![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.000b_01.jpg | 2011-03-07 16:28 | 1.1K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0001.html | 2013-12-16 13:13 | 23K | The PAULINE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0001.pdf | 2011-11-01 10:40 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0004.1.html | 2013-12-16 13:13 | 1.2K | PAUL SHEARMAN, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0004.1.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0004.2.html | 2013-12-16 13:13 | 2.3K | In re PAULSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0004.2.pdf | 2011-11-01 10:40 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0005.1.html | 2013-12-16 13:13 | 1.2K | PAUTUCKET HAIRCLOTH CO. (STAFFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0005.1.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0005.2.html | 2013-12-16 13:13 | 4.4K | The PAVONIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0005.2.pdf | 2011-11-01 10:40 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0005.3.html | 2013-12-16 13:13 | 30K | The PAWASHICK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0005.3.pdf | 2011-11-01 10:40 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0010.html | 2013-12-16 13:13 | 5.1K | PAWTUCKET INST. FOR SAVINGS v. BOWEN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0010.pdf | 2011-11-01 10:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0011.1.html | 2013-12-16 13:13 | 1.2K | PAXTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0011.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0011.2.html | 2013-12-16 13:13 | 1.2K | PAYEN (BRITTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0011.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0011.3.html | 2013-12-16 13:13 | 2.5K | PAYEN v. HODGSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0011.3.pdf | 2011-11-01 10:40 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0011.4.html | 2013-12-16 13:13 | 1.3K | PAYNE v. ABLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0011.4.pdf | 2011-11-01 10:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0011.5.html | 2013-12-16 13:13 | 9.5K | PAYNE v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0011.5.pdf | 2011-11-01 10:40 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0012.1.html | 2013-12-16 13:13 | 1.2K | PAYNE (BOWERBANK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0012.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0012.2.html | 2013-12-16 13:13 | 1.2K | PAYNE (COTTLE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0012.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0012.3.html | 2013-12-16 13:13 | 1.2K | PAYNE (POWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0012.3.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0012.4.html | 2013-12-16 13:13 | 27K | PAYNE et al. v. SOLOMON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0012.4.pdf | 2011-11-01 10:40 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0017.1.html | 2013-12-16 13:13 | 1.2K | PAYNE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0017.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0017.2.html | 2013-12-16 13:13 | 1.2K | PAYNTER (MURPHY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0017.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0017.3.html | 2013-12-16 13:13 | 1.2K | PAYSON (BATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0017.3.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0017.4.html | 2013-12-16 13:13 | 5.9K | PAYSON v. BROOKE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0017.4.pdf | 2011-11-01 10:40 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0018.1.html | 2013-12-16 13:13 | 4.6K | PAYSON v. COFFIN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0018.1.pdf | 2011-11-01 10:40 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0018.2.html | 2013-12-16 13:13 | 8.0K | PAYSON v. COFFIN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0018.2.pdf | 2011-11-01 10:40 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0019.html | 2013-12-16 13:13 | 16K | PAYSON et al. v. COOLIDGE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0019.pdf | 2011-11-01 10:40 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0022.html | 2013-12-16 13:13 | 12K | PAYSON v. DIETZ. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0022.pdf | 2011-11-01 10:40 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0023.html | 2013-12-16 13:13 | 21K | PAYSON v. HADDUCK et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0023.pdf | 2011-11-01 10:40 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0027.1.html | 2013-12-16 13:13 | 1.2K | PAYSON (LEITER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0027.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0027.2.html | 2013-12-16 13:13 | 1.2K | PAYSON (MICHENER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0027.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0027.3.html | 2013-12-16 13:13 | 17K | PAYSON v. STOEVER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0027.3.pdf | 2011-11-01 10:40 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0029.1.html | 2013-12-16 13:13 | 1.2K | PAYSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0029.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0029.2.html | 2013-12-16 13:13 | 26K | PAYSON v. WITHERS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0029.2.pdf | 2011-11-01 10:40 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0033.html | 2013-12-16 13:13 | 8.8K | The P. C. SCHULTZ. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0033.pdf | 2011-11-01 10:40 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0035.html | 2013-12-16 13:13 | 20K | In re PEABODY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0035.pdf | 2011-11-01 10:40 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0038.html | 2013-12-16 13:13 | 7.0K | PEABODY v. DENTON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0038.pdf | 2011-11-01 10:40 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0039.1.html | 2013-12-16 13:13 | 2.8K | PEABODY v. GILBERT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0039.1.pdf | 2011-11-01 10:40 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0039.2.html | 2013-12-16 13:13 | 1.2K | PEABODY (MASON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0039.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0039.3.html | 2013-12-16 13:13 | 55K | PEABODY v. PROCEEDS OF TWENTY-EIGHT BAGS OF COTTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0039.3.pdf | 2011-11-01 10:40 | 141K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0048.1.html | 2013-12-16 13:13 | 1.3K | PEABODY v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0048.1.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0048.2.html | 2013-12-16 13:13 | 1.2K | PEABODY (VAN AMRINGE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0048.2.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0048.3.html | 2013-12-16 13:13 | 1.2K | PEACO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0048.3.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0048.4.html | 2013-12-16 13:13 | 1.2K | PEACOCK (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0048.4.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0048.5.html | 2013-12-16 13:13 | 15K | PEACON et al. v. The AMAZON, |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0048.5.pdf | 2011-11-01 10:40 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0050.1.html | 2013-12-16 13:13 | 1.2K | PEALE (PERIN & GAFF MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0050.1.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0050.2.html | 2013-12-16 13:13 | 1.3K | Case of The PEA PATCH ISLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0050.2.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0050.3.html | 2013-12-16 13:13 | 20K | In re PEARCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0050.3.pdf | 2011-11-01 10:40 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.1.html | 2013-12-16 13:13 | 1.2K | PEARCE (EICKEMEYER HAT-BLOCKING MACHINE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.1.pdf | 2011-11-01 10:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.2.html | 2013-12-16 13:13 | 1.2K | PEARCE (MULFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.2.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.3.html | 2013-12-16 13:13 | 1.2K | PEARCE (NICHOLS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.3.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.4.html | 2013-12-16 13:13 | 1.2K | PEARCE (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.4.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.5.html | 2013-12-16 13:13 | 1.2K | PEARCE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.5.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0054.6.html | 2013-12-16 13:13 | 12K | The PEARL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0054.6.pdf | 2011-11-01 10:40 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0055.1.html | 2013-12-16 13:13 | 1.4K | PEARL v. COVENTRY CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0055.1.pdf | 2011-11-01 10:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0055.2.html | 2013-12-16 13:13 | 1.2K | PEARL (ELLICOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0055.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0055.3.html | 2013-12-16 13:13 | 1.2K | PEARL. The (McKEE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0055.3.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0056.html | 2013-12-16 13:13 | 26K | PEARL et al. v. OCEAN MILLS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0056.pdf | 2011-11-01 10:40 | 93K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0057_01.jpg | 2003-04-28 19:37 | 11K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0057_02.jpg | 2003-04-28 19:37 | 6.7K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0060.1.html | 2013-12-16 13:13 | 1.2K | PEARL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0060.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0060.2.html | 2013-12-16 13:13 | 35K | PEARPOINT et al. v. GRAHAM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0060.2.pdf | 2011-11-01 10:40 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0065.html | 2013-12-16 13:13 | 5.2K | In re PEARSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0065.pdf | 2011-11-01 10:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0066.html | 2013-12-16 13:13 | 7.1K | PEARSON v. JAMISON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0066.pdf | 2011-11-01 10:40 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0067.1.html | 2013-12-16 13:13 | 1.2K | PEARSON v. The TANGIER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0067.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0067.2.html | 2013-12-16 13:13 | 1.2K | PEARSON (SPURR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0067.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0067.3.html | 2013-12-16 13:13 | 4.4K | In re PEASE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0067.3.pdf | 2011-11-01 10:40 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0068.1.html | 2013-12-16 13:13 | 6.0K | In re PEASE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0068.1.pdf | 2011-11-01 10:40 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0068.2.html | 2013-12-16 13:13 | 1.2K | PEASE (DWIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0068.2.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0068.3.html | 2013-12-16 13:13 | 7.6K | PEASE v. McCLELLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0068.3.pdf | 2011-11-01 10:40 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0069.html | 2013-12-16 13:13 | 10K | PEASE v. The NAPOLEON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0069.pdf | 2011-11-01 10:40 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.1.html | 2013-12-16 13:13 | 1.2K | PEASE (PECK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.1.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.2.html | 2013-12-16 13:13 | 1.2K | PEASLEE (ATKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.3.html | 2013-12-16 13:13 | 1.2K | PEASLEE (AUSTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.3.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.4.html | 2013-12-16 13:13 | 1.2K | PEASLEE (CLARK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.4.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.5.html | 2013-12-16 13:13 | 1.2K | PEASLEE (FLORIO v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.5.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.6.html | 2013-12-16 13:13 | 1.2K | PEASLEE (FORMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.6.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.7.html | 2013-12-16 13:13 | 1.2K | PEASLEE (FOSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.7.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.8.html | 2013-12-16 13:13 | 1.2K | PEASLEE (GANT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.8.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0071.9.html | 2013-12-16 13:13 | 5.3K | PEASLEE v. HABERSTRO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0071.9.pdf | 2011-11-01 10:40 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.1.html | 2013-12-16 13:13 | 1.2K | PEASLEE (ROSS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.1.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.2.html | 2013-12-16 13:13 | 1.2K | PEASLEE (WARREN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.3.html | 2013-12-16 13:13 | 1.2K | PEASLEE (YZNAGA v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.3.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.4.html | 2013-12-16 13:13 | 1.2K | PEAY (SCHENCK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.4.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.5.html | 2013-12-16 13:13 | 1.2K | PECHOLIER (LATAPEE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.5.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.6.html | 2013-12-16 13:13 | 6.1K | Ex parte PECK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.6.pdf | 2011-11-01 10:40 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0072.7.html | 2013-12-16 13:13 | 12K | In re PECK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0072.7.pdf | 2011-11-01 10:40 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0074.html | 2013-12-16 13:13 | 10K | In re PECK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0074.pdf | 2011-11-01 10:40 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0076.1.html | 2013-12-16 13:13 | 1.3K | PECK's TRIAL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0076.1.pdf | 2011-11-01 10:40 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0076.2.html | 2013-12-16 13:13 | 1.2K | PECK (ARNOLD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0076.2.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0076.3.html | 2013-12-16 13:13 | 11K | PECK et al. v. BURNS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0076.3.pdf | 2011-11-01 10:40 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0077.1.html | 2013-12-16 13:13 | 1.2K | PECK (FLETCHER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0077.1.pdf | 2011-11-01 10:40 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0077.2.html | 2013-12-16 13:13 | 1.2K | PECK (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0077.2.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0077.3.html | 2013-12-16 13:13 | 6.1K | PECK v. LAUGHLIN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0077.3.pdf | 2011-11-01 10:40 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0078.html | 2013-12-16 13:13 | 6.0K | PECK v. MIAMI COUNTY et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0078.pdf | 2011-11-01 10:40 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0079.html | 2013-12-16 13:13 | 9.3K | PECK et ux. v. NEIL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0079.pdf | 2011-11-01 10:40 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0080.html | 2013-12-16 13:13 | 2.6K | PECK v. NEIL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0080.pdf | 2011-11-01 10:40 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0081.html | 2013-12-16 13:13 | 20K | PECK v. PEASE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0081.pdf | 2011-11-01 10:40 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0084.html | 2013-12-16 13:13 | 7.5K | PECK et al. v. SCHULTZE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0084.pdf | 2011-11-01 10:40 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0085.1.html | 2013-12-16 13:13 | 4.8K | PECK v. WILLIAMSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0085.1.pdf | 2011-11-01 10:40 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0085.2.html | 2013-12-16 13:13 | 1.2K | PECK (ZANE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0085.2.pdf | 2011-11-01 10:40 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0085.3.html | 2013-12-16 13:13 | 1.2K | PECKHAM (BARSTOW v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0085.3.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0085.4.html | 2013-12-16 13:13 | 1.2K | PECKHAM (BOUTOUR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0085.4.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0085.5.html | 2013-12-16 13:13 | 25K | PECKHAM v. BURROWS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0085.5.pdf | 2011-11-01 10:40 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0089.1.html | 2013-12-16 13:13 | 1.3K | PECKHAM v. DOYLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0089.1.pdf | 2011-11-01 10:40 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0089.2.html | 2013-12-16 13:13 | 1.2K | PECKHAM (FERGUSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0089.2.pdf | 2011-11-01 10:40 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0089.3.html | 2013-12-16 13:13 | 12K | PECKHAM et al. v. LYON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0089.3.pdf | 2011-11-01 10:40 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0091.1.html | 2013-12-16 13:13 | 1.2K | PECK, STOW & WILCOX CO. (GROSJEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0091.1.pdf | 2011-11-01 10:40 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0091.2.html | 2013-12-16 13:13 | 1.2K | PEDEE, The (MAAS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0091.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0091.3.html | 2013-12-16 13:13 | 6.3K | In re PEDERSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0091.3.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0092.1.html | 2013-12-16 13:13 | 1.2K | PEDRICK (FELLOWS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0092.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0092.2.html | 2013-12-16 13:13 | 4.9K | PEDRICK v. FISHER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0092.2.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0093.1.html | 2013-12-16 13:13 | 1.2K | PEDRICK (SHAKERLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0093.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0093.2.html | 2013-12-16 13:13 | 6.4K | PEDRO v. ALLEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0093.2.pdf | 2011-11-01 10:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0094.1.html | 2013-12-16 13:13 | 1.2K | PEDRO. The (ENGLEHART. v). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0094.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0094.2.html | 2013-12-16 13:13 | 1.2K | PEDRO, The (MALONE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0094.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0094.3.html | 2013-12-16 13:13 | 19K | In re PEEBLES., Ex parte WATKINS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0094.3.pdf | 2011-11-01 10:41 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0096.html | 2013-12-16 13:13 | 1.2K | PEEBLES (COLLINS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0096.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0097.1.html | 2013-12-16 13:13 | 6.9K | PEEK et al v. FRAME et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0097.1.pdf | 2011-11-01 10:41 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0097.2.html | 2013-12-16 13:13 | 6.9K | PEEK et al. v. FRAME et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0097.2.pdf | 2011-11-01 10:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0098.html | 2013-12-16 13:13 | 127K | PEELE et al. v. MERCHANTS INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0098.pdf | 2011-11-01 10:41 | 271K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0119.1.html | 2013-12-16 13:13 | 1.2K | PEERLESS, The (ENSIGN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0119.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0119.2.html | 2013-12-16 13:13 | 1.2K | PEESLER v. HABERSTRO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0119.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0119.3.html | 2013-12-16 13:13 | 1.2K | PEGGY, The (HERRON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0119.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0119.4.html | 2013-12-16 13:13 | 12K | PEGRAM v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0119.4.pdf | 2011-11-01 10:41 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0121.html | 2013-12-16 13:13 | 9.0K | In re PEGUES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0121.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0122.1.html | 2013-12-16 13:13 | 2.6K | PEIRCE v. REINTZEL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0122.1.pdf | 2011-11-01 10:41 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0122.2.html | 2013-12-16 13:13 | 1.2K | PEIRCE (WEBB v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0122.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0122.3.html | 2013-12-16 13:13 | 3.9K | PEIRCE v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0122.3.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0123.1.html | 2013-12-16 13:13 | 4.5K | PEIRCE et al. v. WEST. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0123.1.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0123.2.html | 2013-12-16 13:13 | 1.2K | PEIRSOLL (ELLIOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0123.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0123.3.html | 2013-12-16 13:13 | 12K | PEISCH v. DICKSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0123.3.pdf | 2011-11-01 10:41 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0125.1.html | 2013-12-16 13:13 | 1.2K | PEKIN, The (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0125.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0125.2.html | 2013-12-16 13:13 | 5.3K | PELHAM v. PACE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0125.2.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0126.1.html | 2013-12-16 13:13 | 1.2K | PELLETREAU (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0126.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0126.2.html | 2013-12-16 13:13 | 11K | In re PELTASOHN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0126.2.pdf | 2011-11-01 10:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0127.html | 2013-12-16 13:13 | 16K | PELTON et al. v. WATERS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0127.pdf | 2011-11-01 10:41 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0130.1.html | 2013-12-16 13:13 | 1.2K | PELTZ (BANK OF WASHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0130.1.pdf | 2011-11-01 10:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0130.2.html | 2013-12-16 13:13 | 4.6K | PELTZ v. CLARKE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0130.2.pdf | 2011-11-01 10:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0130.3.html | 2013-12-16 13:13 | 13K | The PENANG. