![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/html/images/nav/box2_open.gif) | Parent Directory | | - | Made Available by a Contribution from Anurag Acharya. See YesWeScan.Org For Details |
![[Text]](/html/icons/compressed.gif) | 0009.f.0001.html | 2013-12-16 12:44 | 9.6K | TAYLOR v. THE PHILADELPHIA READING R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0001.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0004.html | 2013-12-16 12:44 | 7.9K | JOHNSON v. THE PHILADELPHIA, WILMINGTON BALTIMOBE R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0004.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0006.html | 2013-12-16 12:44 | 6.1K | Cook, Assignee, v. HILLIARD and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0006.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0008.html | 2013-12-16 12:44 | 19K | STEAM STONE-CUTTER Co, v. SEARS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0008.pdf | 2011-11-01 11:32 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0014.html | 2013-12-16 12:44 | 5.9K | In re APPOINTMENT OF SUPERVISORS OF ELECTION. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0014.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0016.html | 2013-12-16 12:44 | 8.1K | RECTORS CASE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0016.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0018.html | 2013-12-16 12:44 | 23K | KENNEDY v. HARTRANFT, Collector. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0018.pdf | 2011-11-01 11:32 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0026.html | 2013-12-16 12:44 | 4.5K | UNITED STATES v. MURPHY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0026.pdf | 2011-11-01 11:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0027.html | 2013-12-16 12:44 | 35K | In Re McKENNA, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0027.pdf | 2011-11-01 11:32 | 87K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0038.html | 2013-12-16 12:44 | 6.3K | McCLOSKEY v. DU BOIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0038.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0040.html | 2013-12-16 12:44 | 9.8K | STILL BRO. v. READING and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0040.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0043.html | 2013-12-16 12:44 | 4.8K | HAMMERSCHLAG v. GARRETT and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0043.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0044.html | 2013-12-16 12:44 | 18K | McKESSON and another v. CARNRICK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0044.pdf | 2011-11-01 11:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0050.html | 2013-12-16 12:44 | 35K | McCONNOCHIE and others v. KERR and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0050.pdf | 2011-11-01 11:32 | 99K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0062.html | 2013-12-16 12:44 | 8.3K | THE ROBERT GASKIN |
![[ ]](/html/icons/compressed.gif) | 0009.f.0062.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0065.html | 2013-12-16 12:44 | 22K | POPE and another v. FILLEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0065.pdf | 2011-11-01 11:32 | 74K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0072.html | 2013-12-16 12:44 | 7.2K | MORAN v. THE CITY OF ELIZABETH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0072.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0074.html | 2013-12-16 12:44 | 12K | UNITED STATES v. GILLESPIE and another, Exrs, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0074.pdf | 2011-11-01 11:32 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0078.html | 2013-12-16 12:44 | 7.7K | UNITED STATES v. BIXBY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0078.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0080.html | 2013-12-16 12:44 | 12K | UNITED STATES v. CAHILL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0080.pdf | 2011-11-01 11:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0084.html | 2013-12-16 12:44 | 23K | WISWELL, Assignee, v. JARVIS and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0084.pdf | 2011-11-01 11:32 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0091.html | 2013-12-16 12:44 | 24K | PLATT, Assignee, etc., v. MEAD and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0091.pdf | 2011-11-01 11:32 | 69K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0099.html | 2013-12-16 12:44 | 5.4K | MEYER and another v. MAXHEIMER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0099.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0101.html | 2013-12-16 12:44 | 15K | ZANE and another v. PECK BROTHERS Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0101.pdf | 2011-11-01 11:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0106.html | 2013-12-16 12:44 | 11K | ONDERDONK v. FANNING and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0106.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0109.html | 2013-12-16 12:44 | 31K | THE PANGUSSETT. : THE YANKEE DOODLE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0109.pdf | 2011-11-01 11:32 | 93K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0120.html | 2013-12-16 12:44 | 21K | THE PACIFIC. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0120.pdf | 2011-11-01 11:32 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0126.html | 2013-12-16 12:44 | 10K | THE BELGENLAND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0126.pdf | 2011-11-01 11:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0129.html | 2013-12-16 12:44 | 44K | ALABAMA GOLD LIFE INS. CO. v. GIRARDY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0129.pdf | 2011-11-01 11:32 | 106K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0142.html | 2013-12-16 12:44 | 2.8K | ROBINSON, MCLEOD CO. v. MEMPHIS CHARLESTON R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0142.pdf | 2011-11-01 11:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0143.html | 2013-12-16 12:44 | 6.8K | CHALMERS SPENCE PATENT NON-CONDUCTOR Co. v. PIERCE and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0143.