![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.000b_01.jpg | 2011-07-23 13:50 | 3.7K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0001.html | 2013-12-16 13:11 | 13K | UNITED STATES v. SWEENEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0001.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0003.html | 2013-12-16 13:11 | 28K | UNITED STATES v. SWETT et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0003.pdf | 2011-11-01 11:14 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0007.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (TABER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0007.1.pdf | 2011-11-01 11:14 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0007.2.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TAINTOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0007.2.pdf | 2011-11-01 11:14 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0009.html | 2013-12-16 13:11 | 20K | UNITED STATES v. TALLMAN et al., SAME v. PIKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0009.pdf | 2011-11-01 11:14 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0012.html | 2013-12-16 13:11 | 4.8K | UNITED STATES v. TANNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0012.pdf | 2011-11-01 11:14 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0013.html | 2013-12-16 13:11 | 13K | UNITED STATES v. TAPPAN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0013.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0015.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (TAPPAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0015.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0015.2.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. TARDY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0015.2.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0015.3.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. TARLTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0015.3.pdf | 2011-11-01 11:14 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0016.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TARR et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0016.pdf | 2011-11-01 11:14 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0018.html | 2013-12-16 13:11 | 6.8K | UNITED STATES v. TA-WAN-GA-CA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0018.pdf | 2011-11-01 11:14 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0019.1.html | 2013-12-16 13:11 | 2.6K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0019.1.pdf | 2011-11-01 11:14 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0019.2.html | 2013-12-16 13:11 | 3.1K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0019.2.pdf | 2011-11-01 11:14 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0019.3.html | 2013-12-16 13:11 | 16K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0019.3.pdf | 2011-11-01 11:14 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0022.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TAYLOR., In re SEIFERT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0022.pdf | 2011-11-01 11:14 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0024.html | 2013-12-16 13:11 | 7.7K | UNITED STATES v. TAYLOR et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0024.pdf | 2011-11-01 11:14 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0025.html | 2013-12-16 13:11 | 43K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0025.pdf | 2011-11-01 11:14 | 107K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0031.html | 2013-12-16 13:11 | 12K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0031.pdf | 2011-11-01 11:14 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0032.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0032.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0032.2.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. TEFFRY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0032.2.pdf | 2011-11-01 11:14 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0033.1.html | 2013-12-16 13:11 | 2.6K | UNITED STATES v. TEN BARRELS AND THREE KEGS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0033.1.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0033.2.html | 2013-12-16 13:11 | 1.9K | UNITED STATES v. TEN BARRELS DISTILLED SPIRITS, ETC., AT 294 CHERRY ST. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0033.2.pdf | 2011-11-01 11:14 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0033.3.html | 2013-12-16 13:11 | 5.1K | UNITED STATES v. TENBROEK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0033.3.pdf | 2011-11-01 11:14 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0034.html | 2013-12-16 13:11 | 9.2K | UNITED STATES v. TEN CASES OF MERCHANDISE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0034.pdf | 2011-11-01 11:14 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0035.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TEN CASES SHAWLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0035.pdf | 2011-11-01 11:14 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0037.html | 2013-12-16 13:11 | 4.2K | UNITED STATES v. TEN EYK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0037.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0038.html | 2013-12-16 13:11 | 8.4K | UNITED STATES v. TEN THOUSAND CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0038.pdf | 2011-11-01 11:14 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0039.html | 2013-12-16 13:11 | 8.6K | UNITED STATES v. TEN THOUSAND CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0039.pdf | 2011-11-01 11:14 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0040.html | 2013-12-16 13:11 | 5.4K | UNITED STATES v. TERREL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0040.pdf | 2011-11-01 11:14 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0041.1.html | 2013-12-16 13:11 | 3.5K | UNITED STATES v. TERREL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0041.1.pdf | 2011-11-01 11:14 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0041.2.html | 2013-12-16 13:11 | 2.4K | UNITED STATES v. TERRY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0041.2.pdf | 2011-11-01 11:14 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0041.3.html | 2013-12-16 13:11 | 13K | UNITED STATES v. TESCHEMACHER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0041.3.pdf | 2011-11-01 11:14 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0043.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (TESCHEMACHER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0043.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0043.2.html | 2013-12-16 13:11 | 25K | UNITED STATES v. TETLOW. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0043.2.pdf | 2011-11-01 11:14 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0047.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TEVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0047.1.pdf | 2011-11-01 11:14 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0047.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (THACHER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0047.2.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0047.3.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. THARP. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0047.3.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0048.1.html | 2013-12-16 13:11 | 2.7K | UNITED STATES v. THIRTEEN PACKAGES OF PLATE GLASS., UNITED STATES v. ELEVEN PACKAGES OF PLATE GLASS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0048.1.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0048.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. THIRTY BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0048.2.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0048.3.html | 2013-12-16 13:11 | 21K | UNITED STATES v. THIRTY-FIVE BARRELS OF HIGHWINES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0048.3.pdf | 2011-11-01 11:14 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0051.html | 2013-12-16 13:11 | 13K | UNITED STATES v. THIRTY-FOUR BARRELS DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0051.pdf | 2011-11-01 11:14 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0053.html | 2013-12-16 13:11 | 9.9K | UNITED STATES v. THIRTY-FOUR BARRELS WHISKEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0053.pdf | 2011-11-01 11:14 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0054.html | 2013-12-16 13:11 | 4.8K | UNITED STATES v. THIRTY-NINE BARRELS OF SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0054.pdf | 2011-11-01 11:14 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0055.html | 2013-12-16 13:11 | 7.5K | UNITED STATES v. THIRTY-NINE THOUSAND ONE HUNDRED AND FIFTY CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0055.pdf | 2011-11-01 11:14 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0056.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. THIRTY-NINE TRUNKS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0056.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0056.2.html | 2013-12-16 13:11 | 42K | UNITED STATES v. THIRTY-ONE BOXES, etc. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0056.2.pdf | 2011-11-01 11:14 | 123K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0057_01.jpg | 2011-08-01 13:01 | 4.7K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0057_02.jpg | 2011-08-01 13:01 | 5.0K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0063.html | 2013-12-16 13:11 | 22K | UNITED STATES v. THIRTY-SEVEN BARRELS OF APPLE BRANDY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0063.pdf | 2011-11-01 11:14 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0066.html | 2013-12-16 13:11 | 4.9K | UNITED STATES v. THIRTY-SEVEN BARRELS OF RUM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0066.pdf | 2011-11-01 11:14 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0067.html | 2013-12-16 13:11 | 24K | UNITED STATES v. THIRTY-SIX BARRELS OF HIGH WINES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0067.pdf | 2011-11-01 11:14 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0070.html | 2013-12-16 13:11 | 14K | UNITED STATES v. THIRTY-SIX BARRELS OF HIGH WINES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0070.pdf | 2011-11-01 11:14 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0072.html | 2013-12-16 13:11 | 13K | UNITED STATES v. THIRTY-THREE BARRELS OF SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0072.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0074.html | 2013-12-16 13:11 | 7.5K | UNITED STATES v. THOMA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0074.pdf | 2011-11-01 11:14 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0075.html | 2013-12-16 13:11 | 8.3K | UNITED STATES v. THOMAS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0075.pdf | 2011-11-01 11:14 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0076.html | 2013-12-16 13:11 | 14K | UNITED STATES v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0076.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0078.html | 2013-12-16 13:11 | 3.5K | UNITED STATES v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0078.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0079.1.html | 2013-12-16 13:11 | 2.9K | UNITED STATES v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0079.1.pdf | 2011-11-01 11:14 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0079.2.html | 2013-12-16 13:11 | 7.1K | UNITED STATES v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0079.2.pdf | 2011-11-01 11:14 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0080.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0080.1.pdf | 2011-11-01 11:14 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0080.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (The THOMAS AND HENRY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0080.2.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0080.3.html | 2013-12-16 13:11 | 13K | UNITED STATES v. THOMASSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0080.3.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0082.html | 2013-12-16 13:11 | 22K | UNITED STATES v. THOMASSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0082.pdf | 2011-11-01 11:14 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0086.html | 2013-12-16 13:11 | 19K | UNITED STATES v. The THOMAS SWAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0086.pdf | 2011-11-01 11:14 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0089.1.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. THOMES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0089.1.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0089.2.html | 2013-12-16 13:11 | 3.0K | UNITED STATES v. THOMES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0089.2.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0089.3.html | 2013-12-16 13:11 | 2.2K | UNITED STATES v. THOMPKINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0089.3.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0089.4.html | 2013-12-16 13:11 | 4.1K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0089.4.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0090.1.html | 2013-12-16 13:11 | 3.3K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0090.1.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0090.2.html | 2013-12-16 13:11 | 10K | UNITED STATES v. THOMPSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0090.2.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0092.html | 2013-12-16 13:11 | 30K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0092.pdf | 2011-11-01 11:14 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0096.html | 2013-12-16 13:11 | 3.4K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0096.pdf | 2011-11-01 11:14 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0097.html | 2013-12-16 13:11 | 11K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0097.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0098.html | 2013-12-16 13:11 | 15K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0098.pdf | 2011-11-01 11:14 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0101.html | 2013-12-16 13:11 | 8.3K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0101.pdf | 2011-11-01 11:14 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0102.html | 2013-12-16 13:11 | 11K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0102.pdf | 2011-11-01 11:14 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0103.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0103.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0103.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (THOMSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0103.2.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0103.3.html | 2013-12-16 13:11 | 19K | UNITED STATES v. THORN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0103.3.pdf | 2011-11-01 11:14 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0106.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (THORNDIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0106.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0107.1.html | 2013-12-16 13:11 | 6.6K | UNITED STATES v. THORPE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0107.1.pdf | 2011-11-01 11:14 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0107.2.html | 2013-12-16 13:11 | 8.0K | UNITED STATES v. THREE BALES OF CLOTH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0107.2.pdf | 2011-11-01 11:14 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0109.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. THREE CASES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0109.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0109.2.html | 2013-12-16 13:11 | 12K | UNITED STATES v. THREE CASES, ETC. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0109.2.pdf | 2011-11-01 11:14 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0110.html | 2013-12-16 13:11 | 10K | UNITED STATES v. THREE CASES, MARKED A. D. 1, 2, AND 3. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0110.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0112.html | 2013-12-16 13:11 | 8.4K | UNITED STATES v. THREE CASES OF TOYS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0112.pdf | 2011-11-01 11:14 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0113.html | 2013-12-16 13:11 | 11K | UNITED STATES v. THREE HORSES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0113.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0115.1.html | 2013-12-16 13:11 | 6.2K | UNITED STATES v. THREE HUNDRED AND EIGHT CADDIES OF TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0115.1.pdf | 2011-11-01 11:14 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0115.2.html | 2013-12-16 13:11 | 33K | UNITED STATES v. THREE HUNDRED AND NINETY-SIX BARRELS DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0115.2.pdf | 2011-11-01 11:14 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0121.html | 2013-12-16 13:11 | 50K | UNITED STATES v. THREE HUNDRED AND NINETY-SIX BARRELS DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0121.pdf | 2011-11-01 11:14 | 117K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0129.html | 2013-12-16 13:11 | 14K | UNITED STATES v. THREE HUNDRED AND NINETY-SIX BARRELS DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0129.pdf | 2011-11-01 11:14 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0131.html | 2013-12-16 13:11 | 15K | UNITED STATES v. THREE HUNDRED AND SEVENTY-TWO PIPES OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0131.pdf | 2011-11-01 11:14 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0133.html | 2013-12-16 13:11 | 9.9K | UNITED STATES v. THREE HUNDRED AND THIRTY-SEVEN CASES OF WINE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0133.pdf | 2011-11-01 11:14 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0135.1.html | 2013-12-16 13:11 | 5.4K | UNITED STATES v. THREE HUNDRED AND TWENTY-SIX CASES OF HOSIERY, MARKED H. & V. & T. S. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0135.1.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0135.2.html | 2013-12-16 13:11 | 13K | UNITED STATES v. THREE HUNDRED BALES OF WOOL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0135.2.pdf | 2011-11-01 11:14 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0137.html | 2013-12-16 13:11 | 12K | UNITED STATES v. THREE HUNDRED BARRELS OF ALCOHOL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0137.pdf | 2011-11-01 11:14 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0139.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. THREE HUNDRED BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0139.1.pdf | 2011-11-01 11:14 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0139.2.html | 2013-12-16 13:11 | 9.9K | UNITED STATES v. THREE HUNDRED BARRELS OF WHISKEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0139.2.pdf | 2011-11-01 11:14 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0141.1.html | 2013-12-16 13:11 | 6.4K | UNITED STATES v. THREE HUNDRED CASKS OP JUNIPER CORDIAL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0141.1.pdf | 2011-11-01 11:14 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0141.2.html | 2013-12-16 13:11 | 17K | UNITED STATES v. THREE PARCELS OF EMBROIDERY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0141.2.pdf | 2011-11-01 11:14 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0144.html | 2013-12-16 13:11 | 32K | UNITED STATES v. THREE RAILROAD CARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0144.pdf | 2011-11-01 11:14 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0149.1.html | 2013-12-16 13:11 | 2.3K | UNITED STATES v. THREE THOUSAND BASKETS OF CHAMPAGNE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0149.1.pdf | 2011-11-01 11:14 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0149.2.html | 2013-12-16 13:11 | 57K | UNITED STATES v. THREE TONS OF COAL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0149.2.pdf | 2011-11-01 11:14 | 130K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0158.html | 2013-12-16 13:11 | 7.3K | UNITED STATES v. THROCKMORTON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0158.pdf | 2011-11-01 11:14 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0159.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. THROCKMORTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0159.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0159.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (THURN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0159.2.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0159.3.html | 2013-12-16 13:11 | 7.6K | UNITED STATES v. TIERNEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0159.3.pdf | 2011-11-01 11:14 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0160.