![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.000b_01.jpg | 2011-07-08 17:20 | 5.3K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0001.html | 2013-12-16 13:10 | 9.4K | GREY v. THOMAS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0001.pdf | 2011-11-01 10:05 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0002.1.html | 2013-12-16 13:10 | 2.4K | GREYOR v. The BLACK WARRIOR. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0002.1.pdf | 2011-11-01 10:05 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0002.2.html | 2013-12-16 13:09 | 7.5K | GRIDLEY v. NORTHWESTERN MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0002.2.pdf | 2011-11-01 10:05 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0003.html | 2013-12-16 13:09 | 2.8K | In re GRIEVES et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0003.pdf | 2011-11-01 10:05 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0004.1.html | 2013-12-16 13:10 | 6.8K | In re GRIFFEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0004.1.pdf | 2011-11-01 10:05 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0004.2.html | 2013-12-16 13:09 | 3.9K | GRIFFENBERG v. The JOHN LAUGHLIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0004.2.pdf | 2011-11-01 10:05 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0005.1.html | 2013-12-16 13:09 | 3.4K | In re GRIFFIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0005.1.pdf | 2011-11-01 10:05 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0005.2.html | 2013-12-16 13:10 | 8.4K | In re GRIFFIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0005.2.pdf | 2011-11-01 10:05 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0006.html | 2013-12-16 13:10 | 6.9K | The GRIFFIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0006.pdf | 2011-11-01 10:05 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0007.html | 2013-12-16 13:09 | 122K | GRIFFIN'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0007.pdf | 2011-11-01 10:05 | 245K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0027.html | 2013-12-16 13:09 | 28K | GRIFFIN v. CLINTON LINE EXTENSION R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0027.pdf | 2011-11-01 10:05 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0032.1.html | 2013-12-16 13:09 | 1.2K | GRIFFIN, The (GREENWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0032.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0032.2.html | 2013-12-16 13:10 | 3.5K | GRIFFIN T. JEFFERS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0032.2.pdf | 2011-11-01 10:05 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0032.3.html | 2013-12-16 13:10 | 3.4K | GRIFFIN v. NOKES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0032.3.pdf | 2011-11-01 10:05 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0032.4.html | 2013-12-16 13:10 | 4.7K | GRIFFIN et al. v. WOODWARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0032.4.pdf | 2011-11-01 10:05 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0033.html | 2013-12-16 13:09 | 34K | GRIFFING v. GIBB et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0033.pdf | 2011-11-01 10:05 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0038.html | 2013-12-16 13:10 | 10K | In re GRIFFITH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0038.pdf | 2011-11-01 10:05 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0040.1.html | 2013-12-16 13:10 | 1.2K | GRIFFITH (BLANDY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0040.1.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0040.2.html | 2013-12-16 13:09 | 12K | GRIFFITH v. BRADSHAW et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0040.2.pdf | 2011-11-01 10:05 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.1.html | 2013-12-16 13:10 | 1.2K | GRIFFITH (DECKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.1.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.2.html | 2013-12-16 13:09 | 4.1K | GRIFFITH v. EVANS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.2.pdf | 2011-11-01 10:05 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.3.html | 2013-12-16 13:09 | 1.2K | GRIFFITH (HAYFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.3.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.4.html | 2013-12-16 13:10 | 1.2K | GRIFFITH (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.4.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.5.html | 2013-12-16 13:10 | 1.2K | GRIFFITH (MACBEE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.5.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.6.html | 2013-12-16 13:09 | 1.2K | GRIFFITH (McFARLANE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.6.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0042.7.html | 2013-12-16 13:09 | 24K | GRIFFITH v. TUNCKHOUSER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0042.7.pdf | 2011-11-01 10:05 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0046.1.html | 2013-12-16 13:10 | 1.2K | GRIFFITH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0046.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0046.2.html | 2013-12-16 13:09 | 1.3K | GRIFFITH v. WORTMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0046.2.pdf | 2011-11-01 10:05 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0046.3.html | 2013-12-16 13:09 | 1.2K | GRIFFITH (WORTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0046.3.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0046.4.html | 2013-12-16 13:10 | 9.2K | In re GRIFFITHS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0046.4.pdf | 2011-11-01 10:05 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0047.1.html | 2013-12-16 13:09 | 1.2K | GRIFFITHS (COLLENDER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0047.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0047.2.html | 2013-12-16 13:10 | 1.2K | GRIFFITHS (HAYFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0047.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0047.3.html | 2013-12-16 13:10 | 1.2K | GRIFFON, The (GREENAWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0047.3.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0047.4.html | 2013-12-16 13:09 | 7.0K | GRIGG v. The CLARISSA ANN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0047.4.pdf | 2011-11-01 10:05 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0048.1.html | 2013-12-16 13:09 | 1.2K | GRIGG (FRY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0048.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0048.2.html | 2013-12-16 13:10 | 1.2K | GRIGGS (COX v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0048.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0048.3.html | 2013-12-16 13:10 | 4.5K | GRIGSBY v. LOVE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0048.3.pdf | 2011-11-01 10:05 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0049.1.html | 2013-12-16 13:10 | 1.2K | GRIMES (FENWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0049.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0049.2.html | 2013-12-16 13:09 | 7.8K | GRIMES et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0049.2.pdf | 2011-11-01 10:05 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0050.1.html | 2013-12-16 13:10 | 1.2K | GRIMES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0050.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0050.2.html | 2013-12-16 13:09 | 4.9K | In re GRINNEILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0050.2.pdf | 2011-11-01 10:05 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0051.html | 2013-12-16 13:09 | 24K | In re GRINNELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0051.pdf | 2011-11-01 10:05 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0054.1.html | 2013-12-16 13:10 | 1.2K | GRINNELL (CROSBY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0054.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0054.2.html | 2013-12-16 13:09 | 12K | GRINNELL et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0054.2.pdf | 2011-11-01 10:05 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0056.1.html | 2013-12-16 13:10 | 1.2K | GRINNELL (SEDGWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0056.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0056.2.html | 2013-12-16 13:09 | 1.2K | GRINNELL (SHAW v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0056.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0056.3.html | 2013-12-16 13:09 | 19K | GRISAR v. MCDOWELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0056.3.pdf | 2011-11-01 10:05 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0059.html | 2013-12-16 13:09 | 6.4K | GRISWOLD v. CONNOLLY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0059.pdf | 2011-11-01 10:05 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0060.1.html | 2013-12-16 13:09 | 1.2K | GRISWOLD (DOWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0060.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0060.2.html | 2013-12-16 13:10 | 6.8K | GRISWOLD v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0060.2.pdf | 2011-11-01 10:05 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0061.html | 2013-12-16 13:09 | 12K | GRISWOLD v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0061.pdf | 2011-11-01 10:05 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0063.html | 2013-12-16 13:10 | 24K | GRISWOLD et al. ads. HILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0063.pdf | 2011-11-01 10:05 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0066.html | 2013-12-16 13:10 | 9.0K | GRISWOLD et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0066.pdf | 2011-11-01 10:05 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0067.1.html | 2013-12-16 13:10 | 4.2K | GRISWOLD v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0067.1.pdf | 2011-11-01 10:05 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0067.2.html | 2013-12-16 13:09 | 9.9K | GRISWOLD v. The NEVADA., SHERMAN v. The SAME. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0067.2.pdf | 2011-11-01 10:05 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0069.1.html | 2013-12-16 13:09 | 1.2K | GRISWOLD (RIDGWAY TP. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0069.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0069.2.html | 2013-12-16 13:10 | 21K | GRISWOLD et al. v. UNION MUT. INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0069.2.pdf | 2011-11-01 10:05 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0072.1.html | 2013-12-16 13:09 | 1.2K | GRISWOLD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0072.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0072.2.html | 2013-12-16 13:10 | 1.2K | GRISWOLD (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0072.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0072.3.html | 2013-12-16 13:10 | 1.2K | GROPF (PENN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0072.3.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0072.4.html | 2013-12-16 13:10 | 25K | GROSJEAN v. PECK, STOW & WILCOX CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0072.4.pdf | 2011-11-01 10:05 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0076.html | 2013-12-16 13:10 | 9.2K | GROSS v. SIOUX COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0076.pdf | 2011-11-01 10:05 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0077.html | 2013-12-16 13:10 | 4.2K | GROSS & P. MANUF'G CO. v. GERHARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0077.pdf | 2011-11-01 10:05 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0078.1.html | 2013-12-16 13:10 | 1.2K | GROSVENOR (GEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0078.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0078.2.html | 2013-12-16 13:09 | 1.2K | GROSVENOR (SEABURY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0078.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0078.3.html | 2013-12-16 13:09 | 1.2K | GROTE (DECKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0078.3.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0078.4.html | 2013-12-16 13:10 | 1.2K | GROTENKEMPER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0078.4.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0078.5.html | 2013-12-16 13:10 | 8.3K | The GROTIUS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0078.5.pdf | 2011-11-01 10:05 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0079.1.html | 2013-12-16 13:09 | 1.2K | GROVE (CAVENDER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0079.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0079.2.html | 2013-12-16 13:10 | 1.2K | GROVE (RANSDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0079.2.pdf | 2011-11-01 10:05 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0079.3.html | 2013-12-16 13:10 | 1.2K | GROVER v. CLINTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0079.3.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0079.4.html | 2013-12-16 13:09 | 14K | GROVER & BAKER SEWING MACH. CO. v. CLINTON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0079.4.pdf | 2011-11-01 10:05 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0081.1.html | 2013-12-16 13:09 | 1.2K | GROVER & BAKER SEWING MACH. CO. (COPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0081.1.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0081.2.html | 2013-12-16 13:10 | 1.3K | GROVER & BAKER SEWING MACH. CO. (FLORENCE SEWING MACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0081.2.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0081.3.html | 2013-12-16 13:10 | 9.4K | GROVER & BAKER SEWING MACH. CO. v. SLOAT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0081.3.pdf | 2011-11-01 10:05 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0083.html | 2013-12-16 13:10 | 31K | GROVER & BAKER SEWING MACH. CO. v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0083.pdf | 2011-11-01 10:05 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0087.1.html | 2013-12-16 13:09 | 1.2K | GROVERMAN (DARLINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0087.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0087.2.html | 2013-12-16 13:10 | 1.2K | GROVERMAN (WISE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0087.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0088.html | 2013-12-16 13:09 | 8.3K | GROW v. BALLARD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0088.pdf | 2011-11-01 10:05 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0089.html | 2013-12-16 13:09 | 38K | GRUBB v. BAYARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0089.pdf | 2011-11-01 10:05 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0095.1.html | 2013-12-16 13:10 | 3.7K | GRUBB v. CLAYTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0095.1.pdf | 2011-11-01 10:05 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0095.2.html | 2013-12-16 13:10 | 2.6K | GRUNDY v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0095.2.pdf | 2011-11-01 10:05 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0095.3.html | 2013-12-16 13:10 | 3.5K | GRUNDY v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0095.3.pdf | 2011-11-01 10:05 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0096.html | 2013-12-16 13:10 | 8.5K | GRUNNINGER v. PHILPOT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0096.pdf | 2011-11-01 10:05 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0097.html | 2013-12-16 13:10 | 5.6K | GRUNNINGER v. PHILPOT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0097.pdf | 2011-11-01 10:05 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.1.html | 2013-12-16 13:10 | 1.2K | GRUSH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.2.html | 2013-12-16 13:10 | 2.6K | GRUTACAP v. WOULLUISE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.2.pdf | 2011-11-01 10:05 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.3.html | 2013-12-16 13:10 | 1.2K | GUARDIAN LIFE INS. CO. (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.3.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.4.html | 2013-12-16 13:09 | 1.2K | GUARDIAN MUT. LIFE INS. CO. (EISNER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.4.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.5.html | 2013-12-16 13:09 | 1.2K | GUDERYALEN v. The F. W. GIFFORD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.5.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.6.html | 2013-12-16 13:10 | 1.2K | GUERARD (GIRARD FIRE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.6.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0098.7.html | 2013-12-16 13:10 | 10K | GUERNSEY v. BURLINGTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0098.7.pdf | 2011-11-01 10:05 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0099.1.html | 2013-12-16 13:10 | 1.2K | GUERRERO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0099.1.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0099.2.html | 2013-12-16 13:09 | 1.2K | GUGENHEIM (BARRY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0099.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0099.3.html | 2013-12-16 13:09 | 1.2K | GUGENHEIM (PENNSYLVANIA SALT MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0099.3.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0100.html | 2013-12-16 13:10 | 22K | GUIBERT et al. v. The GEORGE BELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0100.pdf | 2011-11-01 10:05 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0103.html | 2013-12-16 13:10 | 11K | GUIDET v. BARBER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0103.pdf | 2011-11-01 10:05 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0105.1.html | 2013-12-16 13:09 | 4.4K | GUIDET v. BROOKLYN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0105.1.pdf | 2011-11-01 10:05 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0105.2.html | 2013-12-16 13:10 | 9.1K | GUIDET v. PALMER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0105.2.pdf | 2011-11-01 10:05 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0106.html | 2013-12-16 13:10 | 11K | In re GUILD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0106.pdf | 2011-11-01 10:05 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0108.1.html | 2013-12-16 13:09 | 1.2K | GUILD (SAWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0108.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0108.2.html | 2013-12-16 13:10 | 1.2K | GUILD (WOODMAN PEBBLING MACH. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0108.2.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0108.3.html | 2013-12-16 13:10 | 11K | GUILLOU v. FONTAIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0108.3.pdf | 2011-11-01 10:05 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0109.1.html | 2013-12-16 13:10 | 1.3K | GUINET'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0109.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0109.2.html | 2013-12-16 13:09 | 1.2K | GUINET (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0109.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0110.1.html | 2013-12-16 13:10 | 2.9K | GUION v. M'CULLOUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0110.1.pdf | 2011-11-01 10:05 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0110.2.html | 2013-12-16 13:09 | 5.5K | The GUISBOROUGH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0110.2.pdf | 2011-11-01 10:05 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0110.3.html | 2013-12-16 13:10 | 2.8K | GULICK'S EX'RS v. McIVER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0110.3.pdf | 2011-11-01 10:05 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0111.1.html | 2013-12-16 13:09 | 2.6K | GULLAT et al. v. TUCKER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0111.1.pdf | 2011-11-01 10:05 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0111.2.html | 2013-12-16 13:10 | 23K | GUM v. EQUITABLE TRUST CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0111.2.pdf | 2011-11-01 10:05 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0115.1.html | 2013-12-16 13:09 | 4.1K | In re GUNIKE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0115.1.pdf | 2011-11-01 10:05 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0115.2.html | 2013-12-16 13:10 | 1.1K | GUNN (PLANT, v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0115.2.pdf | 2011-11-01 10:05 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0115.3.html | 2013-12-16 13:10 | 4.9K | GUNNEL v. DADE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0115.3.pdf | 2011-11-01 10:05 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0116.1.html | 2013-12-16 13:10 | 1.2K | GUNTHER (SCHILLINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0116.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0116.2.html | 2013-12-16 13:10 | 10K | GUNTON et al. v. INGLE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0116.2.pdf | 2011-11-01 10:05 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0117.1.html | 2013-12-16 13:09 | 2.9K | GUPPE et al. v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0117.1.pdf | 2011-11-01 10:05 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0117.2.html | 2013-12-16 13:10 | 23K | GURNEE v. BRUNSWICK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0117.2.pdf | 2011-11-01 10:05 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0121.html | 2013-12-16 13:09 | 12K | In re GURNEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0121.pdf | 2011-11-01 10:05 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0123.html | 2013-12-16 13:10 | 12K | GURNEY v. CROCKETT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0123.pdf | 2011-11-01 10:05 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0124.html | 2013-12-16 13:09 | 11K | GURNEY et al. v. HOGE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0124.pdf | 2011-11-01 10:05 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0126.1.html | 2013-12-16 13:09 | 1.2K | GURNEY (UNITED STATUS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0126.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0126.2.html | 2013-12-16 13:10 | 13K | The GUSTAVIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0126.2.pdf | 2011-11-01 10:05 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0128.1.html | 2013-12-16 13:10 | 3.6K | GUSTINE v. RINGGOLD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0128.1.pdf | 2011-11-01 10:05 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0128.2.html | 2013-12-16 13:09 | 2.5K | GUSTY v. DIGGS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0128.2.pdf | 2011-11-01 10:05 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0129.1.html | 2013-12-16 13:09 | 1.2K | GUTHRIE (COBLLIDGE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0129.1.pdf | 2011-11-01 10:05 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0129.2.html | 2013-12-16 13:10 | 1.2K | GUTHRIE (COOLLIDGE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0129.