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0130.3.pdf | 2011-11-01 10:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0132.html | 2013-12-16 13:13 | 11K | PENARO v. FLOURNOY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0132.pdf | 2011-11-01 10:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0134.html | 2013-12-16 13:13 | 7.9K | PENDALL v. BENCH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0134.pdf | 2011-11-01 10:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0135.html | 2013-12-16 13:13 | 25K | PENDERGAST v. BANK OF STOCKTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0135.pdf | 2011-11-01 10:41 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0139.1.html | 2013-12-16 13:13 | 1.2K | PENDERGAST (DAVIS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0139.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0139.2.html | 2013-12-16 13:13 | 1.2K | PENDERGAST (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0139.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0139.3.html | 2013-12-16 13:13 | 8.4K | PENDERGRAST v. LAMPMAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0139.3.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0140.1.html | 2013-12-16 13:13 | 1.2K | PENDLETON (BENNETT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0140.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0140.2.html | 2013-12-16 13:13 | 6.9K | PENDLETON v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0140.2.pdf | 2011-11-01 10:41 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0141.1.html | 2013-12-16 13:13 | 5.4K | PENDLETON v. EVANS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0141.1.pdf | 2011-11-01 10:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0141.2.html | 2013-12-16 13:13 | 35K | PENDLETON v. KINSLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0141.2.pdf | 2011-11-01 10:41 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0147.html | 2013-12-16 13:13 | 13K | PENDLETON et al. v. PHELPS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0147.pdf | 2011-11-01 10:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0149.1.html | 2013-12-16 13:13 | 1.2K | PENDLETON (TEN BROECK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0149.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0149.2.html | 2013-12-16 13:13 | 13K | PENDLETON v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0149.2.pdf | 2011-11-01 10:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.1.html | 2013-12-16 13:13 | 1.2K | PENDLETON (VAN HOOK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.2.html | 2013-12-16 13:13 | 1.2K | PENELOPE, The (LAMAR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.3.html | 2013-12-16 13:13 | 1.2K | PENELOPE, The (LOCKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.4.html | 2013-12-16 13:13 | 1.2K | PENELOPE, The (McQUIRK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.4.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.5.html | 2013-12-16 13:13 | 1.2K | PENELOPE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.6.html | 2013-12-16 13:13 | 1.2K | PENELOPE, The (VINCENT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.6.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.7.html | 2013-12-16 13:13 | 1.3K | PENHALLOW v. DOANE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.7.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.8.html | 2013-12-16 13:13 | 4.9K | In re PENN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.8.pdf | 2011-11-01 10:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0151.9.html | 2013-12-16 13:13 | 22K | In re PENN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0151.9.pdf | 2011-11-01 10:41 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0155.1.html | 2013-12-16 13:13 | 5.0K | In re PENN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0155.1.pdf | 2011-11-01 10:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0155.2.html | 2013-12-16 13:13 | 6.9K | In re PENN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0155.2.pdf | 2011-11-01 10:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0156.html | 2013-12-16 13:13 | 10K | PENN V. BUTLER. PENN v. PENN. BUTLER v. PENN (two cases). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0156.pdf | 2011-11-01 10:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0158.1.html | 2013-12-16 13:13 | 3.0K | PENN v. BUTLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0158.1.pdf | 2011-11-01 10:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0158.2.html | 2013-12-16 13:13 | 1.1K | PENN (CONN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0158.2.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0158.3.html | 2013-12-16 13:13 | 8.4K | PENN v. GROPE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0158.3.pdf | 2011-11-01 10:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0159.html | 2013-12-16 13:13 | 12K | PENN v. INGHAM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0159.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0161.1.html | 2013-12-16 13:13 | 2.3K | PENN v. KLINE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0161.1.pdf | 2011-11-01 10:41 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0161.2.html | 2013-12-16 13:13 | 31K | PENN v. KLYNE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0161.2.pdf | 2011-11-01 10:41 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0166.html | 2013-12-16 13:13 | 9.7K | PENN v. KLYNE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0166.pdf | 2011-11-01 10:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.1.html | 2013-12-16 13:13 | 1.3K | PENN v. KLYNE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.1.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.2.html | 2013-12-16 13:13 | 1.2K | PENN v. PENN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.2.pdf | 2011-11-01 10:41 | 20K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.3.html | 2013-12-16 13:13 | 1.2K | PENN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.4.html | 2013-12-16 13:13 | 1.2K | PENNIMAN (DE BRIMONT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.4.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.5.html | 2013-12-16 13:13 | 1.2K | PENNIMAN (WESTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.5.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.6.html | 2013-12-16 13:13 | 1.2K | PENNINGTON (COXE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.6.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0168.7.html | 2013-12-16 13:13 | 7.6K | PENNINGTON v. LOWENSTEIN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0168.7.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0169.html | 2013-12-16 13:13 | 7.9K | PENNINGTON v. SALE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0169.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0170.1.html | 2013-12-16 13:13 | 2.7K | PENNINGTON v. THORNTON., PENNINGTON v. STICKNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0170.1.pdf | 2011-11-01 10:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0170.2.html | 2013-12-16 13:13 | 1.2K | PENNINGTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0170.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0170.3.html | 2013-12-16 13:13 | 4.4K | PENNOCK v. BEALE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0170.3.pdf | 2011-11-01 10:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0171.1.html | 2013-12-16 13:13 | 1.2K | PENNOCK (COE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0171.1.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0171.2.html | 2013-12-16 13:13 | 26K | PENNOCK et al. v. DIALOGUE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0171.2.pdf | 2011-11-01 10:41 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0175.1.html | 2013-12-16 13:13 | 1.3K | PENNOCK v. GILLELAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0175.1.pdf | 2011-11-01 10:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0175.2.html | 2013-12-16 13:13 | 1.2K | PENNOCK (LONGSTRETH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0175.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0175.3.html | 2013-12-16 13:13 | 1.2K | PENNOYER (NEFF v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0175.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0175.4.html | 2013-12-16 13:13 | 9.4K | PENNOYER et al. v. SHELDEN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0175.4.pdf | 2011-11-01 10:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0176.1.html | 2013-12-16 13:13 | 2.7K | PENNS v. INGRAHAM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0176.1.pdf | 2011-11-01 10:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0176.2.html | 2013-12-16 13:13 | 1.2K | PENNS v. KLYNE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0176.2.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0176.3.html | 2013-12-16 13:13 | 14K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0176.3.pdf | 2011-11-01 10:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0178.html | 2013-12-16 13:13 | 11K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0178.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0180.html | 2013-12-16 13:13 | 16K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0180.pdf | 2011-11-01 10:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0183.1.html | 2013-12-16 13:13 | 5.8K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0183.1.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0183.2.html | 2013-12-16 13:13 | 6.0K | The PENNSYLVANIA., The A. R. GRAY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0183.2.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0184.html | 2013-12-16 13:13 | 15K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0184.pdf | 2011-11-01 10:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0186.html | 2013-12-16 13:13 | 4.7K | The PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0186.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0187.html | 2013-12-16 13:13 | 5.2K | PENNSYLVANIA v. ARTMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0187.pdf | 2011-11-01 10:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.1.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA, The (SCHMIDT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.2.html | 2013-12-16 13:13 | 1.3K | PENNSYLVANIA CANAL BOAT NOS. 68 AND 69, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.3.html | 2013-12-16 13:13 | 4.5K | PENNSYLVANIA COAL CO. v. The QUEEN VICTORIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.3.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.4.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA CO. (PIERCE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.4.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.5.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA INS. CO (CRUDER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.6.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA INS. CO. (GRAHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.6.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.7.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA MUT. LIFE INS. CO. (BIRD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.7.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0188.8.html | 2013-12-16 13:13 | 7.5K | PENNSYLVANIA R. CO. v. NEW YORK & L. B. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0188.8.pdf | 2011-11-01 10:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.1.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (DOWDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.2.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (KELSEY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.3.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (LOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.4.html | 2013-12-16 13:13 | 1.3K | PENNSYLVANIA R. CO. (LOCOMOTIVE ENGINE SAFETY TRUCK CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.4.pdf | 2011-11-01 10:41 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.5.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (SHERMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.6.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (WARNER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.6.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.7.html | 2013-12-16 13:13 | 1.2K | PENNSYLVANIA R. CO. (WRIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.7.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0189.8.html | 2013-12-16 13:13 | 14K | PENNSYLVANIA SALT MANUF'G CO. v. GUGENHEIM et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0189.8.pdf | 2011-11-01 10:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0191.html | 2013-12-16 13:13 | 6.4K | PENNSYLVANIA SALT MANFU'G CO. v. MYERS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0191.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0192.html | 2013-12-16 13:13 | 14K | PENNSYLVANIA SALT MANUF'G CO. v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0192.pdf | 2011-11-01 10:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0194.html | 2013-12-16 13:13 | 14K | PENNY v. TAYLOR. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0194.pdf | 2011-11-01 10:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.1.html | 2013-12-16 13:13 | 4.8K | PENROSE v. PENROSE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.1.pdf | 2011-11-01 10:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.2.html | 2013-12-16 13:13 | 1.2K | PENROSE FERRY BRIDGE CO. (DEVOE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.3.html | 2013-12-16 13:13 | 1.2K | PENSACOLA (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.3.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.4.html | 2013-12-16 13:13 | 1.2K | PENSACOLA (MILNER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.4.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.5.html | 2013-12-16 13:13 | 1.2K | PENSACOLA & G. R. CO. (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0197.6.html | 2013-12-16 13:13 | 9.5K | In re PENSACOLA LUMBER CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0197.6.pdf | 2011-11-01 10:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0199.html | 2013-12-16 13:13 | 12K | PENSACOLA TEL. CO. v. WESTERN UNION TEL. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0199.pdf | 2011-11-01 10:41 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0200.1.html | 2013-12-16 13:13 | 1.2K | PENT v. The CONCORDIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0200.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0200.2.html | 2013-12-16 13:13 | 28K | PENT et al. v. The OCEAN BELLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0200.2.pdf | 2011-11-01 10:41 | 81K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0205.html | 2013-12-16 13:13 | 13K | PENT et al. v. TWO THOUSAND EIGHT HUNDRED AND FIFTY DOLLARS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0205.pdf | 2011-11-01 10:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0207.1.html | 2013-12-16 13:13 | 5.6K | In re PENTLARGE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0207.1.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0207.2.html | 2013-12-16 13:13 | 10K | PENTLARGE v. BEESTON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0207.2.pdf | 2011-11-01 10:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0209.html | 2013-12-16 13:13 | 6.3K | PENTLARGE v. BEESTON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0209.pdf | 2011-11-01 10:41 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0210.1.html | 2013-12-16 13:13 | 3.2K | PENTLARGE v. NEW YORK B. & B. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0210.1.pdf | 2011-11-01 10:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0210.2.html | 2013-12-16 13:13 | 1.4K | PENTLARGE v. PENTLARGE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0210.2.pdf | 2011-11-01 10:41 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0210.3.html | 2013-12-16 13:13 | 5.0K | PENTLARGE v. PENTLARGE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0210.3.pdf | 2011-11-01 10:41 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.1.html | 2013-12-16 13:13 | 3.1K | PENTLETON v. FORBES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.1.pdf | 2011-11-01 10:41 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.2.html | 2013-12-16 13:13 | 1.2K | PENTZ (DORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.3.html | 2013-12-16 13:13 | 1.2K | PENTZ (DUGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.4.html | 2013-12-16 13:13 | 1.3K | PEOPLE v. CANNON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.4.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.5.html | 2013-12-16 13:13 | 1.3K | PEOPLE v. GRAY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.6.html | 2013-12-16 13:13 | 1.5K | PEOPLE v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.6.pdf | 2011-11-01 10:41 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.7.html | 2013-12-16 13:13 | 1.2K | PEOPLE's BANK (NATIONAL PARK BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.7.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.8.html | 2013-12-16 13:13 | 1.2K | PEOPLE's INS. CO. (ROBBINS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.8.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0211.9.html | 2013-12-16 13:13 | 6.0K | In re PEOPLE'S MAIL STEAMSHIP CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0211.9.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0212.html | 2013-12-16 13:13 | 10K | In re PEOPLE'S SAFE-DEPOSIT & SAVINGS INST. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0212.pdf | 2011-11-01 10:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0213.1.html | 2013-12-16 13:13 | 1.2K | PEORIA BRIDGE ASS'N (COLUMBUS INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0213.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0213.2.html | 2013-12-16 13:13 | 1.2K | PEORIA. P. & J. R. CO. (LABAREE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0213.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0213.3.html | 2013-12-16 13:13 | 1.2K | PEPITA. The (STETSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0213.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0213.4.html | 2013-12-16 13:13 | 16K | PEPPER v. SALINE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0213.4.pdf | 2011-11-01 10:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0216.1.html | 2013-12-16 13:13 | 1.2K | PERAGIO, The (DULANY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0216.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0216.2.html | 2013-12-16 13:13 | 1.2K | PERALTA (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0216.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0216.3.html | 2013-12-16 13:13 | 8.6K | PERDICARIES v. CHARLESTON GASLIGHT Co. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0216.3.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0217.html | 2013-12-16 13:13 | 17K | PERDICARIS v. CHARLESTON GASLIGHT CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0217.pdf | 2011-11-01 10:41 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0220.html | 2013-12-16 13:13 | 14K | In re PERDUE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0220.pdf | 2011-11-01 10:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0222.1.html | 2013-12-16 13:13 | 1.2K | PEREGO (BIRDSALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0222.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0222.2.html | 2013-12-16 13:13 | 9.8K | PEREGO et al. v. BONESTEEL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0222.2.pdf | 2011-11-01 10:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0223.html | 2013-12-16 13:13 | 8.8K | PEREGO v. BONESTEEL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0223.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0224.1.html | 2013-12-16 13:13 | 1.3K | The PEREIRE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0224.1.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0224.2.html | 2013-12-16 13:13 | 17K | The PEREIRE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0224.2.pdf | 2011-11-01 10:41 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0227.html | 2013-12-16 13:13 | 19K | PERELES v. WATERTOWN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0227.pdf | 2011-11-01 10:41 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0230.1.html | 2013-12-16 13:13 | 1.2K | PEREZ (DODGE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0230.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0230.2.html | 2013-12-16 13:13 | 1.2K | PEREZ (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0230.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0230.3.html | 2013-12-16 13:13 | 9.2K | PERIN & GAFF MANUF'G CO. et al v. PEALE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0230.3.pdf | 2011-11-01 10:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0231.1.html | 2013-12-16 13:13 | 1.2K | PERINE (WALTER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0231.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0231.2.html | 2013-12-16 13:13 | 31K | Ex parte PERKINS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0231.2.pdf | 2011-11-01 10:41 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0237.html | 2013-12-16 13:13 | 19K | In re PERKINS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0237.pdf | 2011-11-01 10:41 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0239.html | 2013-12-16 13:13 | 2.5K | PERKINS v. BECK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0239.pdf | 2011-11-01 10:41 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0240.html | 2013-12-16 13:13 | 56K | PERKINS et al. v. CURRIER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0240.pdf | 2011-11-01 10:41 | 132K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0249.1.html | 2013-12-16 13:13 | 1.2K | PERKINS (DODGE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0249.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0249.2.html | 2013-12-16 13:13 | 1.2K | PERKINS (DUNNING v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0249.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0249.3.html | 2013-12-16 13:13 | 7.5K | PERKINS v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0249.3.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0250.html | 2013-12-16 13:13 | 21K | PERKINS v. HILL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0250.pdf | 2011-11-01 10:41 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.1.html | 2013-12-16 13:13 | 3.8K | PERKINS v. INGERSOLL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.1.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.2.html | 2013-12-16 13:13 | 1.3K | PERKINS et al. v. The PROSPECT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.3.html | 2013-12-16 13:13 | 1.2K | PERKINS (RUSSELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.4.html | 2013-12-16 13:13 | 1.2K | PERKINS (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.4.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.5.html | 2013-12-16 13:13 | 1.2K | PERKINS (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.5.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0253.6.html | 2013-12-16 13:13 | 5.7K | PERKINS et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0253.6.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0254.html | 2013-12-16 13:13 | 8.9K | PERKINS v. WATERTOWN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0254.