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0145.html | 2013-12-16 12:44 | 7.4K | UNITED STATES v. VOORHEES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0145.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0146.html | 2013-12-16 12:44 | 7.0K | FISCHER v. DAUDISTAL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0146.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0149.html | 2013-12-16 12:44 | 9.9K | In re YOUNG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0149.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0152.html | 2013-12-16 12:44 | 9.0K | ALEXANDER and others, Assignees, etc., v. GALT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0152.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0154.html | 2013-12-16 12:44 | 3.6K | CONSOLIDATED MIDDLINGS PURIFIER Co. v. GUILDER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0154.pdf | 2011-11-01 11:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0155.html | 2013-12-16 12:44 | 11K | ILLINGWORTH v. SPAULDING, JENNINGS Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0155.pdf | 2011-11-01 11:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0159.html | 2013-12-16 12:44 | 17K | THE HARRISBURGH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0159.pdf | 2011-11-01 11:32 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0164.html | 2013-12-16 12:44 | 16K | GOULD v. STAPLES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0164.pdf | 2011-11-01 11:32 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0169.html | 2013-12-16 12:44 | 7.9K | THE CLYMENE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0169.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0172.html | 2013-12-16 12:44 | 15K | THE ALCONA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0172.pdf | 2011-11-01 11:32 | 56K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0177.html | 2013-12-16 12:44 | 22K | FLANAGIN v. THOMPSON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0177.pdf | 2011-11-01 11:32 | 66K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0183.html | 2013-12-16 12:44 | 11K | BROWN v. PHILADELPHIA, WILMINGTON BALTIMORE R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0183.pdf | 2011-11-01 11:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0186.html | 2013-12-16 12:44 | 17K | BLACK, Trustee, v. SCOTT and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0186.pdf | 2011-11-01 11:32 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0191.html | 2013-12-16 12:44 | 15K | STEVENS v. RICHARDSON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0191.pdf | 2011-11-01 11:32 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0196.html | 2013-12-16 12:44 | 10K | In re HENDERSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0196.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0199.html | 2013-12-16 12:44 | 9.4K | NEW YORK BUNG BUSHING CO. v. HOFFMAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0199.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0202.html | 2013-12-16 12:44 | 8.9K | BLATHERWICK v. CAREY and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0202.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0205.html | 2013-12-16 12:44 | 9.8K | SHANNON v. J. M. W. JONES STATIONERY PRINTING CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0205.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0208.html | 2013-12-16 12:44 | 4.0K | LAWRENCE and others v. MORRISANIA STEAM-BOAT CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0208.pdf | 2011-11-01 11:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0209.html | 2013-12-16 12:44 | 7.9K | TWO HUNDRED AND SEVENTY-FIVE TONS OF MINERAL PHOSPHATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0209.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0211.html | 2013-12-16 12:44 | 4.7K | THE CHOTEAU. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0211.pdf | 2011-11-01 11:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0213.html | 2013-12-16 12:44 | 27K | THE NAHOR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0213.pdf | 2011-11-01 11:32 | 85K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0222.html | 2013-12-16 12:44 | 9.5K | THE MARY C. CONERY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0222.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0225.html | 2013-12-16 12:44 | 5.0K | THANNHAUSER v. THE CORTES Co. (Three Cases.) |
![[ ]](/html/icons/compressed.gif) | 0009.f.0225.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0226.html | 2013-12-16 12:44 | 9.7K | THE CORTES Co. v. THANNHAUSER and another. : CHITTENDEN and others v. THE SAME. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0226.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0229.html | 2013-12-16 12:44 | 55K | HOLMES, Admr, etc., v. OREGON CALIFORNIA R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0229.pdf | 2011-11-01 11:32 | 124K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0247.html | 2013-12-16 12:44 | 9.0K | FORSYTH and another v. VAN WINKLE and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0247.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0249.html | 2013-12-16 12:44 | 21K | BROCKWAY, Admr, v. MUTUAL BENEFIT LIFE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0249.pdf | 2011-11-01 11:32 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0256.html | 2013-12-16 12:44 | 5.5K | STRETTELL v. BALLOU and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0256.