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0160.pdf | 2011-11-01 11:14 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0161.html | 2013-12-16 13:11 | 56K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0161.pdf | 2011-11-01 11:14 | 128K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0169.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0169.pdf | 2011-11-01 11:14 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0171.html | 2013-12-16 13:11 | 15K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0171.pdf | 2011-11-01 11:14 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0174.html | 2013-12-16 13:11 | 32K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0174.pdf | 2011-11-01 11:14 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0179.html | 2013-12-16 13:11 | 9.3K | UNITED STATES v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0179.pdf | 2011-11-01 11:14 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0180.html | 2013-12-16 13:11 | 62K | UNITED STATES v. TILLOTSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0180.pdf | 2011-11-01 11:14 | 138K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0190.html | 2013-12-16 13:11 | 17K | UNITED STATES v. TILTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0190.pdf | 2011-11-01 11:14 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0193.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TINKLEPAUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0193.pdf | 2011-11-01 11:14 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0195.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0195.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0195.2.html | 2013-12-16 13:11 | 29K | UNITED STATES v. TOBACCO FACTORY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0195.2.pdf | 2011-11-01 11:14 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0200.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TOLBEE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0200.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0200.2.html | 2013-12-16 13:11 | 4.1K | UNITED STATES v. TOLSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0200.2.pdf | 2011-11-01 11:14 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0200.3.html | 2013-12-16 13:11 | 2.1K | UNITED STATES v. TOM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0200.3.pdf | 2011-11-01 11:14 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0200.4.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TOMPKINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0200.4.pdf | 2011-11-01 11:14 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0200.5.html | 2013-12-16 13:11 | 2.5K | UNITED STATES v. TOMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0200.5.pdf | 2011-11-01 11:14 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0201.1.html | 2013-12-16 13:11 | 4.5K | UNITED STATES v. TORGE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0201.1.pdf | 2011-11-01 11:14 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0201.2.html | 2013-12-16 13:11 | 3.2K | UNITED STATES v. TOWN-MAKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0201.2.pdf | 2011-11-01 11:14 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0201.3.html | 2013-12-16 13:11 | 10K | UNITED STATES ex rel. HILL v. TOWNS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0201.3.pdf | 2011-11-01 11:14 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0203.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (TOWNSEND v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0203.1.pdf | 2011-11-01 11:14 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0203.2.html | 2013-12-16 13:11 | 3.7K | UNITED STATES v. TRACT OF LAND. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0203.2.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0203.3.html | 2013-12-16 13:11 | 4.9K | UNITED STATES v. TRACY et at. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0203.3.pdf | 2011-11-01 11:15 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0204.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (TRAFTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0204.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0204.2.html | 2013-12-16 13:11 | 54K | UNITED STATES v. TRAVERS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0204.2.pdf | 2011-11-01 11:15 | 126K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0213.html | 2013-12-16 13:11 | 17K | UNITED STATES v. TREASURER OF MUSCATINE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0213.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0216.1.html | 2013-12-16 13:11 | 6.7K | UNITED STATES v. TRIPLETT et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0216.1.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0216.2.html | 2013-12-16 13:11 | 5.9K | UNITED STATES v. TROAX. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0216.2.pdf | 2011-11-01 11:15 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0217.html | 2013-12-16 13:11 | 5.8K | UNITED STATES v. TROBE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0217.pdf | 2011-11-01 11:15 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0218.html | 2013-12-16 13:11 | 29K | UNITED STATES v. The TROPIC WIND. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0218.pdf | 2011-11-01 11:15 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0223.html | 2013-12-16 13:11 | 8.4K | UNITED STATES v. TROUT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0223.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0224.html | 2013-12-16 13:11 | 15K | UNITED STATES v. TRUESDELL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0224.pdf | 2011-11-01 11:15 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0226.1.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. TUCKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0226.1.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0226.2.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. The TULIP. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0226.2.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0226.3.html | 2013-12-16 13:11 | 21K | UNITED STATES v. TULLY et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0226.3.pdf | 2011-11-01 11:15 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0230.1.html | 2013-12-16 13:11 | 3.0K | UNITED STATES v. TURLEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0230.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0230.2.html | 2013-12-16 13:11 | 16K | UNITED STATES v. TURNER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0230.2.pdf | 2011-11-01 11:15 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0232.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. TURNER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0232.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0233.html | 2013-12-16 13:11 | 7.5K | UNITED STATES v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0233.pdf | 2011-11-01 11:15 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0234.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0234.1.pdf | 2011-11-01 11:15 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0234.2.html | 2013-12-16 13:11 | 10K | UNITED STATES v. TUSKA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0234.2.pdf | 2011-11-01 11:15 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0235.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TUTTLE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0235.1.pdf | 2011-11-01 11:15 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0235.2.html | 2013-12-16 13:11 | 2.3K | UNITED STATES v. TWELVE BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0235.2.pdf | 2011-11-01 11:15 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0235.3.html | 2013-12-16 13:11 | 4.2K | UNITED STATES v. TWELVE BARRELS OF PARAFFINE OIL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0235.3.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0236.html | 2013-12-16 13:11 | 16K | UNITED STATES v. TWELVE CASKS OF CUDBEAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0236.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0238.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TWELVE HUNDRED AND NINE QUARTER CASKS OF SHERRY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0238.pdf | 2011-11-01 11:15 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0239.html | 2013-12-16 13:11 | 19K | UNITED STATES v. TWELVE THOUSAND THREE HUNDRED AND FORTY-SEVEN BAGS OF SUGAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0239.pdf | 2011-11-01 11:15 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0242.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TWELVE THOUSAND THREE HUNDRED AND FORTY-SEVEN BAGS OF SUGAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0242.1.pdf | 2011-11-01 11:15 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0242.2.html | 2013-12-16 13:11 | 3.1K | UNITED STATES v. TWENTY BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0242.2.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0242.3.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TWENTY BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0242.3.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0242.4.html | 2013-12-16 13:11 | 3.4K | UNITED STATES v. TWENTY BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0242.4.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0242.5.html | 2013-12-16 13:11 | 8.9K | UNITED STATES v. TWENTY CASES OF MATCHES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0242.5.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0244.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TWENTY-EIGHT CASKS, ETC. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0244.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0244.2.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWENTY-EIGHT CASKS OF WINE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0244.2.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0244.3.html | 2013-12-16 13:11 | 52K | UNITED STATES v. TWENTY-EIGHT PACKAGES OF PINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0244.3.pdf | 2011-11-01 11:15 | 124K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0252.html | 2013-12-16 13:11 | 28K | UNITED STATES v. TWENTY-FIVE BARRELS OF ALCOHOL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0252.pdf | 2011-11-01 11:15 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0257.html | 2013-12-16 13:11 | 106K | UNITED STATES v. TWENTY-FIVE CASES OF CLOTHS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0257.pdf | 2011-11-01 11:15 | 221K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0274.html | 2013-12-16 13:11 | 9.0K | UNITED STATES v. TWENTY-FIVE CASES OF CLOTH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0274.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0275.html | 2013-12-16 13:11 | 5.1K | UNITED STATES v. TWENTY-FIVE THOUSAND GALLONS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0275.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0276.1.html | 2013-12-16 13:11 | 3.3K | UNITED STATES v. TWENTY-FIVE THOUSAND SEGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0276.1.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0276.2.html | 2013-12-16 13:11 | 23K | UNITED STATES v. TWENTY-FOUR COILS OF CORDAGE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0276.2.pdf | 2011-11-01 11:15 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0280.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWENTY-NINE AND ONE-HALF BOXES OF SUGAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0280.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0280.2.html | 2013-12-16 13:11 | 3.5K | UNITED STATES v. TWENTY-ONE BARRELS OF HIGH WINES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0280.2.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0280.3.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TWENTY-ONE BARRELS OF WHISKEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0280.3.pdf | 2011-11-01 11:15 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0280.4.html | 2013-12-16 13:11 | 4.6K | UNITED STATES v. TWENTY PACKAGES OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0280.4.pdf | 2011-11-01 11:15 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0281.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TWENTY-SIX BALES OF RUBBER BOOTS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0281.pdf | 2011-11-01 11:15 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0283.html | 2013-12-16 13:11 | 30K | UNITED STATES v. TWENTY-SIX CASES OF RUBBER BOOTS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0283.pdf | 2011-11-01 11:15 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0288.html | 2013-12-16 13:11 | 14K | UNITED STATES v. TWENTY-SIX DIAMOND RINGS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0288.pdf | 2011-11-01 11:15 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0290.html | 2013-12-16 13:11 | 15K | UNITED STATES v. TWENTY-THREE COILS OF CORDAGE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0290.pdf | 2011-11-01 11:15 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0292.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWENTY-THREE GALLONS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0292.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0292.2.html | 2013-12-16 13:11 | 8.2K | UNITED STATES v. TWO BARRELS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0292.2.pdf | 2011-11-01 11:15 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0293.html | 2013-12-16 13:11 | 3.7K | UNITED STATES v. TWO CASES OF WOOLENS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0293.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0294.1.html | 2013-12-16 13:11 | 1.9K | UNITED STATES v. The TWO FRIENDS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0294.1.pdf | 2011-11-01 11:15 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0294.2.html | 2013-12-16 13:11 | 10K | UNITED STATES v. TWO HORSES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0294.2.pdf | 2011-11-01 11:15 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0295.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWO HUNDRED AND FIFTY BARRELS OF MOLASSES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0295.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0295.2.html | 2013-12-16 13:11 | 9.8K | UNITED STATES v. TWO HUNDRED AND FIFTY-SIX BARRELS OF BEER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0295.2.pdf | 2011-11-01 11:15 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0297.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWO HUNDRED AND FORTY BUNDLES OF CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0297.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0297.2.html | 2013-12-16 13:11 | 28K | UNITED STATES v. TWO HUNDRED AND SEVENTY-EIGHT BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0297.2.pdf | 2011-11-01 11:15 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0301.html | 2013-12-16 13:11 | 5.2K | UNITED STATES v. TWO HUNDRED AND SEVENTY–EIGHT BARRELS OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0301.pdf | 2011-11-01 11:15 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0302.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES ex rel. AMES v. TWO HUNDRED AND SEVENTY–FIVE CADDIES OF TOBACCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0302.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0302.2.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. TWO HUNDRED AND SIX BARRELS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0302.2.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0302.3.html | 2013-12-16 13:11 | 52K | UNITED STATES v. TWO HUNDRED AND SIXTY–NINE AND ONE–HALF BALES OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0302.3.pdf | 2011-11-01 11:15 | 131K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0310.html | 2013-12-16 13:11 | 16K | UNITED STATES v. TWO HUNDRED AND THIRTY–SIX DOZEN BOXES OF COSMETICS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0310.pdf | 2011-11-01 11:15 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0313.html | 2013-12-16 13:11 | 9.7K | UNITED STATES v. TWO HUNDRED BARRELS OF WHISKY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0313.pdf | 2011-11-01 11:15 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0314.1.html | 2013-12-16 13:11 | 3.4K | UNITED STATES v. TWO. HUNDRED BUSHELS OF CORN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0314.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0314.2.html | 2013-12-16 13:11 | 6.8K | UNITED STATES v. TWO HUNDRED QUARTER BOXES OF CIGARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0314.2.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0315.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. TWO PACKAGES OF DISTILLED SPIRITS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0315.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0315.2.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. TWO STEAM BOILERS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0315.2.pdf | 2011-11-01 11:15 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0315.3.html | 2013-12-16 13:11 | 1.5K | UNITED STATES v. TWO THOUSAND BUSHELS OF WHEAT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0315.3.pdf | 2011-11-01 11:15 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0315.4.html | 2013-12-16 13:11 | 28K | UNITED STATES v. TWO THOUSAND FOUR HUNDRED AND NINETEEN SHEEPSKINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0315.4.pdf | 2011-11-01 11:15 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0320.1.html | 2013-12-16 13:11 | 4.2K | UNITED STATES v. TWO TONS OF COAL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0320.1.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0320.2.html | 2013-12-16 13:11 | 11K | UNITED STATES v. TWO TRUNKS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0320.2.pdf | 2011-11-01 11:15 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0322.html | 2013-12-16 13:11 | 11K | UNITED STATES v. TWO TRUNKS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0322.pdf | 2011-11-01 11:15 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0323.html | 2013-12-16 13:11 | 32K | UNITED STATES v. ULLMAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0323.pdf | 2011-11-01 11:15 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0328.html | 2013-12-16 13:11 | 25K | UNITED STATES v. ULRICL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0328.pdf | 2011-11-01 11:15 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0332.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. UNGER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0332.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0333.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. UNION NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0333.1.pdf | 2011-11-01 11:15 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0333.2.html | 2013-12-16 13:11 | 5.5K | UNITED STATES v. UNION NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0333.2.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0333.3.html | 2013-12-16 13:11 | 50K | UNITED STATES v. UNION PAC. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0333.3.pdf | 2011-11-01 11:15 | 118K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0341.html | 2013-12-16 13:11 | 13K | UNITED STATES ex rel. HALL et al v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0341.pdf | 2011-11-01 11:15 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0343.html | 2013-12-16 13:11 | 16K | UNITED STATES ex rel. HALL et al. v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0343.pdf | 2011-11-01 11:15 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0345.html | 2013-12-16 13:11 | 42K | UNITED STATES ex rel. HALL et al. v. UNION PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0345.pdf | 2011-11-01 11:15 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0352.html | 2013-12-16 13:11 | 8.5K | UNITED STATES v. UNITED STATES EXP. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0352.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0353.html | 2013-12-16 13:11 | 8.3K | UNITED STATES v. UNITED STATES TEL. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0353.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0354.html | 2013-12-16 13:11 | 8.2K | UNITED STATES v. VACA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0354.pdf | 2011-11-01 11:15 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0356.1.html | 2013-12-16 13:11 | 6.6K | UNITED STATES v. VALLEJO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0356.1.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0356.2.html | 2013-12-16 13:11 | 5.0K | UNITED STATES v. VALLEJO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0356.2.