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0129.3.html | 2013-12-16 13:10 | 7.7K | GUTTA-PERCHA & RUBBER MANUF'G CO. v. GOODYEAR RUBBER CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0129.3.pdf | 2011-11-01 10:05 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0130.html | 2013-12-16 13:09 | 16K | GUTTSCHLICK v. BANK OF THE METROPOLIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0130.pdf | 2011-11-01 10:05 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0132.html | 2013-12-16 13:10 | 8.4K | GUYON v. SERRELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0132.pdf | 2011-11-01 10:05 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0133.html | 2013-12-16 13:10 | 6.4K | GWATHNEY v. M'LANE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0133.pdf | 2011-11-01 10:05 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0134.1.html | 2013-12-16 13:09 | 1.2K | GWYNNE (HARMER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0134.1.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0134.2.html | 2013-12-16 13:10 | 1.2K | GWYNNE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0134.2.pdf | 2011-11-01 10:05 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0134.3.html | 2013-12-16 13:10 | 25K | In re HAAKE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0134.3.pdf | 2011-11-01 10:05 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0138.html | 2013-12-16 13:09 | 4.8K | In re HAAS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0138.pdf | 2011-11-01 10:05 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0139.1.html | 2013-12-16 13:09 | 5.0K | HAAS et al. v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0139.1.pdf | 2011-11-01 10:05 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0139.2.html | 2013-12-16 13:10 | 7.9K | HABEMAN et al. v. WHITMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0139.2.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0140.1.html | 2013-12-16 13:10 | 1.2K | HABERSHAM (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0140.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0140.2.html | 2013-12-16 13:09 | 1.2K | HABERSHAM (PARROT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0140.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0140.3.html | 2013-12-16 13:09 | 1.2K | HABERSTRO (PEASLEE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0140.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0141.html | 2013-12-16 13:10 | 12K | HABRICHT v. ALEXANDER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0141.pdf | 2011-11-01 10:06 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0142.html | 2013-12-16 13:09 | 7.6K | HACKER v. STEVENS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0142.pdf | 2011-11-01 10:06 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0143.html | 2013-12-16 13:09 | 2.7K | HACKER v. STEVENS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0143.pdf | 2011-11-01 10:06 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0144.1.html | 2013-12-16 13:10 | 1.2K | HACKETT (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0144.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0144.2.html | 2013-12-16 13:09 | 1.2K | HACKETT (LETTS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0144.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0144.3.html | 2013-12-16 13:09 | 18K | HACKETT v. OTTAWA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0144.3.pdf | 2011-11-01 10:06 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0146.1.html | 2013-12-16 13:10 | 1.2K | HACKFELD v. The COSTA RICA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0146.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0146.2.html | 2013-12-16 13:09 | 1.2K | HACKLEY (DAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0146.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0146.3.html | 2013-12-16 13:10 | 1.2K | HACKLEY (FOSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0146.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0146.4.html | 2013-12-16 13:10 | 1.2K | HADDEN (HOWE MACHINE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0146.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0147.1.html | 2013-12-16 13:09 | 4.8K | HADDEN et al. v. HOYT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0147.1.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0147.2.html | 2013-12-16 13:10 | 3.5K | HADDEN v. HOYT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0147.2.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.1.html | 2013-12-16 13:09 | 1.2K | HADDUCK (PAYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.2.html | 2013-12-16 13:10 | 3.3K | HADE v. BROTHERTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.2.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.3.html | 2013-12-16 13:10 | 1.2K | HADE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.4.html | 2013-12-16 13:09 | 2.4K | HADEN v. PERRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.4.pdf | 2011-11-01 10:06 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.5.html | 2013-12-16 13:09 | 1.2K | HADFIELD (RHODES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0148.6.html | 2013-12-16 13:10 | 25K | In re HADLEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0148.6.pdf | 2011-11-01 10:06 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0152.1.html | 2013-12-16 13:10 | 1.2K | HADLEY (ATWATER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0152.1.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0152.2.html | 2013-12-16 13:09 | 1.2K | HADLEY (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0152.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0152.3.html | 2013-12-16 13:09 | 1.2K | HADLEY. (HARRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0152.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0152.4.html | 2013-12-16 13:10 | 3.2K | Ex parte HADRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0152.4.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0152.5.html | 2013-12-16 13:10 | 3.4K | In re HAFER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0152.5.pdf | 2011-11-01 10:06 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0153.1.html | 2013-12-16 13:09 | 6.0K | In re HAFER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0153.1.pdf | 2011-11-01 10:06 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0153.2.html | 2013-12-16 13:10 | 1.2K | HAGAMAN (WELLS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0153.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0154.1.html | 2013-12-16 13:10 | 4.3K | In re HAGAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0154.1.pdf | 2011-11-01 10:06 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0154.2.html | 2013-12-16 13:09 | 5.7K | HAGEN v. KEAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0154.2.pdf | 2011-11-01 10:06 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0155.1.html | 2013-12-16 13:09 | 1.2K | HAGERSTOWN AGRICULTURAL IMPLEMENT MANUF'G CO. (BIRDSALL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0155.1.pdf | 2011-11-01 10:06 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0155.2.html | 2013-12-16 13:10 | 1.2K | HAGERTY (TYLER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0155.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0155.3.html | 2013-12-16 13:10 | 7.9K | HAGGETT v. BOWMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0155.3.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.1.html | 2013-12-16 13:10 | 1.2K | HAGNER (BRENT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.2.html | 2013-12-16 13:10 | 1.2K | HAGNER (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.3.html | 2013-12-16 13:09 | 3.4K | In re HAHNLEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.3.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.4.html | 2013-12-16 13:10 | 1.2K | HAIGHT (BLISS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.5.html | 2013-12-16 13:10 | 1.2K | HAIGHT (DEXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0156.6.html | 2013-12-16 13:09 | 27K | HAIGHT et al. v. MORRIS AQUEDUCT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0156.6.pdf | 2011-11-01 10:06 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0161.1.html | 2013-12-16 13:10 | 7.0K | HAIGHT v. PITTSBURGH, FT. W. & C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0161.1.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0161.2.html | 2013-12-16 13:09 | 1.2K | HAIGHT (THOMPkSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0161.2.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0162.1.html | 2013-12-16 13:09 | 38K | HAILES et al. v. VAN WORMER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0162.1.pdf | 2011-11-01 10:06 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0168.html | 2013-12-16 13:10 | 23K | HAINES et al. v. CARPENTER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0168.pdf | 2011-11-01 10:06 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0171.1.html | 2013-12-16 13:10 | 1.2K | HAINES (RUGG v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0171.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0171.2.html | 2013-12-16 13:09 | 1.2K | HAINES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0171.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0171.3.html | 2013-12-16 13:09 | 4.9K | HAINEY v. The TRISTRAM SHANDY, ETC. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0171.3.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0172.1.html | 2013-12-16 13:09 | 1.2K | HAISH (WASHBURN & M. MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0172.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0172.2.html | 2013-12-16 13:10 | 1.2K | HAIZLETTE v. LAKE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0172.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0172.3.html | 2013-12-16 13:10 | 1.2K | HALBERSTADT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0172.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0172.4.html | 2013-12-16 13:09 | 1.2K | HALCYON, The (ACOSTA v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0172.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0172.5.html | 2013-12-16 13:09 | 29K | HALDERMAN et al. v. BECKWITH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0172.5.pdf | 2011-11-01 10:06 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0176.html | 2013-12-16 13:09 | 6.9K | HALDERMAN v. HALDERMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0176.pdf | 2011-11-01 10:06 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0177.html | 2013-12-16 13:09 | 7.4K | HALDERMAN v. HALDERMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0177.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0178.html | 2013-12-16 13:10 | 8.8K | Ex parte HALE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0178.pdf | 2011-11-01 10:06 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0180.html | 2013-12-16 13:10 | 11K | In re HALE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0180.pdf | 2011-11-01 10:06 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0181.html | 2013-12-16 13:10 | 5.9K | In re HALE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0181.pdf | 2011-11-01 10:06 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0182.html | 2013-12-16 13:09 | 22K | HALE v. BALDWIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0182.pdf | 2011-11-01 10:06 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0185.1.html | 2013-12-16 13:09 | 1.2K | HALE (BURDICK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0185.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0185.2.html | 2013-12-16 13:10 | 1.2K | HALE (COXE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0185.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0185.3.html | 2013-12-16 13:10 | 8.5K | HALE v. DUNCAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0185.3.pdf | 2011-11-01 10:06 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0187.html | 2013-12-16 13:09 | 17K | HALE et al. v. STIMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0187.pdf | 2011-11-01 10:06 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0189.1.html | 2013-12-16 13:10 | 1.2K | HALE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0189.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0189.2.html | 2013-12-16 13:09 | 32K | HALE et al. v. WASHINGTON INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0189.2.pdf | 2011-11-01 10:06 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0194.1.html | 2013-12-16 13:10 | 1.3K | HALE v. WILKINSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0194.1.pdf | 2011-11-01 10:06 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0194.2.html | 2013-12-16 13:09 | 12K | In re HALEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0194.2.pdf | 2011-11-01 10:06 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0196.1.html | 2013-12-16 13:10 | 1.2K | HALEY (BAYERQUE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0196.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0196.2.html | 2013-12-16 13:10 | 1.2K | HALEY (MAINE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0196.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0196.3.html | 2013-12-16 13:09 | 1.2K | HALF BARREL. ETC. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0196.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0196.4.html | 2013-12-16 13:10 | 17K | Ex parte HALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0196.4.pdf | 2011-11-01 10:06 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0199.1.html | 2013-12-16 13:10 | 3.6K | In re HALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0199.1.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0199.2.html | 2013-12-16 13:09 | 16K | In re HALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0199.2.pdf | 2011-11-01 10:06 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0201.html | 2013-12-16 13:10 | 7.4K | In re HALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0201.pdf | 2011-11-01 10:06 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0202.html | 2013-12-16 13:09 | 8.3K | In re HALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0202.pdf | 2011-11-01 10:06 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0204.html | 2013-12-16 13:10 | 37K | HALL'S DEPOSITION. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0204.pdf | 2011-11-01 10:06 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0209.html | 2013-12-16 13:10 | 12K | HALL v. AUSTIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0209.pdf | 2011-11-01 10:06 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0211.1.html | 2013-12-16 13:10 | 1.2K | HALL (BARRETT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0211.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0211.2.html | 2013-12-16 13:09 | 18K | HALL v. BIRD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0211.2.pdf | 2011-11-01 10:06 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0214.1.html | 2013-12-16 13:09 | 1.2K | HALL (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0214.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0214.2.html | 2013-12-16 13:10 | 19K | HALL v. The BUFFALO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0214.2.pdf | 2011-11-01 10:06 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0217.1.html | 2013-12-16 13:10 | 1.2K | HALL (CAPELLB v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0217.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0217.2.html | 2013-12-16 13:09 | 23K | HALL et al. v. COOLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0217.2.pdf | 2011-11-01 10:06 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0220.1.html | 2013-12-16 13:10 | 1.2K | HALL (CUNNINGHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0220.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0220.2.html | 2013-12-16 13:09 | 8.0K | HALL et al. v. DEXTER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0220.2.pdf | 2011-11-01 10:06 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0221.html | 2013-12-16 13:10 | 6.9K | HALL v. EASTWICK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0221.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0222.html | 2013-12-16 13:09 | 19K | HALL et al. v. EQUATOR MINING & SMELTING CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0222.pdf | 2011-11-01 10:06 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0225.1.html | 2013-12-16 13:10 | 1.2K | HALL (FELLOWS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0225.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0225.2.html | 2013-12-16 13:10 | 4.0K | HALL v. FOX |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0225.2.pdf | 2011-11-01 10:06 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0226.1.html | 2013-12-16 13:10 | 4.8K | HALL v. HAYNER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0226.1.pdf | 2011-11-01 10:06 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0226.2.html | 2013-12-16 13:09 | 6.7K | HALL v. HOYT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0226.2.pdf | 2011-11-01 10:06 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0227.html | 2013-12-16 13:10 | 7.4K | HALL v. HUDSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0227.pdf | 2011-11-01 10:06 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0228.html | 2013-12-16 13:10 | 31K | HALL et al. v. HURLBUT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0228.pdf | 2011-11-01 10:06 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0233.html | 2013-12-16 13:09 | 8.3K | HALL et al. v. JONES et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0233.pdf | 2011-11-01 10:06 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0234.html | 2013-12-16 13:10 | 15K | HALL v. KIMBARK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0234.pdf | 2011-11-01 10:06 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0236.html | 2013-12-16 13:09 | 22K | HALL et al. v. LITTLE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0236.pdf | 2011-11-01 10:06 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0240.1.html | 2013-12-16 13:09 | 1.2K | HALL (LYNN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0240.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0240.2.html | 2013-12-16 13:10 | 19K | HALL v. NASHVILLE & C. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0240.2.pdf | 2011-11-01 10:06 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0243.1.html | 2013-12-16 13:10 | 1.2K | HALL (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0243.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0243.2.html | 2013-12-16 13:10 | 1.2K | HALL (OFFUT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0243.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0243.3.html | 2013-12-16 13:09 | 1.2K | HALL (OFFUTT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0243.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0243.4.html | 2013-12-16 13:10 | 1.2K | HALL (O'HARRA v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0243.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0243.5.html | 2013-12-16 13:10 | 18K | HALL v. The PAQUET BOT DE CAYENNE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0243.5.pdf | 2011-11-01 10:06 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0246.html | 2013-12-16 13:10 | 16K | HALL v. PEROTT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0246.pdf | 2011-11-01 10:06 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0248.1.html | 2013-12-16 13:10 | 1.1K | HALL (PITTS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0248.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0248.2.html | 2013-12-16 13:09 | 1.2K | HALL (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0248.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0248.3.html | 2013-12-16 13:10 | 1.2K | HALL (ROSSITER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0248.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0248.4.html | 2013-12-16 13:10 | 28K | HALL v. RUSSELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0248.4.pdf | 2011-11-01 10:06 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0252.1.html | 2013-12-16 13:09 | 1.2K | HALL (SARVEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0252.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0252.2.html | 2013-12-16 13:10 | 5.5K | HALL v. SAVAGE et ux. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0252.2.pdf | 2011-11-01 10:06 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0253.1.html | 2013-12-16 13:10 | 1.2K | HALL v. SCHNEIDER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0253.1.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0253.2.html | 2013-12-16 13:09 | 12K | HALL v. SCOVEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0253.2.pdf | 2011-11-01 10:06 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0255.1.html | 2013-12-16 13:10 | 1.2K | HALL (SHERWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0255.1.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0255.2.html | 2013-12-16 13:10 | 4.5K | HALL v. SINGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0255.2.pdf | 2011-11-01 10:06 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0255.3.html | 2013-12-16 13:09 | 8.8K | HALL v. SPEER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0255.3.pdf | 2011-11-01 10:06 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0257.html | 2013-12-16 13:10 | 28K | HALL et al. v. SULLIVAN R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0257.pdf | 2011-11-01 10:06 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0261.html | 2013-12-16 13:09 | 41K | HALL v. UNGER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0261.pdf | 2011-11-01 10:06 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0268.html | 2013-12-16 13:09 | 22K | HALL et al. v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0268.pdf | 2011-11-01 10:06 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0271.1.html | 2013-12-16 13:09 | 1.2K | HALL v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0271.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0271.2.html | 2013-12-16 13:10 | 1.2K | HALL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0271.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0271.3.html | 2013-12-16 13:10 | 27K | HALL v. WAGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0271.3.pdf | 2011-11-01 10:06 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0275.html | 2013-12-16 13:09 | 19K | HALL v. WARREN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0275.pdf | 2011-11-01 10:06 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0278.html | 2013-12-16 13:09 | 14K | HALL v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0278.pdf | 2011-11-01 10:06 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0280.1.html | 2013-12-16 13:09 | 1.2K | HALL (WATSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0280.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0280.2.html | 2013-12-16 13:10 | 1.2K | HALL (WHANN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0280.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0280.3.html | 2013-12-16 13:10 | 24K | HALL v. WILES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0280.3.pdf | 2011-11-01 10:06 | 256K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0281_01.jpg | 2011-07-08 17:20 | 183K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0284.1.html | 2013-12-16 13:09 | 1.2K | HALL (WOODWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0284.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0284.2.html | 2013-12-16 13:10 | 1.2K | HALL (WOODWORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0284.