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0255.1.html | 2013-12-16 13:13 | 1.2K | PERKINS (WICKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0255.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0255.2.html | 2013-12-16 13:13 | 14K | In re PERLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0255.2.pdf | 2011-11-01 10:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0257.html | 2013-12-16 13:13 | 1.2K | PEROT (FREEMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0257.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0258.html | 2013-12-16 13:13 | 13K | PEROTS et. al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0258.pdf | 2011-11-01 10:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0259.1.html | 2013-12-16 13:13 | 1.2K | PEROTT (HALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0259.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0260.html | 2013-12-16 13:13 | 9.6K | PERRIGO et al. v. SPAULDING. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0260.pdf | 2011-11-01 10:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0261.1.html | 2013-12-16 13:13 | 1.2K | PERRILL (NORTHWESTERN MUT. LIFE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0261.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0261.2.html | 2013-12-16 13:13 | 5.7K | In re PERRIN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0261.2.pdf | 2011-11-01 10:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0262.1.html | 2013-12-16 13:13 | 4.7K | PERRIN v. EPPING. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0262.1.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0262.2.html | 2013-12-16 13:13 | 1.2K | PERRIN (WHITE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0262.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0262.3.html | 2013-12-16 13:13 | 7.0K | PERRINE v. THOMPSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0262.3.pdf | 2011-11-01 10:41 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0263.1.html | 2013-12-16 13:13 | 1.2K | PERROT (TABER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0263.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0263.2.html | 2013-12-16 13:13 | 7.6K | In re PERRY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0263.2.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0264.html | 2013-12-16 13:13 | 10K | In re PERRY et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0264.pdf | 2011-11-01 10:41 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0266.1.html | 2013-12-16 13:13 | 1.2K | PERRY v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0266.1.pdf | 2011-11-01 10:41 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0266.2.html | 2013-12-16 13:13 | 6.8K | PERRY et al. v. BARRY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0266.2.pdf | 2011-11-01 10:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0266.3.html | 2013-12-16 13:13 | 1.2K | PERRY (CARROLL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0266.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0267.1.html | 2013-12-16 13:13 | 5.6K | PERRY v. CORNELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0267.1.pdf | 2011-11-01 10:41 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0267.2.html | 2013-12-16 13:13 | 27K | PERRY v. CORNELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0267.2.pdf | 2011-11-01 10:41 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0272.html | 2013-12-16 13:13 | 8.7K | PERRY v. CORNING et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0272.pdf | 2011-11-01 10:41 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0273.html | 2013-12-16 13:13 | 28K | PERRY v. CORNING et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0273.pdf | 2011-11-01 10:41 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0277.html | 2013-12-16 13:13 | 20K | PERRY et al. v. CRAMMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0277.pdf | 2011-11-01 10:41 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0280.1.html | 2013-12-16 13:13 | 1.2K | PERRY (DETROIT STOVE WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0280.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0280.2.html | 2013-12-16 13:13 | 1.2K | PERRY (HADEN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0280.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0280.3.html | 2013-12-16 13:13 | 27K | PERRY v. LANGLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0280.3.pdf | 2011-11-01 10:41 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0284.1.html | 2013-12-16 13:13 | 1.2K | PERRY (LANGLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0284.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0284.2.html | 2013-12-16 13:13 | 1.4K | PERRY v. LITTLEFIELD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0284.2.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0285.html | 2013-12-16 13:13 | 34K | PERRY v. LITTLEFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0285.pdf | 2011-11-01 10:41 | 112K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0286_01.jpg | 2003-04-28 19:38 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0290.html | 2013-12-16 13:13 | 5.3K | PERRY v. NEWSOME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0290.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0291.html | 2013-12-16 13:13 | 24K | PERRY et al. v. PARKER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0291.pdf | 2011-11-01 10:41 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0295.1.html | 2013-12-16 13:13 | 2.1K | PERRY v. RHODES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0295.1.pdf | 2011-11-01 10:41 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0295.2.html | 2013-12-16 13:13 | 16K | PERRY et al. v. STARRETT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0295.2.pdf | 2011-11-01 10:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0297.1.html | 2013-12-16 13:13 | 1.2K | PERRY (STOVE-WORKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0297.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0297.2.html | 2013-12-16 13:13 | 1.2K | PERRY (THOMAS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0297.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0297.3.html | 2013-12-16 13:13 | 3.8K | PERRY et al. v. BANGS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0297.3.pdf | 2011-11-01 10:41 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0298.html | 2013-12-16 13:13 | 9.0K | PERRY MANUF'G CO. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0298.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0299.html | 2013-12-16 13:13 | 50K | PERRY MANUF'G CO. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0299.pdf | 2011-11-01 10:41 | 123K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0307.1.html | 2013-12-16 13:13 | 3.8K | PERSEE v. The CLARENCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0307.1.pdf | 2011-11-01 10:41 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0307.2.html | 2013-12-16 13:13 | 10K | The PERSEVERANCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0307.2.pdf | 2011-11-01 10:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0309.html | 2013-12-16 13:13 | 10K | PERU v. The NORTH AMERICA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0309.pdf | 2011-11-01 10:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0310.1.html | 2013-12-16 13:13 | 1.2K | PERUVIAN. The (WOOLLY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0310.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0310.2.html | 2013-12-16 13:13 | 11K | The PESHTIGO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0310.2.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0312.1.html | 2013-12-16 13:13 | 1.2K | PETALUMA, The (MORRISON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0312.1.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0312.2.html | 2013-12-16 13:13 | 1.2K | PETER (BANK OF THE UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0312.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0312.3.html | 2013-12-16 13:13 | 1.2K | PETER (BRECKENRIDGE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0312.3.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0312.4.html | 2013-12-16 13:13 | 6.8K | PETER et al. v. CURETON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0312.4.pdf | 2011-11-01 10:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0313.1.html | 2013-12-16 13:13 | 1.2K | PETER (DUNLOP v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0313.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0313.2.html | 2013-12-16 13:13 | 6.0K | PETER et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0313.2.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0314.1.html | 2013-12-16 13:13 | 2.4K | PETER v. SUTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0314.1.pdf | 2011-11-01 10:41 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0314.2.html | 2013-12-16 13:13 | 1.2K | PETER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0314.2.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0314.3.html | 2013-12-16 13:13 | 8.7K | The PETERHOFF. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0314.3.pdf | 2011-11-01 10:41 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0315.html | 2013-12-16 13:13 | 5.1K | The PETERHOFF. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0315.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0316.html | 2013-12-16 13:13 | 242K | The PETERHOFF. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0316.pdf | 2011-11-01 10:41 | 480K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0356.html | 2013-12-16 13:13 | 10K | The PETERHOFF. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0356.pdf | 2011-11-01 10:41 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0358.html | 2013-12-16 13:13 | 9.3K | PETERKIN v. NEW ORLEANS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0358.pdf | 2011-11-01 10:41 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0359.html | 2013-12-16 13:13 | 11K | Ex parte PETERS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0359.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0361.html | 2013-12-16 13:13 | 11K | PETERS et al. v. BOWMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0361.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0362.html | 2013-12-16 13:13 | 16K | PETERS v. BOWMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0362.pdf | 2011-11-01 10:41 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0365.html | 2013-12-16 13:13 | 6.6K | PETERS v. BRECKENRIDGE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0365.pdf | 2011-11-01 10:41 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0366.1.html | 2013-12-16 13:13 | 5.6K | PETERS v. MARTENS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0366.1.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0366.2.html | 2013-12-16 13:13 | 8.8K | PETERS et al. v. PREVOST et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0366.2.pdf | 2011-11-01 10:41 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0368.html | 2013-12-16 13:13 | 14K | PETERS et al. v. ROGERS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0368.pdf | 2011-11-01 10:41 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0370.1.html | 2013-12-16 13:13 | 1.2K | PETERS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0370.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0370.2.html | 2013-12-16 13:13 | 23K | PETERS et al. v. WARREN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0370.2.pdf | 2011-11-01 10:41 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0373.html | 2013-12-16 13:13 | 35K | PETERS et al. v. WARREN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0373.pdf | 2011-11-01 10:41 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.1.html | 2013-12-16 13:13 | 1.2K | PETERS (WHEATON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.2.html | 2013-12-16 13:13 | 1.2K | PETERSBURG JUDGES OF ELECTION (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.2.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.3.html | 2013-12-16 13:13 | 1.2K | PETERSBURG R. CO. (ATKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.3.pdf | 2011-11-01 10:41 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.4.html | 2013-12-16 13:13 | 1.2K | PETERSBURG R. CO. (KEPPEL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.4.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.5.html | 2013-12-16 13:13 | 1.2K | PETERSON (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.5.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.6.html | 2013-12-16 13:13 | 1.2K | PETERSON v. The JAVA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.6.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.7.html | 2013-12-16 13:13 | 1.2K | PETERSON (MILLICK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.7.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0379.8.html | 2013-12-16 13:13 | 11K | PETERSON v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0379.8.pdf | 2011-11-01 10:41 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0380.1.html | 2013-12-16 13:13 | 1.2K | PETERSON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0380.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0380.2.html | 2013-12-16 13:13 | 14K | PETERSON v. WATSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0380.2.pdf | 2011-11-01 10:41 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0382.1.html | 2013-12-16 13:13 | 1.2K | PETERSON (WONSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0382.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0382.2.html | 2013-12-16 13:13 | 5.1K | PETERSON et al. v. WOODEN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0382.2.pdf | 2011-11-01 10:41 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0383.1.html | 2013-12-16 13:13 | 1.3K | PETILLON v. NOBLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0383.1.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0383.2.html | 2013-12-16 13:13 | 1.3K | The PETREL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0383.2.pdf | 2011-11-01 10:41 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0383.3.html | 2013-12-16 13:13 | 6.3K | In re PETRIE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0383.3.pdf | 2011-11-01 10:41 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0384.1.html | 2013-12-16 13:13 | 2.7K | PETRIE v. PENNSYLVANIA R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0384.1.pdf | 2011-11-01 10:41 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0384.2.html | 2013-12-16 13:13 | 7.2K | PETROCOKINO v. STUART. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0384.2.pdf | 2011-11-01 10:41 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0385.1.html | 2013-12-16 13:13 | 1.2K | PETRY (FRINK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0385.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0385.2.html | 2013-12-16 13:13 | 15K | PETTERSON v. CHAPMAN et al., BROWNSON et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0385.2.pdf | 2011-11-01 10:41 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0387.1.html | 2013-12-16 13:13 | 1.2K | PETTIBONE (BABCOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0387.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0387.2.html | 2013-12-16 13:13 | 18K | PETTIBONE v. DERRINGER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0387.2.pdf | 2011-11-01 10:41 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0390.1.html | 2013-12-16 13:13 | 1.2K | PETTIBONE (HAMLIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0390.1.pdf | 2011-11-01 10:41 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0390.2.html | 2013-12-16 13:13 | 13K | PETTILON et al. v. NOBLE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0390.2.pdf | 2011-11-01 10:41 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0392.html | 2013-12-16 13:13 | 17K | PETTINGILL v. DINSMORE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0392.pdf | 2011-11-01 10:42 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0395.1.html | 2013-12-16 13:13 | 4.2K | In re PETTIS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0395.1.pdf | 2011-11-01 10:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0395.2.html | 2013-12-16 13:13 | 1.2K | PETTIS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0395.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0395.3.html | 2013-12-16 13:13 | 1.7K | Case of PETTIT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0395.3.pdf | 2011-11-01 10:42 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0395.4.html | 2013-12-16 13:13 | 1.2K | PETTIT (BEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0395.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0395.5.html | 2013-12-16 13:13 | 7.1K | PETTIT v. The CHAS. HEMJE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0395.5.pdf | 2011-11-01 10:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0396.1.html | 2013-12-16 13:13 | 1.2K | PETTITT v. The KALLISTO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0396.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0396.2.html | 2013-12-16 13:13 | 24K | PETTUS et al. v. GEORGIA RAILROAD & BANKING CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0396.2.pdf | 2011-11-01 10:42 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0400.1.html | 2013-12-16 13:13 | 1.3K | PETTY v. MERRILL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0400.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0400.2.html | 2013-12-16 13:13 | 9.5K | PETTY et al. v. MERRILL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0400.2.pdf | 2011-11-01 10:42 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0402.html | 2013-12-16 13:13 | 21K | PETTY et al. v. MERRILL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0402.pdf | 2011-11-01 10:42 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0405.1.html | 2013-12-16 13:13 | 4.5K | The PETUNIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0405.1.pdf | 2011-11-01 10:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0405.2.html | 2013-12-16 13:13 | 5.8K | In re PEVEAR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0405.2.pdf | 2011-11-01 10:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0406.html | 2013-12-16 13:13 | 3.9K | The PEVENSEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0406.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0407.1.html | 2013-12-16 13:13 | 4.1K | PEYATTE et al. v. ENGLISH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0407.1.pdf | 2011-11-01 10:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0407.2.html | 2013-12-16 13:13 | 1.2K | PEYTON (AULD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0407.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0407.3.html | 2013-12-16 13:13 | 11K | PEYTON v. BLISS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0407.3.pdf | 2011-11-01 10:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.1.html | 2013-12-16 13:13 | 2.9K | PEYTON v. BRENT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.1.pdf | 2011-11-01 10:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.2.html | 2013-12-16 13:13 | 1.2K | PEYTON (BROOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.3.html | 2013-12-16 13:13 | 1.2K | PEYTON (GARDNER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.4.html | 2013-12-16 13:13 | 1.2K | PEYTON (HUTCHINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.5.html | 2013-12-16 13:13 | 1.2K | PEYTON (NEALE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.5.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.6.html | 2013-12-16 13:13 | 1.2K | PEYTON (RICHARDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.6.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0409.7.html | 2013-12-16 13:13 | 7.3K | PEYTON v. VEITCH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0409.7.pdf | 2011-11-01 10:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0410.html | 2013-12-16 13:13 | 17K | The PEYTONA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0410.pdf | 2011-11-01 10:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0412.html | 2013-12-16 13:13 | 13K | The PEYTONA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0412.pdf | 2011-11-01 10:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0414.1.html | 2013-12-16 13:13 | 1.2K | PEYTONA, The (BROOKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0414.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0414.2.html | 2013-12-16 13:13 | 4.7K | In re PFAFF. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0414.2.pdf | 2011-11-01 10:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0415.html | 2013-12-16 13:13 | 10K | In re PFROMM et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0415.pdf | 2011-11-01 10:42 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0416.html | 2013-12-16 13:13 | 8.6K | PHARO v. SMITH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0416.pdf | 2011-11-01 10:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0418.1.html | 2013-12-16 13:13 | 4.7K | PHARO et al. v. SMITH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0418.1.pdf | 2011-11-01 10:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0418.2.html | 2013-12-16 13:13 | 33K | The PHEBE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0418.2.pdf | 2011-11-01 10:42 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0424.html | 2013-12-16 13:13 | 19K | The PHEBE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0424.pdf | 2011-11-01 10:42 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0426.html | 2013-12-16 13:13 | 13K | The PHEBE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0426.pdf | 2011-11-01 10:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0428.html | 2013-12-16 13:13 | 3.7K | PHELAN v. The ALVARADO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0428.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0429.html | 2013-12-16 13:13 | 29K | PHELAN v. HAZARD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0429.pdf | 2011-11-01 10:42 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0433.html | 2013-12-16 13:13 | 12K | PHELAN v. IRON MOUNTAIN BANK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0433.pdf | 2011-11-01 10:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0435.1.html | 2013-12-16 13:13 | 1.2K | PHELAN (KELLY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0435.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0435.2.html | 2013-12-16 13:13 | 9.0K | In re PHELPS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0435.2.pdf | 2011-11-01 10:42 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0436.html | 2013-12-16 13:13 | 15K | In re PHELPS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0436.pdf | 2011-11-01 10:42 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0439.1.html | 2013-12-16 13:13 | 1.2K | PHELPS (BENTLEY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0439.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0439.2.html | 2013-12-16 13:13 | 13K | PHELPS et al. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0439.2.pdf | 2011-11-01 10:42 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0441.html | 2013-12-16 13:13 | 29K | PHELPS et al. v. The CAMILLA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0441.pdf | 2011-11-01 10:42 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0445.html | 2013-12-16 13:13 | 25K | PHELPS v. CLASEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0445.pdf | 2011-11-01 10:42 | 76K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0449.1.html | 2013-12-16 13:13 | 1.2K | PHELPS (COHEN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0449.1.pdf | 2011-11-01 10:42 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0449.2.html | 2013-12-16 13:13 | 7.8K | PHELPS v. COMSTOCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0449.2.