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0357.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (VALLEJO v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0357.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0357.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (VALLIERE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0357.2.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0357.3.html | 2013-12-16 13:11 | 17K | UNITED STATES v. VAN FOSSEN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0357.3.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0359.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (VAN NESS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0359.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0360.html | 2013-12-16 13:11 | 7.1K | UNITED STATES v. VANRANST. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0360.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0361.html | 2013-12-16 13:11 | 15K | UNITED STATES v. VANSICKLE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0361.pdf | 2011-11-01 11:15 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0363.html | 2013-12-16 13:11 | 15K | UNITED STATES v. VAN SLYKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0363.pdf | 2011-11-01 11:15 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0365.html | 2013-12-16 13:11 | 13K | UNITED STATES v. VANZANDT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0365.pdf | 2011-11-01 11:15 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0367.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. VAPORISOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0367.1.pdf | 2011-11-01 11:15 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0367.2.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. VEITCH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0367.2.pdf | 2011-11-01 11:15 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0367.3.html | 2013-12-16 13:11 | 3.2K | UNITED STATES v. VEITCH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0367.3.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0368.1.html | 2013-12-16 13:11 | 3.2K | UNITED STATES v. VENABLE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0368.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0368.2.html | 2013-12-16 13:11 | 2.7K | UNITED STATES v. VENABLE., UNITED STATES v. BROOKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0368.2.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0368.3.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. The VENUS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0368.3.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0368.4.html | 2013-12-16 13:11 | 29K | UNITED STATES v. VERMILYE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0368.4.pdf | 2011-11-01 11:15 | 93K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0370_01.jpg | 2011-08-01 13:01 | 4.9K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0373.html | 2013-12-16 13:11 | 6.4K | UNITED STATES v. The VERMONT., [MS.] |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0373.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0374.1.html | 2013-12-16 13:11 | 6.6K | UNITED STATES v. VICKERY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0374.1.pdf | 2011-11-01 11:15 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0374.2.html | 2013-12-16 13:11 | 9.1K | UNITED STATES v. The VICTORIA PEREZ. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0374.2.pdf | 2011-11-01 11:15 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0376.html | 2013-12-16 13:11 | 8.4K | UNITED STATES v. VIGOL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0376.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0377.html | 2013-12-16 13:11 | 13K | UNITED STATES v. VILLATO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0377.pdf | 2011-11-01 11:15 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0379.1.html | 2013-12-16 13:11 | 2.4K | UNITED STATES v. VINSENT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0379.1.pdf | 2011-11-01 11:15 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0379.2.html | 2013-12-16 13:11 | 23K | UNITED STATES v. VINTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0379.2.pdf | 2011-11-01 11:15 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0383.html | 2013-12-16 13:11 | 8.1K | UNITED STATES v. The VIRGIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0383.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0384.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES (VIRGINIA & MARYLAND STEAM NAV. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0384.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0384.2.html | 2013-12-16 13:11 | 2.4K | UNITED STATES v. VIRGINIA BONDS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0384.2.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0384.3.html | 2013-12-16 13:11 | 10K | UNITED STATES v. VOLZ. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0384.3.pdf | 2011-11-01 11:15 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0385.html | 2013-12-16 13:11 | 3.0K | UNITED STATES v. VOSS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0385.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0386.1.html | 2013-12-16 13:11 | 2.9K | UNITED STATES V. WADE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0386.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0386.2.html | 2013-12-16 13:11 | 2.6K | UNITED STATES v. WAGNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0386.2.pdf | 2011-11-01 11:15 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0386.3.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WAIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0386.3.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0386.4.html | 2013-12-16 13:11 | 11K | UNITED STATES v. WAITZ. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0386.4.pdf | 2011-11-01 11:15 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0388.1.html | 2013-12-16 13:11 | 2.3K | UNITED STATES v. WALKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0388.1.pdf | 2011-11-01 11:15 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0388.2.html | 2013-12-16 13:11 | 20K | UNITED STATES v. WALKINSHAW. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0388.2.pdf | 2011-11-01 11:15 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0391.1.html | 2013-12-16 13:11 | 3.2K | UNITED STATES v. WALLER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0391.1.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0391.2.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WALSH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0391.2.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0394.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WALSH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0394.pdf | 2011-11-01 11:15 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0396.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WALSH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0396.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0396.2.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WANGEREIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0396.2.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0397.1.html | 2013-12-16 13:11 | 3.7K | UNITED STATES v. WANN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0397.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0397.2.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WARD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0397.2.pdf | 2011-11-01 11:15 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0399.html | 2013-12-16 13:11 | 33K | UNITED STATES v. WARDWELL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0399.pdf | 2011-11-01 11:15 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0404.1.html | 2013-12-16 13:11 | 2.7K | UNITED STATES v. WARE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0404.1.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0404.2.html | 2013-12-16 13:11 | 2.6K | UNITED STATES v. WARNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0404.2.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0404.3.html | 2013-12-16 13:11 | 41K | UNITED STATES v. WARNER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0404.3.pdf | 2011-11-01 11:15 | 103K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0411.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WARR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0411.pdf | 2011-11-01 11:15 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0414.1.html | 2013-12-16 13:11 | 2.6K | UNITED STATES v. WARY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0414.1.pdf | 2011-11-01 11:15 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0414.2.html | 2013-12-16 13:11 | 5.0K | UNITED STATES v. WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0414.2.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0414.3.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WASHINGTON MILLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0414.3.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0417.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WATERBOROUGH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0417.pdf | 2011-11-01 11:15 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0419.html | 2013-12-16 13:11 | 431K | UNITED STATES v. WATKINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0419.pdf | 2011-11-01 11:15 | 781K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0490.html | 2013-12-16 13:11 | 55K | UNITED STATES v. WATKINS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0490.pdf | 2011-11-01 11:15 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0499.1.html | 2013-12-16 13:11 | 3.7K | UNITED STATES ex rel. RUSH v. WATSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0499.1.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0499.2.html | 2013-12-16 13:11 | 15K | UNITED STATES v. WATSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0499.2.pdf | 2011-11-01 11:15 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0501.1.html | 2013-12-16 13:11 | 3.3K | UNITED STATES v. WATSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0501.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0501.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WATT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0501.2.pdf | 2011-11-01 11:15 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0501.3.html | 2013-12-16 13:11 | 15K | UNITED STATES v. WATTS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0501.3.pdf | 2011-11-01 11:15 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0504.html | 2013-12-16 13:11 | 12K | UNITED STATES v. WAYNE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0504.pdf | 2011-11-01 11:15 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0506.html | 2013-12-16 13:11 | 9.5K | UNITED STATES v. WEBB. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0506.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0507.html | 2013-12-16 13:11 | 10K | UNITED STATES v. WEBBER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0507.pdf | 2011-11-01 11:15 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0508.html | 2013-12-16 13:11 | 7.2K | UNITED STATES v. WEBER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0508.pdf | 2011-11-01 11:15 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0509.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. WEBER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0509.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0509.2.html | 2013-12-16 13:11 | 50K | UNITED STATES v. WEBSTER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0509.2.pdf | 2011-11-01 11:15 | 127K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0518.html | 2013-12-16 13:11 | 20K | UNITED STATES v. WEISE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0518.pdf | 2011-11-01 11:15 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0520.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WELD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0520.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0520.2.html | 2013-12-16 13:11 | 3.1K | UNITED STATES v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0520.2.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0521.1.html | 2013-12-16 13:11 | 3.7K | UNITED STATES v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0521.1.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0521.2.html | 2013-12-16 13:11 | 6.3K | UNITED STATES v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0521.2.pdf | 2011-11-01 11:15 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0522.1.html | 2013-12-16 13:11 | 3.2K | UNITED STATES v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0522.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0522.2.html | 2013-12-16 13:11 | 15K | UNITED STATES v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0522.2.pdf | 2011-11-01 11:15 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0525.html | 2013-12-16 13:11 | 26K | UNITED STATES v. WENDELL et al., UNITED STATES v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0525.pdf | 2011-11-01 11:15 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0529.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WENTWORTH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0529.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0529.2.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0529.2.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0529.3.html | 2013-12-16 13:11 | 13K | UNITED STATES v. WESTERVELT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0529.3.pdf | 2011-11-01 11:15 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0531.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0531.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0531.2.html | 2013-12-16 13:11 | 22K | UNITED STATES v. WHALAN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0531.2.pdf | 2011-11-01 11:15 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0535.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WHEATON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0535.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0535.2.html | 2013-12-16 13:11 | 10K | UNITED STATES v. WHIDDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0535.2.pdf | 2011-11-01 11:15 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0536.html | 2013-12-16 13:11 | 14K | UNITED STATES v. WHISKEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0536.pdf | 2011-11-01 11:15 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0538.html | 2013-12-16 13:11 | 5.7K | UNITED STATES v. WHITAKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0538.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0539.html | 2013-12-16 13:11 | 44K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0539.pdf | 2011-11-01 11:15 | 108K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0546.html | 2013-12-16 13:11 | 22K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0546.pdf | 2011-11-01 11:15 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0550.html | 2013-12-16 13:11 | 83K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0550.pdf | 2011-11-01 11:15 | 175K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0562.html | 2013-12-16 13:11 | 41K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0562.pdf | 2011-11-01 11:15 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0568.html | 2013-12-16 13:11 | 14K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0568.pdf | 2011-11-01 11:15 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0570.html | 2013-12-16 13:11 | 9.0K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0570.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0572.html | 2013-12-16 13:11 | 12K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0572.pdf | 2011-11-01 11:15 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0573.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0573.pdf | 2011-11-01 11:15 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0576.html | 2013-12-16 13:11 | 23K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0576.pdf | 2011-11-01 11:15 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0580.html | 2013-12-16 13:11 | 30K | UNITED STATES v. WHITE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0580.pdf | 2011-11-01 11:15 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0584.html | 2013-12-16 13:11 | 7.9K | UNITED STATES v. WHITE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0584.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0586.html | 2013-12-16 13:11 | 15K | UNITED STATES v. WHITE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0586.pdf | 2011-11-01 11:15 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0588.1.html | 2013-12-16 13:11 | 4.4K | UNITED STATES v. WHITE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0588.1.pdf | 2011-11-01 11:15 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0588.2.html | 2013-12-16 13:11 | 15K | UNITED STATES v. WHITE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0588.2.pdf | 2011-11-01 11:15 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0590.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0590.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0590.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. WHITEHEAD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0590.2.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0590.3.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WHITTAKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0590.3.pdf | 2011-11-01 11:15 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0591.html | 2013-12-16 13:11 | 26K | UNITED STATES v. WHITTIER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0591.pdf | 2011-11-01 11:15 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0595.1.html | 2013-12-16 13:11 | 3.3K | UNITED STATES v. WICKHAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0595.1.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0595.2.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WIGGLESWORTH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0595.2.pdf | 2011-11-01 11:15 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0597.html | 2013-12-16 13:11 | 13K | UNITED STATES v. WILCOX. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0597.pdf | 2011-11-01 11:15 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0599.html | 2013-12-16 13:11 | 7.5K | UNITED STATES v. WILCOX. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0599.pdf | 2011-11-01 11:15 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0600.html | 2013-12-16 13:11 | 5.1K | UNITED STATES v. WILCOX. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0600.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0601.html | 2013-12-16 13:11 | 25K | UNITED STATES v. WILDER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0601.pdf | 2011-11-01 11:15 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0605.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WILKINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0605.pdf | 2011-11-01 11:15 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0607.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WILKINSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0607.1.pdf | 2011-11-01 11:15 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0607.2.html | 2013-12-16 13:11 | 9.8K | UNITED STATES v. WILL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0607.2.pdf | 2011-11-01 11:15 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0608.html | 2013-12-16 13:11 | 22K | UNITED STATES v. WILLARD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0608.pdf | 2011-11-01 11:15 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0612.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WILLETTS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0612.pdf | 2011-11-01 11:15 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0614.html | 2013-12-16 13:11 | 59K | UNITED STATES v. The WILLIAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0614.pdf | 2011-11-01 11:15 | 131K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0624.1.html | 2013-12-16 13:11 | 3.4K | UNITED STATES v. The WILLIAM and SAMUEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0624.1.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0624.2.html | 2013-12-16 13:11 | 30K | UNITED STATES v. The WILLIAM ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0624.2.pdf | 2011-11-01 11:15 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0629.html | 2013-12-16 13:11 | 16K | UNITED STATES v. The WILLIAM POPE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0629.pdf | 2011-11-01 11:15 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0631.