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0258.html | 2013-12-16 12:44 | 56K | BROWN, Assignee, etc., v. THE JEFFERSON COUNTY NAT. BANK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0258.pdf | 2011-11-01 11:32 | 135K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0277.html | 2013-12-16 12:44 | 23K | HUNKER, Assignee, etc., v. BING, Jr. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0277.pdf | 2011-11-01 11:32 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0284.html | 2013-12-16 12:44 | 28K | KELLS v. McKENZIE and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0284.pdf | 2011-11-01 11:32 | 78K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0293.html | 2013-12-16 12:44 | 18K | DETROIT LUBRICATOR MANUFG Co. v. RENCHARD and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0293.pdf | 2011-11-01 11:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0299.html | 2013-12-16 12:44 | 14K | TUCKER v. SARGENT CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0299.pdf | 2011-11-01 11:32 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0304.html | 2013-12-16 12:44 | 5.8K | ALLIS and others v. STOWELL, Survivor, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0304.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0306.html | 2013-12-16 12:44 | 33K | DEDERICK v. CASSELL and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0306.pdf | 2011-11-01 11:32 | 83K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0316.html | 2013-12-16 12:44 | 4.8K | ATLANTIC GIANT POWDER Co. v. DITTMAR POWDER MANUFG Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0316.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0318.html | 2013-12-16 12:44 | 8.7K | ARBO v. BROWN and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0318.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0320.html | 2013-12-16 12:44 | 4.9K | TURNBULL, MARTIN Co. v. EIGHTY-SEVEN BLOCKS OF MARBLE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0320.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0322.html | 2013-12-16 12:44 | 33K | THE SARATOGA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0322.pdf | 2011-11-01 11:32 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0333.html | 2013-12-16 12:44 | 2.8K | THE PRINCE LEOPOLD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0333.pdf | 2011-11-01 11:32 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0334.html | 2013-12-16 12:44 | 4.7K | THE GOLDEN RULE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0334.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0335.html | 2013-12-16 12:44 | 6.1K | THE SYLVAN GLEN, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0335.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0337.html | 2013-12-16 12:44 | 39K | ONEIL v. ST. LOUIS, IRON MOUNTAIN SOUTHERN RY. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0337.pdf | 2011-11-01 11:32 | 95K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0347.html | 2013-12-16 12:44 | 3.5K | ADAMS and another v. HOWARD and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0347.pdf | 2011-11-01 11:32 | 31K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0348.html | 2013-12-16 12:44 | 9.7K | YOUNG v. GRAND TRUNK RY. OF CANADA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0348.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0351.html | 2013-12-16 12:44 | 8.0K | BUELL and others v. CINCINNATI, EFFINGHAM QUINCY CONSTRUCTION Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0351.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0353.html | 2013-12-16 12:44 | 30K | HANCOCK v. HOLBROOK and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0353.pdf | 2011-11-01 11:32 | 80K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0363.html | 2013-12-16 12:44 | 6.1K | TRADERS BANK OF CHICAGO v. TALLMADGE and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0363.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0365.html | 2013-12-16 12:44 | 7.1K | PLIMPTON v. WINSLOW. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0365.pdf | 2011-11-01 11:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0367.html | 2013-12-16 12:44 | 5.3K | MARVIN v. ELLIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0367.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0368.html | 2013-12-16 12:44 | 4.3K | SIOUX CITY ST. PAUL R. CO. v. RICE. : ST. PAUL SIOUX CITY R. Co. v. THE SAME. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0368.pdf | 2011-11-01 11:32 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0369.html | 2013-12-16 12:44 | 6.6K | UNITED STATES v. FRENCH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0369.pdf | 2011-11-01 11:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0371.html | 2013-12-16 12:44 | 5.3K | WHITE v. CRAWFORD and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0371.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0373.html | 2013-12-16 12:44 | 9.1K | In re HELLER and another, Bankrupts. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0373.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0376.html | 2013-12-16 12:44 | 26K | In re FREY and others, Bankrupts. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0376.pdf | 2011-11-01 11:32 | 73K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0385.html | 2013-12-16 12:44 | 8.5K | In re BIGNALL, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0385.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0387.html | 2013-12-16 12:44 | 9.4K | BATE REFRIGERATING Co. v. GILLETT and others, impleaded, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0387.