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.1.html | 2013-12-16 13:13 | 1.2K | PHELPS (DAY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.2.html | 2013-12-16 13:13 | 1.2K | PHELPS v. DUDLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.3.html | 2013-12-16 13:13 | 1.2K | PHELPS v. FARRINGTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.4.html | 2013-12-16 13:13 | 1.2K | PHELPS (GOODYEAR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.5.html | 2013-12-16 13:13 | 1.2K | PHELPS (INDIA RUBBER COMB CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.5.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0450.6.html | 2013-12-16 13:13 | 67K | PHELPS v. LEWISTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0450.6.pdf | 2011-11-01 10:42 | 150K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0461.html | 2013-12-16 13:13 | 7.6K | PHELPS v. LOYHED., PHELPS v. FARRINGTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0461.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0462.html | 2013-12-16 13:13 | 5.2K | PHELPS v. O'BRIEN COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0462.pdf | 2011-11-01 10:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0463.1.html | 2013-12-16 13:13 | 1.2K | PHELPS (PENDLETON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0463.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0463.2.html | 2013-12-16 13:13 | 1.2K | PHELPS (RAWLE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0463.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0463.3.html | 2013-12-16 13:13 | 15K | PHELPS v. SELLICK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0463.3.pdf | 2011-11-01 10:42 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0465.html | 2013-12-16 13:13 | 3.2K | PHELPS v. STERNS., SAME v. DUDLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0465.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0466.1.html | 2013-12-16 13:13 | 1.2K | PHELPS (TEESE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0466.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0466.2.html | 2013-12-16 13:13 | 1.2K | PHELPS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0466.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0466.3.html | 2013-12-16 13:13 | 1.3K | PHELPS v. YATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0466.3.pdf | 2011-11-01 10:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0466.4.html | 2013-12-16 13:13 | 7.7K | PHELPS v. YATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0466.4.pdf | 2011-11-01 10:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0467.1.html | 2013-12-16 13:13 | 1.3K | PHENIX INS. CO. v. The FRANK G. FOWLER., CONWAY v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0467.1.pdf | 2011-11-01 10:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0467.2.html | 2013-12-16 13:13 | 1.2K | PHETTEPLACE (PARKER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0467.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0467.3.html | 2013-12-16 13:13 | 32K | PHETTIPLACE v. SAYLES et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0467.3.pdf | 2011-11-01 10:42 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0472.html | 2013-12-16 13:13 | 13K | The PHILADELPHIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0472.pdf | 2011-11-01 10:42 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.1.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA (GIRARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.2.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA (MURTAGH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.3.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA (SUMNER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.4.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA, The (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.4.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.5.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA (VIDAL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.5.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.6.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & A. STEAM NAV. CO. v. The DELAWARE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.6.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0474.7.html | 2013-12-16 13:13 | 22K | PHILADELPHIA & HAVRE DE GRACE STEAM TOW—BOAT CO. v. PHILADELPHIA, W. & B. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0474.7.pdf | 2011-11-01 10:42 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0477.html | 2013-12-16 13:13 | 6.3K | In re PHILADELPHIA & R. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0477.pdf | 2011-11-01 10:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0478.html | 2013-12-16 13:13 | 7.7K | PHILADELPHIA & R. R. CO. v. BARNARD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0478.pdf | 2011-11-01 10:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0479.html | 2013-12-16 13:13 | 28K | PHILADELPHIA & R. R. GO. v. BARNES et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0479.pdf | 2011-11-01 10:42 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0484.1.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & R. R. CO. (CAMBLOS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0484.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0484.2.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & R. R. CO. (DINSMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0484.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0484.3.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & R. R. CO. (JEHNER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0484.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0484.4.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & R. R. CO. v. The J. H. GAUTIER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0484.4.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0484.5.html | 2013-12-16 13:13 | 20K | PHILADELPHIA & R. R. CO. v. KENNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0484.5.pdf | 2011-11-01 10:42 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0487.html | 2013-12-16 13:13 | 33K | PHILADELPHIA & R. R. CO. v. MORRISON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0487.pdf | 2011-11-01 10:42 | 89K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0492.html | 2013-12-16 13:13 | 11K | PHILADELPHIA & R. R. CO. v. NORTHAM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0492.pdf | 2011-11-01 10:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.1.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA & T. R. CO. (ATKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.2.html | 2013-12-16 13:13 | 3.3K | In re PHILADELPHIA AXLE WORKS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.2.pdf | 2011-11-01 10:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.3.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA BUTCHERS' ICE CO. (SHEPPARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.4.html | 2013-12-16 13:13 | 1.3K | PHILADELPHIA FIRE EXTINGUISHER CO. (NORTHWESTERN FIRE EXTINGUISHER CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.4.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.5.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA INS. CO. (CRUDER v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.5.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.6.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA MUT. INS. CO. (HOWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.6.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.7.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA SAV. FUND (ALLEN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.7.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.8.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA STEAM NAV. CO. v. The DELAWARE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.8.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.9.html | 2013-12-16 13:13 | 1.3K | PHILADELPHIA TRUST, SAFE DEPOSIT & INS. CO. (CORN EXCH. NAT. BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.9.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.10.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA. W. & B. R. CO. (DUBOIS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.10.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.11.html | 2013-12-16 13:13 | 1.2K | PHILADELPHIA. W. & B. R. CO. (MINOT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.11.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.12.html | 2013-12-16 13:13 | 1.3K | PHILADELPHIA, W. & B. R. CO. (PHILADELPHIA & HAVRE DEV GRACE STEAM TOW-BOAT CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.12.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0494.13.html | 2013-12-16 13:13 | 20K | The PHILAH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0494.13.pdf | 2011-11-01 10:42 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0497.1.html | 2013-12-16 13:13 | 1.2K | PHILBROOK (VOSE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0497.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0497.2.html | 2013-12-16 13:13 | 1.2K | PHILIP DE PEYSTER, The (MORGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0497.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0497.3.html | 2013-12-16 13:13 | 18K | PHILIPS et al. v. CRAMMOND et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0497.3.pdf | 2011-11-01 10:42 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0500.html | 2013-12-16 13:13 | 3.2K | PHILIPS v. ERWIN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0500.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0501.html | 2013-12-16 13:13 | 22K | PHILIPS v. HATCH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0501.pdf | 2011-11-01 10:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0504.html | 2013-12-16 13:13 | 5.2K | PHILIPS v. JANNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0504.pdf | 2011-11-01 10:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0505.html | 2013-12-16 13:13 | 11K | PHILIPS v. LEDLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0505.pdf | 2011-11-01 10:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0506.1.html | 2013-12-16 13:13 | 1.2K | PHILIPS (POTE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0506.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0506.2.html | 2013-12-16 13:13 | 1.2K | PHILIPS v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0506.2.pdf | 2011-11-01 10:42 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0506.3.html | 2013-12-16 13:13 | 1.2K | PHILLIBAUM (HOLTZAPPLE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0506.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0506.4.html | 2013-12-16 13:13 | 1.2K | PHILLIP BEST BREWING CO. (GOTTFRIED v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0506.4.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0506.5.html | 2013-12-16 13:13 | 8.2K | In re PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0506.5.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0507.html | 2013-12-16 13:13 | 9.1K | In re PHILLIPS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0507.pdf | 2011-11-01 10:42 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0508.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS v. The BLANCHE PAGE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0508.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0508.2.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (BORLAND v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0508.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0508.3.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (BURRILL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0508.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0509.1.html | 2013-12-16 13:13 | 3.1K | PHILLIPS v. COMBSTOCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0509.1.pdf | 2011-11-01 10:42 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0509.2.html | 2013-12-16 13:13 | 17K | PHILLIPS et al. v. DETROIT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0509.2.pdf | 2011-11-01 10:42 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0512.html | 2013-12-16 13:13 | 17K | PHILLIPS et al. v. DETROIT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0512.pdf | 2011-11-01 10:42 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0514.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS v. HATCH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0514.1.pdf | 2011-11-01 10:42 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0514.2.html | 2013-12-16 13:13 | 16K | PHILLIPS v. INSURANCE CO. OF PENNSYLVANIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0514.2.pdf | 2011-11-01 10:42 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0517.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (KING v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0517.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0517.2.html | 2013-12-16 13:13 | 3.1K | PHILLIPS et al. v. LOWNDES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0517.2.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0517.3.html | 2013-12-16 13:13 | 24K | PHILLIPS v. M'CALL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0517.3.pdf | 2011-11-01 10:42 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0521.html | 2013-12-16 13:13 | 12K | PHILLIPS et al. v. MARINER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0521.pdf | 2011-11-01 10:42 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0522.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (MILTENBERGER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0522.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0522.2.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (PICKERING v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0522.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0522.3.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (RANDALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0522.3.pdf | 2011-11-01 10:42 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0522.4.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (RIDYARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0522.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0523.1.html | 2013-12-16 13:13 | 5.8K | PHILLIPS v. RUSSELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0523.1.pdf | 2011-11-01 10:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0523.2.html | 2013-12-16 13:13 | 21K | PHILLIPS v. The THOMAS SCATTER-GOOD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0523.2.pdf | 2011-11-01 10:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0527.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (THOMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0527.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0527.2.html | 2013-12-16 13:13 | 8.1K | PHILLIPS et al. v. The UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0527.2.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0528.1.html | 2013-12-16 13:13 | 1.3K | PHILLIPS v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0528.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0528.2.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (WILCOCKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0528.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0528.3.html | 2013-12-16 13:13 | 1.2K | PHILLIPS (WILLETT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0528.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0528.4.html | 2013-12-16 13:13 | 15K | PHILLIPS v. WILSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0528.4.pdf | 2011-11-01 10:42 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0530.1.html | 2013-12-16 13:13 | 1.2K | PHILLIPS & COLBY CONST. CO. (SEYMOUR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0530.1.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0530.2.html | 2013-12-16 13:13 | 1.2K | PHILLIPS COUNTY (BORO v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0530.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0530.3.html | 2013-12-16 13:13 | 1.2K | PHILPOT (GRUNNINGER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0530.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0530.4.html | 2013-12-16 13:13 | 3.9K | The PHOEBE v. DIGNUM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0530.4.pdf | 2011-11-01 10:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0531.html | 2013-12-16 13:13 | 9.2K | The PHOENIX. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0531.pdf | 2011-11-01 10:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.1.html | 2013-12-16 13:13 | 1.2K | PHOENIX, The (JONES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.2.html | 2013-12-16 13:13 | 1.2K | PHOENIX CHEMICAL WORKS (NELSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.3.html | 2013-12-16 13:13 | 1.2K | PHOENIX FIRE INS. CO. (CADY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.4.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (ALLISON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.5.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. v. The ATLAS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.5.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.6.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (BLAGG v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.6.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.7.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (CLEMENT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.7.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.8.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (COPELAND v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.8.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.9.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (COSTER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.9.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.10.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (DAVIDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.10.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0532.11.html | 2013-12-16 13:13 | 47K | PHOENIX INS. CO. v. ERIE & W. TRANSP. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0532.11.pdf | 2011-11-01 10:42 | 113K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.1.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (HALLET v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.2.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (HURTIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.3.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (HYDE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.4.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (IDE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.5.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.5.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.6.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (MCKIM v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.6.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.7.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (SCHOLLENBERGER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.7.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.8.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (VALE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.8.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.9.html | 2013-12-16 13:13 | 1.2K | PHOENIX INS. CO. (VAN AVERY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.9.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.10.html | 2013-12-16 13:13 | 1.2K | PHOENIX IRON. CO. (KEYSTONE BRIDGE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.10.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.11.html | 2013-12-16 13:13 | 1.2K | PHOENIX MUT. LIFE INS. CO. (BROOKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.11.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.12.html | 2013-12-16 13:13 | 1.2K | PHOENIX MUT. LIFE INS. CO. (CONVER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.12.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.13.html | 2013-12-16 13:13 | 1.2K | PHOENIX MUT. LIFE INS. CO. (SINCLAIR v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.13.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.14.html | 2013-12-16 13:13 | 1.2K | PHOENIX MUT. LIFE INS. CO. (WATTS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.14.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.15.html | 2013-12-16 13:13 | 1.2K | PHOENIX MUT. LIFE INS. CO. (WHITCOMB v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.15.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.16.html | 2013-12-16 13:13 | 1.2K | PIATT (BROWN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.16.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0540.17.html | 2013-12-16 13:13 | 35K | PIATT et al. v. McCULLOUGH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0540.17.pdf | 2011-11-01 10:42 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0546.html | 2013-12-16 13:13 | 26K | PIATT v. OLIVER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0546.pdf | 2011-11-01 10:42 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0550.html | 2013-12-16 13:13 | 110K | PIATT v. OLIVER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0550.pdf | 2011-11-01 10:42 | 240K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0568.html | 2013-12-16 13:13 | 31K | PIATT v. OLIVER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0568.pdf | 2011-11-01 10:42 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0573.html | 2013-12-16 13:13 | 45K | PIATT v. VATTIER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0573.pdf | 2011-11-01 10:42 | 112K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0580.1.html | 2013-12-16 13:13 | 1.8K | Ex parte PIC. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0580.1.pdf | 2011-11-01 10:42 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0580.2.html | 2013-12-16 13:13 | 1.2K | PIC (BEEDING v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0580.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0580.3.html | 2013-12-16 13:13 | 1.2K | PIC (MAUPIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0580.3.pdf | 2011-11-01 10:42 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0580.4.html | 2013-12-16 13:13 | 6.9K | PICKELL v. The LOPER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0580.4.pdf | 2011-11-01 10:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0581.html | 2013-12-16 13:13 | 4.3K | In re PICKERING. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0581.pdf | 2011-11-01 10:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0582.1.html | 2013-12-16 13:13 | 6.5K | PICKERING et al. v. McCULLOUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0582.1.pdf | 2011-11-01 10:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0582.2.html | 2013-12-16 13:13 | 14K | PICKERING et al. v. PHILLIPS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0582.2.pdf | 2011-11-01 10:42 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0584.1.html | 2013-12-16 13:13 | 1.2K | PICKERING (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0584.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0584.2.html | 2013-12-16 13:13 | 7.8K | PICKERSGILL et al. v. WILLIAMS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0584.2.