | NEAFIE et al. v. CHEESEBROUGH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1262.pdf | 2011-11-01 10:34 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1263.1.html | 2013-12-16 13:14 | 1.2K | NEAL v. BECKWITH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1263.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1263.2.html | 2013-12-16 13:14 | 8.2K | NEAL v. GREEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1263.2.pdf | 2011-11-01 10:34 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1264.1.html | 2013-12-16 13:14 | 1.2K | NEAL (RAILROAD CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1264.1.pdf | 2011-11-01 10:34 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1264.2.html | 2013-12-16 13:14 | 14K | In re NEALE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1264.2.pdf | 2011-11-01 10:34 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1266.1.html | 2013-12-16 13:14 | 1.2K | NEALE (BANK OF WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1266.1.pdf | 2011-11-01 10:34 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1266.2.html | 2013-12-16 13:14 | 2.8K | NEALE v. CONINGHAM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1266.2.pdf | 2011-11-01 10:35 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1266.3.html | 2013-12-16 13:14 | 2.8K | NEALE v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1266.3.pdf | 2011-11-01 10:35 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1266.4.html | 2013-12-16 13:14 | 4.9K | NEALE et al. v. JANNEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1266.4.pdf | 2011-11-01 10:35 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.1.html | 2013-12-16 13:14 | 1.2K | NEALE (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.2.html | 2013-12-16 13:14 | 1.2K | NEALE (LEONARD v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.2.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.3.html | 2013-12-16 13:14 | 2.5K | NEALE v. MINIFIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.3.pdf | 2011-11-01 10:35 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.4.html | 2013-12-16 13:14 | 2.5K | NEALE v. PEYTON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.4.pdf | 2011-11-01 10:35 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.5.html | 2013-12-16 13:14 | 1.2K | NEALE (QUEEN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.5.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.6.html | 2013-12-16 13:14 | 1.2K | NEALE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.6.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1267.7.html | 2013-12-16 13:14 | 3.7K | NEALE v. WALKER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1267.7.pdf | 2011-11-01 10:35 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1268.1.html | 2013-12-16 13:14 | 1.2K | NEALE'S ADM'R (DUFFY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1268.1.pdf | 2011-11-01 10:35 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1268.2.html | 2013-12-16 13:14 | 11K | In re NEBE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1268.2.pdf | 2011-11-01 10:35 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1269.html | 2013-12-16 13:14 | 9.9K | In re NEBENZAHL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1269.pdf | 2011-11-01 10:35 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1271.1.html | 2013-12-16 13:14 | 5.4K | The NEBRASKA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1271.1.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1271.2.html | 2013-12-16 13:14 | 6.8K | The NEBRASKA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1271.2.pdf | 2011-11-01 10:35 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1272.1.html | 2013-12-16 13:14 | 1.3K | NEBRASKA v. POLLOCK. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1272.1.pdf | 2011-11-01 10:35 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1272.2.html | 2013-12-16 13:14 | 5.8K | The NED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1272.2.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1273.html | 2013-12-16 13:14 | 7.8K | NEEDERER v. BARBER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1273.pdf | 2011-11-01 10:35 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1274.html | 2013-12-16 13:14 | 4.5K | Ex parte NEEDHAM et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1274.pdf | 2011-11-01 10:35 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1275.1.html | 2013-12-16 13:14 | 5.2K | In re NEEDHAM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1275.1.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1275.2.html | 2013-12-16 13:14 | 2.2K | In re NEEDHAM. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1275.2.pdf | 2011-11-01 10:35 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1276.html | 2013-12-16 13:14 | 18K | NEEDHAM v. WASHBURN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1276.pdf | 2011-11-01 10:35 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1278.html | 2013-12-16 13:14 | 3.9K | NEELY v. ROBINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1278.pdf | 2011-11-01 10:35 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1279.1.html | 2013-12-16 13:14 | 1.2K | NEFF (BAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1279.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1279.2.html | 2013-12-16 13:14 | 1.2K | NEFF (CRABTREE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1279.2.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1279.3.html | 2013-12-16 13:14 | 1.2K | NEFF (HARPER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1279.3.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1279.4.html | 2013-12-16 13:14 | 69K | NEFF v. PENNOYER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1279.4.pdf | 2011-11-01 10:35 | 152K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1290.html | 2013-12-16 13:14 | 7.1K | NEFF v. PENNOYER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1290.pdf | 2011-11-01 10:35 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1291.html | 2013-12-16 13:14 | 14K | NEFF v. PENNOYER. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1291.pdf | 2011-11-01 10:35 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1293.1.html | 2013-12-16 13:14 | 1.2K | NEID (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1293.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1293.2.html | 2013-12-16 13:14 | 21K | NEIDLINGER et al. v. INSURANCE CO. OF NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1293.2.pdf | 2011-11-01 10:35 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1296.1.html | 2013-12-16 13:14 | 1.3K | The NEIL COCHRAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1296.1.pdf | 2011-11-01 10:35 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1296.2.html | 2013-12-16 13:14 | 2.9K | NEIL v. ABBOTT. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1296.2.pdf | 2011-11-01 10:35 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1296.3.html | 2013-12-16 13:14 | 1.2K | NEIL (McKINNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1296.3.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1296.4.html | 2013-12-16 13:14 | 1.1K | NEIL (PECK v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1296.4.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1296.5.html | 2013-12-16 13:14 | 32K | In re NEILL. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1296.5.pdf | 2011-11-01 10:35 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1301.html | 2013-12-16 13:14 | 4.9K | In re NEILSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1301.pdf | 2011-11-01 10:35 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1302.html | 2013-12-16 13:14 | 16K | NEILSON v. GARZA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1302.pdf | 2011-11-01 10:35 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1305.html | 2013-12-16 13:14 | 15K | NEILSON et al. v. The LAURA. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1305.pdf | 2011-11-01 10:35 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1307.1.html | 2013-12-16 13:14 | 1.2K | NEILSON. The (MESSENA v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1307.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1307.2.html | 2013-12-16 13:14 | 5.3K | The NELLIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1307.2.pdf | 2011-11-01 10:35 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1308.1.html | 2013-12-16 13:14 | 6.1K | The NELLIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1308.1.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1308.2.html | 2013-12-16 13:14 | 4.8K | The NELLIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1308.2.pdf | 2011-11-01 10:35 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1309.html | 2013-12-16 13:14 | 7.0K | The NELLIE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1309.pdf | 2011-11-01 10:35 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1310.html | 2013-12-16 13:14 | 5.1K | The NELLIE D. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1310.pdf | 2011-11-01 10:35 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1311.1.html | 2013-12-16 13:14 | 5.6K | The NELLIE HUSTED. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1311.1.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1311.2.html | 2013-12-16 13:14 | 9.0K | NELLIS et al. v. McLANAHAN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1311.2.pdf | 2011-11-01 10:35 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1312.html | 2013-12-16 13:14 | 9.8K | In re NELSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1312.pdf | 2011-11-01 10:35 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1314.1.html | 2013-12-16 13:14 | 1.2K | NELSON v. BAILEY. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1314.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1314.2.html | 2013-12-16 13:14 | 4.6K | NELSON v. BARKER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1314.2.pdf | 2011-11-01 10:35 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1314.3.html | 2013-12-16 13:14 | 8.4K | NELSON v. BELL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1314.3.pdf | 2011-11-01 10:35 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1316.1.html | 2013-12-16 13:14 | 1.2K | NELSON (BELL v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1316.1.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1316.2.html | 2013-12-16 13:14 | 1.3K | NELSON v. BOWEN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1316.2.pdf | 2011-11-01 10:35 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1316.3.html | 2013-12-16 13:14 | 3.6K | NELSON v. CARMAN. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1316.3.pdf | 2011-11-01 10:35 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1316.4.html | 2013-12-16 13:14 | 1.2K | NELSON (CROPPER v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1316.4.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1316.5.html | 2013-12-16 13:14 | 8.7K | NELSON et al. v. CUTTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1316.5.pdf | 2011-11-01 10:35 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1317.1.html | 2013-12-16 13:14 | 1.2K | NELSON (DALTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1317.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1317.2.html | 2013-12-16 13:14 | 1.2K | NELSON (DOLTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1317.2.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1317.3.html | 2013-12-16 13:14 | 10K | NELSON et al. v. FOSTER et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1317.3.pdf | 2011-11-01 10:35 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1319.html | 2013-12-16 13:14 | 35K | NELSON et al. v. The GOLIAH. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1319.pdf | 2011-11-01 10:35 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1324.html | 2013-12-16 13:14 | 5.8K | NELSON v. HALL et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1324.