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0631.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0631.2.html | 2013-12-16 13:11 | 21K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0631.2.pdf | 2011-11-01 11:15 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0635.html | 2013-12-16 13:11 | 11K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0635.pdf | 2011-11-01 11:15 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0636.html | 2013-12-16 13:11 | 55K | UNITED STATES v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0636.pdf | 2011-11-01 11:15 | 127K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0645.html | 2013-12-16 13:11 | 6.2K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0645.pdf | 2011-11-01 11:15 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0646.1.html | 2013-12-16 13:11 | 3.9K | UNITED STATES v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0646.1.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0646.2.html | 2013-12-16 13:11 | 5.1K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0646.2.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0647.1.html | 2013-12-16 13:11 | 2.9K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0647.1.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0647.2.html | 2013-12-16 13:11 | 79K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0647.2.pdf | 2011-11-01 11:15 | 167K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0660.html | 2013-12-16 13:11 | 28K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0660.pdf | 2011-11-01 11:15 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0665.1.html | 2013-12-16 13:11 | 5.6K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0665.1.pdf | 2011-11-01 11:15 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0665.2.html | 2013-12-16 13:11 | 6.3K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0665.2.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0666.html | 2013-12-16 13:11 | 29K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0666.pdf | 2011-11-01 11:15 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0670.html | 2013-12-16 13:11 | 12K | UNITED STATES v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0670.pdf | 2011-11-01 11:15 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0672.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0672.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0672.2.html | 2013-12-16 13:11 | 9.1K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0672.2.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0674.1.html | 2013-12-16 13:11 | 6.3K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0674.1.pdf | 2011-11-01 11:15 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0674.2.html | 2013-12-16 13:11 | 7.0K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0674.2.pdf | 2011-11-01 11:15 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0675.html | 2013-12-16 13:11 | 9.5K | UNITED STATES v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0675.pdf | 2011-11-01 11:15 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0677.html | 2013-12-16 13:11 | 8.6K | UNITED STATES v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0677.pdf | 2011-11-01 11:15 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0678.html | 2013-12-16 13:11 | 23K | UNITED STATES v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0678.pdf | 2011-11-01 11:15 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0682.html | 2013-12-16 13:11 | 29K | UNITED STATES ex rel. WHEELER v. WILLIAMSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0682.pdf | 2011-11-01 11:15 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0686.html | 2013-12-16 13:11 | 54K | UNITED STATES ex rel. WHEELER v. WILLIAMSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0686.pdf | 2011-11-01 11:15 | 129K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0695.html | 2013-12-16 13:11 | 21K | UNITED STATES v. WILLING. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0695.pdf | 2011-11-01 11:15 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0698.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WILLING v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0698.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0698.2.html | 2013-12-16 13:11 | 5.2K | UNITED STATES v. WILLIS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0698.2.pdf | 2011-11-01 11:15 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0699.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0699.1.pdf | 2011-11-01 11:15 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0699.2.html | 2013-12-16 13:11 | 119K | UNITED STATES v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0699.2.pdf | 2011-11-01 11:15 | 243K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0718.html | 2013-12-16 13:11 | 12K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0718.pdf | 2011-11-01 11:15 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0720.html | 2013-12-16 13:11 | 5.3K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0720.pdf | 2011-11-01 11:15 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0721.1.html | 2013-12-16 13:11 | 5.7K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0721.1.pdf | 2011-11-01 11:15 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0721.2.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0721.2.pdf | 2011-11-01 11:15 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0724.1.html | 2013-12-16 13:11 | 3.6K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0724.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0724.2.html | 2013-12-16 13:11 | 4.0K | UNITED STATES v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0724.2.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0725.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0725.pdf | 2011-11-01 11:15 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0727.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WILSON, The, v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0727.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0727.2.html | 2013-12-16 13:11 | 23K | UNITED STATES v. WILTBERGER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0727.2.pdf | 2011-11-01 11:15 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0731.html | 2013-12-16 13:11 | 7.8K | UNITED STATES v. WINCHESTER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0731.pdf | 2011-11-01 11:15 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0732.html | 2013-12-16 13:11 | 6.5K | UNITED STATES v. WINN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0732.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0733.html | 2013-12-16 13:11 | 27K | UNITED STATES v. WINN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0733.pdf | 2011-11-01 11:15 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0737.1.html | 2013-12-16 13:11 | 2.7K | UNITED STATES v. WINSLOW (two cases). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0737.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0737.2.html | 2013-12-16 13:11 | 13K | UNITED STATES v. WINSLOW. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0737.2.pdf | 2011-11-01 11:15 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0739.html | 2013-12-16 13:11 | 6.1K | UNITED STATES v. WINTER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0739.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0740.html | 2013-12-16 13:11 | 6.6K | UNITED STATES v. WINTER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0740.pdf | 2011-11-01 11:15 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0741.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WINTER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0741.1.pdf | 2011-11-01 11:15 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0741.2.html | 2013-12-16 13:11 | 8.9K | UNITED STATES v. WIRT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0741.2.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0742.1.html | 2013-12-16 13:11 | 2.4K | UNITED STATES v. WISE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0742.1.pdf | 2011-11-01 11:15 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0742.2.html | 2013-12-16 13:11 | 10K | UNITED STATES v. WISE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0742.2.pdf | 2011-11-01 11:15 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0743.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WITHENBURY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0743.pdf | 2011-11-01 11:15 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0744.html | 2013-12-16 13:11 | 9.6K | UNITED STATES v. WITTIG. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0744.pdf | 2011-11-01 11:15 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0745.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. The W. K. MUIR AND THE DAVIDSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0745.1.pdf | 2011-11-01 11:15 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0745.2.html | 2013-12-16 13:11 | 36K | UNITED STATES v. WONSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0745.2.pdf | 2011-11-01 11:15 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0751.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0751.1.pdf | 2011-11-01 11:15 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0751.2.html | 2013-12-16 13:11 | 8.6K | UNITED STATES v. WOOD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0751.2.pdf | 2011-11-01 11:15 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0752.1.html | 2013-12-16 13:11 | 3.0K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0752.1.pdf | 2011-11-01 11:15 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0752.2.html | 2013-12-16 13:11 | 4.4K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0752.2.pdf | 2011-11-01 11:15 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0753.html | 2013-12-16 13:11 | 6.5K | UNITED STATES v. WOOD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0753.pdf | 2011-11-01 11:15 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0754.1.html | 2013-12-16 13:11 | 4.3K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0754.1.pdf | 2011-11-01 11:15 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0754.2.html | 2013-12-16 13:11 | 7.7K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0754.2.pdf | 2011-11-01 11:15 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0755.html | 2013-12-16 13:11 | 38K | UNITED STATES v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0755.pdf | 2011-11-01 11:16 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0761.html | 2013-12-16 13:11 | 5.1K | UNITED STATES v. WOODRUFF. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0761.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0762.1.html | 2013-12-16 13:11 | 3.1K | UNITED STATES v. WOODS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0762.1.pdf | 2011-11-01 11:16 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0762.2.html | 2013-12-16 13:11 | 14K | UNITED STATES v. WOODS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0762.2.pdf | 2011-11-01 11:16 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0764.html | 2013-12-16 13:11 | 8.1K | UNITED STATES v. WOODWARD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0764.pdf | 2011-11-01 11:16 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0766.1.html | 2013-12-16 13:11 | 2.8K | UNITED STATES v. WOOLHEIM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0766.1.pdf | 2011-11-01 11:16 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0766.2.html | 2013-12-16 13:11 | 24K | UNITED STATES v. WOOLSEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0766.2.pdf | 2011-11-01 11:16 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0770.1.html | 2013-12-16 13:11 | 8.4K | UNITED STATES v. WOOLSEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0770.1.pdf | 2011-11-01 11:16 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0771.html | 2013-12-16 13:11 | 17K | UNITED STATES v. WORKMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0771.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0773.html | 2013-12-16 13:11 | 4.4K | UNITED STATES v. WORMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0773.pdf | 2011-11-01 11:16 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0774.html | 2013-12-16 13:11 | 38K | UNITED STATES v. WORRALL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0774.pdf | 2011-11-01 11:16 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0780.html | 2013-12-16 13:11 | 6.8K | UNITED STATES v. WRAPE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0780.pdf | 2011-11-01 11:16 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0781.html | 2013-12-16 13:11 | 47K | UNITED STATES v. The WHEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0781.pdf | 2011-11-01 11:16 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0789.1.html | 2013-12-16 13:11 | 1.4K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0789.1.pdf | 2011-11-01 11:16 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0789.2.html | 2013-12-16 13:11 | 7.2K | UNITED STATES v. WRIGHT et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0789.2.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0790.1.html | 2013-12-16 13:11 | 2.2K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0790.1.pdf | 2011-11-01 11:16 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0790.2.html | 2013-12-16 13:11 | 3.3K | UNITED STATES v. WEIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0790.2.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0790.3.html | 2013-12-16 13:11 | 7.6K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0790.3.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0791.html | 2013-12-16 13:11 | 5.5K | UNITED STATES v. WEIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0791.pdf | 2011-11-01 11:16 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0792.html | 2013-12-16 13:11 | 13K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0792.pdf | 2011-11-01 11:16 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0794.html | 2013-12-16 13:11 | 16K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0794.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0796.html | 2013-12-16 13:11 | 12K | UNITED STATES ex rel. HENDERSON v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0796.pdf | 2011-11-01 11:16 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0798.html | 2013-12-16 13:11 | 9.8K | UNITED STATES ex rel. TURNER v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0798.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0799.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0799.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0799.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0799.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0799.3.html | 2013-12-16 13:11 | 3.7K | UNITED STATES v. YEATON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0799.3.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0800.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. YELLOW SUN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0800.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0800.2.html | 2013-12-16 13:11 | 11K | UNITED STATES v. YORK STREET FLAX SPINNING CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0800.2.pdf | 2011-11-01 11:16 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0801.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0801.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0801.2.html | 2013-12-16 13:11 | 8.7K | UNITED STATES v. YOUNGS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0801.2.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0803.1.html | 2013-12-16 13:11 | 3.4K | UNITED STATES v. YOUNT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0803.1.pdf | 2011-11-01 11:16 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0803.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (YOUNT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0803.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0803.3.html | 2013-12-16 13:11 | 1.2K | UNITED STATES (YTURBIDE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0803.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0803.4.html | 2013-12-16 13:11 | 8.1K | UNITED STATES v. ZANTZINGER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0803.4.pdf | 2011-11-01 11:16 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0804.html | 2013-12-16 13:11 | 10K | UNITED STATES v. ZEREGA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0804.pdf | 2011-11-01 11:16 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0806.1.html | 2013-12-16 13:11 | 3.7K | UNITED STATES & FOREIGN SALAMANDER FELTING CO. v. ASBESTOS FELTING CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0806.1.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0806.2.html | 2013-12-16 13:11 | 5.9K | UNITED STATES & FOREIGN SALAMANDER FELTING CO. v. ASBESTOS FELTING CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0806.2.pdf | 2011-11-01 11:16 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0807.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES & FOBEIGN SALAMANDEB FELTING CO. (ASBESTOS FELTING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0807.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0807.2.html | 2013-12-16 13:11 | 12K | UNITED STATES & FOREIGN SALAMANDER FELTING CO. et al. v. HAVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0807.2.pdf | 2011-11-01 11:16 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0809.html | 2013-12-16 13:11 | 7.2K | UNITED STATES & FOREIGN SALAMANDER FELTING CO. v. MERRIMACK MANUF'G CO., SAME v. LAWRENCE MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0809.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0810.html | 2013-12-16 13:11 | 9.2K | UNITED STATES ANNUNCIATOR & BELL TELEGRAPH MANUF'G CO. v. SANDERSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0810.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0811.html | 2013-12-16 13:11 | 32K | UNITED STATES BANK v. BINNEY et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0811.pdf | 2011-11-01 11:16 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES CARTRIDGE CO. (UNION METALLIC CARTRIDGE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.2.html | 2013-12-16 13:11 | 1.2K | UNITED STATES CORSET CO. (CARSTAEDT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.3.html | 2013-12-16 13:11 | 1.2K | UNITED STATES CORSET CO. (COHN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.4.html | 2013-12-16 13:11 | 1.3K | UNITED STATES DISINTEGRATING ORE CO. (GOLD AND SILVER ORE SEPARATING CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.5.html | 2013-12-16 13:11 | 1.2K | UNITED STATES EXPRESS CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.5.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.6.html | 2013-12-16 13:11 | 1.2K | UNITED STATES INS. CO. (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.6.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.7.html | 2013-12-16 13:11 | 1.2K | UNITED STATES INS. CO. (HENNING v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.7.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.8.html | 2013-12-16 13:11 | 1.2K | UNITED STATES INS. CO. (MAREAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.8.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.9.html | 2013-12-16 13:11 | 1.2K | UNITED STATES INS. CO. (SCHWARTZ v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.9.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0816.10.html | 2013-12-16 13:11 | 12K | UNITED STATES LIFE INS. CO. v. ADAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0816.10.pdf | 2011-11-01 11:16 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0818.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES MAIL S. S. CO. (HIGGINS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0818.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0818.2.html | 2013-12-16 13:11 | 4.6K | UNITED STATES MAIL S. S. CO. v. The JOHN POTTER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0818.2.pdf | 2011-11-01 11:16 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0819.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES PATENT BUTTON, RIVET, NEEDLE & MACHINE MANUF'G CO. (PLATT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0819.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0819.2.html | 2013-12-16 13:11 | 21K | UNITED STATES RIFLE, ETC., CO. et al. v. WHITNEY ABMS CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0819.2.pdf | 2011-11-01 11:16 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0822.1.html | 2013-12-16 13:11 | 1.3K | UNITED STATES STAMPING CO. v. KING et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0822.1.pdf | 2011-11-01 11:16 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0822.2.html | 2013-12-16 13:11 | 11K | UNITED STATES STEAM—GAUGE CO. v. AMERICAN STEAM—GAUGE CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0822.2.