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0390.html | 2013-12-16 12:44 | 33K | SELDEN and others v. STOCKWELL SELF-LIGHTING GAS-BURNER Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0390.pdf | 2011-11-01 11:32 | 84K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0400.html | 2013-12-16 12:44 | 6.7K | THE PLYMOUTH ROCK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0400.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0402.html | 2013-12-16 12:44 | 20K | BERNARD and another v. HEIMANN and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0402.pdf | 2011-11-01 11:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0409.html | 2013-12-16 12:44 | 11K | DOWNTON v. THE YAEGER MILLING CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0409.pdf | 2011-11-01 11:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0413.html | 2013-12-16 12:44 | 30K | PROVOST v. PIDGEON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0413.pdf | 2011-11-01 11:32 | 90K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0423.html | 2013-12-16 12:44 | 28K | YE SENG CO. v. CORBITT MACLEAY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0423.pdf | 2011-11-01 11:32 | 86K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0432.html | 2013-12-16 12:44 | 2.7K | ESPEY, Jr., v. BLANKS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0432.pdf | 2011-11-01 11:32 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0433.html | 2013-12-16 12:44 | 18K | MEYER HAY v. NORTON CALHOUN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0433.pdf | 2011-11-01 11:32 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0438.html | 2013-12-16 12:44 | 5.4K | BROOKS v. BAILEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0438.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0440.html | 2013-12-16 12:44 | 6.4K | In re SIMS, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0440.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0442.html | 2013-12-16 12:44 | 5.5K | UNITED STATES v. HAMILTON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0442.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0443.html | 2013-12-16 12:44 | 5.8K | UNITED STATES v. SIMS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0443.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0445.html | 2013-12-16 12:44 | 7.9K | SHARP v. REISSNER and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0445.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0448.html | 2013-12-16 12:44 | 8.0K | PUTNAM v. LOMAX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0448.pdf | 2011-11-01 11:32 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0450.html | 2013-12-16 12:44 | 29K | EDGARTON and others v. FURST BRADLEY MANUFG Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0450.pdf | 2011-11-01 11:32 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0460.html | 2013-12-16 12:44 | 8.5K | MAXHEIMER v. MEYER and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0460.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0462.html | 2013-12-16 12:44 | 7.1K | AVERILL CHEMICAL PAINT Co. v. NATIONAL MIXED PAINT Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0462.pdf | 2011-11-01 11:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0465.html | 2013-12-16 12:44 | 8.9K | AMERICAN BALLAST LOG Co. OF NEW YORK v. BARNES. GATTO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0465.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0468.html | 2013-12-16 12:44 | 14K | THE FERRERI. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0468.pdf | 2011-11-01 11:32 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0472.html | 2013-12-16 12:44 | 6.2K | MITCHELL v. LANGDON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0472.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0474.html | 2013-12-16 12:44 | 5.8K | THE WALTER M. FLEMING. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0474.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0476.html | 2013-12-16 12:44 | 7.6K | THE OLD NATCHEZ. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0476.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0478.html | 2013-12-16 12:44 | 7.1K | THE OLD NATCHEZ. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0478.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0481.html | 2013-12-16 12:44 | 7.6K | UNITED STATES v. LEVERICH and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0481.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0483.html | 2013-12-16 12:44 | 25K | SMITH and others v. SCHWED and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0483.pdf | 2011-11-01 11:32 | 72K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0491.html | 2013-12-16 12:44 | 5.3K | In re BRIGHT, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0491.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0493.html | 2013-12-16 12:44 | 7.8K | In re JACKSON, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0493.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0495.html | 2013-12-16 12:44 | 15K | In re SHAW and another, Bankrupts. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0495.pdf | 2011-11-01 11:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0500.html | 2013-12-16 12:44 | 15K | SPRING and others v. DOMESTIC SEWING-MACHINE Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0500.pdf | 2011-11-01 11:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0505.html | 2013-12-16 12:44 | 13K | CAMPBELL v. THE MAYOR, etc., OF NEW YORK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0505.pdf | 2011-11-01 11:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0509.html | 2013-12-16 12:44 | 8.9K | P. LORILLARD Co. v. DOHAN CARROLL Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0509.