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0586.html | 2013-12-16 13:13 | 12K | PICKERT v. The INDEPENDENCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0586.pdf | 2011-11-01 10:42 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0587.html | 2013-12-16 13:13 | 2.2K | PICKETT v. LYLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0587.pdf | 2011-11-01 10:42 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0588.html | 2013-12-16 13:13 | 20K | PICKETT v. McGAVICK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0588.pdf | 2011-11-01 10:42 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0590.1.html | 2013-12-16 13:13 | 1.2K | PICKETT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0590.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0590.2.html | 2013-12-16 13:13 | 1.2K | PICKETT'S HEIRS (LEDGERWOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0590.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0590.3.html | 2013-12-16 13:13 | 1.2K | PICO (SPARKS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0590.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0590.4.html | 2013-12-16 13:13 | 16K | PICO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0590.4.pdf | 2011-11-01 10:42 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0593.html | 2013-12-16 13:13 | 12K | PICO et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0593.pdf | 2011-11-01 10:42 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0594.html | 2013-12-16 13:13 | 7.3K | PICO v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0594.pdf | 2011-11-01 10:42 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0595.html | 2013-12-16 13:13 | 8.1K | PICO et al. v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0595.pdf | 2011-11-01 10:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0597.1.html | 2013-12-16 13:13 | 1.2K | PICO (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0597.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0597.2.html | 2013-12-16 13:13 | 10K | PICQUET v. CURTIS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0597.2.pdf | 2011-11-01 10:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0598.html | 2013-12-16 13:13 | 13K | PICQUET et al. v. SWAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0598.pdf | 2011-11-01 10:42 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0600.html | 2013-12-16 13:13 | 56K | PICQUET v. SWAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0600.pdf | 2011-11-01 10:42 | 132K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0609.html | 2013-12-16 13:13 | 50K | PICQUET v. SWAN, et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0609.pdf | 2011-11-01 10:42 | 121K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0617.html | 2013-12-16 13:13 | 25K | PICQUET v. SWAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0617.pdf | 2011-11-01 10:42 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0620.html | 2013-12-16 13:13 | 7.7K | In re PICTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0620.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0621.1.html | 2013-12-16 13:13 | 1.4K | PIECE (INSDETH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0621.1.pdf | 2011-11-01 10:42 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0621.2.html | 2013-12-16 13:13 | 1.2K | PIEDMONT, The (LARRABEE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0621.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0622.html | 2013-12-16 13:13 | 21K | PIEHL v. BALCHEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0622.pdf | 2011-11-01 10:42 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0625.html | 2013-12-16 13:13 | 15K | PIEK et al. v. CHICAGO & N. W. RY. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0625.pdf | 2011-11-01 10:42 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0627.html | 2013-12-16 13:13 | 11K | In re PIERCE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0627.pdf | 2011-11-01 10:42 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0629.html | 2013-12-16 13:13 | 9.7K | In re PIERCE et al., Ex parte WHITE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0629.pdf | 2011-11-01 10:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0630.html | 2013-12-16 13:13 | 8.6K | In re PIERCE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0630.pdf | 2011-11-01 10:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0631.html | 2013-12-16 13:13 | 17K | PIERCE et al v. The ALBERTO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0631.pdf | 2011-11-01 10:42 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0634.1.html | 2013-12-16 13:13 | 1.2K | PIERCE (BROOKLYN WHITE LEAD CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0634.1.pdf | 2011-11-01 10:42 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0634.2.html | 2013-12-16 13:13 | 7.8K | PIERCE et al. v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0634.2.pdf | 2011-11-01 10:42 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0635.1.html | 2013-12-16 13:13 | 1.2K | PIERCE (GILLET v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0635.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0635.2.html | 2013-12-16 13:13 | 1.2K | PIERCE (INDSETH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0635.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0635.3.html | 2013-12-16 13:13 | 1.2K | PIERCE (JENNINGS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0635.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0635.4.html | 2013-12-16 13:13 | 5.3K | PIERCE v. LANG. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0635.4.pdf | 2011-11-01 10:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0636.1.html | 2013-12-16 13:13 | 1.2K | PIERCE (MANDELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0636.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0636.2.html | 2013-12-16 13:13 | 1.2K | PIERCE (NATIONAL STATE BANK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0636.2.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0636.3.html | 2013-12-16 13:13 | 10K | PIERCE v. PATTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0636.3.pdf | 2011-11-01 10:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0637.html | 2013-12-16 13:13 | 4.0K | PIERCE v. PENNSYLVANIA CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0637.pdf | 2011-11-01 10:42 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0638.html | 2013-12-16 13:13 | 44K | PIERCE et al. v. STRICKLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0638.pdf | 2011-11-01 10:42 | 110K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0645.1.html | 2013-12-16 13:13 | 2.9K | PIERCE v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0645.1.pdf | 2011-11-01 10:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0645.2.html | 2013-12-16 13:13 | 5.6K | PIERCE v. TURNER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0645.2.pdf | 2011-11-01 10:42 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0645.3.html | 2013-12-16 13:13 | 1.2K | PIERCE (UNION IRON CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0645.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0646.1.html | 2013-12-16 13:13 | 4.7K | PIERCE v. The VICTORY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0646.1.pdf | 2011-11-01 10:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0646.2.html | 2013-12-16 13:13 | 1.2K | PIERCE (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0646.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0646.3.html | 2013-12-16 13:13 | 34K | PIERCE v. WINSOR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0646.3.pdf | 2011-11-01 10:42 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0652.1.html | 2013-12-16 13:13 | 6.7K | PIERCE v. WINSOR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0652.1.pdf | 2011-11-01 10:42 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0652.2.html | 2013-12-16 13:13 | 54K | PIERPONT v. FOWLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0652.2.pdf | 2011-11-01 10:42 | 131K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0661.1.html | 2013-12-16 13:13 | 1.2K | PIERREZ (MARSHALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0661.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0661.2.html | 2013-12-16 13:13 | 45K | In re PIERSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0661.2.pdf | 2011-11-01 10:42 | 109K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0668.html | 2013-12-16 13:13 | 20K | In re PIERSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0668.pdf | 2011-11-01 10:42 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0671.html | 2013-12-16 13:13 | 6.2K | PIERSON et al. v. BANK OF WASHINGTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0671.pdf | 2011-11-01 10:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0672.1.html | 2013-12-16 13:13 | 1.2K | PIERSON (BANK OF WASHINGTON v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0672.1.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0672.2.html | 2013-12-16 13:13 | 20K | PIERSON v. EAGLE SCREW CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0672.2.pdf | 2011-11-01 10:42 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0675.html | 2013-12-16 13:13 | 9.9K | PIERSON v. ELGAR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0675.pdf | 2011-11-01 10:42 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0677.html | 2013-12-16 13:13 | 28K | PIERSON et al. v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0677.pdf | 2011-11-01 10:42 | 88K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0681.html | 2013-12-16 13:13 | 4.4K | PIERSON et al. v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0681.pdf | 2011-11-01 10:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0682.html | 2013-12-16 13:13 | 9.7K | PIERSON et al. v. OGDEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0682.pdf | 2011-11-01 10:42 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0683.1.html | 2013-12-16 13:13 | 1.2K | PIERSON v. RICHARDSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0683.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0683.2.html | 2013-12-16 13:13 | 1.2K | PIGNEL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0683.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0683.3.html | 2013-12-16 13:13 | 3.8K | PIGOU v. FRENCH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0683.3.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0683.4.html | 2013-12-16 13:13 | 22K | PIKE v. POTTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0683.4.pdf | 2011-11-01 10:42 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0687.html | 2013-12-16 13:13 | 12K | PIKE v. PROVIDENCE & W. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0687.pdf | 2011-11-01 10:42 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0689.html | 2013-12-16 13:13 | 12K | PIKE et al. v. WASSELL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0689.pdf | 2011-11-01 10:42 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0690.html | 2013-12-16 13:13 | 3.1K | PILES v. PLUM et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0690.pdf | 2011-11-01 10:42 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0691.1.html | 2013-12-16 13:13 | 1.3K | The PILGRIM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0691.1.pdf | 2011-11-01 10:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0691.2.html | 2013-12-16 13:13 | 1.3K | PILLOW v. ROBERTS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0691.2.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0691.3.html | 2013-12-16 13:13 | 1.2K | PILLSBURY (WHITHED v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0691.3.pdf | 2011-11-01 10:42 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0691.4.html | 2013-12-16 13:13 | 21K | The PILOT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0691.4.pdf | 2011-11-01 10:42 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0694.1.html | 2013-12-16 13:13 | 1.4K | PILOT. The (GALLATIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0694.1.pdf | 2011-11-01 10:42 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0694.2.html | 2013-12-16 13:13 | 1.2K | PILOT NO. 2. The (FOSTER v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0694.2.pdf | 2011-11-01 10:42 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0694.3.html | 2013-12-16 13:13 | 1.2K | PINE (WEST v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0694.3.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0694.4.html | 2013-12-16 13:13 | 1.2K | PINGREE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0694.4.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0694.5.html | 2013-12-16 13:13 | 3.9K | PINNES et al. v. ELY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0694.5.pdf | 2011-11-01 10:42 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0695.1.html | 2013-12-16 13:13 | 5.3K | In re PINTARD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0695.1.pdf | 2011-11-01 10:42 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0695.2.html | 2013-12-16 13:13 | 65K | PINTARD v. GOODLOE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0695.2.pdf | 2011-11-01 10:42 | 152K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0706.1.html | 2013-12-16 13:13 | 1.2K | PINTARD (SESSIONS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0706.1.pdf | 2011-11-01 10:42 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0706.2.html | 2013-12-16 13:13 | 6.7K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0706.2.pdf | 2011-11-01 10:42 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0707.1.html | 2013-12-16 13:13 | 5.1K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0707.1.pdf | 2011-11-01 10:42 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0707.2.html | 2013-12-16 13:13 | 4.1K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0707.2.pdf | 2011-11-01 10:42 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0708.1.html | 2013-12-16 13:13 | 2.9K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0708.1.pdf | 2011-11-01 10:42 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0708.2.html | 2013-12-16 13:13 | 8.8K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0708.2.pdf | 2011-11-01 10:42 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0709.html | 2013-12-16 13:13 | 11K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0709.pdf | 2011-11-01 10:42 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0711.html | 2013-12-16 13:13 | 23K | The PIONEER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0711.pdf | 2011-11-01 10:42 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0715.html | 2013-12-16 13:13 | 10K | In re PIONEER PAPER CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0715.pdf | 2011-11-01 10:43 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0716.1.html | 2013-12-16 13:13 | 1.2K | PIONEER TOW LINE (BOWAS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0716.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0716.2.html | 2013-12-16 13:13 | 15K | PIPER v. BALDY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0716.2.pdf | 2011-11-01 10:43 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0718.html | 2013-12-16 13:13 | 24K | PIPER v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0718.pdf | 2011-11-01 10:43 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0722.html | 2013-12-16 13:13 | 13K | PIPER v. BROWN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0722.pdf | 2011-11-01 10:43 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0724.html | 2013-12-16 13:13 | 18K | PIPER v. MOON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0724.pdf | 2011-11-01 10:43 | 74K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0724_01.jpg | 2003-04-28 19:39 | 12K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0727.1.html | 2013-12-16 13:13 | 3.1K | PIPSICO v. BONTZ. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0727.1.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0727.2.html | 2013-12-16 13:13 | 1.2K | PITCAIRN (LIENOW v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0727.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0727.3.html | 2013-12-16 13:13 | 14K | In re PITMAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0727.3.pdf | 2011-11-01 10:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0729.html | 2013-12-16 13:13 | 3.7K | PITMAN v. DAVIS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0729.pdf | 2011-11-01 10:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0730.html | 2013-12-16 13:13 | 45K | PITMAN v. HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0730.pdf | 2011-11-01 10:43 | 114K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0737.html | 2013-12-16 13:13 | 47K | PITMAN v. HOOPER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0737.pdf | 2011-11-01 10:43 | 118K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0744.html | 2013-12-16 13:13 | 3.4K | PITMAN et al. v. The PARAGUAY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0744.pdf | 2011-11-01 10:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.1.html | 2013-12-16 13:13 | 1.2K | PITMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.2.html | 2013-12-16 13:13 | 3.3K | In re PITT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.2.pdf | 2011-11-01 10:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.3.html | 2013-12-16 13:13 | 1.2K | PITT (SPRAGUE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.4.html | 2013-12-16 13:13 | 1.2K | PITT, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.4.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.5.html | 2013-12-16 13:13 | 1.2K | PITTMAN (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.5.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0745.6.html | 2013-12-16 13:13 | 28K | In re PITTOCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0745.6.pdf | 2011-11-01 10:43 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0750.html | 2013-12-16 13:13 | 6.9K | In re PITTS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0750.pdf | 2011-11-01 10:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0751.html | 2013-12-16 13:13 | 21K | PITTS v. EDMONDS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0751.pdf | 2011-11-01 10:43 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0754.html | 2013-12-16 13:13 | 28K | PITTS v. HALL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0754.pdf | 2011-11-01 10:43 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0758.html | 2013-12-16 13:13 | 22K | PITTS et al. v. HALL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0758.pdf | 2011-11-01 10:43 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0762.html | 2013-12-16 13:13 | 26K | PITTS v. WEMPLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0762.pdf | 2011-11-01 10:43 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0766.html | 2013-12-16 13:13 | 11K | PITTS et al. v. WEMPLE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0766.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0767.html | 2013-12-16 13:13 | 31K | PITTS v. WHITMAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0767.pdf | 2011-11-01 10:43 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.1.html | 2013-12-16 13:13 | 1.2K | PITTSBURG (EVANS v). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.2.html | 2013-12-16 13:13 | 1.2K | PITTSBURG & C. R. CO. (BALTIMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.3.html | 2013-12-16 13:13 | 1.2K | PITTSBURG, FT. W. & C. R. CO. (KNOWLES. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.3.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.4.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH, The (KELLY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.4.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.5.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH (OEBRICKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.5.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.6.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH (OELRICH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.6.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.7.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH (ROCKMUHL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.7.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0772.8.html | 2013-12-16 13:13 | 78K | PITTSBURG, C. & ST. L. RY. CO. v. COLUMBUS, C. & I. C. RY. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0772.8.pdf | 2011-11-01 10:43 | 174K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0785.1.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH. C. & ST. L. R. CO. (HUME v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0785.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0785.2.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH, FT. W. & C. R. CO. (EMIGH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0785.2.pdf | 2011-11-01 10:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0785.3.html | 2013-12-16 13:13 | 1.2K | PITTSBURGH, FT. W. & C. R. CO. (HAIGHT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0785.3.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0785.4.html | 2013-12-16 13:13 | 7.1K | PITTSBURGH LOCOMOTIVE & CAR WORKS v. STATE NAT. BANK OF KEOKUK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0785.4.pdf | 2011-11-01 10:43 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0786.html | 2013-12-16 13:13 | 22K | The PIZARRO v. MATTHIAS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0786.pdf | 2011-11-01 10:43 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0790.html | 2013-12-16 13:13 | 8.1K | In re PLACE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0790.pdf | 2011-11-01 10:43 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0791.html | 2013-12-16 13:13 | 8.9K | In re PLACE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0791.pdf | 2011-11-01 10:43 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0792.1.html | 2013-12-16 13:13 | 1.2K | PLACE (BEERS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0792.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0792.2.html | 2013-12-16 13:13 | 38K | PLACE et al. v. The CITY OF NORWICH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0792.2.pdf | 2011-11-01 10:43 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0798.1.html | 2013-12-16 13:13 | 1.2K | PLACE (RUSSELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0798.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0798.2.html | 2013-12-16 13:13 | 1.2K | PLACE (SEDGWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0798.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0798.3.html | 2013-12-16 13:13 | 1.2K | PLAINFIELD, The (BRUSH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0798.3.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0798.4.html | 2013-12-16 13:13 | 9.8K | The PLANET. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0798.4.pdf | 2011-11-01 10:43 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0800.1.html | 2013-12-16 13:13 | 5.4K | The PLANET. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0800.1.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0800.2.html | 2013-12-16 13:13 | 20K | PLANT et al. v. GUNN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0800.2.pdf | 2011-11-01 10:43 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0803.1.html | 2013-12-16 13:13 | 1.2K | PLANT (GODY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0803.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0803.2.html | 2013-12-16 13:13 | 11K | PLANT v. HOLTZMAN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0803.2.pdf | 2011-11-01 10:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0805.html | 2013-12-16 13:13 | 13K | The PLANTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0805.pdf | 2011-11-01 10:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0807.html | 2013-12-16 13:13 | 12K | The PLANTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0807.pdf | 2011-11-01 10:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0809.1.html | 2013-12-16 13:13 | 1.2K | PLANTER, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0809.