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0824.1.html | 2013-12-16 13:11 | 1.2K | UNITED STATES TEL. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0824.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0824.2.html | 2013-12-16 13:11 | 1.3K | UNITED STATES WIND—ENGINE & PUMP CO., In re. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0824.2.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0824.3.html | 2013-12-16 13:11 | 1.2K | UNIVERSAL LIFE INS. CO. (McKENTY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0824.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0824.4.html | 2013-12-16 13:11 | 1.2K | UNNA (SELZ v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0824.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0824.5.html | 2013-12-16 13:11 | 13K | UNTHANK v. TRAVELERS' INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0824.5.pdf | 2011-11-01 11:16 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0826.html | 2013-12-16 13:11 | 17K | UPHAM v. BROOKS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0826.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0828.html | 2013-12-16 13:11 | 21K | UPHAM v. BROOKS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0828.pdf | 2011-11-01 11:16 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0831.1.html | 2013-12-16 13:11 | 1.2K | UPPERMAN (MOCKBEE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0831.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0831.2.html | 2013-12-16 13:11 | 12K | UPTON v. BURNHAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0831.2.pdf | 2011-11-01 11:16 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0833.html | 2013-12-16 13:11 | 13K | UPTON v. BURNHAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0833.pdf | 2011-11-01 11:16 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0835.1.html | 2013-12-16 13:11 | 1.2K | UPTON (ELLIOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0835.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0835.2.html | 2013-12-16 13:11 | 23K | UPTON v. ENGLEHART. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0835.2.pdf | 2011-11-01 11:16 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0839.html | 2013-12-16 13:11 | 32K | UPTON v. HANSBROUGH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0839.pdf | 2011-11-01 11:16 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0844.1.html | 2013-12-16 13:11 | 1.2K | UPTON (HOBART v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0844.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0844.2.html | 2013-12-16 13:11 | 18K | UPTON v. JACKSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0844.2.pdf | 2011-11-01 11:16 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.1.html | 2013-12-16 13:11 | 1.2K | UPTON (MILLIGAN & H. GLUE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.2.html | 2013-12-16 13:11 | 1.2K | UPTON (ROBBINS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.3.html | 2013-12-16 13:11 | 1.2K | UPTON v. TRIBLECOCK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.4.html | 2013-12-16 13:11 | 1.2K | URANN (HARRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.5.html | 2013-12-16 13:11 | 1.2K | URBANA, TOWN OF (LESLIE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.5.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.6.html | 2013-12-16 13:11 | 1.2K | URQUHART (BOYD v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.6.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0846.7.html | 2013-12-16 13:11 | 34K | The U. S. GRANT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0846.7.pdf | 2011-11-01 11:16 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0852.html | 2013-12-16 13:11 | 7.3K | The U. S. GRANT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0852.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0853.1.html | 2013-12-16 13:11 | 1.2K | USHER (GIBBS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0853.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0853.2.html | 2013-12-16 13:11 | 11K | USHER v. McBRATNEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0853.2.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0854.1.html | 2013-12-16 13:11 | 1.2K | USHER (McBRATNEY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0854.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0854.2.html | 2013-12-16 13:11 | 1.2K | USHER (MADDUX v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0854.2.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0854.3.html | 2013-12-16 13:11 | 1.2K | USTICK (POSTMASTER GENERAL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0854.3.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0854.4.html | 2013-12-16 13:11 | 1.2K | UTICA, The (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0854.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0854.5.html | 2013-12-16 13:11 | 17K | The UTILITY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0854.5.pdf | 2011-11-01 11:16 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0857.html | 2013-12-16 13:11 | 12K | UTLEY et al. v. DONALDSON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0857.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0859.html | 2013-12-16 13:11 | 13K | UTPADEL et al. v. FEARS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0859.pdf | 2011-11-01 11:16 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0861.html | 2013-12-16 13:11 | 8.1K | UTTERBACH et al. v. BINNS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0861.pdf | 2011-11-01 11:16 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0862.1.html | 2013-12-16 13:11 | 1.2K | VACA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0862.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0862.2.html | 2013-12-16 13:11 | 24K | VACCARI v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0862.2.pdf | 2011-11-01 11:16 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0865.1.html | 2013-12-16 13:11 | 1.2K | VAIDEN (NORDLINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0865.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0865.2.html | 2013-12-16 13:11 | 1.2K | VAIL (AMERICAN MIDDLINGS PURIFIER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0865.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0866.html | 2013-12-16 13:11 | 9.3K | VALARINO v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0866.pdf | 2011-11-01 11:16 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0867.html | 2013-12-16 13:11 | 5.8K | VALE v. PHOENIX INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0867.pdf | 2011-11-01 11:16 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0868.1.html | 2013-12-16 13:11 | 7.1K | In re VALENTINE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0868.1.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0868.2.html | 2013-12-16 13:11 | 1.2K | VALENTINE (BETTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0868.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0868.3.html | 2013-12-16 13:11 | 1.2K | VALENTINE (BUERK v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0868.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0868.4.html | 2013-12-16 13:11 | 1.2K | VALENTINE (HAZLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0868.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0869.html | 2013-12-16 13:11 | 17K | VALENTINE et al. v. MARSHAL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0869.pdf | 2011-11-01 11:16 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0871.html | 2013-12-16 13:11 | 5.2K | VALENTINE et al. v. REYNOLDS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0871.pdf | 2011-11-01 11:16 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0872.html | 2013-12-16 13:11 | 6.4K | VALERINO v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0872.pdf | 2011-11-01 11:16 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0873.html | 2013-12-16 13:11 | 6.8K | In re VALK et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0873.pdf | 2011-11-01 11:16 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0874.1.html | 2013-12-16 13:11 | 4.6K | VALK v. SIMMONS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0874.1.pdf | 2011-11-01 11:16 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0874.2.html | 2013-12-16 13:11 | 306K | Ex parte VALLANDIGHAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0874.2.pdf | 2011-11-01 11:16 | 579K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0925.1.html | 2013-12-16 13:11 | 1.3K | Ex parte VALLANDINGHAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0925.1.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0925.2.html | 2013-12-16 13:11 | 1.2K | VALLE (WICKHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0925.2.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0925.3.html | 2013-12-16 13:11 | 6.5K | VALLEJO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0925.3.pdf | 2011-11-01 11:16 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0926.1.html | 2013-12-16 13:11 | 4.1K | VALLEJO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0926.1.pdf | 2011-11-01 11:16 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0926.2.html | 2013-12-16 13:11 | 1.2K | VALLEJO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0926.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0926.3.html | 2013-12-16 13:11 | 17K | VALLETTE v. WHITEWATER VALLEY CANAL CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0926.3.pdf | 2011-11-01 11:16 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0929.1.html | 2013-12-16 13:11 | 1.2K | VALLEY BANK (MERCHANTS' NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0929.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0929.2.html | 2013-12-16 13:11 | 1.3K | VALLEY NAT. BANK v. MYERS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0929.2.pdf | 2011-11-01 11:16 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0929.3.html | 2013-12-16 13:11 | 1.2K | VALLEY NAT. BANK v. PAPIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0929.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0929.4.html | 2013-12-16 13:11 | 8.6K | VALLIERE et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0929.4.pdf | 2011-11-01 11:16 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0930.html | 2013-12-16 13:11 | 5.0K | In re VALLIQUETTE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0930.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0931.html | 2013-12-16 13:11 | 16K | Ex parte VAN AERNAM. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0931.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0933.html | 2013-12-16 13:11 | 8.7K | VAN AMRINGE v. PEABODY et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0933.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0934.html | 2013-12-16 13:11 | 1.2K | VAN ANTWERP (GOODYEAR DENTAL VULCANITE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0934.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0935.html | 2013-12-16 13:11 | 41K | VAN ANTWERP v. HULBURD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0935.pdf | 2011-11-01 11:16 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0941.html | 2013-12-16 13:11 | 31K | VAN ANTWERP v. HULBURD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0941.pdf | 2011-11-01 11:16 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0946.1.html | 2013-12-16 13:11 | 1.2K | VAN ARMAN (GILBERT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0946.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0946.2.html | 2013-12-16 13:11 | 11K | In re VAN AUKEN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0946.2.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0948.1.html | 2013-12-16 13:11 | 3.7K | VAN AVERY v. PHOENIX INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0948.1.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0948.2.html | 2013-12-16 13:11 | 1.2K | VAN BERGEN v. STUART. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0948.2.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0948.3.html | 2013-12-16 13:11 | 11K | VAN BOKELEN v. BROOKLYN CITY R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0948.3.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0949.html | 2013-12-16 13:11 | 18K | VAN BOKKELEN et al. v. COOK et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0949.pdf | 2011-11-01 11:16 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0952.html | 2013-12-16 13:11 | 5.0K | VAN BRUNT v. CORBIN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0952.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0953.html | 2013-12-16 13:11 | 8.9K | In re VAN BUREN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0953.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0954.1.html | 2013-12-16 13:11 | 1.2K | VAN BUREN v. The E. M. McCHESNEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0954.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0954.2.html | 2013-12-16 13:11 | 1.4K | VAN CAMPBUSH v. CRAWFORD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0954.2.pdf | 2011-11-01 11:16 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0954.3.html | 2013-12-16 13:11 | 12K | In re VAN CAMPEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0954.3.pdf | 2011-11-01 11:16 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0956.1.html | 2013-12-16 13:11 | 1.7K | VANCE v. CAMPBELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0956.1.pdf | 2011-11-01 11:16 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0956.2.html | 2013-12-16 13:11 | 14K | VANCE v. CAMPBELL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0956.2.pdf | 2011-11-01 11:16 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0958.1.html | 2013-12-16 13:11 | 1.2K | VANCE (SUYDAM v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0958.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0958.2.html | 2013-12-16 13:11 | 1.2K | VANCLEVE (STEVENS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0958.2.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0958.3.html | 2013-12-16 13:11 | 19K | The VANCOUVER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0958.3.pdf | 2011-11-01 11:16 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0961.1.html | 2013-12-16 13:11 | 1.2K | VANDERBILT (McKIBBIN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0961.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0961.2.html | 2013-12-16 13:11 | 30K | VANDERBILT et al. v. REYNOLDS et al., The NORTH STAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0961.2.pdf | 2011-11-01 11:16 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0966.1.html | 2013-12-16 13:11 | 1.3K | VANDERBILT v. REYNOLDS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0966.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0966.2.html | 2013-12-16 13:11 | 3.8K | In re VANDERHOEF et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0966.2.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0966.3.html | 2013-12-16 13:11 | 3.7K | In re VANDERHOEF et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0966.3.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0967.html | 2013-12-16 13:11 | 22K | VANDERHOOF v. CITY BANK OF ST. PAUL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0967.pdf | 2011-11-01 11:16 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0970.html | 2013-12-16 13:11 | 24K | VANDERSLICE v. The SUPERIOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0970.pdf | 2011-11-01 11:16 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0974.html | 2013-12-16 13:11 | 10K | In re VANDERVELPEN et ux. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0974.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0975.html | 2013-12-16 13:11 | 6.2K | VANDERWICK v. SUMMERL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0975.pdf | 2011-11-01 11:16 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0976.1.html | 2013-12-16 13:11 | 1.2K | VAN DEUSEN (UNION PAPER—COLLAR CO. V.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0976.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0976.2.html | 2013-12-16 13:11 | 9.5K | VANDEVER v. TILGHMAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0976.2.pdf | 2011-11-01 11:16 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0977.html | 2013-12-16 13:11 | 14K | VANDEWATER v. WESTERVELT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0977.pdf | 2011-11-01 11:16 | 53K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0977_01.jpg | 2011-08-01 13:07 | 6.4K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0980.html | 2013-12-16 13:11 | 17K | Federal Cases, Volume 28 |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0980.pdf | 2011-11-01 11:16 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0982.html | 2013-12-16 13:11 | 12K | VANDOVER v. WILMOT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0982.pdf | 2011-11-01 11:16 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0984.1.html | 2013-12-16 13:11 | 1.2K | VAN DRESAR (GIBSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0984.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0984.2.html | 2013-12-16 13:11 | 1.2K | VAN DYCK (MORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0984.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0984.3.html | 2013-12-16 13:11 | 1.2K | VANDYKE (JOHNSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0984.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0984.4.html | 2013-12-16 13:11 | 14K | VAN DYKE et al. v. TINKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0984.4.pdf | 2011-11-01 11:16 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0986.1.html | 2013-12-16 13:11 | 1.2K | VAN DYKE (TINKER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0986.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0986.2.html | 2013-12-16 13:11 | 32K | VAN EPPS v. WALSH et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0986.2.pdf | 2011-11-01 11:16 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0991.1.html | 2013-12-16 13:11 | 1.2K | VAN FOSSEN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0991.1.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0991.2.html | 2013-12-16 13:11 | 1.2K | VAN HAGEN (STURGES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0991.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0991.3.html | 2013-12-16 13:11 | 1.2K | VAN HAVEN, Ex parte. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0991.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0991.4.html | 2013-12-16 13:11 | 36K | VAN HOOK v. PENDLETON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0991.4.pdf | 2011-11-01 11:16 | 185K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0993_01.jpg | 2011-07-26 14:53 | 42K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.0994_01.jpg | 2011-07-26 14:53 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.0998.html | 2013-12-16 13:11 | 24K | VAN HOOK v. PENDLETON et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.0998.pdf | 2011-11-01 11:16 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1001.html | 2013-12-16 13:11 | 9.2K | VAN HOOK v. SCUDDER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1001.pdf | 2011-11-01 11:16 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1003.html | 2013-12-16 13:11 | 25K | VAN HOOK v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1003.pdf | 2011-11-01 11:16 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1007.html | 2013-12-16 13:11 | 31K | VAN HOOK v. WOOD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1007.pdf | 2011-11-01 11:16 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1011.html | 2013-12-16 13:11 | 3.3K | VANHORN v. CHESNUT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1011.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1012.html | 2013-12-16 13:11 | 50K | VANHORNE v. DORRANCE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1012.pdf | 2011-11-01 11:16 | 118K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1020.html | 2013-12-16 13:11 | 10K | Ex parte VAN HOVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1020.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1021.html | 2013-12-16 13:11 | 23K | Ex parte VAN HOVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1021.pdf | 2011-11-01 11:16 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1025.1.html | 2013-12-16 13:11 | 1.2K | VAN INGEN (LIVINGSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1025.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1025.2.html | 2013-12-16 13:11 | 1.2K | VAN INWAGEN (SCARLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1025.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1025.3.html | 2013-12-16 13:11 | 1.2K | VAN KIRK (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1025.