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0512.html | 2013-12-16 12:44 | 9.2K | THE GUIDING STAR. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0512.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0515.html | 2013-12-16 12:44 | 4.7K | SAYLES, Exr, v. LOUISVILLE CITY R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0515.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0516.html | 2013-12-16 12:44 | 3.5K | *SAYLES v. LAKE SHORE MICHIGAN SOUTHERN RY. Co. : SAME v. CHICAGO NORTHWESTERN RY. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0516.pdf | 2011-11-01 11:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0517.1.html | 2013-12-16 12:44 | 2.8K | SAYLES v. DUBUQUE SIOUX CITY R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0517.1.pdf | 2011-11-01 11:32 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0517.2.html | 2013-12-16 12:44 | 12K | IRWIN and another v. METROPOLITAN TELEPHONE TELEGRAPH Co. and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0517.2.pdf | 2011-11-01 11:32 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0521.html | 2013-12-16 12:44 | 15K | THORSON and another v. PETERSON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0521.pdf | 2011-11-01 11:32 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0526.html | 2013-12-16 12:44 | 9.2K | McDERMOTT and others v. COPELAND and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0526.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0529.html | 2013-12-16 12:44 | 12K | THE MECHANIC. : THE FREE STATE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0529.pdf | 2011-11-01 11:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0532.html | 2013-12-16 12:44 | 12K | UNION INS Co. v. GLOVER and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0532.pdf | 2011-11-01 11:32 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0536.html | 2013-12-16 12:44 | 12K | COONS BRAINE v. TOME and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0536.pdf | 2011-11-01 11:32 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0540.html | 2013-12-16 12:44 | 8.5K | HERRING v. GAS CONSUMERS ASSOCIATION. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0540.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0542.html | 2013-12-16 12:44 | 9.4K | BRUCE v. GIBSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0542.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0545.html | 2013-12-16 12:44 | 4.7K | In re PITTS, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0545.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0547.html | 2013-12-16 12:44 | 28K | In re ELMENDORF. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0547.pdf | 2011-11-01 11:32 | 77K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0556.html | 2013-12-16 12:44 | 6.7K | WILSON PACKING Co. and another v. CHICAGO PACKING PROVISION Co. : SAME v. ST. LOUIS BEEF CANNING Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0556.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0558.html | 2013-12-16 12:44 | 11K | NAT. FEATHER DUSTER Co. v. HIBBARD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0558.pdf | 2011-11-01 11:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0562.html | 2013-12-16 12:44 | 24K | MURRAY v. WHITE and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0562.pdf | 2011-11-01 11:32 | 71K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0569.html | 2013-12-16 12:44 | 21K | THE VESPER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0569.pdf | 2011-11-01 11:32 | 65K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0576.html | 2013-12-16 12:44 | 3.9K | THE BELGENLAND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0576.pdf | 2011-11-01 11:32 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0577.html | 2013-12-16 12:44 | 5.2K | COIT v. NORTH CAROLINA GOLD AMALGAMATING Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0577.pdf | 2011-11-01 11:32 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0578.html | 2013-12-16 12:44 | 9.4K | NEW YORKBALTIMORE COFFEE POLISHING Co. v. NEW YORK COFFEE : POLISHING Co., (Limited.) |
![[ ]](/html/icons/compressed.gif) | 0009.f.0578.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0581.html | 2013-12-16 12:44 | 12K | SIMMONS v. SPENCER and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0581.pdf | 2011-11-01 11:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0585.html | 2013-12-16 12:44 | 5.6K | HALL v. MEMPHIS CHARLESTON R. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0585.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0586.html | 2013-12-16 12:44 | 8.7K | UNITED STATES v. LEVERICH and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0586.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0589.html | 2013-12-16 12:44 | 10K | SEAY v. WILSON, Assignee. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0589.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0592.html | 2013-12-16 12:44 | 8.4K | In re SMITH, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0592.pdf | 2011-11-01 11:32 | 42K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0595.html | 2013-12-16 12:44 | 19K | SIX HUNDRED TONS OF IRON ORE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0595.pdf | 2011-11-01 11:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0601.html | 2013-12-16 12:44 | 5.9K | SAWYER v. KELLOGG. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0601.