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0809.2.html | 2013-12-16 13:13 | 18K | PLANTERS BANK v. ST. JOHN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0809.2.pdf | 2011-11-01 10:43 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0812.html | 2013-12-16 13:13 | 13K | PLASTIC SLATE—ROOFING JOINT—STOCK CO. et al. v. MOORE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0812.pdf | 2011-11-01 10:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0813.html | 2013-12-16 13:13 | 11K | The PLATINA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0813.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0815.1.html | 2013-12-16 13:13 | 2.9K | In re PLATT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0815.1.pdf | 2011-11-01 10:43 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0815.2.html | 2013-12-16 13:13 | 40K | In re PLATT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0815.2.pdf | 2011-11-01 10:43 | 101K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0822.html | 2013-12-16 13:13 | 77K | PLATT v. ARCHER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0822.pdf | 2011-11-01 10:43 | 164K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0834.html | 2013-12-16 13:13 | 14K | PLATT v. ARCHER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0834.pdf | 2011-11-01 10:43 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0836.html | 2013-12-16 13:13 | 34K | PLATT v. BEACH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0836.pdf | 2011-11-01 10:43 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0841.1.html | 2013-12-16 13:13 | 1.2K | PLATT v. BOYD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0841.1.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0841.2.html | 2013-12-16 13:13 | 4.5K | PLATT v. BROACH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0841.2.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0841.3.html | 2013-12-16 13:13 | 5.6K | PLATT v. DICKENSON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0841.3.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0842.html | 2013-12-16 13:13 | 18K | PLATT v. JEROME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0842.pdf | 2011-11-01 10:43 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0845.1.html | 2013-12-16 13:13 | 1.2K | PLATT (LELAND v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0845.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0845.2.html | 2013-12-16 13:13 | 12K | PLATT v. McCLURE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0845.2.pdf | 2011-11-01 10:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0847.1.html | 2013-12-16 13:13 | 3.2K | PLATT v. MATTHEWS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0847.1.pdf | 2011-11-01 10:43 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0847.2.html | 2013-12-16 13:13 | 30K | PLATT v. PRESTON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0847.2.pdf | 2011-11-01 10:43 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0852.html | 2013-12-16 13:13 | 52K | PLATT v. STEWART et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0852.pdf | 2011-11-01 10:43 | 124K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0860.html | 2013-12-16 13:13 | 5.0K | PLATT v. STEWART et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0860.pdf | 2011-11-01 10:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0861.1.html | 2013-12-16 13:13 | 1.2K | PLATT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0861.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0861.2.html | 2013-12-16 13:13 | 9.4K | PLATT v. UNITED STATES PATENT BUTTON, RIVET, NEEDLE & MACHINE MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0861.2.pdf | 2011-11-01 10:43 | 51K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0861_01.jpg | 2003-04-28 19:40 | 5.3K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0862.1.html | 2013-12-16 13:13 | 1.2K | PLATTE CITY (BRITTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0862.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0862.2.html | 2013-12-16 13:13 | 1.2K | PLATTSBURG (JUDSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0862.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0862.3.html | 2013-12-16 13:13 | 4.5K | PLAYER v. LIPPINCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0862.3.pdf | 2011-11-01 10:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0863.html | 2013-12-16 13:13 | 10K | PLAYER v. LIPPINCOTT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0863.pdf | 2011-11-01 10:43 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0864.1.html | 2013-12-16 13:13 | 1.2K | PLEASANT HILL (POLLARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0864.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0864.2.html | 2013-12-16 13:13 | 27K | Ex parte PLEASANTS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0864.2.pdf | 2011-11-01 10:43 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0868.1.html | 2013-12-16 13:13 | 1.2K | PLEASANTS (GOYON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0868.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0868.2.html | 2013-12-16 13:13 | 1.2K | PLEASANTS (WOOD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0868.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0868.3.html | 2013-12-16 13:13 | 35K | The PLEASANT VALLEY., The SAMUEL ROTAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0868.3.pdf | 2011-11-01 10:43 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0874.1.html | 2013-12-16 13:13 | 1.2K | PLEASONTON (NEW JERSEY STEAMBOAT CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0874.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0874.2.html | 2013-12-16 13:13 | 1.2K | PLEASONTON (UNDERHILL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0874.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0874.3.html | 2013-12-16 13:13 | 4.5K | In re PLIMPTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0874.3.pdf | 2011-11-01 10:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0875.html | 2013-12-16 13:13 | 61K | Ex parte PLITT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0875.pdf | 2011-11-01 10:43 | 150K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0884.html | 2013-12-16 13:13 | 7.1K | The PLOUGHBOY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0884.pdf | 2011-11-01 10:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0885.html | 2013-12-16 13:13 | 5.0K | The PLOUGHBOY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0885.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0886.1.html | 2013-12-16 13:13 | 1.2K | PLUM (PILES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0886.1.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0886.2.html | 2013-12-16 13:13 | 16K | In re PLUMB. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0886.2.pdf | 2011-11-01 10:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0888.1.html | 2013-12-16 13:13 | 1.2K | PLUMER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0888.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0888.2.html | 2013-12-16 13:13 | 15K | PLUMMER v. CONNECTICUT MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0888.2.pdf | 2011-11-01 10:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0891.1.html | 2013-12-16 13:13 | 1.2K | PLUMMER (CONNECTICUT MUT. LIFE INS. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0891.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0891.2.html | 2013-12-16 13:13 | 1.2K | PLUMMER (GILPIN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0891.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0891.3.html | 2013-12-16 13:13 | 23K | PLUMMER v. WEBB. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0891.3.pdf | 2011-11-01 10:43 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0894.html | 2013-12-16 13:13 | 19K | PLUMMER v. WEBB et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0894.pdf | 2011-11-01 10:43 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.1.html | 2013-12-16 13:13 | 1.2K | PLUMSEL (HOLTZMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.2.html | 2013-12-16 13:13 | 1.2K | PLUMSELL (MCCLEAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.3.html | 2013-12-16 13:13 | 1.2K | PLUNKETT (WOLF v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.4.html | 2013-12-16 13:13 | 1.2K | PLUTO, The (FAGAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.4.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.5.html | 2013-12-16 13:13 | 1.2K | PLYMOUTH, The (FISHER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.5.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.6.html | 2013-12-16 13:13 | 1.2K | PLYMOUTH, The (SCOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.6.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0897.7.html | 2013-12-16 13:13 | 5.4K | The PLYMOUTH ROCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0897.7.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0898.html | 2013-12-16 13:13 | 10K | The PLYMOUTH ROCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0898.pdf | 2011-11-01 10:43 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0899.html | 2013-12-16 13:13 | 11K | The PLYMOUTH ROCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0899.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0901.1.html | 2013-12-16 13:13 | 1.2K | PLYMTON (SLOAT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0901.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0901.2.html | 2013-12-16 13:13 | 1.2K | PLYMTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0901.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0901.3.html | 2013-12-16 13:13 | 15K | POAG v. The McDONALD., CHAMBERLAIN v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0901.3.pdf | 2011-11-01 10:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0903.html | 2013-12-16 13:13 | 12K | POAG v. The McDONALD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0903.pdf | 2011-11-01 10:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0905.1.html | 2013-12-16 13:13 | 1.2K | POAGE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0905.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0905.2.html | 2013-12-16 13:13 | 1.2K | POCKLINGTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0905.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0905.3.html | 2013-12-16 13:13 | 5.6K | POE v. MOUNGER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0905.3.pdf | 2011-11-01 10:43 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0906.1.html | 2013-12-16 13:13 | 1.2K | POILLON (GRANT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0906.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0906.2.html | 2013-12-16 13:13 | 17K | POILLON v. SCHMIDT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0906.2.pdf | 2011-11-01 10:43 | 72K | |
![[IMG]](/html/icons/compressed.gif) | 0019.f.cas.0906_01.jpg | 2003-04-28 19:41 | 13K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0908.1.html | 2013-12-16 13:13 | 1.3K | POLACK v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0908.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0908.2.html | 2013-12-16 13:13 | 13K | The POLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0908.2.pdf | 2011-11-01 10:43 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0910.html | 2013-12-16 13:13 | 1.4K | POLAND v. GLYN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0910.pdf | 2011-11-01 10:43 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0911.1.html | 2013-12-16 13:13 | 5.9K | POLAND v. MARYLAND COAL CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0911.1.pdf | 2011-11-01 10:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0911.2.html | 2013-12-16 13:13 | 7.4K | POLAND v. MARYLAND COAL CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0911.2.pdf | 2011-11-01 10:43 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0912.html | 2013-12-16 13:13 | 36K | POLAND et al. v. The SPARTAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0912.pdf | 2011-11-01 10:43 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0918.html | 2013-12-16 13:13 | 7.0K | In re POLEMAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0918.pdf | 2011-11-01 10:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0919.1.html | 2013-12-16 13:13 | 1.4K | POLHAMUS (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0919.1.pdf | 2011-11-01 10:43 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0919.2.html | 2013-12-16 13:13 | 12K | POLK. v. COSGROVE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0919.2.pdf | 2011-11-01 10:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0921.html | 2013-12-16 13:13 | 101K | POLK v. HILL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0921.pdf | 2011-11-01 10:43 | 219K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0937.html | 2013-12-16 13:13 | 18K | POLK v. ROBERTSON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0937.pdf | 2011-11-01 10:43 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0940.html | 2013-12-16 13:13 | 11K | POLK v. WINDEL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0940.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0942.html | 2013-12-16 13:13 | 15K | Ex parte POLLARD., In re ELIOT FELTING MILLS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0942.pdf | 2011-11-01 10:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0944.html | 2013-12-16 13:13 | 7.8K | POLLARD v. CITY OF PLEASANT HILL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0944.pdf | 2011-11-01 10:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0945.1.html | 2013-12-16 13:13 | 1.2K | POLLOCK (BISPHAM v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0945.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0945.2.html | 2013-12-16 13:13 | 1.2K | POLLOCK (CRAIG v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0945.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0945.3.html | 2013-12-16 13:13 | 6.4K | POLLOCK et al. v. DONALDSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0945.3.pdf | 2011-11-01 10:43 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0946.html | 2013-12-16 13:13 | 16K | POLLOCK v. LAWRENCE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0946.pdf | 2011-11-01 10:43 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0948.1.html | 2013-12-16 13:13 | 1.2K | POLLOCK (NEBRASKA v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0948.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0948.2.html | 2013-12-16 13:13 | 8.1K | POLLOCK v. PRATT et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0948.2.pdf | 2011-11-01 10:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0949.1.html | 2013-12-16 13:13 | 1.2K | POLLY, The (PUTNAM v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0949.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0949.2.html | 2013-12-16 13:13 | 1.2K | POLLY. The (SKIDMORE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0949.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0950.1.html | 2013-12-16 13:13 | 1.2K | POLLY AND JANE, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0950.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0950.2.html | 2013-12-16 13:13 | 1.2K | POLLY AND KITTY, THE (RICE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0950.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0950.3.html | 2013-12-16 13:13 | 1.2K | POLLY AND NANCY, The (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0950.3.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0950.4.html | 2013-12-16 13:13 | 42K | POLYDORE v. PRINCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0950.4.pdf | 2011-11-01 10:43 | 107K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0956.html | 2013-12-16 13:13 | 4.5K | In re POMEROY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0956.pdf | 2011-11-01 10:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0957.1.html | 2013-12-16 13:13 | 1.2K | POMEROY (BELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0957.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0957.2.html | 2013-12-16 13:13 | 14K | POMEROY v. CONNISON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0957.2.pdf | 2011-11-01 10:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0959.html | 2013-12-16 13:13 | 41K | POMEROY v. MANIN et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0959.pdf | 2011-11-01 10:43 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0965.html | 2013-12-16 13:13 | 12K | POMEROY v. NEW YORK & N. H. R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0965.pdf | 2011-11-01 10:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0966.html | 2013-12-16 13:13 | 1.2K | POMEROY (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0966.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0967.1.html | 2013-12-16 13:13 | 1.2K | POMEROY (UNITED STATES v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0967.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0967.2.html | 2013-12-16 13:13 | 1.2K | POMEROY (WILKINSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0967.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0967.3.html | 2013-12-16 13:13 | 4.0K | POMERY v. SLACUM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0967.3.pdf | 2011-11-01 10:43 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0967.4.html | 2013-12-16 13:13 | 4.9K | POMROY et al. v. HARTER et al., BALDWIN et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0967.4.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0968.1.html | 2013-12-16 13:13 | 1.2K | POMPEY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0968.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0968.2.html | 2013-12-16 13:13 | 1.2K | POND (RENWICK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0968.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0968.3.html | 2013-12-16 13:13 | 1.2K | POND (STIMPSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0968.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0968.4.html | 2013-12-16 13:13 | 1.2K | POND (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0968.4.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0968.5.html | 2013-12-16 13:13 | 52K | POND et al. v. VERMONT VAL. R. CO. et al., CHASE et al. v. SAME. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0968.5.pdf | 2011-11-01 10:43 | 136K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0976.html | 2013-12-16 13:13 | 45K | POND et al. v. VERMONT VAL. R. CO. et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0976.pdf | 2011-11-01 10:43 | 109K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0983.html | 2013-12-16 13:13 | 20K | PONSFORD v. JOHNSON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0983.pdf | 2011-11-01 10:43 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0986.1.html | 2013-12-16 13:13 | 1.2K | PONSONBY (SHERRARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0986.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0986.2.html | 2013-12-16 13:13 | 5.9K | PONSOT v. MAXWELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0986.2.pdf | 2011-11-01 10:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0987.1.html | 2013-12-16 13:13 | 1.2K | PONTIAC, The (McGINNIS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0987.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0987.2.html | 2013-12-16 13:13 | 1.1K | POOKE (HUNT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0987.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0987.3.html | 2013-12-16 13:13 | 1.2K | POOL (FLEEGER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0987.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0987.4.html | 2013-12-16 13:13 | 11K | POOL v. McDONALD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0987.4.pdf | 2011-11-01 10:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0989.html | 2013-12-16 13:13 | 23K | POOL v. WELSH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0989.pdf | 2011-11-01 10:43 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.0992.html | 2013-12-16 13:13 | 95K | POOLE et al. v. NIXON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.0992.pdf | 2011-11-01 10:43 | 212K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1008.html | 2013-12-16 13:13 | 31K | POOLE et al. v. The WASHINGTON., STURGES et al. v. The MAZEPPA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1008.pdf | 2011-11-01 10:43 | 96K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1013.1.html | 2013-12-16 13:13 | 1.2K | POOR (ARCHER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1013.1.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1013.2.html | 2013-12-16 13:13 | 33K | POOR v. CARLETON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1013.2.pdf | 2011-11-01 10:43 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1018.1.html | 2013-12-16 13:13 | 1.2K | POOR (CHESAPEAKE & O. CANAL CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1018.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1018.2.html | 2013-12-16 13:13 | 1.2K | POOR (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1018.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1018.3.html | 2013-12-16 13:13 | 1.2K | POOR (WILLIAMS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1018.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1018.4.html | 2013-12-16 13:13 | 23K | POPE et al. v. BARRETT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1018.4.pdf | 2011-11-01 10:43 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1021.html | 2013-12-16 13:13 | 1.2K | POPE (DREW v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1021.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1022.html | 2013-12-16 13:13 | 92K | POPE et al. v. NICKERSON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1022.pdf | 2011-11-01 10:43 | 200K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1036.html | 2013-12-16 13:13 | 44K | POPE et al. v. The R. B. FORBES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1036.pdf | 2011-11-01 10:43 | 109K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1044.html | 2013-12-16 13:13 | 16K | POPE v. The SAPPHIRE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1044.pdf | 2011-11-01 10:43 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1046.1.html | 2013-12-16 13:13 | 1.2K | POPE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1046.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1046.2.html | 2013-12-16 13:13 | 1.2K | POPE (WHITAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1046.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1046.3.html | 2013-12-16 13:13 | 10K | POPINO v. McALLISTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1046.3.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1048.1.html | 2013-12-16 13:13 | 3.4K | POPLESTON v. KITCHEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1048.1.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1048.2.html | 2013-12-16 13:13 | 1.2K | POPPE (ZEREGA v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1048.