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1025.4.html | 2013-12-16 13:11 | 35K | VAN KLEECK v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1025.4.pdf | 2011-11-01 11:16 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1031.html | 2013-12-16 13:11 | 22K | VAN KLEECK et al. v. THURBER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1031.pdf | 2011-11-01 11:16 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1034.1.html | 2013-12-16 13:11 | 1.1K | VAN LEAR (DODGE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1034.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1034.2.html | 2013-12-16 13:11 | 5.1K | VAN LIER v. DORD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1034.2.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1035.html | 2013-12-16 13:11 | 11K | VAN MARTER v. MILLER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1035.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1036.1.html | 2013-12-16 13:11 | 1.2K | VAN METER v. MITCHEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1036.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1036.2.html | 2013-12-16 13:11 | 1.2K | VAN METER (RICHARD v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1036.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1036.3.html | 2013-12-16 13:11 | 1.3K | VAN METRE v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1036.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1036.4.html | 2013-12-16 13:11 | 38K | VAN METRE v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1036.4.pdf | 2011-11-01 11:16 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1042.html | 2013-12-16 13:11 | 11K | VAN METRE v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1042.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.1.html | 2013-12-16 13:11 | 1.2K | VAN METTER v. MITCHELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.2.html | 2013-12-16 13:11 | 1.2K | VAN NAME (TRIPLET v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.3.html | 2013-12-16 13:11 | 1.2K | VAN NESS (BALTIMORE & O. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.4.html | 2013-12-16 13:11 | 1.2K | VAN NESS (BANK OF UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.5.html | 2013-12-16 13:11 | 1.2K | VAN NESS (BEATTY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.5.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.6.html | 2013-12-16 13:11 | 1.2K | VAN NESS (BROHAWN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.6.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.7.html | 2013-12-16 13:11 | 1.2K | VAN NESS (CRAMPTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.7.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.8.html | 2013-12-16 13:11 | 1.2K | VAN NESS (GILLIS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.8.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.9.html | 2013-12-16 13:11 | 3.1K | VAN NESS v. HEINEKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.9.pdf | 2011-11-01 11:16 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1044.10.html | 2013-12-16 13:11 | 79K | VAN NESS v. HYATT et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1044.10.pdf | 2011-11-01 11:16 | 171K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1056.html | 2013-12-16 13:11 | 1.3K | VAN NESS (ROCKVILLE & W. TURNPIKE—ROAD v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1056.pdf | 2011-11-01 11:16 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1057.html | 2013-12-16 13:11 | 11K | VAN NESS et ux. v. UNITED STATES et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1057.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1058.html | 2013-12-16 13:11 | 11K | VAN NESS v. VAN NESS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1058.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.1.html | 2013-12-16 13:11 | 1.2K | VAN NEST (MERRIAM v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.2.html | 2013-12-16 13:11 | 1.2K | VAN NEST (SEARLES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.2.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.3.html | 2013-12-16 13:11 | 1.2K | VAN NORMAN v. HOLMAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.3.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.4.html | 2013-12-16 13:11 | 1.2K | VAN NORTHWICK v. STERLING. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.5.html | 2013-12-16 13:11 | 1.2K | VAN NOSTRAND (MINON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.5.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1060.6.html | 2013-12-16 13:11 | 8.3K | Ex parte VAN ORDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1060.6.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1061.1.html | 2013-12-16 13:11 | 1.2K | VAN PELT (BULLOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1061.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1061.2.html | 2013-12-16 13:11 | 4.9K | VAN PELT v. The OHIO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1061.2.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1062.1.html | 2013-12-16 13:11 | 1.2K | VANRANST (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1062.1.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1062.2.html | 2013-12-16 13:11 | 34K | VAN REIMSDYK v. KANE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1062.2.pdf | 2011-11-01 11:16 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1067.html | 2013-12-16 13:11 | 29K | VAN REIMSDYK v. KANE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1067.pdf | 2011-11-01 11:16 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1071.html | 2013-12-16 13:11 | 8.7K | VAN RENSSELLAER v. KELLY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1071.pdf | 2011-11-01 11:16 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1072.html | 2013-12-16 13:11 | 15K | In re VAN RIPER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1072.pdf | 2011-11-01 11:16 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1075.1.html | 2013-12-16 13:11 | 1.2K | VAN SANDS (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1075.1.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1075.2.html | 2013-12-16 13:11 | 19K | VAN SANTWOOD et al. v. The JOHN B. COLE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1075.2.pdf | 2011-11-01 11:16 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1078.html | 2013-12-16 13:11 | 13K | VAN SCHAACK et al. v. NORTHERN TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1078.pdf | 2011-11-01 11:16 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1079.1.html | 2013-12-16 13:11 | 1.2K | VANSICKLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1079.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1079.2.html | 2013-12-16 13:11 | 1.2K | VAN SLYKE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1079.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1080.html | 2013-12-16 13:11 | 10K | VAN STRATTON v. BORBOCK et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1080.pdf | 2011-11-01 11:16 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1081.html | 2013-12-16 13:11 | 27K | VAN SYCKEL v. The THOMAS SWING. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1081.pdf | 2011-11-01 11:16 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1085.1.html | 2013-12-16 13:11 | 1.2K | VANSYCKLE v. The THOMAS EWING. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1085.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1085.2.html | 2013-12-16 13:11 | 15K | VANTINE v. The LAKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1085.2.pdf | 2011-11-01 11:16 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1088.1.html | 2013-12-16 13:11 | 5.3K | In re VAN TUYL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1088.1.pdf | 2011-11-01 11:16 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1088.2.html | 2013-12-16 13:11 | 13K | In re VAN TUYL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1088.2.pdf | 2011-11-01 11:16 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1090.html | 2013-12-16 13:11 | 9.2K | In re VAN TUYL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1090.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1091.html | 2013-12-16 13:11 | 1.2K | VAN VOORST (ELLIOT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1091.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1092.1.html | 2013-12-16 13:11 | 6.0K | VAN WINKLE v. The HENRY MORRISON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1092.1.pdf | 2011-11-01 11:16 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1092.2.html | 2013-12-16 13:11 | 5.5K | VAN WINKLE v. JARVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1092.2.pdf | 2011-11-01 11:16 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1093.1.html | 2013-12-16 13:11 | 1.2K | VAN WINKLE v. The JENNY LIND. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1093.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1093.2.html | 2013-12-16 13:11 | 1.2K | VAN WORMER (HAILES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1093.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1093.3.html | 2013-12-16 13:11 | 1.2K | VAN ZANDT (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1093.3.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1093.4.html | 2013-12-16 13:11 | 1.2K | VAN ZANDT (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1093.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1093.5.html | 2013-12-16 13:11 | 11K | VAN ZANDT v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1093.5.pdf | 2011-11-01 11:16 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.1.html | 2013-12-16 13:11 | 1.2K | VAN ZANDT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.2.html | 2013-12-16 13:11 | 1.2K | VAN ZANDT (WILLIAM v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.3.html | 2013-12-16 13:11 | 1.2K | VAPORISOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.4.html | 2013-12-16 13:11 | 1.2K | VARDEN (MOFFIT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.5.html | 2013-12-16 13:11 | 1.2K | VARDEN (TAYLOE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.5.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.6.html | 2013-12-16 13:11 | 1.2K | VARDEN (VOSS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.6.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.7.html | 2013-12-16 13:11 | 1.2K | VARN (GOODING v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.7.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1095.8.html | 2013-12-16 13:11 | 9.2K | VARNER v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1095.8.pdf | 2011-11-01 11:16 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1096.html | 2013-12-16 13:11 | 14K | VARNUM v. BELLAMY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1096.pdf | 2011-11-01 11:16 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1098.1.html | 2013-12-16 13:11 | 1.2K | VARNUM (BURTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1098.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1098.2.html | 2013-12-16 13:11 | 4.2K | VARNUM et al. v. CAMPBELL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1098.2.pdf | 2011-11-01 11:16 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1099.1.html | 2013-12-16 13:11 | 1.3K | VARNUM v. DANFORD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1099.1.pdf | 2011-11-01 11:16 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1099.2.html | 2013-12-16 13:11 | 4.1K | VARNUM v. MAURO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1099.2.pdf | 2011-11-01 11:16 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1099.3.html | 2013-12-16 13:11 | 8.9K | VARNUM et al. v. MILFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1099.3.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1100.html | 2013-12-16 13:11 | 6.0K | VARNUM et al. v. MILFORD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1100.pdf | 2011-11-01 11:16 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.1.html | 2013-12-16 13:11 | 1.2K | VARNUM (POWLING v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.1.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.2.html | 2013-12-16 13:11 | 3.0K | VABNUM v. RUNION et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.2.pdf | 2011-11-01 11:16 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.3.html | 2013-12-16 13:11 | 1.2K | VARRENE (VON GLAHN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.3.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.4.html | 2013-12-16 13:11 | 1.2K | VASSAULT (MEEKS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.4.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.5.html | 2013-12-16 13:11 | 1.2K | VASSE (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.5.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1101.6.html | 2013-12-16 13:11 | 24K | VASSE v. COMEGYS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1101.6.pdf | 2011-11-01 11:16 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1105.html | 2013-12-16 13:11 | 6.1K | VASSE v. COMEGYSS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1105.pdf | 2011-11-01 11:16 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1106.html | 2013-12-16 13:11 | 6.5K | VASSE v. MIFFLIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1106.pdf | 2011-11-01 11:16 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1107.1.html | 2013-12-16 13:11 | 3.8K | VASSE v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1107.1.pdf | 2011-11-01 11:16 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1107.2.html | 2013-12-16 13:11 | 1.2K | VATTIER (HINDE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1107.2.pdf | 2011-11-01 11:16 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1107.3.html | 2013-12-16 13:11 | 1.2K | VATTIER (PIATT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1107.3.pdf | 2011-11-01 11:16 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1107.4.html | 2013-12-16 13:11 | 22K | VAUGHAN v. CENTRAL PAC. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1107.4.pdf | 2011-11-01 11:16 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1111.html | 2013-12-16 13:11 | 14K | VAUGHAN v. EAST TENNESSEE, V. & G. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1111.pdf | 2011-11-01 11:16 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1113.html | 2013-12-16 13:11 | 7.8K | VAUGHAN et al. v. NORTHROP. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1113.pdf | 2011-11-01 11:16 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1114.html | 2013-12-16 13:11 | 10K | VAUGHAN v. SIX HUNDRED AND THIRTY CASKS OF SHERRY WINE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1114.pdf | 2011-11-01 11:17 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1115.1.html | 2013-12-16 13:11 | 1.4K | VAUGHAN v. SOUTH & NORTH ALABAMA R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1115.1.pdf | 2011-11-01 11:17 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1115.2.html | 2013-12-16 13:11 | 1.4K | VAUGHAN v. WALLACE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1115.2.pdf | 2011-11-01 11:17 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1115.3.html | 2013-12-16 13:11 | 20K | VAUGHAN v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1115.3.pdf | 2011-11-01 11:17 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1118.1.html | 2013-12-16 13:11 | 1.2K | VAUGHN (LAMB v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1118.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1118.2.html | 2013-12-16 13:11 | 1.2K | VAUGHN (MIZNER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1118.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1118.3.html | 2013-12-16 13:11 | 1.2K | VAUGHT (BLOOMER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1118.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1118.4.html | 2013-12-16 13:11 | 1.2K | VAUX (BRUDENELL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1118.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1118.5.html | 2013-12-16 13:11 | 6.1K | VEACOCK v. McCALL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1118.5.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1119.1.html | 2013-12-16 13:11 | 2.3K | VEATCH v. HARBAUGH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1119.1.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1119.2.html | 2013-12-16 13:11 | 1.2K | VEAZIE (WADLEIGH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1119.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1119.3.html | 2013-12-16 13:11 | 29K | VEAZIE v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1119.3.pdf | 2011-11-01 11:17 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1124.html | 2013-12-16 13:11 | 71K | VEAZIE v. WILLIAMS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1124.pdf | 2011-11-01 11:17 | 158K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1135.1.html | 2013-12-16 13:11 | 1.2K | VECHIO (CALHOUN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1135.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1135.2.html | 2013-12-16 13:11 | 6.2K | VEIL et al. v. MITCHEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1135.2.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1136.1.html | 2013-12-16 13:11 | 3.4K | VEITCH et al. v. BASYE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1136.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1136.2.html | 2013-12-16 13:11 | 2.2K | VEITCH et al. v. FARMERS' BANK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1136.2.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1136.3.html | 2013-12-16 13:11 | 1.2K | VEITCH (PEYTON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1136.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1136.4.html | 2013-12-16 13:11 | 1.2K | VEITCH (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1136.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1136.5.html | 2013-12-16 13:11 | 11K | The VELASCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1136.5.pdf | 2011-11-01 11:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1138.html | 2013-12-16 13:11 | 31K | The VELOCITY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1138.pdf | 2011-11-01 11:17 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1143.html | 2013-12-16 13:11 | 8.6K | The VELONA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1143.pdf | 2011-11-01 11:17 | 50K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.1143_01.jpg | 2011-08-01 13:01 | 6.9K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1144.1.html | 2013-12-16 13:11 | 1.2K | VENABLE (BRENT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1144.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1144.2.html | 2013-12-16 13:11 | 1.2K | VENABLE (FRENCH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1144.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1144.3.html | 2013-12-16 13:11 | 16K | VENABLE et al. v. RICHARDS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1144.3.pdf | 2011-11-01 11:17 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1146.1.html | 2013-12-16 13:11 | 1.2K | VENABLE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1146.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1146.2.html | 2013-12-16 13:11 | 4.4K | The VENUS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1146.2.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1147.1.html | 2013-12-16 13:11 | 1.2K | VENUS, The (BREED v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1147.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1147.2.html | 2013-12-16 13:11 | 1.2K | VERE, The (REID v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1147.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1147.3.html | 2013-12-16 13:11 | 28K | In re VEREMAITRE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1147.3.pdf | 2011-11-01 11:17 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1151.html | 2013-12-16 13:11 | 6.3K | In re VERMEULE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1151.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1152.1.html | 2013-12-16 13:11 | 1.2K | VERMILYE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1152.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1152.2.html | 2013-12-16 13:11 | 5.1K | The VERMONT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1152.2.pdf | 2011-11-01 11:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1153.1.html | 2013-12-16 13:11 | 1.4K | VERMONT & C. R. CO. v. VERMONT CENT. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1153.1.pdf | 2011-11-01 11:17 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1153.2.html | 2013-12-16 13:11 | 19K | VERMONT v. SOCIETY FOR THE PROPAGATION OF THE GOSPEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1153.2.pdf | 2011-11-01 11:17 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1155.html | 2013-12-16 13:11 | 52K | VERMONT v. SOCIETY FOR THE PROPAGATION OF THE GOSPEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1155.pdf | 2011-11-01 11:17 | 124K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.1.html | 2013-12-16 13:11 | 1.2K | VERMONT & C. R. CO. (CODMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.2.html | 2013-12-16 13:11 | 1.2K | VERMONT & M. R. CO. (WHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.2.