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0603.html | 2013-12-16 12:44 | 13K | MILLER WORLEY v. FOREE Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0603.pdf | 2011-11-01 11:32 | 50K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0607.html | 2013-12-16 12:44 | 12K | CROSS v. LIVERMORE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0607.pdf | 2011-11-01 11:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0611.html | 2013-12-16 12:44 | 9.0K | ILLINGWORTH v. SPAULDING. : DOYLE v. THE SAME. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0611.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0614.html | 2013-12-16 12:44 | 14K | THE JAMES JACKSON. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0614.pdf | 2011-11-01 11:32 | 52K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0618.html | 2013-12-16 12:44 | 5.9K | PENNSYLVANIA RAILROAD CO. v. GILHOOLEY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0618.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0620.html | 2013-12-16 12:44 | 7.7K | THE GENERAL TOMPKINS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0620.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0622.html | 2013-12-16 12:44 | 7.5K | THE LAURETTA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0622.pdf | 2011-11-01 11:32 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0625.html | 2013-12-16 12:44 | 32K | PRATT v. ALBRIGHT, Defendant, and another, Garnishee. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0625.pdf | 2011-11-01 11:32 | 82K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0634.html | 2013-12-16 12:44 | 18K | KEEP v. INDIANAPOLIS ST. LOUIS R. Co. : KEEP v. UNION RAILWAY TRANSIT Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0634.pdf | 2011-11-01 11:32 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0640.html | 2013-12-16 12:44 | 11K | CASS v. MANCHESTER IRON STEEL Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0640.pdf | 2011-11-01 11:32 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0643.html | 2013-12-16 12:44 | 6.1K | In re SWENK, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0643.pdf | 2011-11-01 11:32 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0645.html | 2013-12-16 12:44 | 6.4K | KIRK v. LEWIS and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0645.pdf | 2011-11-01 11:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0647.html | 2013-12-16 12:44 | 37K | DAVIS and others v. BROWN and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0647.pdf | 2011-11-01 11:32 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0659.html | 2013-12-16 12:44 | 22K | CRANDAL v. WALTERS and another. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0659.pdf | 2011-11-01 11:32 | 67K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0666.html | 2013-12-16 12:44 | 18K | THE BUCKEYE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0666.pdf | 2011-11-01 11:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0672.html | 2013-12-16 12:44 | 2.3K | THE WILLIAM COX. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0672.pdf | 2011-11-01 11:32 | 30K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0673.html | 2013-12-16 12:44 | 5.8K | WARREN and others v. MOODY and another, Assignees. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0673.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0674.html | 2013-12-16 12:44 | 11K | UNITED STATES v. HOWELL and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0674.pdf | 2011-11-01 11:32 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0678.html | 2013-12-16 12:44 | 2.5K | BERRIAN v. CHETWOOD. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0678.pdf | 2011-11-01 11:32 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0679.html | 2013-12-16 12:44 | 15K | LEATHERS v. AIKEN, Admx. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0679.pdf | 2011-11-01 11:32 | 53K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0683.html | 2013-12-16 12:44 | 3.8K | WILKINSON, Assignee, etc., v. TILDEN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0683.pdf | 2011-11-01 11:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0684.html | 2013-12-16 12:44 | 12K | UNITED STATES v. MILLS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0684.pdf | 2011-11-01 11:32 | 57K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0688.html | 2013-12-16 12:44 | 3.8K | LESZYNSKY v. MERRITT. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0688.pdf | 2011-11-01 11:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0689.html | 2013-12-16 12:44 | 12K | UNITED STATES v. BUCHANAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0689.pdf | 2011-11-01 11:32 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0693.html | 2013-12-16 12:44 | 8.4K | RALPH v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0693.pdf | 2011-11-01 11:32 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0696.html | 2013-12-16 12:44 | 6.9K | ROYER v. RUSSELL Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0696.pdf | 2011-11-01 11:32 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0698.html | 2013-12-16 12:44 | 3.5K | MACAULAY v. WHITE SEWING MACHINE Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0698.pdf | 2011-11-01 11:32 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0699.html | 2013-12-16 12:44 | 20K | BOYKIN, CARMER Co. v. BAKER Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0699.pdf | 2011-11-01 11:32 | 62K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0706.html | 2013-12-16 12:44 | 9.5K | WESTERN ELECTRIC MANUFG Co. v. ANSONIA BRASS COPPER CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0706.