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1048.3.html | 2013-12-16 13:13 | 28K | POPPENHUSEN v. FALKE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1048.3.pdf | 2011-11-01 10:43 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1052.html | 2013-12-16 13:13 | 21K | POPPENHUSEN v. FALKE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1052.pdf | 2011-11-01 10:43 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1056.html | 2013-12-16 13:13 | 15K | POPPENHUSEN v. NEW YORK GUTTA PERCHA COMB CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1056.pdf | 2011-11-01 10:43 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1058.html | 2013-12-16 13:13 | 8.7K | POPPENHUSEN v. NEW YORK GUTTA PERCHA COMB CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1058.pdf | 2011-11-01 10:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1059.html | 2013-12-16 13:13 | 29K | POPPENHUSEN v. NEW YORK GUTTA PEECHA COMB CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1059.pdf | 2011-11-01 10:43 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1064.html | 2013-12-16 13:13 | 22K | The PORPOISE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1064.pdf | 2011-11-01 10:43 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1067.1.html | 2013-12-16 13:13 | 1.2K | PORTAGE COUNTY (PREBLE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1067.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1067.2.html | 2013-12-16 13:13 | 1.2K | PORTE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1067.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1067.3.html | 2013-12-16 13:13 | 17K | The PORTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1067.3.pdf | 2011-11-01 10:43 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1070.html | 2013-12-16 13:13 | 12K | PORTER v. AETNA INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1070.pdf | 2011-11-01 10:43 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.1.html | 2013-12-16 13:13 | 1.2K | PORTER (CENTENNIAL CATALOGUE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.2.html | 2013-12-16 13:13 | 1.2K | PORTER v. The FRIENDSHIP. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.3.html | 2013-12-16 13:13 | 1.2K | PORTER (GEORGETOWN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.4.html | 2013-12-16 13:13 | 1.2K | PORTER (HOFFMAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.4.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.5.html | 2013-12-16 13:13 | 1.2K | PORTER (JACKSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.5.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.6.html | 2013-12-16 13:13 | 1.2K | PORTER (JASPER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.6.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.7.html | 2013-12-16 13:13 | 1.2K | PORTER (JENKINS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.7.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.8.html | 2013-12-16 13:13 | 2.4K | PORTER v. MARSTELLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.8.pdf | 2011-11-01 10:43 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.9.html | 2013-12-16 13:13 | 2.4K | PORTER v. RAPINE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.9.pdf | 2011-11-01 10:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1072.10.html | 2013-12-16 13:13 | 6.1K | PORTER et al. v. The SEA WITCH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1072.10.pdf | 2011-11-01 10:43 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1073.html | 2013-12-16 13:13 | 34K | PORTER ads. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1073.pdf | 2011-11-01 10:43 | 92K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1077.1.html | 2013-12-16 13:13 | 1.2K | PORTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1077.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1077.2.html | 2013-12-16 13:13 | 8.8K | PORTER et al. v. VIETS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1077.2.pdf | 2011-11-01 10:43 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1078.1.html | 2013-12-16 13:13 | 1.2K | PORTER (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1078.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1078.2.html | 2013-12-16 13:13 | 1.2K | PORTER (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1078.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1078.3.html | 2013-12-16 13:13 | 9.7K | PORTEVANT v. The BELLA DONNA., OWNERS OF THE LOUISA v. The BELLA DONNA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1078.3.pdf | 2011-11-01 10:43 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1080.html | 2013-12-16 13:13 | 13K | In re PORT HURON DRY DOCK CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1080.pdf | 2011-11-01 10:43 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.1.html | 2013-12-16 13:13 | 4.4K | In re PORTINGTON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.1.pdf | 2011-11-01 10:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.2.html | 2013-12-16 13:13 | 1.2K | PORTLAND (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.2.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.3.html | 2013-12-16 13:13 | 1.2K | PORTLAND (BRAGG v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.4.html | 2013-12-16 13:13 | 1.2K | PORTLAND (COULSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.4.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.5.html | 2013-12-16 13:13 | 1.2K | PORTLAND (LOWNSDALE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.5.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.6.html | 2013-12-16 13:13 | 1.2K | PORTLAND, The (LOWRY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.6.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.7.html | 2013-12-16 13:13 | 1.2K | PORTLAND (MERRILL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.7.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.8.html | 2013-12-16 13:13 | 1.2K | PORTLAND & K. R. CO. (SULLIVAN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.8.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.9.html | 2013-12-16 13:13 | 1.2K | PORTLAND MANUF'G CO. (WEBB v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.9.pdf | 2011-11-01 10:43 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1082.10.html | 2013-12-16 13:13 | 14K | The PORTSMOUTH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1082.10.pdf | 2011-11-01 10:43 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1084.1.html | 2013-12-16 13:13 | 1.2K | PORTSMOUTH (SANFORD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1084.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1084.2.html | 2013-12-16 13:13 | 15K | PORTSMOUTH SAV. BANK v. YELLOW HEAD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1084.2.pdf | 2011-11-01 10:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1087.1.html | 2013-12-16 13:13 | 5.3K | In re PORTSMOUTH SAV. FUND SOC. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1087.1.pdf | 2011-11-01 10:43 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1087.2.html | 2013-12-16 13:13 | 15K | In re PORTSMOUTH SAV. FUND SOC., Ex parte MURDAUGH et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1087.2.pdf | 2011-11-01 10:43 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1090.html | 2013-12-16 13:13 | 12K | POST v. CORBIN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1090.pdf | 2011-11-01 10:43 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1091.1.html | 2013-12-16 13:13 | 1.2K | POST v. HUGHES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1091.1.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1091.2.html | 2013-12-16 13:13 | 2.2K | POST v. ROUSE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1091.2.pdf | 2011-11-01 10:43 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1092.1.html | 2013-12-16 13:13 | 3.4K | POST et al. v. SARMIENTO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1092.1.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1092.2.html | 2013-12-16 13:13 | 15K | POST et al. v. TAYLOR COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1092.2.pdf | 2011-11-01 10:43 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1094.html | 2013-12-16 13:13 | 8.4K | The POSTBOY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1094.pdf | 2011-11-01 10:43 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1095.html | 2013-12-16 13:13 | 5.1K | POSTLEY et al. v. HIGGENS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1095.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1096.1.html | 2013-12-16 13:13 | 1.4K | POSTMASTER GENERAL v. APPLE-BACK et. al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1096.1.pdf | 2011-11-01 10:43 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1096.2.html | 2013-12-16 13:13 | 5.0K | POSTMASTER GENERAL v. CROSS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1096.2.pdf | 2011-11-01 10:43 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1097.html | 2013-12-16 13:13 | 8.3K | POSTMASTER GENERAL v. FENNELL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1097.pdf | 2011-11-01 10:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1098.html | 2013-12-16 13:13 | 9.4K | POSTMASTER GENERAL v. FURBER et al., SAME v. LATHROP et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1098.pdf | 2011-11-01 10:43 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1099.1.html | 2013-12-16 13:13 | 1.2K | POSTMASTER GENERAL v. LATHROP. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1099.1.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1099.2.html | 2013-12-16 13:13 | 1.2K | POSTMASTER GENERAL (LOCKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1099.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1099.3.html | 2013-12-16 13:13 | 28K | POSTMASTER GENERAL v. MUNGER et. al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1099.3.pdf | 2011-11-01 10:43 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1103.html | 2013-12-16 13:13 | 67K | POSTMASTER GENERAL v. NORVELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1103.pdf | 2011-11-01 10:43 | 151K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1114.html | 2013-12-16 13:13 | 41K | POSTMASTER GENERAL v. REEDER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1114.pdf | 2011-11-01 10:43 | 105K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1120.html | 2013-12-16 13:13 | 23K | POSTMASTER GENERAL v. RICE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1120.pdf | 2011-11-01 10:43 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1124.html | 2013-12-16 13:13 | 12K | POSTMASTER GENERAL v. RIDGWAY et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1124.pdf | 2011-11-01 10:43 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1126.html | 2013-12-16 13:13 | 15K | POSTMASTER GENERAL v. ROBBINS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1126.pdf | 2011-11-01 10:43 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1128.html | 2013-12-16 13:13 | 8.0K | POSTMASTER GENERAL v. USTICK et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1128.pdf | 2011-11-01 10:43 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1129.html | 2013-12-16 13:13 | 11K | POTE v. PHILIPS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1129.pdf | 2011-11-01 10:43 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1130.1.html | 2013-12-16 13:13 | 1.2K | POTOMAC, The (BAKER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1130.1.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1130.2.html | 2013-12-16 13:13 | 1.2K | POTOMAC, The (BEDELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1130.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1130.3.html | 2013-12-16 13:13 | 1.2K | POTOMAC, The (CANNON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1130.3.pdf | 2011-11-01 10:43 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1130.4.html | 2013-12-16 13:13 | 1.2K | POTOMAC BUILDING ASS'N (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1130.4.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1131.1.html | 2013-12-16 13:13 | 2.4K | POTOMAC CO. v. GILMAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1131.1.pdf | 2011-11-01 10:43 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1131.2.html | 2013-12-16 13:13 | 3.2K | POTOMAC CO. v. UNION BANK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1131.2.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1131.3.html | 2013-12-16 13:13 | 1.2K | POTOMSKA MILLS CORP. (DRAPER v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1131.3.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1131.4.html | 2013-12-16 13:13 | 1.2K | POTOWMACK CO. (BROOKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1131.4.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1131.5.html | 2013-12-16 13:13 | 5.1K | POTT et al. v. ARTHUR. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1131.5.pdf | 2011-11-01 10:43 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1132.1.html | 2013-12-16 13:13 | 1.2K | POTT (YOUNG v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1132.1.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1132.2.html | 2013-12-16 13:13 | 1.2K | POTTAWATTAMIE COUNTY (UNION PACIFIC R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1132.2.pdf | 2011-11-01 10:43 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1132.3.html | 2013-12-16 13:13 | 3.8K | In re POTTEIGER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1132.3.pdf | 2011-11-01 10:43 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1132.4.html | 2013-12-16 13:13 | 1.2K | POTTER (ATLEE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1132.4.pdf | 2011-11-01 10:43 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1132.5.html | 2013-12-16 13:13 | 35K | POTTER et al. v. BRAUNSDORF et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1132.5.pdf | 2011-11-01 10:43 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1138.html | 2013-12-16 13:13 | 29K | POTTER et al. v. COGGESHALL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1138.pdf | 2011-11-01 10:43 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1142.html | 2013-12-16 13:13 | 1.2K | POTTER (COGGESHALL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1142.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1143.html | 2013-12-16 13:13 | 9.9K | POTTER et al. v. CROWELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1143.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1144.html | 2013-12-16 13:13 | 5.6K | POTTER et al. v. DAVIS SEWING-MACH. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1144.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1145.html | 2013-12-16 13:13 | 15K | POTTER et al. v. DIXON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1145.pdf | 2011-11-01 10:44 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1147.1.html | 2013-12-16 13:13 | 5.0K | POTTER et al. v. EMPIRE SEWING MACHINE CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1147.1.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1147.2.html | 2013-12-16 13:13 | 1.2K | POTTER (EVANS v.) |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1147.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1148.html | 2013-12-16 13:13 | 42K | POTTER et al. v. FULLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1148.pdf | 2011-11-01 10:44 | 104K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1154.1.html | 2013-12-16 13:13 | 1.2K | POTTER v. GIBBS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1154.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1154.2.html | 2013-12-16 13:13 | 1.4K | POTTER v. HICKS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1154.2.pdf | 2011-11-01 10:44 | 27K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1154.3.html | 2013-12-16 13:13 | 33K | POTTER et al. v. HOLLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1154.3.pdf | 2011-11-01 10:44 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1160.html | 2013-12-16 13:13 | 38K | POTTER et al. v. HOLLAND. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1160.pdf | 2011-11-01 10:44 | 97K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1166.html | 2013-12-16 13:13 | 10K | POTTER et al. v. MACK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1166.pdf | 2011-11-01 10:44 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1167.html | 2013-12-16 13:13 | 6.6K | POTTER v. MARINE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1167.pdf | 2011-11-01 10:44 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1168.1.html | 2013-12-16 13:13 | 1.2K | POTTER v. The MONTICELLO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1168.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1168.2.html | 2013-12-16 13:13 | 9.8K | POTTER et al. v. MULLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1168.2.pdf | 2011-11-01 10:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1170.html | 2013-12-16 13:13 | 19K | POTTER et al. v. MULLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1170.pdf | 2011-11-01 10:44 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1173.html | 2013-12-16 13:13 | 60K | POTTER v. OCEAN INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1173.pdf | 2011-11-01 10:44 | 131K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1180.1.html | 2013-12-16 13:13 | 1.2K | POTTER (PIKE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1180.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1180.2.html | 2013-12-16 13:13 | 12K | POTTER v. PROVIDENCE WASHINGTON INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1180.2.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1182.1.html | 2013-12-16 13:13 | 1.2K | POTTER (RIDDLE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1182.1.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1182.2.html | 2013-12-16 13:13 | 15K | POTTER v. SCHENCK. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1182.2.pdf | 2011-11-01 10:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1184.1.html | 2013-12-16 13:13 | 1.2K | POTTER (SKOLFIELD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1184.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1184.2.html | 2013-12-16 13:13 | 1.2K | POTTER v. SLOAT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1184.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1184.3.html | 2013-12-16 13:13 | 12K | POTTER et al. v. STEVENS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1184.3.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1186.html | 2013-12-16 13:13 | 23K | POTTER v. SUFFOLK INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1186.pdf | 2011-11-01 10:44 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1190.html | 2013-12-16 13:13 | 8.3K | POTTER v. THAYER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1190.pdf | 2011-11-01 10:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1191.1.html | 2013-12-16 13:13 | 1.2K | POTTER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1191.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1191.2.html | 2013-12-16 13:13 | 1.2K | POTTER (WATT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1191.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1191.3.html | 2013-12-16 13:13 | 13K | POTTER et al. v. WHITNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1191.3.pdf | 2011-11-01 10:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1193.html | 2013-12-16 13:13 | 27K | POTTER et al. v. WILSON et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1193.pdf | 2011-11-01 10:44 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1197.html | 2013-12-16 13:13 | 9.8K | POTTER v. WRIGHT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1197.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1199.html | 2013-12-16 13:13 | 22K | Ex parte POTTS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1199.pdf | 2011-11-01 10:44 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1202.html | 2013-12-16 13:13 | 4.8K | POTTS v. FINDLAY et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1202.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1203.1.html | 2013-12-16 13:13 | 1.5K | POTTS v. GHEQUIERE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1203.1.pdf | 2011-11-01 10:44 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1203.2.html | 2013-12-16 13:13 | 14K | POTTS v. GILBERT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1203.2.pdf | 2011-11-01 10:44 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1205.1.html | 2013-12-16 13:13 | 2.4K | POTTS et al. v. SKINNER et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1205.1.pdf | 2011-11-01 10:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1205.2.html | 2013-12-16 13:13 | 1.2K | POTTS (SMITH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1205.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1205.3.html | 2013-12-16 13:13 | 3.1K | POTTS v. The WILLIAM A. BURDEN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1205.3.pdf | 2011-11-01 10:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1205.4.html | 2013-12-16 13:13 | 25K | Ex parte POULSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1205.4.pdf | 2011-11-01 10:44 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1209.1.html | 2013-12-16 13:13 | 1.3K | POUNDER v. The CAROLINE V. CASEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1209.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1209.2.html | 2013-12-16 13:13 | 1.2K | POUNDER v. PROCEEDS OF THE CAROLINE CASEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1209.2.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1209.3.html | 2013-12-16 13:13 | 1.2K | POULSON, The (McCREADY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1209.3.pdf | 2011-11-01 10:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1209.4.html | 2013-12-16 13:13 | 3.5K | POUSOT v. LAWRENCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1209.4.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1210.html | 2013-12-16 13:13 | 7.1K | POWDEN v. JOHNSON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1210.pdf | 2011-11-01 10:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1211.1.html | 2013-12-16 13:13 | 5.4K | In re POWELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1211.1.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1211.2.html | 2013-12-16 13:13 | 1.2K | POWELL (ABBOTT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1211.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1211.3.html | 2013-12-16 13:13 | 40K | POWELL et al. v. The BETSY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1211.3.pdf | 2011-11-01 10:44 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1218.1.html | 2013-12-16 13:13 | 1.2K | POWELL, The (MAXWELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1218.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1218.2.html | 2013-12-16 13:13 | 68K | POWELL et ux. v. MONSON & BRIMFIELD MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1218.2.pdf | 2011-11-01 10:44 | 154K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1228.html | 2013-12-16 13:13 | 24K | POWELL et al. v. MONSON & BRIMFIELD MANUF'G CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1228.pdf | 2011-11-01 10:44 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1232.1.html | 2013-12-16 13:13 | 1.3K | POWELL v. PAYNE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1232.1.pdf | 2011-11-01 10:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1232.2.html | 2013-12-16 13:13 | 12K | POWELL et al. v. REDFIELD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1232.2.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.1.html | 2013-12-16 13:13 | 1.2K | POWELL (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.2.html | 2013-12-16 13:13 | 2.7K | POWER v. SEMMES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.2.pdf | 2011-11-01 10:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.3.html | 2013-12-16 13:13 | 1.2K | POWER (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.4.html | 2013-12-16 13:13 | 5.1K | POWERS et al. v. BARNEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.4.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.5.html | 2013-12-16 13:13 | 1.2K | POWERS (LANSTRAAZ v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.5.