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0284.3.html | 2013-12-16 13:10 | 14K | HALL v. YAHOOLA RIVER MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0284.3.pdf | 2011-11-01 10:06 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0286.1.html | 2013-12-16 13:09 | 1.3K | HALL, The D. M. v. The JOHN LAND. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0286.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0286.2.html | 2013-12-16 13:10 | 19K | HALLACK et al. v. TRITCH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0286.2.pdf | 2011-11-01 10:06 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.1.html | 2013-12-16 13:09 | 3.1K | HALLER v. BEALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.1.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.2.html | 2013-12-16 13:10 | 1.2K | HALLET (ALLEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.2.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.3.html | 2013-12-16 13:10 | 3.1K | HALLET et al. v. PHOENIX INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.3.pdf | 2011-11-01 10:06 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.4.html | 2013-12-16 13:09 | 1.2K | HALLETT (BARBER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.5.html | 2013-12-16 13:09 | 1.2K | HALLETT (OH CHOW v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0289.6.html | 2013-12-16 13:10 | 5.5K | HALLETT et al. v. SMYTHE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0289.6.pdf | 2011-11-01 10:06 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0290.1.html | 2013-12-16 13:09 | 1.2K | HALLETT (TOY WILLIAM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0290.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0290.2.html | 2013-12-16 13:10 | 3.6K | In re HALLIE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0290.2.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0290.3.html | 2013-12-16 13:10 | 12K | The HALLIE JACKSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0290.3.pdf | 2011-11-01 10:06 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.1.html | 2013-12-16 13:09 | 3.2K | HALLIHAN v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.1.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.2.html | 2013-12-16 13:10 | 1.2K | HALLOCK (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.2.pdf | 2011-11-01 10:06 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.3.html | 2013-12-16 13:10 | 1.2K | HALLORAN (UNITED STATES v.) |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.4.html | 2013-12-16 13:09 | 1.2K | HALLOWELL (SEIDENBACH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.5.html | 2013-12-16 13:09 | 1.2K | HALLOWELL & AUGUSTA BANK (BELLOWS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.5.pdf | 2011-11-01 10:06 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0292.6.html | 2013-12-16 13:10 | 18K | In re HALSEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0292.6.pdf | 2011-11-01 10:06 | 177K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0293_01.jpg | 2011-07-08 17:20 | 38K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0293_02.jpg | 2011-07-08 17:20 | 42K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0293_03.jpg | 2011-07-08 17:20 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0295.html | 2013-12-16 13:09 | 61K | HALSEY et al. v. FAIRBANKS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0295.pdf | 2011-11-01 10:06 | 136K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0305.html | 2013-12-16 13:09 | 5.0K | HALSEY v. GARLICK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0305.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0306.1.html | 2013-12-16 13:09 | 3.3K | HALSEY v. HURD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0306.1.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0306.2.html | 2013-12-16 13:10 | 11K | HALSEY et al. v. HURD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0306.2.pdf | 2011-11-01 10:06 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0307.html | 2013-12-16 13:10 | 1.2K | HALSTEAD (UNITED STATE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0307.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0308.html | 2013-12-16 13:10 | 15K | HALSTED v. LYON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0308.pdf | 2011-11-01 10:06 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0310.1.html | 2013-12-16 13:09 | 1.3K | HALSTED v. MILLER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0310.1.pdf | 2011-11-01 10:06 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0310.2.html | 2013-12-16 13:10 | 1.2K | HALSTED (MILLER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0310.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0310.3.html | 2013-12-16 13:10 | 1.2K | HALSTED (STOVER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0310.3.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0310.4.html | 2013-12-16 13:09 | 9.5K | HALVERSON v. NISEN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0310.4.pdf | 2011-11-01 10:06 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0311.html | 2013-12-16 13:09 | 3.6K | In re HAMBERGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0311.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0312.html | 2013-12-16 13:10 | 14K | HAMBLETON v. HOME INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0312.pdf | 2011-11-01 10:06 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0314.html | 2013-12-16 13:09 | 18K | In re HAMBRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0314.pdf | 2011-11-01 10:06 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0317.1.html | 2013-12-16 13:10 | 5.8K | In re HAMBURGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0317.1.pdf | 2011-11-01 10:06 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0317.2.html | 2013-12-16 13:09 | 12K | In re HAMBURGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0317.2.pdf | 2011-11-01 10:06 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0319.html | 2013-12-16 13:09 | 14K | In re HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0319.pdf | 2011-11-01 10:06 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0321.1.html | 2013-12-16 13:09 | 1.2K | HAMILTON, The (ATKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0321.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0321.2.html | 2013-12-16 13:10 | 1.2K | HAMILTON v. BTJTLBR. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0321.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0321.3.html | 2013-12-16 13:10 | 1.2K | HAMILTON (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0321.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0321.4.html | 2013-12-16 13:09 | 3.5K | HAMILTON v. CARNES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0321.4.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0322.1.html | 2013-12-16 13:10 | 1.2K | HAMILTON (CHINN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0322.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0322.2.html | 2013-12-16 13:09 | 66K | HAMILTON et al. v. CUNNINGHAM. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0322.2.pdf | 2011-11-01 10:06 | 156K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0332.1.html | 2013-12-16 13:10 | 1.2K | HAMILTON (DICK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0332.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0332.2.html | 2013-12-16 13:09 | 23K | HAMILTON et al. v. DILLIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0332.2.pdf | 2011-11-01 10:06 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0336.html | 2013-12-16 13:10 | 28K | HAMILTON et al. v. EATON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0336.pdf | 2011-11-01 10:06 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0340.1.html | 2013-12-16 13:10 | 1.2K | HAMILTON (FELICHY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0340.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0340.2.html | 2013-12-16 13:10 | 3.6K | HAMILTON v. FRANKLIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0340.2.pdf | 2011-11-01 10:06 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0341.1.html | 2013-12-16 13:10 | 1.2K | HAMILTON (GRANT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0341.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0341.2.html | 2013-12-16 13:09 | 29K | HAMILTON v. IVES et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0341.2.pdf | 2011-11-01 10:06 | 154K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0341_01.jpg | 2011-07-08 17:20 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0345.html | 2013-12-16 13:10 | 3.3K | HAMILTON v. JONES et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0345.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0346.1.html | 2013-12-16 13:09 | 1.2K | HAMILTON (KERR v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0346.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0346.2.html | 2013-12-16 13:10 | 14K | HAMILTON v. KINGSBURY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0346.2.pdf | 2011-11-01 10:06 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0348.html | 2013-12-16 13:10 | 21K | HAMILTON v. KINGSBURY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0348.pdf | 2011-11-01 10:06 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0351.1.html | 2013-12-16 13:10 | 1.2K | HAMILTON v. LUDLOW. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0351.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0351.2.html | 2013-12-16 13:09 | 1.2K | HAMILTON (MUTTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0351.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0351.3.html | 2013-12-16 13:09 | 65K | HAMILTON v. MUTUAL LIFE INS. CO |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0351.3.pdf | 2011-11-01 10:06 | 145K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0362.html | 2013-12-16 13:09 | 14K | HAMILTON v. NATIONAL LOAN BANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0362.pdf | 2011-11-01 10:06 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0364.html | 2013-12-16 13:10 | 8.7K | HAMILTON v. ROLLINS. SAME v. TODD et al. SAME v. BUTLER et al. SAME v. SHERWOOD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0364.pdf | 2011-11-01 10:06 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0365.1.html | 2013-12-16 13:09 | 3.2K | HAMILTON v. RUSSELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0365.1.pdf | 2011-11-01 10:06 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0365.2.html | 2013-12-16 13:10 | 1.2K | HAMILTON (SANDERS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0365.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0365.3.html | 2013-12-16 13:10 | 1.2K | HAMILTON v. SHERWOOD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0365.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0365.4.html | 2013-12-16 13:09 | 2.6K | HAMILTON v. SIMMS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0365.4.pdf | 2011-11-01 10:06 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.1.html | 2013-12-16 13:10 | 5.7K | HAMILTON v. SIMONS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.1.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.2.html | 2013-12-16 13:10 | 1.2K | HAMILTON (STARR v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.3.html | 2013-12-16 13:09 | 1.2K | HAMILTON (STEDMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.4.html | 2013-12-16 13:10 | 1.2K | HAMILTON (STEVENSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.5.html | 2013-12-16 13:10 | 1.2K | HAMILTON (STEWART v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.6.html | 2013-12-16 13:09 | 1.2K | HAMILTON (THISTLE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.6.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.7.html | 2013-12-16 13:09 | 1.2K | HAMILTON v. TODD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.7.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.8.html | 2013-12-16 13:10 | 1.2K | HAMILTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.8.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.9.html | 2013-12-16 13:10 | 1.2K | HAMILTON COUNTY (COOK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.9.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.10.html | 2013-12-16 13:09 | 1.2K | HAMILTON COUNTY (JACOBS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.10.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0366.11.html | 2013-12-16 13:09 | 1.3K | HAMILTON MANUF'G CO. (BADISCHE ANILIN & SODA FABRIK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0366.11.pdf | 2011-11-01 10:06 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0367.1.html | 2013-12-16 13:09 | 4.7K | The HAMILTON MORTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0367.1.pdf | 2011-11-01 10:06 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0367.2.html | 2013-12-16 13:10 | 11K | Ex parte HAMLIN., In re BRODT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0367.2.pdf | 2011-11-01 10:06 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0369.html | 2013-12-16 13:10 | 26K | In re HAMLIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0369.pdf | 2011-11-01 10:06 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0373.1.html | 2013-12-16 13:09 | 1.2K | HAMLIN (COBB v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0373.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0373.2.html | 2013-12-16 13:10 | 16K | HAMLIN v. PETTIBONE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0373.2.pdf | 2011-11-01 10:06 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0375.html | 2013-12-16 13:10 | 16K | HAMMEKIN v. CLAYTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0375.pdf | 2011-11-01 10:06 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0378.html | 2013-12-16 13:10 | 13K | HAMMER v. KAUFMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0378.pdf | 2011-11-01 10:06 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0380.1.html | 2013-12-16 13:09 | 5.5K | HAMMER v. KLEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0380.1.pdf | 2011-11-01 10:06 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0380.2.html | 2013-12-16 13:10 | 1.2K | HAMMER (PUTNAM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0380.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0380.3.html | 2013-12-16 13:10 | 10K | In re HAMMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0380.3.pdf | 2011-11-01 10:06 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0382.html | 2013-12-16 13:09 | 30K | HAMMOND v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0382.pdf | 2011-11-01 10:06 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.1.html | 2013-12-16 13:10 | 1.2K | HAMMOND (ASTROM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.2.html | 2013-12-16 13:09 | 1.2K | HAMMOND (BROCKETT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.2.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.3.html | 2013-12-16 13:09 | 1.2K | HAMMOND (BURBANK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.3.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.4.html | 2013-12-16 13:10 | 1.2K | HAMMOND (COOK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.4.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.5.html | 2013-12-16 13:10 | 1.2K | HAMMOND v. COOLIDGE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0387.6.html | 2013-12-16 13:10 | 24K | HAMMOND v. ESSEX FIRE & MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0387.6.pdf | 2011-11-01 10:06 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0390.1.html | 2013-12-16 13:09 | 1.2K | HAMMOND (GOULD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0390.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0390.2.html | 2013-12-16 13:10 | 8.1K | HAMMOND v. HAWS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0390.2.pdf | 2011-11-01 10:06 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0391.html | 2013-12-16 13:10 | 13K | HAMMOND v. HUNT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0391.pdf | 2011-11-01 10:06 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0393.html | 2013-12-16 13:09 | 1.2K | HAMMOND (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0393.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0394.html | 2013-12-16 13:10 | 12K | HAMMOND et al. v. MASON & HAMLIN ORGAN CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0394.pdf | 2011-11-01 10:06 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0395.1.html | 2013-12-16 13:10 | 1.2K | HAMMOND (SAXE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0395.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0395.2.html | 2013-12-16 13:09 | 1.2K | HAMMOND (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0395.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0395.3.html | 2013-12-16 13:09 | 1.2K | HAMMOND (THORP v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0395.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0395.4.html | 2013-12-16 13:10 | 1.2K | HAMMOND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0395.4.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0395.5.html | 2013-12-16 13:10 | 18K | The HAMMONIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0395.5.pdf | 2011-11-01 10:06 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0398.html | 2013-12-16 13:10 | 9.8K | The HAMMONIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0398.pdf | 2011-11-01 10:06 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0400.1.html | 2013-12-16 13:09 | 5.0K | The HAMMONIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0400.1.pdf | 2011-11-01 10:06 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0400.2.html | 2013-12-16 13:10 | 6.0K | HAMPDEN BANK v. MORGAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0400.2.pdf | 2011-11-01 10:06 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.1.html | 2013-12-16 13:10 | 1.3K | HAMPDEN STOCK & MUT. EIRE INS. CO. (EDDY STREET IRON FOUNDRY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.2.html | 2013-12-16 13:09 | 1.2K | HAMPTON (ROUSE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.3.html | 2013-12-16 13:09 | 1.2K | HANBERRY (GREEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.4.html | 2013-12-16 13:10 | 2.9K | HANCE v. McCORMICK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.4.pdf | 2011-11-01 10:06 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.5.html | 2013-12-16 13:10 | 1.2K | HANCOCK (FOOTE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.5.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0401.6.html | 2013-12-16 13:09 | 4.1K | HANCOCK v. HILLEGAS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0401.6.pdf | 2011-11-01 10:06 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0402.html | 2013-12-16 13:09 | 7.8K | HANCOCK v. NEW YORK LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0402.pdf | 2011-11-01 10:06 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0403.1.html | 2013-12-16 13:10 | 1.2K | HANCOCK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0403.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0403.2.html | 2013-12-16 13:09 | 36K | HANCOCK v. WALSH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0403.2.pdf | 2011-11-01 10:06 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0409.1.html | 2013-12-16 13:09 | 1.2K | HANCOCK MUT. LIFE INS CO. (WINCHELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0409.1.pdf | 2011-11-01 10:06 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0409.2.html | 2013-12-16 13:10 | 26K | HANCOX v. FISHING INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0409.2.pdf | 2011-11-01 10:06 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0413.1.html | 2013-12-16 13:10 | 1.3K | HANCOX v. The PHENIX. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0413.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0413.2.html | 2013-12-16 13:09 | 38K | HAND et al. v. The ELVIRA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0413.2.pdf | 2011-11-01 10:06 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0419.1.html | 2013-12-16 13:10 | 1.2K | HAND (TURNER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0419.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0419.2.html | 2013-12-16 13:10 | 1.2K | HAND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0419.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0419.3.html | 2013-12-16 13:10 | 6.3K | HAND v. YAHOOLA MIN. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0419.3.pdf | 2011-11-01 10:06 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0420.html | 2013-12-16 13:10 | 4.9K | In re HANDELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0420.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0421.html | 2013-12-16 13:10 | 11K | In re HANDLIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0421.pdf | 2011-11-01 10:06 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0422.html | 2013-12-16 13:09 | 3.3K | HANDY v. BROWN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0422.pdf | 2011-11-01 10:06 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0423.html | 2013-12-16 13:09 | 16K | HANEY et al. v. The LOUISIANA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0423.pdf | 2011-11-01 10:06 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0425.html | 2013-12-16 13:10 | 26K | HANEY et al. v. The LOUISIANA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0425.pdf | 2011-11-01 10:06 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0429.1.html | 2013-12-16 13:10 | 1.2K | HANEY (MARKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0429.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0429.2.html | 2013-12-16 13:09 | 10K | HANFORD et al. v. WESTCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0429.2.pdf | 2011-11-01 10:06 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0431.html | 2013-12-16 13:10 | 13K | In re HANIBEL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0431.pdf | 2011-11-01 10:06 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0433.html | 2013-12-16 13:09 | 10K | HANK v. CRITTENDEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0433.pdf | 2011-11-01 10:06 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0434.html | 2013-12-16 13:10 | 10K | HANKIN et al. v. SQUIRES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0434.pdf | 2011-11-01 10:06 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0435.1.html | 2013-12-16 13:09 | 1.2K | HANKS (ELY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0435.1.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0435.2.html | 2013-12-16 13:10 | 1.2K | HANLENBECH (ARMSTRONG v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0435.2.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0435.3.html | 2013-12-16 13:10 | 1.2K | HANLEY (TRIPLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0435.3.pdf | 2011-11-01 10:06 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0435.4.html | 2013-12-16 13:09 | 1.2K | HANLY (SNEED v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0435.4.pdf | 2011-11-01 10:06 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0436.1.html | 2013-12-16 13:10 | 5.1K | In re HANNA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0436.1.pdf | 2011-11-01 10:06 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0436.2.html | 2013-12-16 13:09 | 5.9K | In re HANNA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0436.2.