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.3.html | 2013-12-16 13:11 | 1.2K | VERMONT CENT. R. CO. (BROOKS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.4.html | 2013-12-16 13:11 | 1.2K | VERMONT CENT. R. CO. (VERMONT & C. R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.5.html | 2013-12-16 13:11 | 1.2K | VERMONT VAL. R. CO. (POND v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.5.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1162.6.html | 2013-12-16 13:11 | 12K | VERNARD v. HUDSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1162.6.pdf | 2011-11-01 11:17 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1164.1.html | 2013-12-16 13:11 | 1.2K | VERNON (CASSELS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1164.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1164.2.html | 2013-12-16 13:11 | 11K | VERNON v. D'WOLF. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1164.2.pdf | 2011-11-01 11:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1165.1.html | 2013-12-16 13:11 | 1.2K | VERNON (LAWRENCE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1165.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1165.2.html | 2013-12-16 13:11 | 1.2K | VERNON (OLIVER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1165.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1165.3.html | 2013-12-16 13:11 | 1.2K | VERNON COUNTY (McKEE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1165.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1165.4.html | 2013-12-16 13:11 | 1.3K | VERNON COUNTY COURT (UNITED STATES ex tel. McKEE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1165.4.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1165.5.html | 2013-12-16 13:11 | 22K | The VERONICA MADRE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1165.5.pdf | 2011-11-01 11:17 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1169.1.html | 2013-12-16 13:11 | 1.4K | The VERSAILLES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1169.1.pdf | 2011-11-01 11:17 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1169.2.html | 2013-12-16 13:11 | 1.2K | VERSAILLES, The (HENNESSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1169.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1169.3.html | 2013-12-16 13:11 | 5.3K | VERSELIUS v. VERSELIUS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1169.3.pdf | 2011-11-01 11:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1169.4.html | 2013-12-16 13:11 | 1.2K | VESSEL OWNERS' TOWING ASS'N (BOTHWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1169.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1170.1.html | 2013-12-16 13:11 | 4.8K | In re VETTERLEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1170.1.pdf | 2011-11-01 11:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1170.2.html | 2013-12-16 13:11 | 5.4K | In re VETTEELEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1170.2.pdf | 2011-11-01 11:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1171.html | 2013-12-16 13:11 | 8.7K | In re VETTERLEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1171.pdf | 2011-11-01 11:17 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1172.html | 2013-12-16 13:11 | 7.5K | In re VETTERLEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1172.pdf | 2011-11-01 11:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1173.1.html | 2013-12-16 13:11 | 1.2K | VICE (RUMFORD CHEMICAL WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1173.1.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1173.2.html | 2013-12-16 13:11 | 1.2K | VICKERS v. The DANIEL AUGUSTA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1173.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1173.3.html | 2013-12-16 13:11 | 6.1K | In re VICKERY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1173.3.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1174.1.html | 2013-12-16 13:11 | 1.2K | VICKERY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1174.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1174.2.html | 2013-12-16 13:11 | 4.6K | The VICKSBURG. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1174.2.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1174.3.html | 2013-12-16 13:11 | 11K | The VICKSBURG. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1174.3.pdf | 2011-11-01 11:17 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1176.1.html | 2013-12-16 13:11 | 1.2K | VICKSBURG, ETC., R. CO. (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1176.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1176.2.html | 2013-12-16 13:11 | 8.9K | The VICTOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1176.2.pdf | 2011-11-01 11:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1177.1.html | 2013-12-16 13:11 | 4.7K | VICTOR et al. v. CISCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1177.1.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1177.2.html | 2013-12-16 13:11 | 10K | VICTOR SEWING-MACH. CO. v. LANG-HAM et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1177.2.pdf | 2011-11-01 11:17 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.1.html | 2013-12-16 13:11 | 3.2K | VICTOR SEWING-MACH. CO. v. MINGUS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.1.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.2.html | 2013-12-16 13:11 | 1.2K | VICTORIA, The (FRENCH v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.3.html | 2013-12-16 13:11 | 1.2K | VICTORIA, The (SAUNDERS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.4.html | 2013-12-16 13:11 | 1.2K | VICTORIA, The (THORNE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.5.html | 2013-12-16 13:11 | 1.2K | VICTORIA PEREZ, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.5.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1179.6.html | 2013-12-16 13:11 | 21K | The VICTORY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1179.6.pdf | 2011-11-01 11:17 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1183.html | 2013-12-16 13:11 | 18K | The VICTORY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1183.pdf | 2011-11-01 11:17 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1185.1.html | 2013-12-16 13:11 | 1.4K | VIDAL v. PHILADELPHIA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1185.1.pdf | 2011-11-01 11:17 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1185.2.html | 2013-12-16 13:11 | 15K | VIESCA v. WYCHE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1185.2.pdf | 2011-11-01 11:17 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1187.1.html | 2013-12-16 13:11 | 1.2K | VIETOR v. CISCO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1187.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1187.2.html | 2013-12-16 13:11 | 1.3K | VIETS (PORTER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1187.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1188.1.html | 2013-12-16 13:11 | 1.2K | VIGOL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1188.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1188.2.html | 2013-12-16 13:11 | 1.2K | VIGUS, The LILIAN M. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1188.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1188.3.html | 2013-12-16 13:11 | 7.8K | In re VILA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1188.3.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1189.1.html | 2013-12-16 13:11 | 1.3K | VILAS (AKERLY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1189.1.pdf | 2011-11-01 11:17 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1189.2.html | 2013-12-16 13:11 | 1.2K | VILLATO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1189.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1189.3.html | 2013-12-16 13:11 | 9.0K | The VILLE DE PARIS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1189.3.pdf | 2011-11-01 11:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1190.html | 2013-12-16 13:11 | 20K | The VILLE DU HAVRE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1190.pdf | 2011-11-01 11:17 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1193.1.html | 2013-12-16 13:11 | 1.2K | VINACKE (REEVES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1193.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1193.2.html | 2013-12-16 13:11 | 2.2K | The VINCENNES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1193.2.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1193.3.html | 2013-12-16 13:11 | 22K | The VINCENNES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1193.3.pdf | 2011-11-01 11:17 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1197.html | 2013-12-16 13:11 | 8.0K | VINCENT et al. v. The PENELOPE., LOCKE v. The PENELOPE., [MS.] |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1197.pdf | 2011-11-01 11:17 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1198.html | 2013-12-16 13:11 | 6.8K | The VINCENZO PEROTTO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1198.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1199.1.html | 2013-12-16 13:11 | 6.1K | The VINCENZO T. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1199.1.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1199.2.html | 2013-12-16 13:11 | 1.2K | VINEY (HARTELL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1199.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1199.3.html | 2013-12-16 13:11 | 3.9K | VINING v. WOOTEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1199.3.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1200.1.html | 2013-12-16 13:11 | 1.2K | VINSENT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1200.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1200.2.html | 2013-12-16 13:11 | 106K | VINT v. KING et al. FINDLAY v. VINT et al. ALLEN v. VINT et al. SHEFFEY v. VINT et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1200.2.pdf | 2011-11-01 11:17 | 220K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1217.html | 2013-12-16 13:11 | 7.1K | In re VINTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1217.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.1.html | 2013-12-16 13:11 | 1.2K | VINTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.2.html | 2013-12-16 13:11 | 1.2K | VIOLA, The (BARTLETTE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.3.html | 2013-12-16 13:11 | 1.2K | VIOLET (SMALLWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.4.html | 2013-12-16 13:11 | 1.3K | VIOLETT v. PATTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.5.html | 2013-12-16 13:11 | 6.2K | VIOLETT v. STETTINIUS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.5.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1218.6.html | 2013-12-16 13:11 | 2.4K | VIOLETTE v. BALL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1218.6.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1219.1.html | 2013-12-16 13:11 | 3.4K | VIOLETTE v. TYLER., ENGLISH v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1219.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1219.2.html | 2013-12-16 13:11 | 18K | VIRDEN et al. v. The CAROLINE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1219.2.pdf | 2011-11-01 11:17 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1222.1.html | 2013-12-16 13:11 | 1.2K | VIRGIN, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1222.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1222.2.html | 2013-12-16 13:11 | 9.4K | The VIRGINIA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1222.2.pdf | 2011-11-01 11:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1223.1.html | 2013-12-16 13:11 | 1.3K | VIRGINIA v. RIVERS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1223.1.pdf | 2011-11-01 11:17 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1223.2.html | 2013-12-16 13:11 | 1.2K | VIRGINIA, The (ALBERTI v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1223.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1223.3.html | 2013-12-16 13:11 | 1.2K | VIRGINIA, The (BINFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1223.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1223.4.html | 2013-12-16 13:11 | 2.7K | VIRGINIA v. DULANY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1223.4.pdf | 2011-11-01 11:17 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1224.1.html | 2013-12-16 13:11 | 3.4K | VIRGINIA v. EAKIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1224.1.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1224.2.html | 2013-12-16 13:11 | 1.2K | VIRGINIA v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1224.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1224.3.html | 2013-12-16 13:11 | 3.0K | VIRGINIA v. GORDON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1224.3.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1224.4.html | 2013-12-16 13:11 | 2.3K | VIRGINIA v. HOOFF. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1224.4.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1224.5.html | 2013-12-16 13:11 | 4.4K | VIRGINIA v. HOWARD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1224.5.pdf | 2011-11-01 11:17 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1225.1.html | 2013-12-16 13:11 | 3.3K | VIRGINIA v. LEAP. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1225.1.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1225.2.html | 2013-12-16 13:11 | 1.2K | VIRGINIA v. RIVERS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1225.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1225.3.html | 2013-12-16 13:11 | 5.3K | VIRGINIA v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1225.3.pdf | 2011-11-01 11:17 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1226.1.html | 2013-12-16 13:11 | 2.5K | VIRGINIA v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1226.1.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1226.2.html | 2013-12-16 13:11 | 3.4K | VIRGINIA v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1226.2.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1226.3.html | 2013-12-16 13:11 | 1.2K | VIRGINIA v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1226.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1226.4.html | 2013-12-16 13:11 | 1.2K | VIRGINIA v. WISE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1226.4.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1227.1.html | 2013-12-16 13:11 | 3.9K | VIRGINIA v. ZIMMERMAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1227.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1227.2.html | 2013-12-16 13:11 | 7.3K | VIRGINIA v. EVANS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1227.2.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1228.1.html | 2013-12-16 13:11 | 3.2K | VIRGINIA v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1228.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1228.2.html | 2013-12-16 13:11 | 4.6K | VIRGINIA v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1228.2.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1229.1.html | 2013-12-16 13:11 | 3.5K | VIRGINIA v. WISE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1229.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1229.2.html | 2013-12-16 13:11 | 1.2K | VIRGINIA & G. H. WATER CO. (COLE SIL. MIN. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1229.2.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1229.3.html | 2013-12-16 13:11 | 10K | VIRGINIA & M. STEAM NAV. CO. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1229.3.pdf | 2011-11-01 11:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.1.html | 2013-12-16 13:11 | 1.2K | VIRGINIA & T. R. CO. (TYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.2.html | 2013-12-16 13:11 | 1.2K | VIRGINIA BONDS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.3.html | 2013-12-16 13:11 | 1.2K | VIRGINIA COAL & IRON CO. (BRANT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.4.html | 2013-12-16 13:11 | 1.2K | VIRGINIA FIRE & MARINE INS. CO. (COHN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.4.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.5.html | 2013-12-16 13:11 | 1.2K | VIRGINIA FIRE & MARINE INS. CO. (DOOLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.5.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.6.html | 2013-12-16 13:11 | 1.2K | VIRGINIA FIRE & MARINE INS. CO. (LEVY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.6.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.7.html | 2013-12-16 13:11 | 1.2K | VIRGINIA GOLD CASES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.7.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.8.html | 2013-12-16 13:11 | 1.2K | VIRGINIA PROTECTION INS. CO. (KELLY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.8.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1231.9.html | 2013-12-16 13:11 | 6.7K | The VIRGINIA RULON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1231.9.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1232.html | 2013-12-16 13:11 | 6.9K | The VIRGO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1232.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1233.html | 2013-12-16 13:11 | 7.9K | The VIRGO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1233.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1234.1.html | 2013-12-16 13:11 | 1.2K | VIRGO, The (BRENNAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1234.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1234.2.html | 2013-12-16 13:11 | 1.2K | VIVIAN, The ALICE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1234.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1234.3.html | 2013-12-16 13:11 | 3.1K | The VIVID. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1234.3.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1234.4.html | 2013-12-16 13:11 | 17K | The VIVID. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1234.4.pdf | 2011-11-01 11:17 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1236.html | 2013-12-16 13:11 | 7.2K | VOCE v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1236.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1237.html | 2013-12-16 13:11 | 3.9K | VOCKE v. YAEGER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1237.pdf | 2011-11-01 11:17 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1238.html | 2013-12-16 13:11 | 8.4K | In re VOGEL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1238.pdf | 2011-11-01 11:17 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1239.html | 2013-12-16 13:11 | 14K | In re VOGEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1239.pdf | 2011-11-01 11:17 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1241.html | 2013-12-16 13:11 | 20K | In re VOGEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1241.pdf | 2011-11-01 11:17 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1244.html | 2013-12-16 13:11 | 14K | In re VOGEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1244.pdf | 2011-11-01 11:17 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1246.html | 2013-12-16 13:11 | 19K | VOGLE v. LATHROP. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1246.pdf | 2011-11-01 11:17 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1248.html | 2013-12-16 13:11 | 26K | In re VOGLER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1248.pdf | 2011-11-01 11:17 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1252.html | 2013-12-16 13:11 | 13K | VOGLER v. SEMPLE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1252.pdf | 2011-11-01 11:17 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1254.html | 2013-12-16 13:11 | 16K | VOGLER v. SPAUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1254.pdf | 2011-11-01 11:17 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1257.html | 2013-12-16 13:11 | 11K | VOIGHT v. LEWIS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1257.pdf | 2011-11-01 11:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1258.html | 2013-12-16 13:11 | 10K | The VOLUNTEER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1258.pdf | 2011-11-01 11:17 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1260.html | 2013-12-16 13:11 | 58K | The VOLUNTEER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1260.pdf | 2011-11-01 11:17 | 132K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1268.1.html | 2013-12-16 13:11 | 1.2K | VOLUNTEER, The (ELLIOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1268.