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1325.1.html | 2013-12-16 13:14 | 1.2K | NELSON (HAUPTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1325.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1325.2.html | 2013-12-16 13:14 | 3.0K | NELSON v. The HERCULES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1325.2.pdf | 2011-11-01 10:35 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1325.3.html | 2013-12-16 13:14 | 1.2K | NELSON (HERRING v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1325.3.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1325.4.html | 2013-12-16 13:14 | 1.2K | NELSON (LATHROP v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1325.4.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1325.5.html | 2013-12-16 13:14 | 25K | NELSON v. McMANN et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1325.5.pdf | 2011-11-01 10:35 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1329.html | 2013-12-16 13:14 | 28K | NELSON et al. v. MADISON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1329.pdf | 2011-11-01 10:35 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1334.html | 2013-12-16 13:14 | 12K | NELSON v. MOON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1334.pdf | 2011-11-01 10:35 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1335.1.html | 2013-12-16 13:14 | 1.2K | NELSON (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1335.1.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1335.2.html | 2013-12-16 13:14 | 7.3K | NELSON v. NATIONAL STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1335.2.pdf | 2011-11-01 10:35 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1336.html | 2013-12-16 13:14 | 6.8K | NELSON v. PHOENIX CHEMICAL WORKS. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1336.pdf | 2011-11-01 10:35 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1337.1.html | 2013-12-16 13:14 | 1.2K | NELSON (REED v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1337.1.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1337.2.html | 2013-12-16 13:14 | 1.2K | NELSON (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1337.2.pdf | 2011-11-01 10:35 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1337.3.html | 2013-12-16 13:14 | 12K | NELSON v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1337.3.pdf | 2011-11-01 10:35 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1339.1.html | 2013-12-16 13:14 | 1.2K | NELSON (SHUFFLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1339.1.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1339.2.html | 2013-12-16 13:14 | 8.0K | NELSON et al. v. The THOMAS SPARKS., DENNY v. SAME. CHAMBERLAIN v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1339.2.pdf | 2011-11-01 10:35 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1340.html | 2013-12-16 13:14 | 15K | NELSON et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1340.pdf | 2011-11-01 10:35 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1342.html | 2013-12-16 13:14 | 1.2K | NELSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1342.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1343.1.html | 2013-12-16 13:14 | 6.4K | NELSON et al. v. WOODRUFF et al., WOODRUFF et al. v. NELSON et al. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1343.1.pdf | 2011-11-01 10:35 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1343.2.html | 2013-12-16 13:14 | 5.7K | The NEPTUNE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1343.2.pdf | 2011-11-01 10:35 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1344.html | 2013-12-16 13:14 | 3.7K | The NEPTUNE. |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1344.pdf | 2011-11-01 10:35 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1345.html | 2013-12-16 13:14 | 28K | The NEPTUNE |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1345.pdf | 2011-11-01 10:35 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.1.html | 2013-12-16 13:14 | 1.2K | NEPTUNE, The (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.1.pdf | 2011-11-01 10:35 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.2.html | 2013-12-16 13:14 | 1.2K | NEPTUNE. The (COULON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.2.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.3.html | 2013-12-16 13:14 | 1.2K | NEPTUNE, The (JOLLY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.3.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.4.html | 2013-12-16 13:14 | 1.2K | NEPTUNE, The (PAINE v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.4.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.5.html | 2013-12-16 13:14 | 1.2K | NEPTUNE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.5.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.6.html | 2013-12-16 13:14 | 1.2K | NEPTUNE. The (WALTON v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.6.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.7.html | 2013-12-16 13:14 | 1.2K | NEPTUNE, The (WHITEMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.7.pdf | 2011-11-01 10:35 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.8.html | 2013-12-16 13:14 | 1.2K | NEPTUNE INS. CO. (BRADSTREET v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.8.pdf | 2011-11-01 10:35 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.1349.9.html | 2013-12-16 13:14 | 1.3K | NEPTUNE'S CAR, The (DOOLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.1349.9.pdf | 2011-11-01 10:35 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.back.html | 2013-12-16 13:14 | 328K | Federal Cases, Volume 17 |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.back.pdf | 2011-10-31 13:05 | 460K | |
![[Text]](/html/icons/compressed.gif) | 0017.f.cas.front.html | 2013-12-16 13:14 | 2.9K | Federal Cases, Volume 17 |
![[ ]](/html/icons/compressed.gif) | 0017.f.cas.front.pdf | 2011-10-31 13:05 | 39K | |
|