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0437.1.html | 2013-12-16 13:09 | 1.2K | HANNA (ROCKHILL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0437.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0437.2.html | 2013-12-16 13:10 | 1.3K | The HANNAH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0437.2.pdf | 2011-11-01 10:07 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0437.3.html | 2013-12-16 13:10 | 23K | HANNAH et al. v. The CARRINGTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0437.3.pdf | 2011-11-01 10:07 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0441.1.html | 2013-12-16 13:10 | 1.2K | HANNAH, The (CLINTON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0441.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0441.2.html | 2013-12-16 13:09 | 1.2K | HANNAH, The (FORBES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0441.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0441.3.html | 2013-12-16 13:09 | 1.2K | HANNAH, The (HUNTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0441.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0441.4.html | 2013-12-16 13:10 | 1.2K | HANNAH M. BUELL, The (HENDERSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0441.4.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0441.5.html | 2013-12-16 13:10 | 15K | The HANNAH M. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0441.5.pdf | 2011-11-01 10:07 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0443.html | 2013-12-16 13:10 | 7.2K | The HANNAH M. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0443.pdf | 2011-11-01 10:07 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0444.html | 2013-12-16 13:10 | 6.7K | The HANNAH M. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0444.pdf | 2011-11-01 10:07 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0445.html | 2013-12-16 13:09 | 8.1K | In re HANNAHS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0445.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0446.html | 2013-12-16 13:10 | 11K | In re. HANNAHS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0446.pdf | 2011-11-01 10:07 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.1.html | 2013-12-16 13:10 | 1.2K | HANNEGAN (BURROWS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.2.html | 2013-12-16 13:09 | 1.2K | HANNIBAL (FAUNTLEROY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.2.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.3.html | 2013-12-16 13:09 | 1.2K | HANNIBAL (NORTHWESTERN UNION PACKET CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.3.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.4.html | 2013-12-16 13:10 | 1.2K | HANNIBAL, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.5.html | 2013-12-16 13:10 | 1.2K | HANNIBAL & ST. J. R. CO. (AETNA INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.6.html | 2013-12-16 13:10 | 1.2K | HANNIBAL & ST. J. R. CO. (BAILEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.6.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.7.html | 2013-12-16 13:09 | 1.3K | The HANOVER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.7.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.8.html | 2013-12-16 13:10 | 1.2K | HANOVER, The (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.8.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.9.html | 2013-12-16 13:10 | 1.2K | HANOVER, The (SAUNDERS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.9.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0448.10.html | 2013-12-16 13:09 | 9.3K | HANOVER NAT. BANK v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0448.10.pdf | 2011-11-01 10:07 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0449.1.html | 2013-12-16 13:09 | 1.2K | HANRICK (SEVENTH WARD BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0449.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0449.2.html | 2013-12-16 13:10 | 9.8K | The HANSA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0449.2.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0451.html | 2013-12-16 13:09 | 65K | The HANSA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0451.pdf | 2011-11-01 10:07 | 157K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0462.html | 2013-12-16 13:10 | 7.6K | The HANSA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0462.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0463.1.html | 2013-12-16 13:09 | 1.2K | HANSBROUGH (UPTON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0463.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0463.2.html | 2013-12-16 13:10 | 3.3K | In re HANSEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0463.2.pdf | 2011-11-01 10:07 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0463.3.html | 2013-12-16 13:10 | 1.2K | HANSEN v. The LOUISIANA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0463.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0463.4.html | 2013-12-16 13:09 | 1.2K | HANSEN (MAJOR v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0463.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0463.5.html | 2013-12-16 13:10 | 16K | HANSON v. COX. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0463.5.pdf | 2011-11-01 10:07 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0465.1.html | 2013-12-16 13:09 | 1.2K | HANSON (FORREST v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0465.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0465.2.html | 2013-12-16 13:10 | 23K | HANSON v. FOWLE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0465.2.pdf | 2011-11-01 10:07 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0469.html | 2013-12-16 13:09 | 19K | HANSON v. FOWLE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0469.pdf | 2011-11-01 10:07 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0472.1.html | 2013-12-16 13:10 | 1.2K | HANSON (ODENHEIMER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0472.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0472.2.html | 2013-12-16 13:10 | 7.8K | HANSON v. ROWELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0472.2.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0473.1.html | 2013-12-16 13:09 | 1.2K | HANWAY (ROBINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0473.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0473.2.html | 2013-12-16 13:10 | 1.2K | HANWAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0473.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0473.3.html | 2013-12-16 13:10 | 15K | In re HAPGOOD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0473.3.pdf | 2011-11-01 10:07 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0475.1.html | 2013-12-16 13:09 | 1.2K | HAPGOOD (GOLDSMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0475.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0475.2.html | 2013-12-16 13:10 | 1.2K | HAPGOOD (SAYLES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0475.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0475.3.html | 2013-12-16 13:10 | 1.2K | HAPPY RETURN, The (SWIFT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0475.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0476.html | 2013-12-16 13:10 | 11K | In re HARBAUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0476.pdf | 2011-11-01 10:07 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0477.1.html | 2013-12-16 13:09 | 1.2K | HARBAUGH (VEATCH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0477.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0477.2.html | 2013-12-16 13:10 | 1.2K | HABBAUGH (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0477.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0477.3.html | 2013-12-16 13:10 | 11K | HARBECK et al. v. The FRANCIS A. PALMER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0477.3.pdf | 2011-11-01 10:07 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0479.1.html | 2013-12-16 13:10 | 1.2K | HARBECK (MINER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0479.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0479.2.html | 2013-12-16 13:09 | 1.2K | HARBERT (NATIONAL HAY RAKE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0479.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0479.3.html | 2013-12-16 13:10 | 1.2K | HARBIN (HARDY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0479.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0479.4.html | 2013-12-16 13:10 | 1.2K | HARBISON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0479.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0479.5.html | 2013-12-16 13:10 | 5.9K | HARD v. STONE et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0479.5.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0480.html | 2013-12-16 13:09 | 50K | HARDEN v. GORDON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0480.pdf | 2011-11-01 10:07 | 119K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0488.1.html | 2013-12-16 13:10 | 1.2K | HARDICK (LASH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0488.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0488.2.html | 2013-12-16 13:09 | 11K | In re HARDIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0488.2.pdf | 2011-11-01 10:07 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0489.html | 2013-12-16 13:09 | 1.2K | HARDIN (TRUMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0489.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0490.1.html | 2013-12-16 13:09 | 2.5K | HARDING v. ALTEMUS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0490.1.pdf | 2011-11-01 10:07 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0490.2.html | 2013-12-16 13:10 | 1.2K | HARDING (CALDWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0490.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0490.3.html | 2013-12-16 13:10 | 5.8K | HARDING v. CROSBY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0490.3.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0490.4.html | 2013-12-16 13:09 | 1.2K | HARDING (HASKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0490.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.1.html | 2013-12-16 13:10 | 1.2K | HARDING (KELLY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.2.html | 2013-12-16 13:09 | 1.2K | HARDING (McKINSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.3.html | 2013-12-16 13:09 | 1.2K | HARDING v. The MAVERICK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.4.html | 2013-12-16 13:10 | 1.2K | HARDING v. REPLIER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.5.html | 2013-12-16 13:10 | 1.2K | HARDING (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.6.html | 2013-12-16 13:09 | 3.8K | HARDING v. WALKER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.6.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0491.7.html | 2013-12-16 13:09 | 32K | HARDING et al. v. WHEATON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0491.7.pdf | 2011-11-01 10:07 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0496.html | 2013-12-16 13:10 | 14K | HARDING et al. v. WHITNEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0496.pdf | 2011-11-01 10:07 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0498.html | 2013-12-16 13:09 | 12K | In re HARBISON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0498.pdf | 2011-11-01 10:07 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0500.html | 2013-12-16 13:09 | 12K | HARDON v. NEWTON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0500.pdf | 2011-11-01 10:07 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0502.html | 2013-12-16 13:10 | 10K | HARDS et al. v. CONNECTICUT MUT. LIFE INS. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0502.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0503.html | 2013-12-16 13:10 | 4.2K | The HARDY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0503.pdf | 2011-11-01 10:07 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0504.1.html | 2013-12-16 13:09 | 1.4K | HARDY et al. v. BININGER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0504.1.pdf | 2011-11-01 10:07 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0504.2.html | 2013-12-16 13:10 | 1.5K | HARDY et al. v. CLARK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0504.2.pdf | 2011-11-01 10:07 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0504.3.html | 2013-12-16 13:10 | 1.2K | HARDY (COOPER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0504.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0504.4.html | 2013-12-16 13:09 | 41K | HARDY et al. v. HARBIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0504.4.pdf | 2011-11-01 10:07 | 102K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0510.html | 2013-12-16 13:09 | 38K | HARDY et al. v. HARBIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0510.pdf | 2011-11-01 10:07 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0516.html | 2013-12-16 13:10 | 10K | HARDY v. REDMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0516.pdf | 2011-11-01 10:07 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0518.html | 2013-12-16 13:09 | 13K | HARDY et al. v. The RUGGLES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0518.pdf | 2011-11-01 10:07 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0520.html | 2013-12-16 13:10 | 8.0K | In re HARE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0520.pdf | 2011-11-01 10:07 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0521.1.html | 2013-12-16 13:09 | 1.2K | HARE (STEVENSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0521.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0521.2.html | 2013-12-16 13:10 | 1.2K | HARE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0521.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0521.3.html | 2013-12-16 13:10 | 8.8K | HARGRAVE v. CREIGHTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0521.3.pdf | 2011-11-01 10:07 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0522.1.html | 2013-12-16 13:10 | 1.2K | HARGRAVE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0522.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0522.2.html | 2013-12-16 13:09 | 1.2K | H. A. RICHMOND. The (FITZGERALD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0522.2.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0522.3.html | 2013-12-16 13:09 | 1.2K | HARKER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0522.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0522.4.html | 2013-12-16 13:10 | 12K | HARKEY v. TEXAS & P. RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0522.4.pdf | 2011-11-01 10:07 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0524.1.html | 2013-12-16 13:10 | 1.2K | HARKNESS (MONROE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0524.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0524.2.html | 2013-12-16 13:09 | 4.3K | HARLAN et al. v. The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0524.2.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0524.3.html | 2013-12-16 13:09 | 6.6K | HARLAN et al. v. The NASSAU. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0524.3.pdf | 2011-11-01 10:07 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0525.html | 2013-12-16 13:09 | 7.7K | HARLEY et al. v. FOUR HUNDRED AND SIXTY—SEVEN BARS OF RAILROAD IRON, Etc. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0525.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0526.html | 2013-12-16 13:10 | 12K | HARLEY et al. v. GAWLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0526.pdf | 2011-11-01 10:07 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0528.1.html | 2013-12-16 13:09 | 1.2K | HARLEY (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0528.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0528.2.html | 2013-12-16 13:10 | 1.2K | HARLEY (OREN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0528.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0528.3.html | 2013-12-16 13:10 | 12K | In re HARLOW. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0528.3.pdf | 2011-11-01 10:07 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0530.1.html | 2013-12-16 13:10 | 1.2K | HARLOW (CROWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0530.1.pdf | 2011-11-01 10:07 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0530.2.html | 2013-12-16 13:09 | 1.2K | HARLOW (EARLE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0530.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0530.3.html | 2013-12-16 13:09 | 9.5K | HARMAN v. HARMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0530.3.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0531.html | 2013-12-16 13:09 | 46K | HARMANSON v. BAIN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0531.pdf | 2011-11-01 10:07 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0539.html | 2013-12-16 13:09 | 15K | HARMANSON v. BAIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0539.pdf | 2011-11-01 10:07 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0541.html | 2013-12-16 13:10 | 62K | HARMANSON v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0541.pdf | 2011-11-01 10:07 | 141K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0551.html | 2013-12-16 13:10 | 12K | HARMER et al. v. GWYNNE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0551.pdf | 2011-11-01 10:07 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0553.html | 2013-12-16 13:09 | 15K | HARMER v. MORRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0553.pdf | 2011-11-01 10:07 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0555.1.html | 2013-12-16 13:10 | 1.2K | HARMISON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0555.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0555.2.html | 2013-12-16 13:09 | 1.2K | In re HARMON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0555.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0555.3.html | 2013-12-16 13:09 | 2.2K | In re HARMON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0555.3.pdf | 2011-11-01 10:07 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0555.4.html | 2013-12-16 13:10 | 1.1K | HARMON (DICKEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0555.4.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0555.5.html | 2013-12-16 13:10 | 7.7K | HARMON et al. v. JAMESSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0555.5.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0556.1.html | 2013-12-16 13:09 | 1.2K | The HARMONIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0556.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0556.2.html | 2013-12-16 13:10 | 16K | The HARMONY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0556.2.pdf | 2011-11-01 10:07 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0559.1.html | 2013-12-16 13:09 | 1.2K | HARMONY, The (CLAYTON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0559.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0559.2.html | 2013-12-16 13:10 | 1.2K | HARMONY, The (CONCKLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0559.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0559.3.html | 2013-12-16 13:10 | 38K | HARMONY v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0559.3.pdf | 2011-11-01 10:07 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0565.1.html | 2013-12-16 13:09 | 1.2K | HARMONY SETTLEMENT (NACHTRIEB v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0565.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0565.2.html | 2013-12-16 13:10 | 1.2K | HARMONY SOCIETY (LEMIX v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0565.2.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0565.3.html | 2013-12-16 13:10 | 1.2K | HARNDEN (FISHER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0565.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0565.4.html | 2013-12-16 13:09 | 1.2K | HARNDEN (ROBERTS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0565.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0565.5.html | 2013-12-16 13:09 | 30K | HARNEY et al. v. The SYDNEY L. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0565.5.pdf | 2011-11-01 10:07 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0570.html | 2013-12-16 13:10 | 7.8K | The HAROLD HAARFAGER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0570.pdf | 2011-11-01 10:07 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0571.html | 2013-12-16 13:10 | 8.1K | HARP v. The GRAND ERA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0571.pdf | 2011-11-01 10:07 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0572.html | 2013-12-16 13:09 | 7.1K | In re HARPER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0572.pdf | 2011-11-01 10:07 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0573.1.html | 2013-12-16 13:09 | 1.2K | HARPER (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0573.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0573.2.html | 2013-12-16 13:10 | 8.3K | HARPER v. COOKE et al., SAME v. STEVENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0573.2.pdf | 2011-11-01 10:07 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0574.html | 2013-12-16 13:10 | 9.4K | HARPER v. DOUGHERTY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0574.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0575.1.html | 2013-12-16 13:09 | 1.2K | HARPER (GRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0575.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0575.2.html | 2013-12-16 13:10 | 1.2K | HARPER (HILLIARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0575.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0575.3.html | 2013-12-16 13:10 | 1.4K | HARPER v. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0575.3.pdf | 2011-11-01 10:07 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0575.4.html | 2013-12-16 13:09 | 1.1K | HARPER (MAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0575.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0575.5.html | 2013-12-16 13:09 | 1.2K | HARPER (METROPOLITON LIFE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0575.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0576.html | 2013-12-16 13:09 | 8.3K | HARPER v. NEFF et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0576.pdf | 2011-11-01 10:07 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0577.html | 2013-12-16 13:09 | 40K | HARPER et al. v. NEW BRIG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0577.pdf | 2011-11-01 10:07 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0583.1.html | 2013-12-16 13:10 | 2.5K | HARPER et al. v. REILY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0583.1.pdf | 2011-11-01 10:07 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0583.2.html | 2013-12-16 13:09 | 4.7K | HARPER v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0583.2.pdf | 2011-11-01 10:07 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.1.html | 2013-12-16 13:09 | 1.2K | HARPER v. STEVENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.2.html | 2013-12-16 13:10 | 3.1K | HARPER v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.2.pdf | 2011-11-01 10:07 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.3.html | 2013-12-16 13:10 | 1.1K | HARRELL (BEALL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.4.html | 2013-12-16 13:09 | 1.2K | HARRELL (JARRELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.5.html | 2013-12-16 13:09 | 1.2K | HARRIES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0584.6.html | 2013-12-16 13:10 | 3.2K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0584.6.pdf | 2011-11-01 10:07 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0585.html | 2013-12-16 13:10 | 8.0K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0585.