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1234.6.html | 2013-12-16 13:13 | 17K | POWERS v. MORTEE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1234.6.pdf | 2011-11-01 10:44 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1237.1.html | 2013-12-16 13:13 | 1.2K | POWERS (WEBB v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1237.1.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1237.2.html | 2013-12-16 13:13 | 27K | POWHATTAN STEAMBOAT CO. v. APPOMATTOX R. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1237.2.pdf | 2011-11-01 10:44 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1241.html | 2013-12-16 13:13 | 5.7K | POWLING v. VARNUM. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1241.pdf | 2011-11-01 10:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1242.1.html | 2013-12-16 13:13 | 1.2K | POYLLON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1242.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1242.2.html | 2013-12-16 13:13 | 1.3K | The PRAIRIE BIRD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1242.2.pdf | 2011-11-01 10:44 | 26K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1242.3.html | 2013-12-16 13:13 | 1.2K | PRANG (PARTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1242.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1242.4.html | 2013-12-16 13:13 | 5.6K | In re PRANKARD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1242.4.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1243.html | 2013-12-16 13:13 | 6.8K | PRATHER v. BURGESS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1243.pdf | 2011-11-01 10:44 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1244.html | 2013-12-16 13:13 | 15K | PRATHER v. MICHIGAN MUT. LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1244.pdf | 2011-11-01 10:44 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1246.html | 2013-12-16 13:13 | 3.7K | In re PRATT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1246.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1247.html | 2013-12-16 13:13 | 8.1K | In re PRATT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1247.pdf | 2011-11-01 10:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1248.1.html | 2013-12-16 13:13 | 3.7K | In re PRATT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1248.1.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1248.2.html | 2013-12-16 13:13 | 1.2K | PRATT (BENTALOE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1248.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1248.3.html | 2013-12-16 13:13 | 10K | PRATT et al. v. BURR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1248.3.pdf | 2011-11-01 10:44 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1250.html | 2013-12-16 13:13 | 12K | PRATT et al. v. BURR et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1250.pdf | 2011-11-01 10:44 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1251.1.html | 2013-12-16 13:13 | 1.3K | PRATT v. CAMPBELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1251.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1251.2.html | 2013-12-16 13:13 | 18K | PRATT v. CURTIS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1251.2.pdf | 2011-11-01 10:44 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.1.html | 2013-12-16 13:13 | 1.2K | PRATT (FOGERTY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.2.html | 2013-12-16 13:13 | 1.2K | PRATT v. The HEROINE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.3.html | 2013-12-16 13:13 | 1.2K | PRATT v. The KENTUCKY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.4.html | 2013-12-16 13:13 | 1.2K | PRATT (LIVINGSTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.5.html | 2013-12-16 13:13 | 1.2K | PRATT (MITCHELL v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.5.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1254.6.html | 2013-12-16 13:13 | 47K | PRATT et al. v. NORTHAM et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1254.6.pdf | 2011-11-01 10:44 | 114K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1261.1.html | 2013-12-16 13:13 | 1.2K | PRATT (ORME v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1261.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1261.2.html | 2013-12-16 13:13 | 1.2K | PRATT (POLLOCK v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1261.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1262.html | 2013-12-16 13:13 | 25K | PRATT v. THOMAS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1262.pdf | 2011-11-01 10:44 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1265.1.html | 2013-12-16 13:13 | 1.2K | PRATT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1265.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1265.2.html | 2013-12-16 13:13 | 2.9K | PRATT et al. v. WILLARD et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1265.2.pdf | 2011-11-01 10:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1266.1.html | 2013-12-16 13:13 | 5.4K | PRAY et al. v. The RECOVERY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1266.1.pdf | 2011-11-01 10:44 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1266.2.html | 2013-12-16 13:13 | 1.2K | FREARY (TUNNO v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1266.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1266.3.html | 2013-12-16 13:13 | 9.2K | PREBLE v. PORTAGE COUNTY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1266.3.pdf | 2011-11-01 10:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1268.html | 2013-12-16 13:13 | 15K | PRENTICE et al. v. BETTELEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1268.pdf | 2011-11-01 10:44 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1270.1.html | 2013-12-16 13:13 | 1.2K | PRENTICE v. LANE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1270.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1270.2.html | 2013-12-16 13:13 | 1.3K | PRENTICE et al. v. NOE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1270.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1270.3.html | 2013-12-16 13:13 | 1.2K | PRENTICE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1270.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1270.4.html | 2013-12-16 13:13 | 35K | PRENTICE et al. v. ZANE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1270.4.pdf | 2011-11-01 10:44 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1276.html | 2013-12-16 13:13 | 19K | PRENTISS v. BARTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1276.pdf | 2011-11-01 10:44 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1278.html | 2013-12-16 13:13 | 9.5K | PRENTISS v. BRENNAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1278.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1280.html | 2013-12-16 13:13 | 24K | PRENTISS v. ELSWORTH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1280.pdf | 2011-11-01 10:44 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1283.1.html | 2013-12-16 13:13 | 1.3K | PRENTISS v. ELLSWORTH. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1283.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1283.2.html | 2013-12-16 13:13 | 1.2K | PRENTISS (ROSS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1283.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1283.3.html | 2013-12-16 13:13 | 1.2K | PRENTISS (ST. JOHN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1283.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1283.4.html | 2013-12-16 13:13 | 1.3K | PRESBYTERIAN CHURCH, BOARD OF FOREIGN MISSIONS OF THE, v. McMASTER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1283.4.pdf | 2011-11-01 10:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1283.5.html | 2013-12-16 13:13 | 15K | Ex parte PRESCOTT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1283.5.pdf | 2011-11-01 10:44 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1286.1.html | 2013-12-16 13:13 | 5.9K | In re PRESCOTT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1286.1.pdf | 2011-11-01 10:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1286.2.html | 2013-12-16 13:13 | 17K | PRESCOTT et al. v. NEVERS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1286.2.pdf | 2011-11-01 10:44 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.1.html | 2013-12-16 13:13 | 1.5K | PRESCOTT (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.1.pdf | 2011-11-01 10:44 | 28K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.2.html | 2013-12-16 13:13 | 1.2K | PRESIDENT, The (ZANE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.3.html | 2013-12-16 13:13 | 2.1K | PRESIDENT'S PROCLAMATION DECLARED ILLEGAL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.3.pdf | 2011-11-01 10:44 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.4.html | 2013-12-16 13:13 | 1.2K | PRESSY (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.5.html | 2013-12-16 13:13 | 2.5K | In re PRESTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.5.pdf | 2011-11-01 10:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1289.6.html | 2013-12-16 13:13 | 12K | In re PRESTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1289.6.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1291.html | 2013-12-16 13:13 | 17K | In re PRESTON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1291.pdf | 2011-11-01 10:44 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1294.1.html | 2013-12-16 13:13 | 3.7K | PRESTON v. COOPER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1294.1.pdf | 2011-11-01 10:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1294.2.html | 2013-12-16 13:13 | 1.3K | PRESTON v. GIBBONEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1294.2.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1294.3.html | 2013-12-16 13:13 | 1.2K | PRESTON (HATCH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1294.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1294.4.html | 2013-12-16 13:13 | 5.6K | PRESTON v. MCGAUGHEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1294.4.pdf | 2011-11-01 10:44 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1295.1.html | 2013-12-16 13:13 | 1.2K | PRESTON (PLATT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1295.1.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1295.2.html | 2013-12-16 13:13 | 1.3K | PRESTON v. STUART. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1295.2.pdf | 2011-11-01 10:44 | 24K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1295.3.html | 2013-12-16 13:13 | 1.2K | PRESTON (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1295.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1295.4.html | 2013-12-16 13:13 | 1.2K | PRESTON (WORTHINGTON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1295.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1295.5.html | 2013-12-16 13:13 | 8.4K | PRESTON v. YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1295.5.pdf | 2011-11-01 10:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1296.1.html | 2013-12-16 13:13 | 1.2K | PRETERRE (GOODYEAR DENTAL VULCANITE CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1296.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1296.2.html | 2013-12-16 13:13 | 1.2K | PRETTYMAN (DELAWARE R. CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1296.2.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1296.3.html | 2013-12-16 13:13 | 1.2K | PREUSS (LEE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1296.3.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1296.4.html | 2013-12-16 13:13 | 8.0K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1296.4.pdf | 2011-11-01 10:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1297.1.html | 2013-12-16 13:13 | 1.3K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1297.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1297.2.html | 2013-12-16 13:13 | 4.2K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1297.2.pdf | 2011-11-01 10:44 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1298.1.html | 2013-12-16 13:13 | 3.2K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1298.1.pdf | 2011-11-01 10:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1298.2.html | 2013-12-16 13:13 | 16K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1298.2.pdf | 2011-11-01 10:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1301.html | 2013-12-16 13:13 | 11K | PREVOST v. GORRELL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1301.pdf | 2011-11-01 10:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1302.html | 2013-12-16 13:13 | 4.1K | PREVOST v. GORRELL et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1302.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1303.html | 2013-12-16 13:13 | 39K | PREVOST v. GRATZ et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1303.pdf | 2011-11-01 10:44 | 100K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1309.html | 2013-12-16 13:13 | 14K | PREVOST v. GRATZ. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1309.pdf | 2011-11-01 10:44 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1311.html | 2013-12-16 13:13 | 8.0K | PREVOST v. HEALY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1311.pdf | 2011-11-01 10:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1312.1.html | 2013-12-16 13:13 | 1.2K | PREVOST (HEALY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1312.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1312.2.html | 2013-12-16 13:13 | 1.2K | PREVOST (PETERS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1312.2.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1312.3.html | 2013-12-16 13:13 | 1.2K | PREWETT (LABITUT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1312.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1312.4.html | 2013-12-16 13:13 | 1.2K | PREWETT (WILSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1312.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1312.5.html | 2013-12-16 13:13 | 4.1K | In re PRICE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1312.5.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1313.html | 2013-12-16 13:13 | 7.0K | In re PRICE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1313.pdf | 2011-11-01 10:44 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1314.1.html | 2013-12-16 13:13 | 3.2K | In re PRICE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1314.1.pdf | 2011-11-01 10:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1314.2.html | 2013-12-16 13:13 | 17K | In re PRICE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1314.2.pdf | 2011-11-01 10:44 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1316.html | 2013-12-16 13:13 | 3.1K | In re PRICE et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1316.pdf | 2011-11-01 10:44 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1317.1.html | 2013-12-16 13:13 | 1.2K | PRICE v. The HIGHLAND LIGHT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1317.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1317.2.html | 2013-12-16 13:13 | 1.2K | PRICE (ISAACS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1317.2.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1317.3.html | 2013-12-16 13:13 | 1.2K | PRICE (JOHNSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1317.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1317.4.html | 2013-12-16 13:13 | 9.2K | PRICE v. KELLEY. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1317.4.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1318.html | 2013-12-16 13:13 | 9.7K | PRICE et al. v. MORRIS et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1318.pdf | 2011-11-01 10:44 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1320.html | 2013-12-16 13:13 | 11K | PRICE et al. v. NICHOLAS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1320.pdf | 2011-11-01 10:44 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1321.html | 2013-12-16 13:13 | 3.5K | PRICE v. SEARS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1321.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1322.1.html | 2013-12-16 13:13 | 2.3K | PRICE et al. v. TEAL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1322.1.pdf | 2011-11-01 10:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1322.2.html | 2013-12-16 13:13 | 1.2K | PRICE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1322.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1322.3.html | 2013-12-16 13:13 | 8.8K | PRICE v. YATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1322.3.pdf | 2011-11-01 10:44 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1323.1.html | 2013-12-16 13:13 | 1.2K | PRIEST (GILBERT v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1323.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1323.2.html | 2013-12-16 13:13 | 9.2K | The PRIDE OF THE OCEAN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1323.2.pdf | 2011-11-01 10:44 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1324.1.html | 2013-12-16 13:13 | 1.2K | PRIEST (PALMER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1324.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1324.2.html | 2013-12-16 13:13 | 1.3K | PRIETO v. WELLS. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1324.2.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1324.3.html | 2013-12-16 13:13 | 36K | PRIME et al. v. BRANDON MANUF'G CO., BRANDON MANUF'G CO. v. PRIME et al. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1324.3.pdf | 2011-11-01 10:44 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1330.1.html | 2013-12-16 13:13 | 1.2K | PRIME (BRANDON MANUF'G CO. v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1330.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1330.2.html | 2013-12-16 13:13 | 2.6K | PRIME v. McREA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1330.2.pdf | 2011-11-01 10:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1330.3.html | 2013-12-16 13:13 | 2.5K | PRIME v. McREA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1330.3.pdf | 2011-11-01 10:44 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1330.4.html | 2013-12-16 13:13 | 1.2K | PRIMROSE (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1330.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.1.html | 2013-12-16 13:13 | 1.2K | The PRINCE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.1.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.2.html | 2013-12-16 13:13 | 1.2K | PRINCE (GOLDEN v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.2.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.3.html | 2013-12-16 13:13 | 1.2K | PRINCE (HOWARD v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.3.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.4.html | 2013-12-16 13:13 | 1.2K | PRINCE (POLYDORE v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.4.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.5.html | 2013-12-16 13:13 | 1.2K | PRINCE (SABBICH v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.5.pdf | 2011-11-01 10:44 | 22K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1331.6.html | 2013-12-16 13:13 | 13K | PRINCE v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1331.6.pdf | 2011-11-01 10:44 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1333.html | 2013-12-16 13:13 | 7.7K | The PRINCE ALBERT. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1333.pdf | 2011-11-01 10:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1334.1.html | 2013-12-16 13:13 | 1.2K | PRINCE ALBERT, The (BENARY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1334.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1334.2.html | 2013-12-16 13:13 | 4.2K | The PRINCE EDWARD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1334.2.pdf | 2011-11-01 10:44 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1334.3.html | 2013-12-16 13:13 | 7.4K | The PRINCE LEOPOLD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1334.3.pdf | 2011-11-01 10:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1335.1.html | 2013-12-16 13:13 | 3.0K | The PRINCE LEOPOLD. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1335.1.pdf | 2011-11-01 10:44 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1335.2.html | 2013-12-16 13:13 | 3.7K | The PRINCESS ALEXANDRA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1335.2.pdf | 2011-11-01 10:44 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1336.html | 2013-12-16 13:13 | 28K | PRINCESS OF ORANGE, Jewels Stolen from The. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1336.pdf | 2011-11-01 10:44 | 79K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1340.1.html | 2013-12-16 13:13 | 1.3K | The PRINCESS ROYAL. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1340.1.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1340.2.html | 2013-12-16 13:13 | 11K | In re PRINCETON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1340.2.pdf | 2011-11-01 10:44 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1342.html | 2013-12-16 13:13 | 15K | The PRINCETON., SCHUYLKILL NAV. CO. v. The PRINCETON., LAWTON v. The PRINCETON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1342.pdf | 2011-11-01 10:44 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1344.html | 2013-12-16 13:13 | 8.6K | The PRINCETON. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1344.pdf | 2011-11-01 10:44 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1345.html | 2013-12-16 13:13 | 10K | The PRINDIVILLE. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1345.pdf | 2011-11-01 10:44 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1347.1.html | 2013-12-16 13:13 | 1.2K | PRINDEVILLE v. The MONITOR. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1347.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1347.2.html | 2013-12-16 13:13 | 1.2K | PRIOR (TYSON v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1347.2.pdf | 2011-11-01 10:44 | 21K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1347.3.html | 2013-12-16 13:13 | 1.2K | PRIOR (UNITED STATES v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1347.3.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1347.4.html | 2013-12-16 13:13 | 1.2K | PRISCILLA, The (HINDRY v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1347.4.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1347.5.html | 2013-12-16 13:13 | 8.2K | PRITCHARD v. CHANDLER. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1347.5.pdf | 2011-11-01 10:44 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1348.html | 2013-12-16 13:13 | 5.3K | PRITCHARD v. GEORGETOWN. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1348.pdf | 2011-11-01 10:44 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1349.html | 2013-12-16 13:13 | 7.4K | PRITCHARD et al. v. The LADY HORATIA. |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1349.pdf | 2011-11-01 10:44 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1350.1.html | 2013-12-16 13:13 | 1.2K | PRITCHARD (MEYER v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1350.1.pdf | 2011-11-01 10:44 | 23K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.1350.2.html | 2013-12-16 13:13 | 1.3K | PRITCHARD (STEVENS v.). |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.1350.2.pdf | 2011-11-01 10:44 | 25K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.back.html | 2013-12-16 13:13 | 302K | Federal Cases, Volume 19 |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.back.pdf | 2011-10-31 13:16 | 434K | |
![[Text]](/html/icons/compressed.gif) | 0019.f.cas.front.html | 2013-12-16 13:13 | 2.9K | Federal Cases, Volume 19 |
![[ ]](/html/icons/compressed.gif) | 0019.f.cas.front.pdf | 2011-10-31 13:16 | 40K | |
|