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1268.2.html | 2013-12-16 13:11 | 7.3K | The VOLUSIA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1268.2.pdf | 2011-11-01 11:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1269.1.html | 2013-12-16 13:11 | 1.2K | VOLUSIA. The (LINCOLN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1269.1.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1269.2.html | 2013-12-16 13:11 | 1.2K | VOLZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1269.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1269.3.html | 2013-12-16 13:11 | 1.3K | In re VON BECK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1269.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1269.4.html | 2013-12-16 13:11 | 1.3K | VON COTZHAUSEN v. NAZRO et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1269.4.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1269.5.html | 2013-12-16 13:11 | 17K | VON GLAHN v. VARRENNE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1269.5.pdf | 2011-11-01 11:17 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1272.1.html | 2013-12-16 13:11 | 1.3K | Ex parte VON HOVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1272.1.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1272.2.html | 2013-12-16 13:11 | 1.3K | Ex parte VON HOVEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1272.2.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1272.3.html | 2013-12-16 13:11 | 1.2K | VON LIND v. The WILLIAM SLATER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1272.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1272.4.html | 2013-12-16 13:11 | 11K | VON ROY v. BLACKMAN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1272.4.pdf | 2011-11-01 11:17 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1273.html | 2013-12-16 13:11 | 1.2K | VON SACHS (UNGEWITTER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1273.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1274.1.html | 2013-12-16 13:11 | 4.0K | VON STADE v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1274.1.pdf | 2011-11-01 11:17 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1274.2.html | 2013-12-16 13:11 | 3.2K | VOORHEES v. ALBRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1274.2.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1274.3.html | 2013-12-16 13:11 | 1.2K | VOORHEES (BANK OF THE UNITED-STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1274.3.pdf | 2011-11-01 11:17 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1274.4.html | 2013-12-16 13:11 | 1.3K | VOORHEES v. FRISBIE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1274.4.pdf | 2011-11-01 11:17 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1274.5.html | 2013-12-16 13:11 | 23K | VOORHIES v. BONESTEEL et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1274.5.pdf | 2011-11-01 11:17 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1278.1.html | 2013-12-16 13:11 | 2.6K | In re VORBECK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1278.1.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1278.2.html | 2013-12-16 13:11 | 6.0K | VORE v. FOWLER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1278.2.pdf | 2011-11-01 11:17 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1279.html | 2013-12-16 13:11 | 11K | VORHIS v. FORSYTHE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1279.pdf | 2011-11-01 11:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1280.html | 2013-12-16 13:11 | 20K | VOSE v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1280.pdf | 2011-11-01 11:17 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1283.html | 2013-12-16 13:11 | 8.9K | VOSE et al. v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1283.pdf | 2011-11-01 11:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1284.1.html | 2013-12-16 13:11 | 1.2K | VOSE (CANNON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1284.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1284.2.html | 2013-12-16 13:11 | 1.2K | VOSE (DEDEKAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1284.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1285.html | 2013-12-16 13:11 | 8.1K | VOSE et al. v. FLORIDA R. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1285.pdf | 2011-11-01 11:17 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1286.html | 2013-12-16 13:11 | 24K | VOSE v. INTERNAL IMPROVEMENT FUND. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1286.pdf | 2011-11-01 11:17 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1289.html | 2013-12-16 13:11 | 26K | VOSE et al. v. MAYO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1289.pdf | 2011-11-01 11:17 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1293.html | 2013-12-16 13:11 | 31K | VOSE v. PHILBROOK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1293.pdf | 2011-11-01 11:17 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1298.html | 2013-12-16 13:11 | 19K | VOSE v. REED et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1298.pdf | 2011-11-01 11:17 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1301.1.html | 2013-12-16 13:11 | 3.4K | VOSS v. BAKER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1301.1.pdf | 2011-11-01 11:17 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1301.2.html | 2013-12-16 13:11 | 1.2K | VOSS (BEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1301.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1301.3.html | 2013-12-16 13:11 | 1.2K | VOSS (COOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1301.3.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1301.4.html | 2013-12-16 13:11 | 1.2K | VOSS (FENWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1301.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1301.5.html | 2013-12-16 13:11 | 2.9K | VOSS v. HOWARD. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1301.5.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1302.html | 2013-12-16 13:11 | 22K | VOSS V. LUKE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1302.pdf | 2011-11-01 11:17 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.1.html | 2013-12-16 13:11 | 1.2K | VOSS (MOORE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.2.html | 2013-12-16 13:11 | 1.2K | VOSS (MORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.3.html | 2013-12-16 13:11 | 1.2K | VOSS (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.4.html | 2013-12-16 13:11 | 2.4K | VOSS v. TUEL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.4.pdf | 2011-11-01 11:17 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.5.html | 2013-12-16 13:11 | 1.2K | VOSS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.5.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.6.html | 2013-12-16 13:11 | 2.5K | VOSS v. VARDEN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.6.pdf | 2011-11-01 11:17 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.7.html | 2013-12-16 13:11 | 2.4K | VOWELL v. ALEXANDER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.7.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1305.8.html | 2013-12-16 13:11 | 4.5K | VOWELL v. BACON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1305.8.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1306.1.html | 2013-12-16 13:11 | 2.4K | VOWELL et al. v. COLUMBIAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1306.1.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1306.2.html | 2013-12-16 13:11 | 2.5K | VOWELL v. LYLES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1306.2.pdf | 2011-11-01 11:17 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1306.3.html | 2013-12-16 13:11 | 6.3K | VOWELL v. LYLES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1306.3.pdf | 2011-11-01 11:17 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1307.html | 2013-12-16 13:11 | 3.6K | VOWELL v. PATTON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1307.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1308.html | 2013-12-16 13:11 | 9.1K | VOWELL v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1308.pdf | 2011-11-01 11:17 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1309.1.html | 2013-12-16 13:11 | 5.5K | VOWELL v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1309.1.pdf | 2011-11-01 11:17 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1309.2.html | 2013-12-16 13:11 | 1.2K | VOWINKLE (HOSTETTER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1309.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1310.html | 2013-12-16 13:11 | 8.3K | The VOYAGEUR DE LA MER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1310.pdf | 2011-11-01 11:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1311.1.html | 2013-12-16 13:11 | 1.2K | VROW CHRISTINA MAGDALENA, The (JANSEN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1311.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1311.2.html | 2013-12-16 13:11 | 7.4K | VUYTON v. BRENELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1311.2.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1312.1.html | 2013-12-16 13:11 | 1.2K | WABASH AVE. BAPTIST CHURCH SOC. (O'NEIL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1312.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1312.2.html | 2013-12-16 13:11 | 1.2K | WABASH NAV. CO. (CULBERTSON v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1312.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1312.3.html | 2013-12-16 13:11 | 1.2K | WABASH RY. CO. (TYSEN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1312.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1312.4.html | 2013-12-16 13:11 | 1.2K | WACOUSTA, The (BARRETT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1312.4.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1312.5.html | 2013-12-16 13:11 | 26K | Ex parte WADDELL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1312.5.pdf | 2011-11-01 11:17 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1316.1.html | 2013-12-16 13:11 | 1.2K | WADDELL (CUSHMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1316.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1316.2.html | 2013-12-16 13:11 | 1.2K | WADDELL (MARTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1316.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1316.3.html | 2013-12-16 13:11 | 14K | WADDINGTON v. BANKS et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1316.3.pdf | 2011-11-01 11:17 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.1.html | 2013-12-16 13:11 | 1.2K | WADDINGTON (TURNER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.2.html | 2013-12-16 13:11 | 1.2K | WADDLE. (WATTS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.2.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.3.html | 2013-12-16 13:11 | 1.2K | WADE (HOWE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.3.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.4.html | 2013-12-16 13:11 | 2.0K | WADE v. MATHEWS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.4.pdf | 2011-11-01 11:17 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.5.html | 2013-12-16 13:11 | 1.2K | WADE (MATTHEWS v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.5.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.6.html | 2013-12-16 13:11 | 1.2K | WADE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.6.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1318.7.html | 2013-12-16 13:11 | 4.1K | WADE v. WADE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1318.7.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1319.html | 2013-12-16 13:11 | 12K | WADLEIGH v. VEAZIE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1319.pdf | 2011-11-01 11:17 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1320.1.html | 2013-12-16 13:11 | 1.2K | WADSWORTH (ARDREY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1320.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1320.2.html | 2013-12-16 13:11 | 20K | WADSWORTH v. TYLER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1320.2.pdf | 2011-11-01 11:17 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1323.1.html | 2013-12-16 13:11 | 1.2K | WADY (SWIFT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1323.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1323.2.html | 2013-12-16 13:11 | 4.9K | WAGENER v. MINOT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1323.2.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1324.1.html | 2013-12-16 13:11 | 1.2K | WAGER (BUSSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1324.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1324.2.html | 2013-12-16 13:11 | 1.2K | WAGER (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1324.2.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1324.3.html | 2013-12-16 13:11 | 2.7K | WAGER v. LEAR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1324.3.pdf | 2011-11-01 11:17 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1324.4.html | 2013-12-16 13:11 | 14K | WAGGENER et ux. v. CHEEK et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1324.4.pdf | 2011-11-01 11:17 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1326.1.html | 2013-12-16 13:11 | 1.4K | Ex parte WAGGONER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1326.1.pdf | 2011-11-01 11:17 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1326.2.html | 2013-12-16 13:11 | 4.2K | In re WAGGONER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1326.2.pdf | 2011-11-01 11:17 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1327.html | 2013-12-16 13:11 | 20K | In re WAGNER. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1327.pdf | 2011-11-01 11:17 | 171K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.1327_01.jpg | 2011-07-26 14:53 | 15K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.1328_01.jpg | 2011-07-26 14:53 | 55K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.1330_01.jpg | 2011-07-26 14:53 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1331.1.html | 2013-12-16 13:11 | 1.2K | WAGNER (GARDENER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1331.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1331.2.html | 2013-12-16 13:11 | 33K | WAGNER v. The JUANITA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1331.2.pdf | 2011-11-01 11:17 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1336.1.html | 2013-12-16 13:11 | 1.2K | WAGNER (U. S. v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1336.1.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1336.2.html | 2013-12-16 13:11 | 7.7K | WAGNER v. WATTS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1336.2.pdf | 2011-11-01 11:17 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1337.1.html | 2013-12-16 13:11 | 1.2K | WAGNER (WOODHULL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1337.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1337.2.html | 2013-12-16 13:11 | 4.5K | In re WAHL. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1337.2.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1337.3.html | 2013-12-16 13:11 | 1.2K | WAHL (HINE v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1337.3.pdf | 2011-11-01 11:17 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1337.4.html | 2013-12-16 13:11 | 4.7K | WAIGHT v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1337.4.pdf | 2011-11-01 11:17 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1338.1.html | 2013-12-16 13:11 | 1.2K | WAILES (McDANIEL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1338.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1338.2.html | 2013-12-16 13:11 | 6.6K | WAIT v. BULL'S HEAD BANK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1338.2.pdf | 2011-11-01 11:17 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1339.1.html | 2013-12-16 13:11 | 1.2K | WAIT (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1339.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1339.2.html | 2013-12-16 13:11 | 13K | In re WAITE et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1339.2.pdf | 2011-11-01 11:17 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1341.1.html | 2013-12-16 13:11 | 7.4K | WAITE et al. v. The ANTELOPE. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1341.1.pdf | 2011-11-01 11:17 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1342.1.html | 2013-12-16 13:11 | 1.2K | WAITE (CAMPBELL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1342.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1342.2.html | 2013-12-16 13:11 | 5.5K | WAITE v. TRIBLECOCK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1342.2.pdf | 2011-11-01 11:17 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1342.3.html | 2013-12-16 13:11 | 1.2K | WAITZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1342.3.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1342.4.html | 2013-12-16 13:11 | 3.2K | In re WAITZFELDER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1342.4.pdf | 2011-11-01 11:17 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1343.html | 2013-12-16 13:11 | 11K | In re WAITZFELDER et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1343.pdf | 2011-11-01 11:17 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1344.html | 2013-12-16 13:11 | 13K | WAKEFIELD et al. v. The GOVERNOR. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1344.pdf | 2011-11-01 11:17 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1346.1.html | 2013-12-16 13:11 | 1.2K | WAKEFIELD (LAMB v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1346.1.pdf | 2011-11-01 11:17 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1346.2.html | 2013-12-16 13:11 | 27K | WAKEFIELD v. ROSS. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1346.2.pdf | 2011-11-01 11:17 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1350.html | 2013-12-16 13:11 | 12K | WAKEMAN v. HOYT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1350.pdf | 2011-11-01 11:17 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1352.1.html | 2013-12-16 13:11 | 1.2K | WAKEMEN (TALBOT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1352.1.pdf | 2011-11-01 11:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1352.2.html | 2013-12-16 13:11 | 1.2K | WALBRUN (BABBITT v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1352.2.pdf | 2011-11-01 11:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1352.3.html | 2013-12-16 13:11 | 4.6K | WALCOTT v. ALMY et ux. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1352.3.pdf | 2011-11-01 11:18 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1352.4.html | 2013-12-16 13:11 | 2.2K | WALCOTT v. WILCUTT. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1352.4.pdf | 2011-11-01 11:18 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1353.1.html | 2013-12-16 13:11 | 1.2K | WALCOTT (SLACK v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1353.1.pdf | 2011-11-01 11:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1353.2.html | 2013-12-16 13:11 | 5.8K | In re WALD et al. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1353.2.pdf | 2011-11-01 11:18 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1353.3.html | 2013-12-16 13:11 | 1.2K | WALD (WEHL v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1353.3.pdf | 2011-11-01 11:18 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1353.4.html | 2013-12-16 13:11 | 19K | WALDEN v. CHAMBERLAIN. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1353.4.pdf | 2011-11-01 11:18 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1356.html | 2013-12-16 13:11 | 25K | The WALDO. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1356.pdf | 2011-11-01 11:18 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1360.html | 2013-12-16 13:11 | 24K | WALDORF et al. v. The NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1360.pdf | 2011-11-01 11:18 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1364.html | 2013-12-16 13:11 | 20K | WALDRON et al. v. CHASTENEY. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1364.pdf | 2011-11-01 11:18 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1367.1.html | 2013-12-16 13:11 | 1.2K | WALES (THAYER v.). |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1367.1.pdf | 2011-11-01 11:18 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.1367.2.html | 2013-12-16 13:11 | 14K | WALING v. The CHRISTINA. |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.1367.2.pdf | 2011-11-01 11:18 | 60K | |
![[IMG]](/html/icons/compressed.gif) | 0028.f.cas.1367_01.jpg | 2011-08-01 13:02 | 5.8K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.back.html | 2013-12-16 13:11 | 290K | Federal Cases, Volume 28 |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.back.pdf | 2011-10-31 13:54 | 388K | |
![[Text]](/html/icons/compressed.gif) | 0028.f.cas.front.html | 2013-12-16 13:11 | 2.9K | Federal Cases, Volume 28 |
![[ ]](/html/icons/compressed.gif) | 0028.f.cas.front.pdf | 2011-10-31 13:54 | 43K | |
|