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0586.1.html | 2013-12-16 13:09 | 4.8K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0586.1.pdf | 2011-11-01 10:07 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0586.2.html | 2013-12-16 13:10 | 7.1K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0586.2.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0587.html | 2013-12-16 13:09 | 4.1K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0587.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0588.html | 2013-12-16 13:10 | 41K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0588.pdf | 2011-11-01 10:07 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0594.html | 2013-12-16 13:10 | 16K | The HARRIET. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0594.pdf | 2011-11-01 10:07 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0596.1.html | 2013-12-16 13:09 | 1.2K | HARRIET, The (COLEMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0596.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0596.2.html | 2013-12-16 13:10 | 1.2K | HARRIET, The (MOODIE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0596.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0597.html | 2013-12-16 13:09 | 7.3K | The HARRIET ANN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0597.pdf | 2011-11-01 10:07 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0598.html | 2013-12-16 13:10 | 11K | The HARRIET NEWHALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0598.pdf | 2011-11-01 10:07 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0599.1.html | 2013-12-16 13:09 | 1.3K | The HARRIET ROGERS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0599.1.pdf | 2011-11-01 10:07 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0599.2.html | 2013-12-16 13:10 | 1.2K | HARRIETT, The (MYERS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0599.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0599.3.html | 2013-12-16 13:10 | 1.2K | HARRILL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0599.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0599.4.html | 2013-12-16 13:09 | 21K | The HARRIMAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0599.4.pdf | 2011-11-01 10:07 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0602.html | 2013-12-16 13:09 | 4.0K | HARRIMAN v. DODGE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0602.pdf | 2011-11-01 10:07 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0603.html | 2013-12-16 13:09 | 11K | HARRIMAN et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0603.pdf | 2011-11-01 10:07 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0604.1.html | 2013-12-16 13:10 | 1.2K | HARRIMAN (SCHULENBERG v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0604.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0604.2.html | 2013-12-16 13:09 | 1.2K | HARRIMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0604.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0605.1.html | 2013-12-16 13:09 | 5.2K | HARRINGTON v. FIRE ASS'N. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0605.1.pdf | 2011-11-01 10:07 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0605.2.html | 2013-12-16 13:10 | 5.1K | HARRINGTON v. LIBBY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0605.2.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0606.1.html | 2013-12-16 13:10 | 2.3K | HARRINGTON v. McDUEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0606.1.pdf | 2011-11-01 10:07 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0606.2.html | 2013-12-16 13:09 | 1.2K | HARRINGTON (OGDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0606.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0606.3.html | 2013-12-16 13:09 | 8.9K | Ex parte HARRIS et al. In re COCHRANE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0606.3.pdf | 2011-11-01 10:07 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0607.html | 2013-12-16 13:09 | 16K | Ex parte HARRIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0607.pdf | 2011-11-01 10:07 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0610.1.html | 2013-12-16 13:10 | 1.2K | In re HARRIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0610.1.pdf | 2011-11-01 10:07 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0610.2.html | 2013-12-16 13:09 | 6.8K | In re HARRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0610.2.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0611.1.html | 2013-12-16 13:09 | 2.5K | In re HARRIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0611.1.pdf | 2011-11-01 10:07 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0611.2.html | 2013-12-16 13:10 | 5.1K | HARRIS v. ALEXANDER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0611.2.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0612.1.html | 2013-12-16 13:10 | 1.1K | HARRIS (ALEXANDER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0612.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0612.2.html | 2013-12-16 13:09 | 21K | HARRIS et al. v. BABBITT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0612.2.pdf | 2011-11-01 10:07 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0615.html | 2013-12-16 13:10 | 27K | HARRIS v. BERRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0615.pdf | 2011-11-01 10:07 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0619.html | 2013-12-16 13:10 | 14K | HARRIS et al. v. BRADLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0619.pdf | 2011-11-01 10:07 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0621.html | 2013-12-16 13:10 | 15K | HARRIS v. BURCHAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0621.pdf | 2011-11-01 10:07 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0623.html | 2013-12-16 13:09 | 1.1K | HARRIS (BUTTRICK v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0623.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0624.1.html | 2013-12-16 13:10 | 3.3K | HARRIS v. CAPEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0624.1.pdf | 2011-11-01 10:07 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0624.2.html | 2013-12-16 13:10 | 1.1K | HARRIS (DEXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0624.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0624.3.html | 2013-12-16 13:10 | 1.2K | HARRIS (D'WOLF v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0624.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0624.4.html | 2013-12-16 13:09 | 9.2K | HARRIS v. EXCHANGE NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0624.4.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0625.html | 2013-12-16 13:10 | 5.3K | HARRIS v. FIRTH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0625.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0626.1.html | 2013-12-16 13:09 | 1.1K | HARRIS (GIBSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0626.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0626.2.html | 2013-12-16 13:10 | 28K | HARRIS et al. v. The HENRIETTA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0626.2.pdf | 2011-11-01 10:07 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0630.1.html | 2013-12-16 13:09 | 1.1K | HARRIS (HOWLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0630.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0630.2.html | 2013-12-16 13:10 | 1.2K | HARRIS (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0630.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0630.3.html | 2013-12-16 13:10 | 1.1K | HARRIS (KEENE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0630.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0630.4.html | 2013-12-16 13:09 | 31K | HARRIS v. The KENSINGTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0630.4.pdf | 2011-11-01 10:07 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0635.html | 2013-12-16 13:10 | 10K | HARRIS et al. v. LINDSAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0635.pdf | 2011-11-01 10:07 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0637.html | 2013-12-16 13:09 | 24K | HARRIS et al. v. LINDSAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0637.pdf | 2011-11-01 10:07 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0640.html | 2013-12-16 13:09 | 13K | HARRIS et al. v. McGOVERN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0640.pdf | 2011-11-01 10:07 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0642.1.html | 2013-12-16 13:10 | 1.2K | HARRIS (NICHOLS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0642.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0642.2.html | 2013-12-16 13:10 | 2.9K | HARRIS v. NUGENT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0642.2.pdf | 2011-11-01 10:07 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.1.html | 2013-12-16 13:09 | 3.8K | HARRIS et al. v. The PROMETHEUS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.1.pdf | 2011-11-01 10:07 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.2.html | 2013-12-16 13:10 | 1.1K | HARRIS (RIPLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.3.html | 2013-12-16 13:10 | 1.4K | HARRIS et al. v. The ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.3.pdf | 2011-11-01 10:07 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.4.html | 2013-12-16 13:09 | 1.2K | HARRIS (SHIRLY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.5.html | 2013-12-16 13:09 | 1.2K | HARRIS (UNITED NICKEL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.6.html | 2013-12-16 13:10 | 1.2K | HARRIS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.6.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0643.7.html | 2013-12-16 13:10 | 9.0K | HARRIS et al. v. WHEELER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0643.7.pdf | 2011-11-01 10:07 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0644.html | 2013-12-16 13:09 | 11K | HARRIS et al. v. WHEELER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0644.pdf | 2011-11-01 10:07 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0646.1.html | 2013-12-16 13:10 | 2.2K | HARRISON'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0646.1.pdf | 2011-11-01 10:07 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0646.2.html | 2013-12-16 13:09 | 6.5K | HARRISON v. The ANNA KIMBALL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0646.2.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0647.html | 2013-12-16 13:10 | 5.5K | HARRISON et al. v. BOYD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0647.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0648.1.html | 2013-12-16 13:09 | 6.5K | HARRISON v. The ECLIPSE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0648.1.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0648.2.html | 2013-12-16 13:10 | 4.2K | HARRISON v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0648.2.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0649.1.html | 2013-12-16 13:10 | 1.2K | HARRISON, The (FRANCIS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0649.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0649.2.html | 2013-12-16 13:09 | 1.1K | HARRISON (GAGER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0649.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0649.3.html | 2013-12-16 13:10 | 3.0K | HARRISON v. GALES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0649.3.pdf | 2011-11-01 10:07 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0649.4.html | 2013-12-16 13:10 | 34K | HARRISON v. HADLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0649.4.pdf | 2011-11-01 10:07 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0654.1.html | 2013-12-16 13:10 | 1.3K | HARRISON v. HADLEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0654.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0654.2.html | 2013-12-16 13:09 | 1.2K | HARRISON (McCALL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0654.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0654.3.html | 2013-12-16 13:09 | 17K | HARRISON v. McLAREN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0654.3.pdf | 2011-11-01 10:07 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0657.1.html | 2013-12-16 13:09 | 1.2K | HARRISON (NICHOLLS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0657.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0657.2.html | 2013-12-16 13:10 | 1.2K | HARRISON (RINEHART v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0657.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0657.3.html | 2013-12-16 13:10 | 9.8K | HARRISON et al. v. ROWAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0657.3.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0658.html | 2013-12-16 13:09 | 27K | HARRISON v. ROWAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0658.pdf | 2011-11-01 10:07 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0663.html | 2013-12-16 13:10 | 21K | HARRISON v. ROWAN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0663.pdf | 2011-11-01 10:07 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0666.html | 2013-12-16 13:10 | 21K | HARRISON et al. v. ROWAN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0666.pdf | 2011-11-01 10:07 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0669.html | 2013-12-16 13:09 | 11K | HARRISON V. STERRY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0669.pdf | 2011-11-01 10:07 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0671.html | 2013-12-16 13:09 | 17K | HARRISON et al. v. STEWART et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0671.pdf | 2011-11-01 10:07 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0673.html | 2013-12-16 13:10 | 4.4K | HARRISON v. The SUSAN LUDWIG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0673.pdf | 2011-11-01 10:07 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0674.1.html | 2013-12-16 13:09 | 1.2K | HARRISON (TRYPHENIA v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0674.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0674.2.html | 2013-12-16 13:10 | 10K | HARRISON v. URANN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0674.2.pdf | 2011-11-01 10:07 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0675.1.html | 2013-12-16 13:10 | 1.2K | HARRISONVILLE (BONHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0675.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0675.2.html | 2013-12-16 13:09 | 1.2K | HARROLD (BYRD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0675.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0675.3.html | 2013-12-16 13:09 | 6.1K | The HARRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0675.3.pdf | 2011-11-01 10:07 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0676.html | 2013-12-16 13:10 | 29K | HARSHMAN v. BATES COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0676.pdf | 2011-11-01 10:07 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0680.1.html | 2013-12-16 13:10 | 1.2K | HART (BENJAMIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0680.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0680.2.html | 2013-12-16 13:09 | 1.2K | HART (BOUCICAULT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0680.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0681.html | 2013-12-16 13:09 | 16K | HART v. BRIDGEPORT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0681.pdf | 2011-11-01 10:07 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0683.html | 2013-12-16 13:10 | 15K | HART et al. v. DELAWARE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0683.pdf | 2011-11-01 10:07 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0685.html | 2013-12-16 13:09 | 4.6K | HART et al. v. The ENTERPRISE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0685.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0686.html | 2013-12-16 13:10 | 8.0K | HART v. GRAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0686.pdf | 2011-11-01 10:07 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0687.html | 2013-12-16 13:10 | 16K | HART v. The LITTLEJOHN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0687.pdf | 2011-11-01 10:07 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0689.html | 2013-12-16 13:09 | 5.9K | HART et al. v. The OTIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0689.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0690.html | 2013-12-16 13:09 | 5.9K | HART v. ROSE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0690.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0691.html | 2013-12-16 13:09 | 24K | HART v. SHAW. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0691.pdf | 2011-11-01 10:07 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0694.1.html | 2013-12-16 13:10 | 1.2K | HART (SHAW v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0694.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0694.2.html | 2013-12-16 13:10 | 1.2K | HART (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0694.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0694.3.html | 2013-12-16 13:09 | 13K | HART, B. & M. MANUF'G CO. v. SARGEANT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0694.3.pdf | 2011-11-01 10:07 | 175K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.0695_01.jpg | 2011-07-08 17:20 | 122K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0697.1.html | 2013-12-16 13:09 | 5.9K | In re HARTEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0697.1.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0697.2.html | 2013-12-16 13:10 | 1.2K | HARTELL (TILGHMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0697.2.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0697.3.html | 2013-12-16 13:10 | 5.8K | HARTELL et al. v. VINEY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0697.3.pdf | 2011-11-01 10:07 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0698.1.html | 2013-12-16 13:09 | 1.2K | HARTER (POMROY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0698.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0698.2.html | 2013-12-16 13:10 | 7.8K | HARTFIELD v. PATTON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0698.2.pdf | 2011-11-01 10:07 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0699.1.html | 2013-12-16 13:10 | 1.2K | HARTFORD, The (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0699.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0699.2.html | 2013-12-16 13:10 | 16K | HARTFORD N. H. R. CO. v. GRANT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0699.2.pdf | 2011-11-01 10:07 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0702.1.html | 2013-12-16 13:10 | 1.2K | HARTFORD CARPET CO. (LOWELL. MANUFACTURING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0702.1.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0702.2.html | 2013-12-16 13:09 | 1.2K | HARTFORD CITY GASLIGHT CO. (STAPLES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0702.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0702.3.html | 2013-12-16 13:09 | 14K | HARTFORD FIRE INS. CO. v. DOYLE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0702.3.pdf | 2011-11-01 10:07 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.1.html | 2013-12-16 13:10 | 1.2K | HARTFORD FIRE INS. CO. (CRAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.2.html | 2013-12-16 13:09 | 1.2K | HARTFORD FIRE INS. CO. (HOWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.3.html | 2013-12-16 13:09 | 1.2K | HARTFORD FIRE INS. CO. (HUMPHRY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.3.pdf | 2011-11-01 10:07 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.4.html | 2013-12-16 13:10 | 1.2K | HARTFORD INS. CO. (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.4.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.5.html | 2013-12-16 13:10 | 1.2K | HARTFORD INS. CO. (SPRATLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.5.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.6.html | 2013-12-16 13:09 | 1.2K | HARTFORD, P. & F. R. CO. (BARNARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.6.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0704.7.html | 2013-12-16 13:09 | 8.6K | In re HARTHILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0704.7.pdf | 2011-11-01 10:07 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0705.1.html | 2013-12-16 13:09 | 4.1K | In re HARTHORN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0705.1.pdf | 2011-11-01 10:07 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0705.2.html | 2013-12-16 13:10 | 1.3K | HARTLAND (SOCIETY FOR THE PROPAGATION OF THE GOSPEL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0705.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0705.3.html | 2013-12-16 13:10 | 1.2K | HARTLEY (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0705.3.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0706.1.html | 2013-12-16 13:10 | 1.2K | HARTLEY (TALBOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0706.1.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0706.2.html | 2013-12-16 13:09 | 1.2K | HARTLEY v. UNITED STATES |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0706.2.pdf | 2011-11-01 10:07 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0706.3.html | 2013-12-16 13:09 | 10K | HARTMAN v. The WILL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0706.3.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0707.1.html | 2013-12-16 13:09 | 1.2K | HARTNELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0707.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0707.2.html | 2013-12-16 13:10 | 5.0K | In re HARTOUGH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0707.2.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0708.1.html | 2013-12-16 13:09 | 1.2K | HARTSHORN (BRAT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0708.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0708.2.html | 2013-12-16 13:10 | 1.2K | HARTSHORN (DAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0708.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0708.3.html | 2013-12-16 13:10 | 2.1K | HARTSHORN et al. v. ALLISON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0708.3.pdf | 2011-11-01 10:08 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0708.4.html | 2013-12-16 13:09 | 11K | HARTSHORN v. ALMY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0708.4.pdf | 2011-11-01 10:08 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0710.html | 2013-12-16 13:09 | 7.2K | HARTSHORN v. SHOREY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0710.pdf | 2011-11-01 10:08 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0711.html | 2013-12-16 13:09 | 15K | HARTSHORN v. TRIPP et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0711.pdf | 2011-11-01 10:08 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0713.html | 2013-12-16 13:10 | 17K | HARTSHORN et al. v. TWENTY-FIVE CASES SILK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0713.pdf | 2011-11-01 10:08 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0715.html | 2013-12-16 13:09 | 22K | HARTSHORN et al. v. WRIGHT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0715.pdf | 2011-11-01 10:08 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0719.1.html | 2013-12-16 13:10 | 1.2K | HARTSHORNE (GRANON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0719.