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0709.html | 2013-12-16 12:44 | 19K | THE FAVORITE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0709.pdf | 2011-11-01 11:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0715.html | 2013-12-16 12:44 | 6.0K | THE LEVI DAVIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0715.pdf | 2011-11-01 11:32 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0717.html | 2013-12-16 12:44 | 9.4K | THE CETEWAYO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0717.pdf | 2011-11-01 11:32 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0721.html | 2013-12-16 12:44 | 19K | ROGERS v. R. E. LEE MINING Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0721.pdf | 2011-11-01 11:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0726.html | 2013-12-16 12:44 | 37K | MANNING v. SAN JACINTO TIN Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0726.pdf | 2011-11-01 11:32 | 94K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0738.html | 2013-12-16 12:44 | 15K | HANCOCK v. TOLEDO, PEORIA WARSAW R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0738.pdf | 2011-11-01 11:32 | 54K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0743.html | 2013-12-16 12:44 | 14K | BREWIS v. CITY OF DULUTH AND VILLAGE OF DULUTH. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0743.pdf | 2011-11-01 11:32 | 60K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0747.html | 2013-12-16 12:44 | 8.8K | CRESCENT CITY LIVE-STOCK LANDING SLAUGHTER-HOUSE CO. v. BUTCHERS UNION LIVE-STOCK LANDING SLAUGHTER-HOUSE Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0747.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0750.html | 2013-12-16 12:44 | 8.8K | DEMOND v. CRARY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0750.pdf | 2011-11-01 11:32 | 43K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0753.html | 2013-12-16 12:44 | 5.6K | MARCH, PRICE Co. v. CLARK. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0753.pdf | 2011-11-01 11:32 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0754.html | 2013-12-16 12:44 | 9.4K | In re CARY, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0754.pdf | 2011-11-01 11:32 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0757.html | 2013-12-16 12:44 | 13K | HOLMES and another v. PLAINVILLE MANUFG Co. : SAME v. DUNHAM HOSIERY Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0757.pdf | 2011-11-01 11:32 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0762.html | 2013-12-16 12:44 | 14K | GOTTFRIED v. CRESCENT BREWING Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0762.pdf | 2011-11-01 11:32 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0766.html | 2013-12-16 12:44 | 20K | DOWNTON v. ALLIS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0766.pdf | 2011-11-01 11:32 | 63K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0773.html | 2013-12-16 12:44 | 7.2K | THE JOSEPHINE SPANGLER. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0773.pdf | 2011-11-01 11:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0775.html | 2013-12-16 12:44 | 6.2K | THE DELAMBRE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0775.pdf | 2011-11-01 11:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0777.html | 2013-12-16 12:44 | 5.4K | THE JOHN CUTTRELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0777.pdf | 2011-11-01 11:33 | 35K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0779.html | 2013-12-16 12:44 | 18K | NEW HAVEN STEAM SAW-MILL CO. v. SECURITY INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0779.pdf | 2011-11-01 11:33 | 59K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0785.html | 2013-12-16 12:44 | 23K | WEBB and others v. VERMONT CENTRAL R. Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0785.pdf | 2011-11-01 11:33 | 68K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0793.html | 2013-12-16 12:44 | 7.0K | DWIGHT and others v. CENTRAL VERMONT R. Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0793.pdf | 2011-11-01 11:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0795.html | 2013-12-16 12:44 | 6.5K | DWIGHT and others v. SMITH and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0795.pdf | 2011-11-01 11:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0797.html | 2013-12-16 12:44 | 11K | GRISWOLD and others v. CENTRAL VERMONT R. Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0797.pdf | 2011-11-01 11:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0801.html | 2013-12-16 12:44 | 10K | FORSYTH and another v. PIERSON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0801.pdf | 2011-11-01 11:33 | 45K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0804.html | 2013-12-16 12:44 | 16K | UNITED STATES v. RICHARDSON and others, EXrs. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0804.pdf | 2011-11-01 11:33 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0809.html | 2013-12-16 12:44 | 7.3K | SECOR and others v. SINGLETON and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0809.pdf | 2011-11-01 11:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0811.html | 2013-12-16 12:44 | 7.1K | PRESIDENT AND DIRECTORS OF THE INSURANCE COMPANY OF NORTH AMERICA v. ST. LOUIS, IRON MOUNTAIN SOUTHERN RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0811.pdf | 2011-11-01 11:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0813.html | 2013-12-16 12:44 | 12K | BARNES and others v. HARTFORD FIRE INS. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0813.pdf | 2011-11-01 11:33 | 44K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0816.html | 2013-12-16 12:44 | 17K | In re GRAVES, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0816.pdf | 2011-11-01 11:33 | 58K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0821.html | 2013-12-16 12:44 | 37K | PATTEE and others v. MOLINE PLOW Co. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0821.pdf | 2011-11-01 11:33 | 91K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0834.html | 2013-12-16 12:44 | 28K | THE ANCHORIA. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0834.pdf | 2011-11-01 11:33 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0840.html | 2013-12-16 12:44 | 7.6K | THE TUBAL CAIN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0840.pdf | 2011-11-01 11:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0842.html | 2013-12-16 12:44 | 19K | THE ISAAC BELL. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0842.pdf | 2011-11-01 11:33 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0849.html | 2013-12-16 12:44 | 17K | In re CODDING RUSSELL, Bankrupts. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0849.pdf | 2011-11-01 11:33 | 55K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0853.html | 2013-12-16 12:44 | 3.5K | HERDSMAN and others v. LEWIS and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0853.pdf | 2011-11-01 11:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0854.html | 2013-12-16 12:44 | 2.3K | WOOSTER v. CLARK and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0854.pdf | 2011-11-01 11:33 | 29K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0855.html | 2013-12-16 12:44 | 4.0K | MILLIKEN v. ROSS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0855.pdf | 2011-11-01 11:33 | 34K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0856.html | 2013-12-16 12:44 | 14K | HATCH v. INDIANAPOLIS SPRINGFIELD R. CO. and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0856.pdf | 2011-11-01 11:33 | 51K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0860.html | 2013-12-16 12:44 | 3.6K | OGLESBY and another v. SILLOM and Husband. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0860.pdf | 2011-11-01 11:33 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0861.html | 2013-12-16 12:44 | 6.8K | MCGOWAN v. LA PLATA MINING SMELTING Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0861.pdf | 2011-11-01 11:33 | 38K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0863.html | 2013-12-16 12:44 | 6.8K | THE RICHMOND. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0863.pdf | 2011-11-01 11:33 | 39K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0865.html | 2013-12-16 12:44 | 6.0K | H. C. NEWMAN v. RICHARDSON and others. : LETCHFORD v. RICHARDSON CARY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0865.pdf | 2011-11-01 11:33 | 37K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0867.html | 2013-12-16 12:44 | 19K | TUCKER v. DUNCAN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0867.pdf | 2011-11-01 11:33 | 61K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0873.html | 2013-12-16 12:44 | 11K | MARSH v. UNION PACIFIC RY. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0873.pdf | 2011-11-01 11:33 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0877.html | 2013-12-16 12:44 | 7.3K | ROBINSON v. NEW YORK CENT. HUDSON RIVER R. Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0877.pdf | 2011-11-01 11:33 | 40K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0879.html | 2013-12-16 12:44 | 11K | HUDSON v. KANSAS PACIFIC RY. CO. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0879.pdf | 2011-11-01 11:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0882.html | 2013-12-16 12:44 | 4.4K | CHASE and others v. UNITED STATES. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0882.pdf | 2011-11-01 11:33 | 33K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0884.html | 2013-12-16 12:44 | 8.1K | ALBANY CITY NAT. BANK v. MAHER, Receiver, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0884.pdf | 2011-11-01 11:33 | 41K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0886.html | 2013-12-16 12:44 | 29K | UNITED STATES v. WYNN. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0886.pdf | 2011-11-01 11:33 | 75K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0896.html | 2013-12-16 12:44 | 5.2K | THE PHAROS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0896.pdf | 2011-11-01 11:33 | 36K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0897.html | 2013-12-16 12:44 | 12K | UNITED STATES v. BURGESS. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0897.pdf | 2011-11-01 11:33 | 47K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0901.html | 2013-12-16 12:44 | 10K | UNITED STATES v. MALONE. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0901.pdf | 2011-11-01 11:33 | 46K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0904.html | 2013-12-16 12:44 | 3.4K | In re SHIRLEY, Bankrupt. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0904.pdf | 2011-11-01 11:33 | 32K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0905.html | 2013-12-16 12:44 | 20K | SHEDD v. WASHBURN and others. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0905.pdf | 2011-11-01 11:33 | 64K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0912.html | 2013-12-16 12:44 | 12K | COES v. THE COLLINS Co. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0912.pdf | 2011-11-01 11:33 | 48K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0916.html | 2013-12-16 12:44 | 13K | THE AUSTRIA, etc. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0916.pdf | 2011-11-01 11:33 | 49K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.0920.html | 2013-12-16 12:44 | 23K | THE B. C. TERRY. |
![[ ]](/html/icons/compressed.gif) | 0009.f.0920.pdf | 2011-11-01 11:33 | 70K | |
![[Text]](/html/icons/compressed.gif) | 0009.f.front.html | 2013-12-16 12:44 | 80K | |
![[ ]](/html/icons/compressed.gif) | 0009.f.front.pdf | 2011-10-31 14:11 | 70K | |
|