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0719.2.html | 2013-12-16 13:09 | 2.2K | HARTSHORNE et al. v. INGLE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0719.2.pdf | 2011-11-01 10:08 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0719.3.html | 2013-12-16 13:09 | 5.0K | HARTSHORNE v. McIVER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0719.3.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0719.4.html | 2013-12-16 13:10 | 1.2K | HARTSHORNE v. SANFORD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0719.4.pdf | 2011-11-01 10:08 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0720.html | 2013-12-16 13:09 | 9.9K | HARTUPEE v. THE COAL BLUFF NO. 2. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0720.pdf | 2011-11-01 10:08 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0721.html | 2013-12-16 13:09 | 9.7K | In re HARTWELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0721.pdf | 2011-11-01 10:08 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0722.1.html | 2013-12-16 13:09 | 1.1K | HARTWELL (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0722.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0722.2.html | 2013-12-16 13:10 | 1.2K | HARTWELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0722.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0722.3.html | 2013-12-16 13:10 | 1.3K | HARTWELL v. VINEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0722.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0722.4.html | 2013-12-16 13:09 | 13K | Ex parte HARTZ et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0722.4.pdf | 2011-11-01 10:08 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0724.html | 2013-12-16 13:09 | 8.1K | The HARVEST. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0724.pdf | 2011-11-01 10:08 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0726.html | 2013-12-16 13:10 | 7.5K | The HARVEST. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0726.pdf | 2011-11-01 10:08 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0727.1.html | 2013-12-16 13:10 | 1.3K | The HARVEST QUEEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0727.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0727.2.html | 2013-12-16 13:09 | 42K | HARVEY v. ALLEN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0727.2.pdf | 2011-11-01 10:08 | 104K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0734.html | 2013-12-16 13:09 | 14K | HARVEY v. CRANE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0734.pdf | 2011-11-01 10:08 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0736.1.html | 2013-12-16 13:09 | 1.2K | HARVEY (DEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0736.1.pdf | 2011-11-01 10:08 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0736.2.html | 2013-12-16 13:10 | 3.7K | HARVEY v. EVANSVILLE, ETC., STEAM PACKET CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0736.2.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0736.3.html | 2013-12-16 13:10 | 15K | HARVEY v. GRAND TRUNK RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0736.3.pdf | 2011-11-01 10:08 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0738.html | 2013-12-16 13:09 | 13K | HARVEY v. GRAND TRUNK RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0738.pdf | 2011-11-01 10:08 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0740.html | 2013-12-16 13:10 | 33K | HARVEY v. RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0740.pdf | 2011-11-01 10:08 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0746.1.html | 2013-12-16 13:10 | 3.6K | HARVEY v. RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0746.1.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0746.2.html | 2013-12-16 13:09 | 101K | HARVEY v. RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0746.2.pdf | 2011-11-01 10:08 | 208K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0762.1.html | 2013-12-16 13:09 | 1.2K | HARVEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0762.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0762.2.html | 2013-12-16 13:10 | 1.2K | HARVEY v. The VIVID. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0762.2.pdf | 2011-11-01 10:08 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0762.3.html | 2013-12-16 13:10 | 6.6K | Ex parte HARWOOD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0762.3.pdf | 2011-11-01 10:08 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0763.html | 2013-12-16 13:09 | 3.9K | The HARWOOD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0763.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0764.1.html | 2013-12-16 13:09 | 1.2K | HARWOOD (MAHN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0764.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0764.2.html | 2013-12-16 13:10 | 13K | HARWOOD et al. v. MILL RIVER WOOLEN MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0764.2.pdf | 2011-11-01 10:08 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0766.1.html | 2013-12-16 13:09 | 1.2K | HARWOOD (TAYLOR v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0766.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0766.2.html | 2013-12-16 13:10 | 8.4K | HASBROOK et al. v. PALMER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0766.2.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0767.html | 2013-12-16 13:09 | 8.8K | In re HASBROUCK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0767.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0768.html | 2013-12-16 13:10 | 12K | HASELDEN v. OGDEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0768.pdf | 2011-11-01 10:08 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0770.html | 2013-12-16 13:10 | 9.9K | In re HASKELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0770.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0771.html | 2013-12-16 13:10 | 8.3K | In re HASKELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0771.pdf | 2011-11-01 10:08 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0772.html | 2013-12-16 13:09 | 18K | HASKELL v. INGALLS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0772.pdf | 2011-11-01 10:08 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0775.1.html | 2013-12-16 13:10 | 1.2K | HASKELL (MABIE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0775.1.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0775.2.html | 2013-12-16 13:09 | 12K | HASKELL et al. v. SHOE MACHINERY MANUF'G CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0775.2.pdf | 2011-11-01 10:08 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0777.1.html | 2013-12-16 13:10 | 1.2K | HASKELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0777.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0777.2.html | 2013-12-16 13:09 | 1.2K | HASKELL (WYTHE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0777.2.pdf | 2011-11-01 10:08 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0777.3.html | 2013-12-16 13:10 | 8.5K | HASKILL v. FRYE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0777.3.pdf | 2011-11-01 10:08 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0778.html | 2013-12-16 13:10 | 20K | HASKINS v. HARDING et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0778.pdf | 2011-11-01 10:08 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0781.html | 2013-12-16 13:10 | 9.7K | HASKINS v. HARDING et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0781.pdf | 2011-11-01 10:08 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0783.1.html | 2013-12-16 13:09 | 1.2K | HASKINS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0783.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0783.2.html | 2013-12-16 13:10 | 30K | HASLETT et al. v. The ENTERPRISE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0783.2.pdf | 2011-11-01 10:08 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0788.html | 2013-12-16 13:10 | 20K | HASSELL v. BASKET et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0788.pdf | 2011-11-01 10:08 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0791.1.html | 2013-12-16 13:09 | 5.4K | In re HASTINGS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0791.1.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0791.2.html | 2013-12-16 13:10 | 1.2K | HASTINGS (GOULD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0791.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0791.3.html | 2013-12-16 13:10 | 13K | HASTINGS et al. v. GRANBERRY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0791.3.pdf | 2011-11-01 10:08 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0793.html | 2013-12-16 13:09 | 11K | HASTINGS et al. v. SPENSER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0793.pdf | 2011-11-01 10:08 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.1.html | 2013-12-16 13:09 | 1.3K | HASTINGS v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.1.pdf | 2011-11-01 10:08 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.2.html | 2013-12-16 13:10 | 1.2K | HASTINGS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.3.html | 2013-12-16 13:10 | 1.2K | HASTINGS BANK (HAWKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.3.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.4.html | 2013-12-16 13:09 | 1.2K | HASTINGS NAT. BANK (HAWKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.4.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.5.html | 2013-12-16 13:09 | 1.2K | HATCH (BANK OF THE UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.5.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0795.6.html | 2013-12-16 13:10 | 29K | HATCH v. BURROUGHS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0795.6.pdf | 2011-11-01 10:08 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0799.html | 2013-12-16 13:10 | 34K | HATCH v. CHICAGO, R. I. & P. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0799.pdf | 2011-11-01 10:08 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0805.1.html | 2013-12-16 13:09 | 1.2K | HATCH (CHICKERING v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0805.1.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0805.2.html | 2013-12-16 13:10 | 5.0K | HATCH v. CODDINGTON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0805.2.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0805.3.html | 2013-12-16 13:10 | 5.1K | HATCH v. DORR et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0805.3.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0806.html | 2013-12-16 13:10 | 13K | HATCH v. EUSTIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0806.pdf | 2011-11-01 10:08 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0808.1.html | 2013-12-16 13:09 | 4.5K | HATCH v. METROPOLE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0808.1.pdf | 2011-11-01 10:08 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0808.2.html | 2013-12-16 13:10 | 1.2K | HATCH (NICHOLSON PAVEMENT CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0808.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0808.3.html | 2013-12-16 13:10 | 1.2K | HATCH (PHILIPS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0808.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0808.4.html | 2013-12-16 13:09 | 10K | HATCH v. PRESTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0808.4.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.1.html | 2013-12-16 13:10 | 1.2K | HATCH (STOUGH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.2.html | 2013-12-16 13:09 | 1.2K | HATCH (THAXTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.3.html | 2013-12-16 13:09 | 1.2K | HATCH (THOMAS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.4.html | 2013-12-16 13:10 | 1.2K | HATCH v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.4.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.5.html | 2013-12-16 13:10 | 1.2K | HATCH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.5.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0810.6.html | 2013-12-16 13:10 | 22K | HATCH v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0810.6.pdf | 2011-11-01 10:08 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0814.1.html | 2013-12-16 13:10 | 4.3K | In re HATCHER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0814.1.pdf | 2011-11-01 10:08 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0814.2.html | 2013-12-16 13:09 | 1.2K | HATCHER (DAVIE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0814.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0814.3.html | 2013-12-16 13:09 | 11K | HATFIELD v. BUSHNELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0814.3.pdf | 2011-11-01 10:08 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0816.1.html | 2013-12-16 13:10 | 1.2K | HATFIELD (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0816.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0816.2.html | 2013-12-16 13:09 | 1.2K | HATHAWAY (COLLINS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0816.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0816.3.html | 2013-12-16 13:09 | 12K | HATHAWAY v. JONES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0816.3.pdf | 2011-11-01 10:08 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0818.html | 2013-12-16 13:09 | 28K | HATHAWAY v. ROACH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0818.pdf | 2011-11-01 10:08 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0822.1.html | 2013-12-16 13:09 | 1.2K | HATHWAY (SLOCUM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0822.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0822.2.html | 2013-12-16 13:10 | 1.2K | HATHWAY (SWIFT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0822.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0822.3.html | 2013-12-16 13:10 | 1.2K | HATHWAY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0822.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0822.4.html | 2013-12-16 13:09 | 8.7K | In re HATHORN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0822.4.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0823.html | 2013-12-16 13:10 | 15K | In re HATJE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0823.pdf | 2011-11-01 10:08 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0825.html | 2013-12-16 13:09 | 5.1K | The HATTIE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0825.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0826.html | 2013-12-16 13:10 | 5.2K | The HATTIE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0826.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0827.1.html | 2013-12-16 13:10 | 1.2K | HATTIE JACKSON, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0827.1.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0827.2.html | 2013-12-16 13:09 | 1.2K | HATTIE ROSS, The (CHAPIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0827.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0827.3.html | 2013-12-16 13:09 | 24K | HATTON et al. v. The MELITA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0827.3.pdf | 2011-11-01 10:08 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0830.html | 2013-12-16 13:09 | 5.5K | HATTRICK et al. v. The SPANISH BARK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0830.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0831.html | 2013-12-16 13:09 | 20K | In re HAUCK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0831.pdf | 2011-11-01 10:08 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0834.1.html | 2013-12-16 13:09 | 1.2K | HAUEL (LOW v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0834.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0834.2.html | 2013-12-16 13:10 | 5.6K | The HAUGESUND v. The BOWDOIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0834.2.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0835.html | 2013-12-16 13:09 | 13K | HAUGH et al. v. TEXAS & P. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0835.pdf | 2011-11-01 10:08 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0837.html | 2013-12-16 13:10 | 19K | HAUGHEY v. ALBIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0837.pdf | 2011-11-01 10:08 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0840.html | 2013-12-16 13:10 | 6.4K | In re HAUGHTON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0840.pdf | 2011-11-01 10:08 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0841.1.html | 2013-12-16 13:09 | 1.2K | HAUGHTON (BEERS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0841.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0841.2.html | 2013-12-16 13:10 | 11K | HAUGHTON et al. v. EUSTIS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0841.2.pdf | 2011-11-01 10:08 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0842.1.html | 2013-12-16 13:10 | 1.2K | HAUN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0842.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0842.2.html | 2013-12-16 13:09 | 1.2K | HAUN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0842.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0842.3.html | 2013-12-16 13:09 | 3.8K | HAUPTMAN v. NELSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0842.3.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0843.html | 2013-12-16 13:09 | 5.0K | HAUST et al. v. BURGESS et al., MILLER et al. v. BURGESS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0843.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0844.html | 2013-12-16 13:10 | 7.2K | The HAVANA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0844.pdf | 2011-11-01 10:08 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0845.1.html | 2013-12-16 13:09 | 1.3K | HAVEMEYER v. LOEB. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0845.1.pdf | 2011-11-01 10:08 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0845.2.html | 2013-12-16 13:10 | 1.2K | HAVEN (BLANCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0845.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0845.3.html | 2013-12-16 13:10 | 1.2K | HAVEN (BRONDE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0845.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0845.4.html | 2013-12-16 13:09 | 7.0K | HAVEN et al. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0845.4.pdf | 2011-11-01 10:08 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0846.html | 2013-12-16 13:09 | 12K | HAVEN et al. v. HOLLAND. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0846.pdf | 2011-11-01 10:08 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0847.1.html | 2013-12-16 13:09 | 1.2K | HAVEN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0847.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0847.2.html | 2013-12-16 13:10 | 1.3K | HAVEN (UNITED STATES & FOREIGN SALAMANDER FELTING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0847.2.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0847.3.html | 2013-12-16 13:10 | 9.2K | In re HAVENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0847.3.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0849.1.html | 2013-12-16 13:10 | 2.5K | In re HAVENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0849.1.pdf | 2011-11-01 10:08 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0849.2.html | 2013-12-16 13:09 | 1.2K | HAVENS (HUDDY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0849.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0849.3.html | 2013-12-16 13:09 | 31K | The HAVERE., The SCOTLAND. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0849.3.pdf | 2011-11-01 10:08 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0854.html | 2013-12-16 13:10 | 15K | The HAVRE., The SCOTLAND. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0854.pdf | 2011-11-01 10:08 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0856.html | 2013-12-16 13:09 | 34K | IAWES v. ANTISDEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0856.pdf | 2011-11-01 10:08 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0862.html | 2013-12-16 13:09 | 29K | HAWES. v. CONTRA COSTA WATER CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0862.pdf | 2011-11-01 10:08 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0866.html | 2013-12-16 13:09 | 5.0K | HAWES v. COOK et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0866.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0867.html | 2013-12-16 13:09 | 17K | HAWES v. GAGE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0867.pdf | 2011-11-01 10:08 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0869.html | 2013-12-16 13:10 | 2.2K | HAWES v. The JAMES SMITH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0869.pdf | 2011-11-01 10:08 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0870.1.html | 2013-12-16 13:09 | 5.0K | HAWES v. MANN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0870.1.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0870.2.html | 2013-12-16 13:10 | 25K | HAWES et al. v. MARCHANT et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0870.2.pdf | 2011-11-01 10:08 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0874.html | 2013-12-16 13:10 | 6.4K | HAWES et al. v. NEW ENGLAND MUT. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0874.pdf | 2011-11-01 10:08 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0875.html | 2013-12-16 13:10 | 20K | HAWES v. WASHBURNE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0875.pdf | 2011-11-01 10:08 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0878.1.html | 2013-12-16 13:10 | 1.1K | HAWK (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0878.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0878.2.html | 2013-12-16 13:09 | 1.2K | HAWKE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0878.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0878.3.html | 2013-12-16 13:09 | 1.3K | HAWKEYE STEEL BAR FENCE CO. (WASHBURN & M. MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0878.3.pdf | 2011-11-01 10:08 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0878.4.html | 2013-12-16 13:10 | 4.2K | HAWKINS v. COX et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0878.4.pdf | 2011-11-01 10:08 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0879.1.html | 2013-12-16 13:09 | 1.2K | HAWKINS v. FIRST NAT. BANK OF HASTINGS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0879.1.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0879.2.html | 2013-12-16 13:10 | 8.7K | HAWKINS v. HASTINGS BANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0879.2.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0880.html | 2013-12-16 13:10 | 5.7K | HAWKINS v. HASTINGS NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0880.pdf | 2011-11-01 10:08 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0881.1.html | 2013-12-16 13:10 | 1.2K | HAWKINS (LA BAW v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0881.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0881.2.html | 2013-12-16 13:10 | 1.1K | HAWKINS (OLCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0881.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0881.3.html | 2013-12-16 13:10 | 1.1K | HAWKS (STARLING v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0881.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0881.4.html | 2013-12-16 13:09 | 6.4K | HAWKINS et al. v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0881.4.pdf | 2011-11-01 10:08 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0881.5.html | 2013-12-16 13:09 | 2.7K | HAWKINS v. WILLBANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0881.5.pdf | 2011-11-01 10:08 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0882.1.html | 2013-12-16 13:10 | 2.5K | HAWLEY v. BAGLEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0882.1.pdf | 2011-11-01 10:08 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0882.2.html | 2013-12-16 13:09 | 8.5K | HAWLEY v. KEPP. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0882.2.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0883.html | 2013-12-16 13:09 | 14K | HAWLEY v. MITCHELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0883.pdf | 2011-11-01 10:08 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0885.1.html | 2013-12-16 13:09 | 1.1K | HAWLEY (MOLSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0885.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0885.2.html | 2013-12-16 13:10 | 5.4K | HAWORTH v. NYSTROM. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0885.2.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.1.html | 2013-12-16 13:10 | 1.1K | HAWORTH (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.2.html | 2013-12-16 13:09 | 1.1K | HAWS (HAMMOND v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.3.html | 2013-12-16 13:09 | 1.1K | HAWSMAN (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.4.html | 2013-12-16 13:10 | 1.2K | HAWTHORNE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.4.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.5.html | 2013-12-16 13:10 | 1.1K | HAWXHURST (WALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.5.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0886.6.html | 2013-12-16 13:09 | 6.0K | In re HAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0886.6.pdf | 2011-11-01 10:08 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0887.html | 2013-12-16 13:09 | 7.5K | In re HAY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0887.pdf | 2011-11-01 10:08 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0888.html | 2013-12-16 13:10 | 9.8K | HAY v. ALEXANDRIA & W. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0888.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0889.html | 2013-12-16 13:10 | 25K | HAY v. ALEXANDRIA & W. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0889.pdf | 2011-11-01 10:08 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0893.1.html | 2013-12-16 13:09 | 2.8K | HAY v. The BLOOMER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0893.1.pdf | 2011-11-01 10:08 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0893.2.html | 2013-12-16 13:10 | 8.1K | HAY v. WASHINGTON & A. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0893.2.pdf | 2011-11-01 10:08 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0894.html | 2013-12-16 13:10 | 15K | Ex parte HAYDEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0894.pdf | 2011-11-01 10:08 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0897.1.html | 2013-12-16 13:10 | 3.6K | In re HAYDEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0897.1.pdf | 2011-11-01 10:08 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0897.2.html | 2013-12-16 13:10 | 1.3K | HAYDEN v. ANDROSCOGGIN MILLS., HAYDEN v. BATES MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0897.2.pdf | 2011-11-01 10:08 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0897.3.html | 2013-12-16 13:10 | 1.2K | HAYDEN (The COLONEL HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0897.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0897.4.html | 2013-12-16 13:09 | 9.6K | HAYDEN et al. v. The C. W. COCHRANE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0897.4.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0898.html | 2013-12-16 13:10 | 7.2K | HAYDEN v. DAVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0898.pdf | 2011-11-01 10:08 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0899.html | 2013-12-16 13:10 | 3.2K | HAYDEN v. JAMES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0899.pdf | 2011-11-01 10:08 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0900.1.html | 2013-12-16 13:10 | 1.1K | HAYDEN (MANNING v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0900.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0900.2.html | 2013-12-16 13:09 | 50K | HAYDEN v. SUFFOLK MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0900.2.pdf | 2011-11-01 10:08 | 115K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0908.1.html | 2013-12-16 13:09 | 1.2K | HAYDEN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0908.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0908.2.html | 2013-12-16 13:10 | 1.1K | HAYDOCK (COBB v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0908.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0908.3.html | 2013-12-16 13:10 | 4.3K | In re HAYES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0908.3.pdf | 2011-11-01 10:08 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0908.4.html | 2013-12-16 13:09 | 3.1K | HAYES v. BICKELHOUPT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0908.4.pdf | 2011-11-01 10:08 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0909.1.html | 2013-12-16 13:10 | 4.9K | HAYES v. The J. L. WICKWIRE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0909.1.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0909.2.html | 2013-12-16 13:09 | 1.1K | HAYES (SYKES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0909.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0909.3.html | 2013-12-16 13:10 | 8.3K | HAYFORD v. GRIFFITH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0909.3.pdf | 2011-11-01 10:08 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0910.html | 2013-12-16 13:10 | 4.1K | HAYFORD v. GRIFFITH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0910.pdf | 2011-11-01 10:08 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0911.1.html | 2013-12-16 13:09 | 1.1K | HAYMAN (ASH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0911.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0911.2.html | 2013-12-16 13:10 | 1.1K | HAYMAN (ELLIOT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0911.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0911.3.html | 2013-12-16 13:10 | 11K | HAYMAN v. KEALLY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0911.3.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0912.html | 2013-12-16 13:09 | 5.8K | HAYMAN v. MOXLEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0912.pdf | 2011-11-01 10:08 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0913.html | 2013-12-16 13:09 | 5.1K | HAYMAN'S ADM'RS v. ROTHWELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0913.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.1.html | 2013-12-16 13:10 | 1.2K | Ex parte HAYNES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.2.html | 2013-12-16 13:09 | 3.2K | In re HAYNES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.2.pdf | 2011-11-01 10:08 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.3.html | 2013-12-16 13:09 | 1.1K | HAYNES (BLANCHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.4.html | 2013-12-16 13:10 | 1.1K | HAYNES (CHRISTMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.4.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.5.html | 2013-12-16 13:10 | 1.1K | HAYNES (DOHERTY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.5.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.6.html | 2013-12-16 13:09 | 1.1K | HAYNES (RAINER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.6.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.7.html | 2013-12-16 13:09 | 1.2K | HAYNES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.7.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.8.html | 2013-12-16 13:10 | 1.1K | HAYNIE (READ v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.8.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0914.9.html | 2013-12-16 13:10 | 4.3K | HAYS v. BELL et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0914.9.pdf | 2011-11-01 10:08 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0915.1.html | 2013-12-16 13:09 | 1.1K | HAYS v. HEIDELBAUGH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0915.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0915.2.html | 2013-12-16 13:10 | 1.1K | HAYS (HUNTER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0915.2.pdf | 2011-11-01 10:08 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0915.3.html | 2013-12-16 13:10 | 1.1K | HAYS (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0915.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0915.4.html | 2013-12-16 13:10 | 1.1K | HAYS (RIDGWAY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0915.4.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0915.5.html | 2013-12-16 13:09 | 14K | HAYS et al. v. SULSOR et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0915.5.pdf | 2011-11-01 10:08 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0917.html | 2013-12-16 13:10 | 8.4K | HAYTON v. WILKINSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0917.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0918.html | 2013-12-16 13:10 | 18K | HAYWARD v. ELIOT NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0918.pdf | 2011-11-01 10:08 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0921.1.html | 2013-12-16 13:10 | 1.2K | HAYWARD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0921.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0921.2.html | 2013-12-16 13:09 | 1.3K | In re HAYWOOD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0921.2.pdf | 2011-11-01 10:08 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0921.3.html | 2013-12-16 13:09 | 17K | HAZARD v. CHICAGO, B. & Q. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0921.3.pdf | 2011-11-01 10:08 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0924.html | 2013-12-16 13:10 | 8.7K | HAZARD v. CHICAGO, B. & Q. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0924.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0925.1.html | 2013-12-16 13:10 | 2.0K | HAZARD v. GREEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0925.1.pdf | 2011-11-01 10:08 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0925.2.html | 2013-12-16 13:09 | 10K | HAZARD v. HAZARD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0925.2.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0927.html | 2013-12-16 13:09 | 13K | HAZARD v. HAZARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0927.pdf | 2011-11-01 10:08 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0928.html | 2013-12-16 13:10 | 15K | HAZARD v. HOWLAND. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0928.pdf | 2011-11-01 10:08 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0931.1.html | 2013-12-16 13:10 | 1.2K | HAZARD, The (NATTERSTROM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0931.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0931.2.html | 2013-12-16 13:09 | 1.1K | HAZARD (PHELAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0931.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0931.3.html | 2013-12-16 13:09 | 19K | HAZARD v. ROBINSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0931.3.pdf | 2011-11-01 10:08 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0933.1.html | 2013-12-16 13:10 | 1.2K | HAZARD, The (SINGSTROM v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0933.1.pdf | 2011-11-01 10:08 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0933.2.html | 2013-12-16 13:09 | 1.2K | HAZARD (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0933.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0934.html | 2013-12-16 13:10 | 31K | HAZARD v. NEW ENGLAND MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0934.pdf | 2011-11-01 10:08 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0938.1.html | 2013-12-16 13:10 | 1.2K | HAZEL (NICHOLLS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0938.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0938.2.html | 2013-12-16 13:09 | 1.1K | HAZEL (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0938.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0939.html | 2013-12-16 13:10 | 8.9K | HAZEL v. WATERS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0939.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0940.html | 2013-12-16 13:09 | 5.6K | HAZEL v. WATERS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0940.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0941.1.html | 2013-12-16 13:09 | 1.1K | HAZEN (DONALDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0941.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0941.2.html | 2013-12-16 13:10 | 7.1K | In re HAZENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0941.2.pdf | 2011-11-01 10:08 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0942.1.html | 2013-12-16 13:10 | 1.2K | In re HAZLETON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0942.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0942.2.html | 2013-12-16 13:10 | 14K | HAZLETON v. VALENTINE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0942.2.pdf | 2011-11-01 10:08 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0944.html | 2013-12-16 13:10 | 16K | HAZLETT et al. v. CONRAD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0944.pdf | 2011-11-01 10:08 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0946.html | 2013-12-16 13:10 | 9.2K | HAZZARD et al. v. CREDIT MOBILIER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0946.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0948.html | 2013-12-16 13:09 | 29K | The H. B. FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0948.pdf | 2011-11-01 10:08 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0952.html | 2013-12-16 13:10 | 13K | The H. B. FOSTER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0952.pdf | 2011-11-01 10:08 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0954.1.html | 2013-12-16 13:10 | 1.2K | H. D. BACON, The (EADS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0954.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0954.2.html | 2013-12-16 13:09 | 8.8K | HEAD v. GREEN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0954.2.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0956.1.html | 2013-12-16 13:10 | 1.2K | HEAD (MEANY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0956.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0956.2.html | 2013-12-16 13:09 | 9.4K | HEAD v. STARKE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0956.2.pdf | 2011-11-01 10:08 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0957.1.html | 2013-12-16 13:09 | 1.4K | HEAD et al. v. TALLEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0957.1.pdf | 2011-11-01 10:08 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0957.2.html | 2013-12-16 13:10 | 1.2K | HEALEY (BRADLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0957.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0957.3.html | 2013-12-16 13:10 | 1.2K | HEALEY (GRANT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0957.3.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0957.4.html | 2013-12-16 13:09 | 19K | HEALEY v. MARTIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0957.4.pdf | 2011-11-01 10:08 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0960.1.html | 2013-12-16 13:09 | 1.2K | HEALY (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0960.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0960.2.html | 2013-12-16 13:10 | 10K | HEALY et al. v. MOTHERSHED et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0960.2.pdf | 2011-11-01 10:08 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0962.1.html | 2013-12-16 13:09 | 1.2K | HEALY (PREVOST v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0962.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0962.2.html | 2013-12-16 13:10 | 7.2K | HEALY v. PREVOST. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0962.2.pdf | 2011-11-01 10:08 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0963.1.html | 2013-12-16 13:10 | 1.2K | HEARD (LOVERING v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0963.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0963.2.html | 2013-12-16 13:09 | 5.8K | HEARD v. ROGERS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0963.2.pdf | 2011-11-01 10:08 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0963.3.html | 2013-12-16 13:09 | 11K | HEARN v. EQUITABLE SAFETY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0963.3.pdf | 2011-11-01 10:08 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0965.html | 2013-12-16 13:09 | 25K | HEARN v. EQUITABLE SAFETY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0965.pdf | 2011-11-01 10:08 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0969.html | 2013-12-16 13:09 | 28K | HEARN v. NEW ENGLAND MUT. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0969.pdf | 2011-11-01 10:08 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0973.html | 2013-12-16 13:10 | 9.1K | HEARN v. NEW ENGLAND MUT. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0973.pdf | 2011-11-01 10:08 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0974.html | 2013-12-16 13:09 | 3.6K | HEARNE v. BARRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0974.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0975.1.html | 2013-12-16 13:10 | 3.4K | In re HEATH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0975.1.pdf | 2011-11-01 10:08 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0975.2.html | 2013-12-16 13:09 | 5.1K | HEATH v. AUSTIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0975.2.pdf | 2011-11-01 10:08 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.0976.html | 2013-12-16 13:10 | 151K | HEATH et al. v. ERIE RY. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.0976.pdf | 2011-11-01 10:08 | 297K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1001.html | 2013-12-16 13:10 | 14K | HEATH et al. v. ERIE RY. CO. et al., ERIE RY. CO. et al. v. HEATH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1001.pdf | 2011-11-01 10:08 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1003.1.html | 2013-12-16 13:10 | 1.2K | HEATH (ERIE RAILWAY CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1003.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1003.2.html | 2013-12-16 13:10 | 1.3K | HEATH v. HILDRETH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1003.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1003.3.html | 2013-12-16 13:10 | 29K | HEATH v. HILDRETH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1003.3.pdf | 2011-11-01 10:08 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1007.html | 2013-12-16 13:10 | 4.8K | HEATH v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1007.pdf | 2011-11-01 10:08 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1008.1.html | 2013-12-16 13:09 | 1.2K | HEATON (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1008.1.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1008.2.html | 2013-12-16 13:10 | 1.2K | HEATON (MARCH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1008.2.pdf | 2011-11-01 10:08 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1008.3.html | 2013-12-16 13:10 | 11K | HEATON et al. v. QUINTARD et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1008.3.pdf | 2011-11-01 10:09 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1010.html | 2013-12-16 13:10 | 14K | Ex parte HEBARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1010.pdf | 2011-11-01 10:09 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1012.1.html | 2013-12-16 13:10 | 1.3K | Ex parte HEBBARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1012.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1012.2.html | 2013-12-16 13:09 | 24K | In re HEBBARD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1012.2.pdf | 2011-11-01 10:09 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1016.1.html | 2013-12-16 13:10 | 1.3K | HEBBARD v. BANK OF UNITED STATES et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1016.1.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1016.2.html | 2013-12-16 13:09 | 1.1K | HECKER (FOWLER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1016.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1016.3.html | 2013-12-16 13:09 | 1.2K | HECKER (RUMFORD CHEMICAL WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1016.3.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1016.4.html | 2013-12-16 13:10 | 17K | HECKSCHER V. BINNEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1016.4.pdf | 2011-11-01 10:09 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1018.1.html | 2013-12-16 13:09 | 1.2K | HECKSCHER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1018.1.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1018.2.html | 2013-12-16 13:10 | 4.9K | The HECTOR., The WISCONSIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1018.2.pdf | 2011-11-01 10:09 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1019.1.html | 2013-12-16 13:10 | 4.4K | HEDDEN v. EATON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1019.1.pdf | 2011-11-01 10:09 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1019.2.html | 2013-12-16 13:09 | 4.3K | HEDGES et al. v. PAULIN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1019.2.pdf | 2011-11-01 10:09 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1020.1.html | 2013-12-16 13:09 | 1.2K | HEDGES (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1020.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1020.2.html | 2013-12-16 13:10 | 1.6K | HEERMAN v. BEEP SLOUGH MANUF'G, ETC., CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1020.2.pdf | 2011-11-01 10:09 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1020.3.html | 2013-12-16 13:10 | 5.5K | In re HEFFRON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1020.3.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1020.4.html | 2013-12-16 13:09 | 1.2K | HEFT (AMERICAN WOOD PAPER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1020.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1021.html | 2013-12-16 13:10 | 31K | Ex parte HEIDELBACK., In re GLYN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1021.pdf | 2011-11-01 10:09 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1025.1.html | 2013-12-16 13:10 | 1.2K | HEIDELBAUGH (HAYS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1025.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1025.2.html | 2013-12-16 13:10 | 37K | In re HEILBRONN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1025.2.pdf | 2011-11-01 10:09 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1031.html | 2013-12-16 13:10 | 11K | HEINE v. APPLETON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1031.pdf | 2011-11-01 10:09 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1033.html | 2013-12-16 13:09 | 22K | HEINE v. LEVEE COM'RS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1033.pdf | 2011-11-01 10:09 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1037.1.html | 2013-12-16 13:10 | 3.7K | HEINECKE v. RAWLINGS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1037.1.pdf | 2011-11-01 10:09 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1037.2.html | 2013-12-16 13:09 | 1.2K | HEINEGAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1037.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1037.3.html | 2013-12-16 13:09 | 1.2K | HEINEKE (VAN NESS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1037.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1037.4.html | 2013-12-16 13:10 | 9.4K | HEINRICH v. LUTHER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1037.4.pdf | 2011-11-01 10:09 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1038.1.html | 2013-12-16 13:10 | 1.4K | HEINSHEIMER et al. v. SHEA et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1038.1.pdf | 2011-11-01 10:09 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1038.2.html | 2013-12-16 13:09 | 1.7K | In re HEIRSCHBERG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1038.2.pdf | 2011-11-01 10:09 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.1.html | 2013-12-16 13:09 | 1.1K | HEISE (TRUNDLE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.2.html | 2013-12-16 13:10 | 1.1K | HEISER (FRANKLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.3.html | 2013-12-16 13:10 | 1.1K | HEISKELL (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.4.html | 2013-12-16 13:09 | 1.2K | HEISSENBUTTEL (McGOVERN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.4.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.5.html | 2013-12-16 13:10 | 1.2K | HELENA, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.5.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.6.html | 2013-12-16 13:10 | 5.0K | The HELEN E. BOOKER., CASTE et al. v. The HELEN E. BOOKER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.6.pdf | 2011-11-01 10:09 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1039.7.html | 2013-12-16 13:10 | 14K | The HELEN J. HOLLOWAY., The ENOCH MOORE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1039.7.pdf | 2011-11-01 10:09 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1042.html | 2013-12-16 13:10 | 23K | The HELEN M. PIERCE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1042.pdf | 2011-11-01 10:09 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1045.html | 2013-12-16 13:09 | 9.5K | The HELEN R. COOPER and The R. L. MABEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1045.pdf | 2011-11-01 10:09 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1047.html | 2013-12-16 13:10 | 19K | The HELEN R. COOPER. The R. L. MABEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1047.pdf | 2011-11-01 10:09 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1050.1.html | 2013-12-16 13:10 | 5.3K | The HELEN R. COOPER and The R. L. MABEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1050.1.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1050.2.html | 2013-12-16 13:09 | 3.6K | HELLEN v. BEATTY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1050.2.pdf | 2011-11-01 10:09 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1051.html | 2013-12-16 13:09 | 8.7K | In re HELLER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1051.pdf | 2011-11-01 10:09 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1052.1.html | 2013-12-16 13:10 | 2.6K | In re HELLER et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1052.1.pdf | 2011-11-01 10:09 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1052.2.html | 2013-12-16 13:09 | 18K | In re HELLER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1052.2.pdf | 2011-11-01 10:09 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1055.html | 2013-12-16 13:09 | 11K | HELLMAN et al. v. HOLLADAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1055.pdf | 2011-11-01 10:09 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1056.html | 2013-12-16 13:10 | 6.4K | HELLMAN v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1056.pdf | 2011-11-01 10:09 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1057.1.html | 2013-12-16 13:09 | 1.2K | HELLMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1057.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1057.2.html | 2013-12-16 13:10 | 13K | In re HELLMAR. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1057.2.pdf | 2011-11-01 10:09 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1059.html | 2013-12-16 13:09 | 4.7K | HELLRIGLE v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1059.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1060.html | 2013-12-16 13:09 | 8.9K | HELLRIGLE v. OULD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1060.pdf | 2011-11-01 10:09 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1061.1.html | 2013-12-16 13:10 | 1.2K | HELMBOLD (WHEELER V.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1061.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1061.2.html | 2013-12-16 13:09 | 1.2K | HELMS (SWEETSER V.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1061.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1061.3.html | 2013-12-16 13:09 | 1.2K | HELMSLEY (COGGINS V.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1061.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1061.4.html | 2013-12-16 13:10 | 1.2K | HELRIGGLE (UNITED STATES V.) |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1061.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1061.5.html | 2013-12-16 13:10 | 12K | The HELVETIA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1061.5.pdf | 2011-11-01 10:09 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1063.html | 2013-12-16 13:10 | 14K | Ex parte HEMENWAY., In re STEVENS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1063.pdf | 2011-11-01 10:09 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.1.html | 2013-12-16 13:10 | 1.2K | HEMENWAY (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.2.html | 2013-12-16 13:10 | 1.2K | HEMENGWAY (WOPE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.2.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.3.html | 2013-12-16 13:09 | 1.2K | HEMINGWAY (FIREMEN'S INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.3.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.4.html | 2013-12-16 13:10 | 1.2K | HEMMER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.5.html | 2013-12-16 13:10 | 1.2K | HEMP FIELD R. CO. (FOX v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.5.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1065.6.html | 2013-12-16 13:09 | 5.0K | HEMPHILL v. DIXON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1065.6.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1066.1.html | 2013-12-16 13:09 | 4.8K | HEMSTEAD v. COLBURN. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1066.1.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1066.2.html | 2013-12-16 13:10 | 1.2K | HEMPSTONE (CLARKE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1066.2.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1066.3.html | 2013-12-16 13:10 | 7.1K | HENCKLEY v. HENDRICKSON et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1066.3.pdf | 2011-11-01 10:09 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1067.html | 2013-12-16 13:10 | 69K | Ex parte HENDERSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1067.pdf | 2011-11-01 10:09 | 151K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1078.1.html | 2013-12-16 13:10 | 1.2K | HENDERSON (BAILEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1078.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1078.2.html | 2013-12-16 13:09 | 1.2K | HENDERSON (BANK OF ALEXANDRIA v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1078.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1078.3.html | 2013-12-16 13:10 | 1.2K | HENDERSON (BEVERLY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1078.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1078.4.html | 2013-12-16 13:10 | 1.2K | HENDERSON (BOWIE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1078.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1079.1.html | 2013-12-16 13:09 | 2.7K | HENDERSON v. CASTEEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1079.1.pdf | 2011-11-01 10:09 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1079.2.html | 2013-12-16 13:10 | 28K | HENDERSON et al. v. CLEVELAND COOPERATIVE STOVE CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1079.2.pdf | 2011-11-01 10:09 | 206K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.1080_01.jpg | 2011-07-08 17:20 | 128K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1083.1.html | 2013-12-16 13:09 | 1.2K | HENDERSON (DENNY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1083.1.pdf | 2011-11-01 10:09 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1083.2.html | 2013-12-16 13:10 | 4.1K | HENDERSON et al. v. DESHA. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1083.2.pdf | 2011-11-01 10:09 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1084.1.html | 2013-12-16 13:10 | 1.2K | HENDERSON (FISHER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1084.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1084.2.html | 2013-12-16 13:09 | 2.6K | HENDERSON v. The HANNAH M. BUELL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1084.2.pdf | 2011-11-01 10:09 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1084.3.html | 2013-12-16 13:09 | 3.0K | HENDERSON v. HENDERSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1084.3.pdf | 2011-11-01 10:09 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1084.4.html | 2013-12-16 13:10 | 1.2K | HENDERSON (IRWIN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1084.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1084.5.html | 2013-12-16 13:10 | 6.0K | HENDERSON v. LONG. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1084.5.pdf | 2011-11-01 10:09 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.1.html | 2013-12-16 13:09 | 1.2K | HENDERSON (OFFUTT v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.2.html | 2013-12-16 13:10 | 1.2K | HENDERSON (RICKETTS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.3.html | 2013-12-16 13:10 | 1.2K | HENDERSON (SILVER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.4.html | 2013-12-16 13:09 | 1.2K | HENDERSON v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.5.html | 2013-12-16 13:09 | 1.2K | HENDERSON (YEATMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.5.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.6.html | 2013-12-16 13:10 | 1.2K | HENDRICK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.6.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1085.7.html | 2013-12-16 13:10 | 7.7K | The HENDRICK HUDSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1085.7.pdf | 2011-11-01 10:09 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1086.1.html | 2013-12-16 13:10 | 2.6K | HENDRICKSON v. The GESNER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1086.1.pdf | 2011-11-01 10:09 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1087.1.html | 2013-12-16 13:09 | 1.2K | HENDRICKSON (HENCKLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1087.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1087.2.html | 2013-12-16 13:10 | 6.2K | HENDRICKSON v. HINKLEY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1087.2.pdf | 2011-11-01 10:09 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1087.3.html | 2013-12-16 13:10 | 1.2K | HENDRICKSON v. The JAMES GESNER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1087.3.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1087.4.html | 2013-12-16 13:09 | 1.2K | HENDRICKSON (SELDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1087.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1087.5.html | 2013-12-16 13:09 | 62K | The HENDRIK HUDSON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1087.5.pdf | 2011-11-01 10:09 | 140K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1097.html | 2013-12-16 13:10 | 13K | HENDY v. SOULE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1097.pdf | 2011-11-01 10:09 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1099.html | 2013-12-16 13:09 | 144K | HENFIELD'S CASE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1099.pdf | 2011-11-01 10:09 | 288K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1123.html | 2013-12-16 13:10 | 5.6K | In re HINKEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1123.pdf | 2011-11-01 10:09 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1124.html | 2013-12-16 13:09 | 16K | In re HINKEL. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1124.pdf | 2011-11-01 10:09 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1127.1.html | 2013-12-16 13:10 | 6.2K | HENLEY v. BROOKLYN ICE CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1127.1.pdf | 2011-11-01 10:09 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1127.2.html | 2013-12-16 13:09 | 7.7K | HENLEY v. BROOKLYN ICE CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1127.2.pdf | 2011-11-01 10:09 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1128.html | 2013-12-16 13:10 | 23K | HENNESSEY et al. v. The VERSAILLES. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1128.pdf | 2011-11-01 10:09 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1132.1.html | 2013-12-16 13:09 | 1.2K | HENNING (FARMERS LOAN TRUST CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1132.1.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1132.2.html | 2013-12-16 13:10 | 26K | HENNING et al. v. UNITED STATES INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1132.2.pdf | 2011-11-01 10:09 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1136.1.html | 2013-12-16 13:09 | 1.2K | HENNING (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1136.1.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1136.2.html | 2013-12-16 13:10 | 20K | In re HENNOCKSBURGH et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1136.2.pdf | 2011-11-01 10:09 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1139.1.html | 2013-12-16 13:09 | 1.2K | HENOP (DAVIDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1139.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1139.2.html | 2013-12-16 13:10 | 28K | HENOP v. TUCKER. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1139.2.pdf | 2011-11-01 10:09 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1143.html | 2013-12-16 13:09 | 33K | In re HENRICH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1143.pdf | 2011-11-01 10:09 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1148.1.html | 2013-12-16 13:09 | 1.2K | HENRICI (SHOUP v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1148.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1148.2.html | 2013-12-16 13:10 | 1.2K | HENRIETTA, The (HARRIS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1148.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1148.3.html | 2013-12-16 13:10 | 13K | In re HENRY et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1148.3.pdf | 2011-11-01 10:09 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1150.html | 2013-12-16 13:10 | 16K | In re HENRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1150.pdf | 2011-11-01 10:09 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1153.html | 2013-12-16 13:09 | 42K | The HENRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1153.pdf | 2011-11-01 10:09 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1160.html | 2013-12-16 13:10 | 19K | The HENRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1160.pdf | 2011-11-01 10:09 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1162.html | 2013-12-16 13:09 | 1.2K | HENRY BUCK, The (LARVA v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1162.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1163.html | 2013-12-16 13:10 | 8.5K | The HENRY C. BROOKS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1163.pdf | 2011-11-01 10:09 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1164.1.html | 2013-12-16 13:09 | 1.2K | HENRY C. HOMEYER, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1164.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1164.2.html | 2013-12-16 13:10 | 12K | The HENRY CLAY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1164.2.pdf | 2011-11-01 10:09 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1166.html | 2013-12-16 13:09 | 70K | The HENRY EWBANK. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1166.pdf | 2011-11-01 10:09 | 161K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1177.1.html | 2013-12-16 13:10 | 1.2K | HENRY KNEELAND, The (CHAMBERS v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1177.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1177.2.html | 2013-12-16 13:09 | 1.2K | HENRY KNEELAND, The (STALKER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1177.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1177.3.html | 2013-12-16 13:09 | 3.8K | The HENRY LEWIS. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1177.3.pdf | 2011-11-01 10:09 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.1.html | 2013-12-16 13:10 | 3.6K | The HENRY MIDDLETON. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.1.pdf | 2011-11-01 10:09 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.2.html | 2013-12-16 13:09 | 1.2K | HENRY MORRISON, The (VAN WINKLE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.3.html | 2013-12-16 13:09 | 1.2K | HENRY PRATT, The (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.4.html | 2013-12-16 13:10 | 4.3K | The HENRY TROWBRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.4.pdf | 2011-11-01 10:09 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.5.html | 2013-12-16 13:10 | 1.2K | HENRY WOOD, The (HOWLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.5.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1178.6.html | 2013-12-16 13:09 | 2.0K | HENRY v. CORNELIUS et ux. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1178.6.pdf | 2011-11-01 10:09 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1179.html | 2013-12-16 13:10 | 7.4K | HENRY v. CURRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1179.pdf | 2011-11-01 10:09 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1180.html | 2013-12-16 13:10 | 13K | HENRY v. FRANCESTOWN SOAPSTONE STOVE CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1180.pdf | 2011-11-01 10:09 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1181.1.html | 2013-12-16 13:09 | 1.2K | HENRY (GAGER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1181.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1181.2.html | 2013-12-16 13:10 | 6.7K | HENRY v. HENRY. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1181.2.pdf | 2011-11-01 10:09 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1182.1.html | 2013-12-16 13:10 | 1.2K | HENRY (HOVEY v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1182.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1182.2.html | 2013-12-16 13:09 | 1.2K | HENRY (MULLER v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1182.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1182.3.html | 2013-12-16 13:09 | 1.2K | HENRY v. The PARKERSBURGH. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1182.3.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1182.4.html | 2013-12-16 13:10 | 35K | HENRY v. PROVIDENCE TOOL CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1182.4.pdf | 2011-11-01 10:09 | 202K | |
![[IMG]](/html/icons/compressed.gif) | 0011.f.cas.1183_01.jpg | 2011-07-08 17:20 | 111K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1188.html | 2013-12-16 13:10 | 5.2K | HENRY v. RICKETTS et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1188.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1189.1.html | 2013-12-16 13:10 | 2.9K | HENRY v. RICKETTS et al |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1189.1.pdf | 2011-11-01 10:09 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1189.2.html | 2013-12-16 13:09 | 1.3K | HENRY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1189.2.pdf | 2011-11-01 10:09 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1189.3.html | 2013-12-16 13:09 | 1.2K | HENRY, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1189.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1189.4.html | 2013-12-16 13:10 | 1.1K | HENSHAW (BISSELL v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1189.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1189.5.html | 2013-12-16 13:10 | 13K | HENSHAW et al. v. MUTUAL SAFETY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1189.5.pdf | 2011-11-01 10:09 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1191.1.html | 2013-12-16 13:09 | 1.3K | HENTZ et al. v. The IDAHO. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1191.1.pdf | 2011-11-01 10:09 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1191.2.html | 2013-12-16 13:10 | 1.1K | HENTZ (McGEHEE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1191.2.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1191.3.html | 2013-12-16 13:10 | 1.1K | HENZIER (BUFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1191.3.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1191.4.html | 2013-12-16 13:09 | 1.2K | HEPBURN (AULD v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1191.4.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1191.5.html | 2013-12-16 13:10 | 14K | HEPBURN et al. v. AULD., DUNLOP et al. v. HEPBURN et al. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1191.5.pdf | 2011-11-01 10:09 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1193.1.html | 2013-12-16 13:09 | 1.1K | HEPBURN (QUEEN v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1193.1.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1193.2.html | 2013-12-16 13:10 | 5.8K | HEPPARD v. The GENERAL CADWALADER and The MAJOR RINGGOLD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1193.2.pdf | 2011-11-01 10:09 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1194.1.html | 2013-12-16 13:10 | 1.2K | HEQUEMBOURG (LAKE v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1194.1.pdf | 2011-11-01 10:09 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1194.2.html | 2013-12-16 13:09 | 8.7K | The HERALD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1194.2.pdf | 2011-11-01 10:09 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1195.html | 2013-12-16 13:10 | 5.4K | The HERALD, Etc. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1195.pdf | 2011-11-01 10:09 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1196.html | 2013-12-16 13:09 | 6.0K | The HERALD. |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1196.pdf | 2011-11-01 10:09 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.1197.html | 2013-12-16 13:09 | 1.2K | HERAN (BRADSTREET v.). |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.1197.pdf | 2011-11-01 10:09 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.back.html | 2013-12-16 13:09 | 278K | Federal Cases, Volume 11 |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.back.pdf | 2011-10-31 12:36 | 353K | |
![[Text]](/html/icons/compressed.gif) | 0011.f.cas.front.html | 2013-12-16 13:09 | 2.9K | Federal Cases, Volume 11 |
![[ ]](/html/icons/compressed.gif) | 0011.f.cas.front.pdf | 2011-10-31 12:36 | 61K | |
|